(window["webpackJsonp"] = window["webpackJsonp"] || []).push([["vendor"],{ /***/ "./node_modules/@angular-devkit/build-angular/node_modules/webpack/buildin/module.js": /*!***********************************!*\ !*** (webpack)/buildin/module.js ***! \***********************************/ /*! no static exports found */ /***/ (function(module, exports) { module.exports = function(module) { if (!module.webpackPolyfill) { module.deprecate = function() {}; module.paths = []; // module.parent = undefined by default if (!module.children) module.children = []; Object.defineProperty(module, "loaded", { enumerable: true, get: function() { return module.l; } }); Object.defineProperty(module, "id", { enumerable: true, get: function() { return module.i; } }); module.webpackPolyfill = 1; } return module; }; /***/ }), /***/ "./node_modules/@angular-material-extensions/password-strength/__ivy_ngcc__/fesm2015/angular-material-extensions-password-strength.js": /*!********************************************************************************************************************************************!*\ !*** ./node_modules/@angular-material-extensions/password-strength/__ivy_ngcc__/fesm2015/angular-material-extensions-password-strength.js ***! \********************************************************************************************************************************************/ /*! exports provided: Colors, Criteria, MatPassToggleVisibilityComponent, MatPasswordStrengthComponent, MatPasswordStrengthInfoComponent, MatPasswordStrengthModule, MatPasswordStrengthValidator, RegExpValidator, flipIn, flipInX, flipInY, shake, ɵa */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; __webpack_require__.r(__webpack_exports__); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "Colors", function() { return Colors; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "Criteria", function() { return Criteria; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "MatPassToggleVisibilityComponent", function() { return MatPassToggleVisibilityComponent; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "MatPasswordStrengthComponent", function() { return MatPasswordStrengthComponent; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "MatPasswordStrengthInfoComponent", function() { return MatPasswordStrengthInfoComponent; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "MatPasswordStrengthModule", function() { return MatPasswordStrengthModule; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "MatPasswordStrengthValidator", function() { return MatPasswordStrengthValidator; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "RegExpValidator", function() { return RegExpValidator; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "flipIn", function() { return flipIn; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "flipInX", function() { return flipInX; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "flipInY", function() { return flipInY; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "shake", function() { return shake; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵa", function() { return shake; }); /* harmony import */ var _angular_core__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @angular/core */ "./node_modules/@angular/core/__ivy_ngcc__/fesm2015/core.js"); /* harmony import */ var _angular_forms__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! @angular/forms */ "./node_modules/@angular/forms/__ivy_ngcc__/fesm2015/forms.js"); /* harmony import */ var _angular_animations__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(/*! @angular/animations */ "./node_modules/@angular/animations/__ivy_ngcc__/fesm2015/animations.js"); /* harmony import */ var _angular_common__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(/*! @angular/common */ "./node_modules/@angular/common/__ivy_ngcc__/fesm2015/common.js"); /* harmony import */ var _angular_material_progress_bar__WEBPACK_IMPORTED_MODULE_4__ = __webpack_require__(/*! @angular/material/progress-bar */ "./node_modules/@angular/material/__ivy_ngcc__/fesm2015/progress-bar.js"); /* harmony import */ var _angular_material_core__WEBPACK_IMPORTED_MODULE_5__ = __webpack_require__(/*! @angular/material/core */ "./node_modules/@angular/material/__ivy_ngcc__/fesm2015/core.js"); /* harmony import */ var _angular_material_card__WEBPACK_IMPORTED_MODULE_6__ = __webpack_require__(/*! @angular/material/card */ "./node_modules/@angular/material/__ivy_ngcc__/fesm2015/card.js"); /* harmony import */ var _angular_material_icon__WEBPACK_IMPORTED_MODULE_7__ = __webpack_require__(/*! @angular/material/icon */ "./node_modules/@angular/material/__ivy_ngcc__/fesm2015/icon.js"); function MatPasswordStrengthInfoComponent_div_2_div_1_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelement"](0, "div"); } if (rf & 2) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("@flipY", undefined); } } function MatPasswordStrengthInfoComponent_div_2_ng_template_2_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](0, "mat-icon", 5); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtext"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); } if (rf & 2) { const ctx_r9 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵnextContext"](2); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("@positiveState", undefined); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtextInterpolate"](ctx_r9.matIconDone); } } function MatPasswordStrengthInfoComponent_div_2_ng_template_4_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](0, "mat-icon", 6); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtext"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); } if (rf & 2) { const ctx_r11 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵnextContext"](2); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("@negativeState", undefined); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtextInterpolate"](ctx_r11.matIconError); } } function MatPasswordStrengthInfoComponent_div_2_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](0, "div", 1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](1, MatPasswordStrengthInfoComponent_div_2_div_1_Template, 1, 1, "div", 2); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](2, MatPasswordStrengthInfoComponent_div_2_ng_template_2_Template, 2, 2, "ng-template", null, 3, _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplateRefExtractor"]); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](4, MatPasswordStrengthInfoComponent_div_2_ng_template_4_Template, 2, 2, "ng-template", null, 4, _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplateRefExtractor"]); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](6, "span"); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtext"](7); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); } if (rf & 2) { const _r8 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵreference"](3); const _r10 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵreference"](5); const ctx_r0 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵnextContext"](); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("@items", undefined); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("ngIf", ctx_r0.passwordComponent.containAtLeastOneLowerCaseLetter)("ngIfThen", _r8)("ngIfElse", _r10); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](6); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtextInterpolate"](ctx_r0.lowerCaseCriteriaMsg); } } function MatPasswordStrengthInfoComponent_div_3_div_1_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelement"](0, "div"); } } function MatPasswordStrengthInfoComponent_div_3_ng_template_2_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](0, "mat-icon", 5); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtext"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); } if (rf & 2) { const ctx_r14 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵnextContext"](2); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("@positiveState", undefined); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtextInterpolate"](ctx_r14.matIconDone); } } function MatPasswordStrengthInfoComponent_div_3_ng_template_4_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](0, "mat-icon", 6); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtext"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); } if (rf & 2) { const ctx_r16 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵnextContext"](2); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("@negativeState", undefined); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtextInterpolate"](ctx_r16.matIconError); } } function MatPasswordStrengthInfoComponent_div_3_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](0, "div", 1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](1, MatPasswordStrengthInfoComponent_div_3_div_1_Template, 1, 0, "div", 2); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](2, MatPasswordStrengthInfoComponent_div_3_ng_template_2_Template, 2, 2, "ng-template", null, 3, _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplateRefExtractor"]); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](4, MatPasswordStrengthInfoComponent_div_3_ng_template_4_Template, 2, 2, "ng-template", null, 4, _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplateRefExtractor"]); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](6, "span"); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtext"](7); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); } if (rf & 2) { const _r13 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵreference"](3); const _r15 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵreference"](5); const ctx_r1 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵnextContext"](); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("@items", undefined); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("ngIf", ctx_r1.passwordComponent.containAtLeastOneUpperCaseLetter)("ngIfThen", _r13)("ngIfElse", _r15); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](6); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtextInterpolate"](ctx_r1.upperCaseCriteriaMsg); } } function MatPasswordStrengthInfoComponent_div_4_div_1_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelement"](0, "div"); } } function MatPasswordStrengthInfoComponent_div_4_ng_template_2_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](0, "mat-icon", 5); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtext"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); } if (rf & 2) { const ctx_r19 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵnextContext"](2); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("@positiveState", undefined); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtextInterpolate"](ctx_r19.matIconDone); } } function MatPasswordStrengthInfoComponent_div_4_ng_template_4_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](0, "mat-icon", 6); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtext"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); } if (rf & 2) { const ctx_r21 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵnextContext"](2); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("@negativeState", undefined); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtextInterpolate"](ctx_r21.matIconError); } } function MatPasswordStrengthInfoComponent_div_4_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](0, "div", 1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](1, MatPasswordStrengthInfoComponent_div_4_div_1_Template, 1, 0, "div", 2); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](2, MatPasswordStrengthInfoComponent_div_4_ng_template_2_Template, 2, 2, "ng-template", null, 3, _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplateRefExtractor"]); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](4, MatPasswordStrengthInfoComponent_div_4_ng_template_4_Template, 2, 2, "ng-template", null, 4, _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplateRefExtractor"]); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](6, "span"); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtext"](7); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); } if (rf & 2) { const _r18 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵreference"](3); const _r20 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵreference"](5); const ctx_r2 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵnextContext"](); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("@items", undefined); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("ngIf", ctx_r2.passwordComponent.containAtLeastOneDigit)("ngIfThen", _r18)("ngIfElse", _r20); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](6); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtextInterpolate"](ctx_r2.digitsCriteriaMsg); } } function MatPasswordStrengthInfoComponent_div_5_div_1_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelement"](0, "div"); } } function MatPasswordStrengthInfoComponent_div_5_ng_template_2_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](0, "mat-icon", 5); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtext"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); } if (rf & 2) { const ctx_r24 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵnextContext"](2); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("@positiveState", undefined); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtextInterpolate"](ctx_r24.matIconDone); } } function MatPasswordStrengthInfoComponent_div_5_ng_template_4_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](0, "mat-icon", 6); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtext"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); } if (rf & 2) { const ctx_r26 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵnextContext"](2); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("@negativeState", undefined); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtextInterpolate"](ctx_r26.matIconError); } } function MatPasswordStrengthInfoComponent_div_5_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](0, "div", 1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](1, MatPasswordStrengthInfoComponent_div_5_div_1_Template, 1, 0, "div", 2); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](2, MatPasswordStrengthInfoComponent_div_5_ng_template_2_Template, 2, 2, "ng-template", null, 3, _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplateRefExtractor"]); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](4, MatPasswordStrengthInfoComponent_div_5_ng_template_4_Template, 2, 2, "ng-template", null, 4, _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplateRefExtractor"]); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](6, "span"); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtext"](7); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); } if (rf & 2) { const _r23 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵreference"](3); const _r25 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵreference"](5); const ctx_r3 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵnextContext"](); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("@items", undefined); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("ngIf", ctx_r3.passwordComponent.containAtLeastOneSpecialChar)("ngIfThen", _r23)("ngIfElse", _r25); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](6); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtextInterpolate"](ctx_r3.specialCharsCriteriaMsg); } } function MatPasswordStrengthInfoComponent_div_6_div_1_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelement"](0, "div"); } } function MatPasswordStrengthInfoComponent_div_6_ng_template_2_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](0, "mat-icon", 5); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtext"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); } if (rf & 2) { const ctx_r29 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵnextContext"](2); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("@positiveState", undefined); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtextInterpolate"](ctx_r29.matIconDone); } } function MatPasswordStrengthInfoComponent_div_6_ng_template_4_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](0, "mat-icon", 6); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtext"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); } if (rf & 2) { const ctx_r31 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵnextContext"](2); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("@negativeState", undefined); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtextInterpolate"](ctx_r31.matIconError); } } function MatPasswordStrengthInfoComponent_div_6_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](0, "div", 1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](1, MatPasswordStrengthInfoComponent_div_6_div_1_Template, 1, 0, "div", 2); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](2, MatPasswordStrengthInfoComponent_div_6_ng_template_2_Template, 2, 2, "ng-template", null, 3, _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplateRefExtractor"]); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](4, MatPasswordStrengthInfoComponent_div_6_ng_template_4_Template, 2, 2, "ng-template", null, 4, _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplateRefExtractor"]); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](6, "span"); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtext"](7); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); } if (rf & 2) { const _r28 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵreference"](3); const _r30 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵreference"](5); const ctx_r4 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵnextContext"](); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("@items", undefined); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("ngIf", ctx_r4.passwordComponent.containAtLeastMinChars)("ngIfThen", _r28)("ngIfElse", _r30); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](6); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtextInterpolate"](ctx_r4.minCharsCriteriaMsg); } } function MatPasswordStrengthInfoComponent_div_7_div_1_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelement"](0, "div"); } } function MatPasswordStrengthInfoComponent_div_7_ng_template_2_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](0, "mat-icon", 5); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtext"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); } if (rf & 2) { const ctx_r34 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵnextContext"](2); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("@positiveState", undefined); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtextInterpolate"](ctx_r34.matIconDone); } } function MatPasswordStrengthInfoComponent_div_7_ng_template_4_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](0, "mat-icon", 6); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtext"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); } if (rf & 2) { const ctx_r36 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵnextContext"](2); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("@negativeState", undefined); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtextInterpolate"](ctx_r36.matIconError); } } function MatPasswordStrengthInfoComponent_div_7_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](0, "div", 1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](1, MatPasswordStrengthInfoComponent_div_7_div_1_Template, 1, 0, "div", 2); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](2, MatPasswordStrengthInfoComponent_div_7_ng_template_2_Template, 2, 2, "ng-template", null, 3, _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplateRefExtractor"]); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](4, MatPasswordStrengthInfoComponent_div_7_ng_template_4_Template, 2, 2, "ng-template", null, 4, _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplateRefExtractor"]); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](6, "span"); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtext"](7); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); } if (rf & 2) { const _r33 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵreference"](3); const _r35 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵreference"](5); const ctx_r5 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵnextContext"](); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("@items", undefined); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("ngIf", ctx_r5.passwordComponent.containAtCustomChars)("ngIfThen", _r33)("ngIfElse", _r35); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](6); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtextInterpolate"](ctx_r5.customCharsCriteriaMsg); } } function MatPasswordStrengthInfoComponent_div_8_div_1_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelement"](0, "div"); } } function MatPasswordStrengthInfoComponent_div_8_ng_template_2_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](0, "mat-icon", 5); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtext"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); } if (rf & 2) { const ctx_r39 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵnextContext"](2); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("@positiveState", undefined); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtextInterpolate"](ctx_r39.matIconDone); } } function MatPasswordStrengthInfoComponent_div_8_ng_template_4_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](0, "mat-icon", 6); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtext"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); } if (rf & 2) { const ctx_r41 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵnextContext"](2); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("@negativeState", undefined); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtextInterpolate"](ctx_r41.matIconError); } } function MatPasswordStrengthInfoComponent_div_8_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](0, "div", 1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](1, MatPasswordStrengthInfoComponent_div_8_div_1_Template, 1, 0, "div", 2); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](2, MatPasswordStrengthInfoComponent_div_8_ng_template_2_Template, 2, 2, "ng-template", null, 3, _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplateRefExtractor"]); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](4, MatPasswordStrengthInfoComponent_div_8_ng_template_4_Template, 2, 2, "ng-template", null, 4, _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplateRefExtractor"]); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](6, "span"); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtext"](7); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); } if (rf & 2) { const _r38 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵreference"](3); const _r40 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵreference"](5); const ctx_r6 = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵnextContext"](); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("@items", undefined); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("ngIf", ctx_r6.passwordComponent.strength === 100)("ngIfThen", _r38)("ngIfElse", _r40); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](6); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtextInterpolate1"]("Password's strength = ", ctx_r6.passwordComponent.strength, " %100"); } } var Colors; (function (Colors) { Colors["primary"] = "primary"; Colors["accent"] = "accent"; Colors["warn"] = "warn"; })(Colors || (Colors = {})); var Criteria; (function (Criteria) { Criteria["at_least_eight_chars"] = "minChar"; Criteria["at_least_one_lower_case_char"] = "lowerCase"; Criteria["at_least_one_upper_case_char"] = "upperCase"; Criteria["at_least_one_digit_char"] = "digit"; Criteria["at_least_one_special_char"] = " specialChar"; Criteria["at_custom_chars"] = "customChars"; })(Criteria || (Criteria = {})); class MatPassToggleVisibilityComponent { constructor() { this._type = 'text'; } get type() { return this.isVisible ? 'text' : 'password'; } } MatPassToggleVisibilityComponent.ɵfac = function MatPassToggleVisibilityComponent_Factory(t) { return new (t || MatPassToggleVisibilityComponent)(); }; MatPassToggleVisibilityComponent.ɵcmp = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineComponent"]({ type: MatPassToggleVisibilityComponent, selectors: [["mat-pass-toggle-visibility"]], inputs: { isVisible: "isVisible", tabindex: "tabindex" }, decls: 3, vars: 2, consts: [["mat-icon-button", "", "matRipple", "", "matRippleCentered", "true", "matRipple", "", "type", "button", 1, "mat-icon-button", "cdk-focused", "cdk-mouse-focused", 3, "click"]], template: function MatPassToggleVisibilityComponent_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](0, "button", 0); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵlistener"]("click", function MatPassToggleVisibilityComponent_Template_button_click_0_listener() { return ctx.isVisible = !ctx.isVisible; }); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](1, "mat-icon"); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtext"](2); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); } if (rf & 2) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵattribute"]("tabindex", ctx.tabindex ? ctx.tabindex : null); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](2); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtextInterpolate"](ctx.isVisible ? "visibility" : "visibility_off"); } }, directives: [_angular_material_core__WEBPACK_IMPORTED_MODULE_5__["MatRipple"], _angular_material_icon__WEBPACK_IMPORTED_MODULE_7__["MatIcon"]], styles: [""], encapsulation: 2 }); MatPassToggleVisibilityComponent.propDecorators = { isVisible: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], tabindex: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](MatPassToggleVisibilityComponent, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Component"], args: [{ selector: 'mat-pass-toggle-visibility', template: "\n {{ isVisible ? \"visibility\" : \"visibility_off\" }}\n\n", encapsulation: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewEncapsulation"].None, styles: [""] }] }], function () { return []; }, { isVisible: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], tabindex: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }] }); })(); class MatPasswordStrengthValidator { isUndefinedOrEmpty(control) { if (!control || !control.value || control.value.length === 0) { return undefined; } } validate(criteria, regex) { const validator = (control) => { this.isUndefinedOrEmpty(control); if (!regex.test(control.value)) { const failed = {}; failed[criteria] = { actualValue: control.value, requiredPattern: regex }; return failed; } return undefined; }; return validator; } confirm(password) { const validator = (control) => { this.isUndefinedOrEmpty(control); if (control.value !== password) { return { notConfirmed: { password: password, passwordConfirmation: control.value } }; } return undefined; }; return validator; } } const RegExpValidator = { 'lowerCase': RegExp(/^(?=.*?[a-z])/), 'upperCase': RegExp(/^(?=.*?[A-Z])/), 'digit': RegExp(/^(?=.*?[0-9])/), 'specialChar': RegExp(/^(?=.*?[" !"#$%&'()*+,-./:;<=>?@[\]^_`{|}~"])/), }; class MatPasswordStrengthComponent { constructor() { this.enableLengthRule = true; this.enableLowerCaseLetterRule = true; this.enableUpperCaseLetterRule = true; this.enableDigitRule = true; this.enableSpecialCharRule = true; this.min = 8; this.max = 30; this.warnThreshold = 21; this.accentThreshold = 81; this.onStrengthChanged = new _angular_core__WEBPACK_IMPORTED_MODULE_0__["EventEmitter"](); this.criteriaMap = new Map(); // TO ACCESS VIA CONTENT CHILD this.passwordFormControl = new _angular_forms__WEBPACK_IMPORTED_MODULE_1__["FormControl"](); this.passwordConfirmationFormControl = new _angular_forms__WEBPACK_IMPORTED_MODULE_1__["FormControl"](); this.validatorsArray = []; this.matPasswordStrengthValidator = new MatPasswordStrengthValidator(); this._strength = 0; this.propagateChange = (_) => { }; } get strength() { return this._strength ? this._strength : 0; } get color() { if (this._strength < this.warnThreshold) { return Colors.warn; } else if (this._strength < this.accentThreshold) { return Colors.accent; } else { return Colors.primary; } } ngOnInit() { this.setRulesAndValidators(); } ngOnChanges(changes) { if ((changes.externalError && changes.externalError.firstChange) || changes.password.isFirstChange()) { return; } else if (changes.externalError && changes.externalError.currentValue) { this._color = Colors.warn; return; } else if (changes.password.previousValue === changes.password.currentValue && !changes.password.firstChange) { this.calculatePasswordStrength(); } else { this.password && this.password.length > 0 ? this.calculatePasswordStrength() : this.reset(); } } parseCustomValidatorsRegex(value = this.customValidator) { if (this.customValidator instanceof RegExp) { return this.customValidator; } else if (typeof this.customValidator === 'string') { return RegExp(this.customValidator); } } setRulesAndValidators() { this.validatorsArray = []; this.criteriaMap = new Map(); this.passwordConfirmationFormControl .setValidators(_angular_forms__WEBPACK_IMPORTED_MODULE_1__["Validators"].compose([ _angular_forms__WEBPACK_IMPORTED_MODULE_1__["Validators"].required, this.matPasswordStrengthValidator.confirm(this.password) ])); this.validatorsArray.push(_angular_forms__WEBPACK_IMPORTED_MODULE_1__["Validators"].required); if (this.enableLengthRule) { this.criteriaMap.set(Criteria.at_least_eight_chars, RegExp(`^.{${this.min},${this.max}}$`)); this.validatorsArray.push(_angular_forms__WEBPACK_IMPORTED_MODULE_1__["Validators"].minLength(this.min)); this.validatorsArray.push(_angular_forms__WEBPACK_IMPORTED_MODULE_1__["Validators"].maxLength(this.max)); } if (this.enableLowerCaseLetterRule) { this.criteriaMap.set(Criteria.at_least_one_lower_case_char, RegExpValidator.lowerCase); this.validatorsArray.push(_angular_forms__WEBPACK_IMPORTED_MODULE_1__["Validators"].pattern(RegExpValidator.lowerCase)); } if (this.enableUpperCaseLetterRule) { this.criteriaMap.set(Criteria.at_least_one_upper_case_char, RegExpValidator.upperCase); this.validatorsArray.push(_angular_forms__WEBPACK_IMPORTED_MODULE_1__["Validators"].pattern(RegExpValidator.upperCase)); } if (this.enableDigitRule) { this.criteriaMap.set(Criteria.at_least_one_digit_char, RegExpValidator.digit); this.validatorsArray.push(_angular_forms__WEBPACK_IMPORTED_MODULE_1__["Validators"].pattern(RegExpValidator.digit)); } if (this.enableSpecialCharRule) { this.criteriaMap.set(Criteria.at_least_one_special_char, RegExpValidator.specialChar); this.validatorsArray.push(_angular_forms__WEBPACK_IMPORTED_MODULE_1__["Validators"].pattern(RegExpValidator.specialChar)); } if (this.customValidator) { this.criteriaMap.set(Criteria.at_custom_chars, this.parseCustomValidatorsRegex()); this.validatorsArray.push(_angular_forms__WEBPACK_IMPORTED_MODULE_1__["Validators"].pattern(this.parseCustomValidatorsRegex())); } this.criteriaMap.forEach((value, key) => { this.validatorsArray.push(this.matPasswordStrengthValidator.validate(key, value)); }); this.passwordFormControl.setValidators(_angular_forms__WEBPACK_IMPORTED_MODULE_1__["Validators"].compose([...this.validatorsArray])); this.Validators = _angular_forms__WEBPACK_IMPORTED_MODULE_1__["Validators"].compose([...this.validatorsArray]); } calculatePasswordStrength() { const requirements = []; const unit = 100 / this.criteriaMap.size; // console.log('this.criteriaMap.size = ', this.criteriaMap.size); // console.log('unit = ', unit); requirements.push(this.enableLengthRule ? this._containAtLeastMinChars() : false, this.enableLowerCaseLetterRule ? this._containAtLeastOneLowerCaseLetter() : false, this.enableUpperCaseLetterRule ? this._containAtLeastOneUpperCaseLetter() : false, this.enableDigitRule ? this._containAtLeastOneDigit() : false, this.enableSpecialCharRule ? this._containAtLeastOneSpecialChar() : false, this.customValidator ? this._containCustomChars() : false); this._strength = requirements.filter(v => v).length * unit; this.propagateChange(this.strength); // console.log('length = ', this._strength / unit); this.onStrengthChanged.emit(this.strength); this.setRulesAndValidators(); } reset() { this._strength = 0; this.containAtLeastMinChars = this.containAtLeastOneLowerCaseLetter = this.containAtLeastOneUpperCaseLetter = this.containAtLeastOneDigit = this.containAtCustomChars = this.containAtLeastOneSpecialChar = false; } writeValue(obj) { if (obj) { this._strength = obj; } } registerOnChange(fn) { this.propagateChange = fn; } registerOnTouched(fn) { // throw new Error("Method not implemented."); } setDisabledState(isDisabled) { // throw new Error("Method not implemented."); } _containAtLeastMinChars() { this.containAtLeastMinChars = this.password.length >= this.min; return this.containAtLeastMinChars; } _containAtLeastOneLowerCaseLetter() { this.containAtLeastOneLowerCaseLetter = this.criteriaMap .get(Criteria.at_least_one_lower_case_char) .test(this.password); return this.containAtLeastOneLowerCaseLetter; } _containAtLeastOneUpperCaseLetter() { this.containAtLeastOneUpperCaseLetter = this.criteriaMap .get(Criteria.at_least_one_upper_case_char) .test(this.password); return this.containAtLeastOneUpperCaseLetter; } _containAtLeastOneDigit() { this.containAtLeastOneDigit = this.criteriaMap .get(Criteria.at_least_one_digit_char) .test(this.password); return this.containAtLeastOneDigit; } _containAtLeastOneSpecialChar() { this.containAtLeastOneSpecialChar = this.criteriaMap .get(Criteria.at_least_one_special_char) .test(this.password); return this.containAtLeastOneSpecialChar; } _containCustomChars() { this.containAtCustomChars = this.criteriaMap .get(Criteria.at_custom_chars) .test(this.password); return this.containAtCustomChars; } ngAfterContentChecked() { if (this.password) { this.calculatePasswordStrength(); } } } MatPasswordStrengthComponent.ɵfac = function MatPasswordStrengthComponent_Factory(t) { return new (t || MatPasswordStrengthComponent)(); }; MatPasswordStrengthComponent.ɵcmp = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineComponent"]({ type: MatPasswordStrengthComponent, selectors: [["mat-password-strength"]], inputs: { enableLengthRule: "enableLengthRule", enableLowerCaseLetterRule: "enableLowerCaseLetterRule", enableUpperCaseLetterRule: "enableUpperCaseLetterRule", enableDigitRule: "enableDigitRule", enableSpecialCharRule: "enableSpecialCharRule", min: "min", max: "max", warnThreshold: "warnThreshold", accentThreshold: "accentThreshold", password: "password", externalError: "externalError", customValidator: "customValidator" }, outputs: { onStrengthChanged: "onStrengthChanged" }, exportAs: ["matPasswordStrength"], features: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵProvidersFeature"]([ { provide: _angular_forms__WEBPACK_IMPORTED_MODULE_1__["NG_VALUE_ACCESSOR"], useExisting: Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["forwardRef"])(() => MatPasswordStrengthComponent), multi: true } ]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵNgOnChangesFeature"]], decls: 1, vars: 2, consts: [["mode", "determinate", 3, "color", "value"]], template: function MatPasswordStrengthComponent_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelement"](0, "mat-progress-bar", 0); } if (rf & 2) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("color", ctx.color)("value", ctx.strength); } }, directives: [_angular_material_progress_bar__WEBPACK_IMPORTED_MODULE_4__["MatProgressBar"]], styles: [".green [_nghost-%COMP%] .mat-progress-bar.mat-primary .mat-progress-bar-fill:after{background-color:#43a047}"], changeDetection: 0 }); MatPasswordStrengthComponent.propDecorators = { password: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], externalError: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], enableLengthRule: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], enableLowerCaseLetterRule: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], enableUpperCaseLetterRule: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], enableDigitRule: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], enableSpecialCharRule: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], min: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], max: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], customValidator: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], warnThreshold: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], accentThreshold: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], onStrengthChanged: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Output"] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](MatPasswordStrengthComponent, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Component"], args: [{ selector: 'mat-password-strength', exportAs: 'matPasswordStrength', template: "\n\n", changeDetection: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ChangeDetectionStrategy"].OnPush, providers: [ { provide: _angular_forms__WEBPACK_IMPORTED_MODULE_1__["NG_VALUE_ACCESSOR"], useExisting: Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["forwardRef"])(() => MatPasswordStrengthComponent), multi: true } ], styles: [".green :host::ng-deep .mat-progress-bar.mat-primary .mat-progress-bar-fill:after{background-color:#43a047}"] }] }], function () { return []; }, { enableLengthRule: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], enableLowerCaseLetterRule: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], enableUpperCaseLetterRule: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], enableDigitRule: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], enableSpecialCharRule: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], min: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], max: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], warnThreshold: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], accentThreshold: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], onStrengthChanged: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Output"] }], password: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], externalError: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], customValidator: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }] }); })(); function flipIn(timing, rotateX, rotateY) { const params = { timing: timing, delay: 0, rotateX, rotateY }; return Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["animation"])([ Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ 'backface-visibility': 'visible' }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["animate"])('{{ timing }}s {{ delay }}s ease-in', Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["keyframes"])([ Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ opacity: 0, transform: 'perspective(400px) rotate3d({{ rotateX }}, {{ rotateY }}, 0, 90deg)', offset: 0, }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ opacity: 1, transform: 'perspective(400px) rotate3d({{ rotateX }}, {{ rotateY }}, 0, -20deg)', offset: 0.4, }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'perspective(400px) rotate3d({{ rotateX }}, {{ rotateY }}, 0, 10deg)', offset: 0.6, }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'perspective(400px) rotate3d({{ rotateX }}, {{ rotateY }}, 0, -5deg)', offset: 0.8, }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'perspective(400px) rotate3d(0, 0, 0, 0)', offset: 1, }), ])), ], { params }); } const flipInX = flipIn(1, 1, 0); const flipInY = flipIn(1, 0, 1); const shake = Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["animation"])(Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["animate"])('{{ timing }}s {{ delay }}s', Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["keyframes"])([ Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'translate3d(0, 0, 0)', offset: 0 }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'translate3d(-10px, 0, 0)', offset: 0.1 }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'translate3d(10px, 0, 0)', offset: 0.2 }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'translate3d(-10px, 0, 0)', offset: 0.3 }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'translate3d(10px, 0, 0)', offset: 0.4 }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'translate3d(-10px, 0, 0)', offset: 0.5 }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'translate3d(10px, 0, 0)', offset: 0.6 }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'translate3d(-10px, 0, 0)', offset: 0.7 }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'translate3d(10px, 0, 0)', offset: 0.8 }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'translate3d(-10px, 0, 0)', offset: 0.9 }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'translate3d(0, 0, 0)', offset: 1 }), ])), { params: { timing: 1, delay: 0 } }); class MatPasswordStrengthInfoComponent { constructor() { this.enableScoreInfo = false; this.lowerCaseCriteriaMsg = 'contains at least one lower character'; this.upperCaseCriteriaMsg = 'contains at least one upper character'; this.digitsCriteriaMsg = 'contains at least one digit character'; this.specialCharsCriteriaMsg = 'contains at least one special character'; this.customCharsCriteriaMsg = 'contains at least one custom character'; this.matIconDone = 'done'; this.matIconError = 'error'; } ngOnInit() { if (!this.minCharsCriteriaMsg) { this.minCharsCriteriaMsg = `contains at least ${this.passwordComponent.min} characters`; } } } MatPasswordStrengthInfoComponent.ɵfac = function MatPasswordStrengthInfoComponent_Factory(t) { return new (t || MatPasswordStrengthInfoComponent)(); }; MatPasswordStrengthInfoComponent.ɵcmp = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineComponent"]({ type: MatPasswordStrengthInfoComponent, selectors: [["mat-password-strength-info"]], inputs: { enableScoreInfo: "enableScoreInfo", lowerCaseCriteriaMsg: "lowerCaseCriteriaMsg", upperCaseCriteriaMsg: "upperCaseCriteriaMsg", digitsCriteriaMsg: "digitsCriteriaMsg", specialCharsCriteriaMsg: "specialCharsCriteriaMsg", customCharsCriteriaMsg: "customCharsCriteriaMsg", matIconDone: "matIconDone", matIconError: "matIconError", minCharsCriteriaMsg: "minCharsCriteriaMsg", passwordComponent: "passwordComponent" }, exportAs: ["matPasswordStrengthInfo"], decls: 9, vars: 8, consts: [["class", "info-row", 4, "ngIf"], [1, "info-row"], [4, "ngIf", "ngIfThen", "ngIfElse"], ["done", ""], ["error", ""], ["color", "primary"], ["color", "warn"]], template: function MatPasswordStrengthInfoComponent_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](0, "mat-card"); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementStart"](1, "mat-card-content"); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](2, MatPasswordStrengthInfoComponent_div_2_Template, 8, 5, "div", 0); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](3, MatPasswordStrengthInfoComponent_div_3_Template, 8, 5, "div", 0); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](4, MatPasswordStrengthInfoComponent_div_4_Template, 8, 5, "div", 0); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](5, MatPasswordStrengthInfoComponent_div_5_Template, 8, 5, "div", 0); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](6, MatPasswordStrengthInfoComponent_div_6_Template, 8, 5, "div", 0); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](7, MatPasswordStrengthInfoComponent_div_7_Template, 8, 5, "div", 0); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵtemplate"](8, MatPasswordStrengthInfoComponent_div_8_Template, 8, 5, "div", 0); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵelementEnd"](); } if (rf & 2) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("@list", undefined); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](2); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("ngIf", ctx.passwordComponent.enableLowerCaseLetterRule); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("ngIf", ctx.passwordComponent.enableUpperCaseLetterRule); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("ngIf", ctx.passwordComponent.enableDigitRule); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("ngIf", ctx.passwordComponent.enableSpecialCharRule); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("ngIf", ctx.passwordComponent.enableLengthRule); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("ngIf", ctx.passwordComponent.customValidator); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵproperty"]("ngIf", ctx.enableScoreInfo); } }, directives: [_angular_material_card__WEBPACK_IMPORTED_MODULE_6__["MatCard"], _angular_material_card__WEBPACK_IMPORTED_MODULE_6__["MatCardContent"], _angular_common__WEBPACK_IMPORTED_MODULE_3__["NgIf"], _angular_material_icon__WEBPACK_IMPORTED_MODULE_7__["MatIcon"]], styles: ["mat-card[_ngcontent-%COMP%]{flex-direction:row;place-content:stretch center;flex:1 1 0}mat-card[_ngcontent-%COMP%], mat-card[_ngcontent-%COMP%] mat-card-content[_ngcontent-%COMP%]{box-sizing:border-box;display:flex;align-items:stretch}mat-card[_ngcontent-%COMP%] mat-card-content[_ngcontent-%COMP%]{flex-direction:column;max-width:100%;place-content:stretch flex-start}mat-card[_ngcontent-%COMP%] mat-card-content[_ngcontent-%COMP%] mat-icon[_ngcontent-%COMP%]{margin-right:10px}mat-card[_ngcontent-%COMP%] mat-card-content[_ngcontent-%COMP%] .info-row[_ngcontent-%COMP%]{flex-direction:row;box-sizing:border-box;display:flex;align-items:center}"], data: { animation: [ // nice stagger effect when showing existing elements Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["trigger"])('list', [ Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["transition"])(':enter', [ // child animation selector + stagger Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["query"])('@items', Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["stagger"])(300, Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["animateChild"])())) ]), ]), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["trigger"])('items', [ // cubic-bezier for a tiny bouncing feel Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["transition"])(':enter', [ Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'scale(0.5)', opacity: 0 }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["animate"])('1s cubic-bezier(.8,-0.6,0.2,1.5)', Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'scale(1)', opacity: 1 })) ]), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["transition"])(':leave', [ Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'scale(1)', opacity: 1, height: '*' }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["animate"])('1s cubic-bezier(.8,-0.6,0.2,1.5)', Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'scale(0.5)', opacity: 0, height: '0px', margin: '0px' })) ]), ]), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["trigger"])('positiveState', [ Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["transition"])(':enter', [ Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ 'backface-visibility': 'visible' }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["animate"])('{{ timing }}s {{ delay }}s ease-in', Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["keyframes"])([ Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ opacity: 0, transform: 'perspective(400px) rotate3d({{ rotateX }}, {{ rotateY }}, 0, 90deg)', offset: 0 }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ opacity: 1, transform: 'perspective(400px) rotate3d({{ rotateX }}, {{ rotateY }}, 0, -20deg)', offset: 0.4 }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'perspective(400px) rotate3d({{ rotateX }}, {{ rotateY }}, 0, 10deg)', offset: 0.6 }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'perspective(400px) rotate3d({{ rotateX }}, {{ rotateY }}, 0, -5deg)', offset: 0.8 }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'perspective(400px) rotate3d(0, 0, 0, 0)', offset: 1 }), ])), ], { params: { timing: 1, delay: 0, rotateX: 1, rotateY: 0 } }), ]), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["trigger"])('negativeState', [ Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["transition"])(':enter', Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["useAnimation"])(shake)), ]), ] } }); MatPasswordStrengthInfoComponent.propDecorators = { passwordComponent: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], enableScoreInfo: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], lowerCaseCriteriaMsg: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], upperCaseCriteriaMsg: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], digitsCriteriaMsg: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], specialCharsCriteriaMsg: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], customCharsCriteriaMsg: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], minCharsCriteriaMsg: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], matIconDone: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], matIconError: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](MatPasswordStrengthInfoComponent, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Component"], args: [{ selector: 'mat-password-strength-info', exportAs: 'matPasswordStrengthInfo', template: "\n \n
\n
\n
\n \n {{matIconDone}}\n \n \n {{matIconError}}\n \n {{lowerCaseCriteriaMsg}}\n
\n\n
\n
\n
\n \n {{matIconDone}}\n \n \n {{matIconError}}\n \n {{upperCaseCriteriaMsg}}\n
\n\n
\n
\n
\n \n {{matIconDone}}\n \n \n {{matIconError}}\n \n {{digitsCriteriaMsg}}\n
\n\n
\n
\n
\n \n {{matIconDone}}\n \n \n {{matIconError}}\n \n {{specialCharsCriteriaMsg}}\n
\n\n
\n
\n
\n \n {{matIconDone}}\n \n \n {{matIconError}}\n \n {{minCharsCriteriaMsg}}\n
\n\n
\n
\n
\n \n {{matIconDone}}\n \n \n {{matIconError}}\n \n {{customCharsCriteriaMsg}}\n
\n\n
\n
\n
\n \n {{matIconDone}}\n \n \n {{matIconError}}\n \n Password's strength = {{passwordComponent.strength}} %100\n
\n\n \n", animations: [ // nice stagger effect when showing existing elements Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["trigger"])('list', [ Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["transition"])(':enter', [ // child animation selector + stagger Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["query"])('@items', Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["stagger"])(300, Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["animateChild"])())) ]), ]), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["trigger"])('items', [ // cubic-bezier for a tiny bouncing feel Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["transition"])(':enter', [ Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'scale(0.5)', opacity: 0 }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["animate"])('1s cubic-bezier(.8,-0.6,0.2,1.5)', Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'scale(1)', opacity: 1 })) ]), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["transition"])(':leave', [ Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'scale(1)', opacity: 1, height: '*' }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["animate"])('1s cubic-bezier(.8,-0.6,0.2,1.5)', Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'scale(0.5)', opacity: 0, height: '0px', margin: '0px' })) ]), ]), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["trigger"])('positiveState', [ Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["transition"])(':enter', [ Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ 'backface-visibility': 'visible' }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["animate"])('{{ timing }}s {{ delay }}s ease-in', Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["keyframes"])([ Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ opacity: 0, transform: 'perspective(400px) rotate3d({{ rotateX }}, {{ rotateY }}, 0, 90deg)', offset: 0 }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ opacity: 1, transform: 'perspective(400px) rotate3d({{ rotateX }}, {{ rotateY }}, 0, -20deg)', offset: 0.4 }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'perspective(400px) rotate3d({{ rotateX }}, {{ rotateY }}, 0, 10deg)', offset: 0.6 }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'perspective(400px) rotate3d({{ rotateX }}, {{ rotateY }}, 0, -5deg)', offset: 0.8 }), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["style"])({ transform: 'perspective(400px) rotate3d(0, 0, 0, 0)', offset: 1 }), ])), ], { params: { timing: 1, delay: 0, rotateX: 1, rotateY: 0 } }), ]), Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["trigger"])('negativeState', [ Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["transition"])(':enter', Object(_angular_animations__WEBPACK_IMPORTED_MODULE_2__["useAnimation"])(shake)), ]), ], styles: ["mat-card{flex-direction:row;place-content:stretch center;flex:1 1 0}mat-card,mat-card mat-card-content{box-sizing:border-box;display:flex;align-items:stretch}mat-card mat-card-content{flex-direction:column;max-width:100%;place-content:stretch flex-start}mat-card mat-card-content mat-icon{margin-right:10px}mat-card mat-card-content .info-row{flex-direction:row;box-sizing:border-box;display:flex;align-items:center}"] }] }], function () { return []; }, { enableScoreInfo: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], lowerCaseCriteriaMsg: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], upperCaseCriteriaMsg: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], digitsCriteriaMsg: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], specialCharsCriteriaMsg: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], customCharsCriteriaMsg: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], matIconDone: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], matIconError: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], minCharsCriteriaMsg: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], passwordComponent: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }] }); })(); class MatPasswordStrengthModule { static forRoot() { return { ngModule: MatPasswordStrengthModule, providers: [] }; } } MatPasswordStrengthModule.ɵmod = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineNgModule"]({ type: MatPasswordStrengthModule }); MatPasswordStrengthModule.ɵinj = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjector"]({ factory: function MatPasswordStrengthModule_Factory(t) { return new (t || MatPasswordStrengthModule)(); }, imports: [[ _angular_common__WEBPACK_IMPORTED_MODULE_3__["CommonModule"], _angular_material_progress_bar__WEBPACK_IMPORTED_MODULE_4__["MatProgressBarModule"], _angular_material_card__WEBPACK_IMPORTED_MODULE_6__["MatCardModule"], _angular_material_icon__WEBPACK_IMPORTED_MODULE_7__["MatIconModule"], _angular_material_core__WEBPACK_IMPORTED_MODULE_5__["MatRippleModule"] ]] }); (function () { (typeof ngJitMode === "undefined" || ngJitMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵsetNgModuleScope"](MatPasswordStrengthModule, { declarations: function () { return [MatPasswordStrengthComponent, MatPasswordStrengthInfoComponent, MatPassToggleVisibilityComponent]; }, imports: function () { return [_angular_common__WEBPACK_IMPORTED_MODULE_3__["CommonModule"], _angular_material_progress_bar__WEBPACK_IMPORTED_MODULE_4__["MatProgressBarModule"], _angular_material_card__WEBPACK_IMPORTED_MODULE_6__["MatCardModule"], _angular_material_icon__WEBPACK_IMPORTED_MODULE_7__["MatIconModule"], _angular_material_core__WEBPACK_IMPORTED_MODULE_5__["MatRippleModule"]]; }, exports: function () { return [MatPasswordStrengthComponent, MatPasswordStrengthInfoComponent, MatPassToggleVisibilityComponent]; } }); })(); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](MatPasswordStrengthModule, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["NgModule"], args: [{ imports: [ _angular_common__WEBPACK_IMPORTED_MODULE_3__["CommonModule"], _angular_material_progress_bar__WEBPACK_IMPORTED_MODULE_4__["MatProgressBarModule"], _angular_material_card__WEBPACK_IMPORTED_MODULE_6__["MatCardModule"], _angular_material_icon__WEBPACK_IMPORTED_MODULE_7__["MatIconModule"], _angular_material_core__WEBPACK_IMPORTED_MODULE_5__["MatRippleModule"] ], exports: [ MatPasswordStrengthComponent, MatPasswordStrengthInfoComponent, MatPassToggleVisibilityComponent ], declarations: [ MatPasswordStrengthComponent, MatPasswordStrengthInfoComponent, MatPassToggleVisibilityComponent ], entryComponents: [MatPassToggleVisibilityComponent] }] }], null, null); })(); /* * Public API Surface of password-strength */ /** * Generated bundle index. Do not edit. */ //# sourceMappingURL=angular-material-extensions-password-strength.js.map /***/ }), /***/ "./node_modules/@angular/animations/__ivy_ngcc__/fesm2015/animations.js": /*!******************************************************************************!*\ !*** ./node_modules/@angular/animations/__ivy_ngcc__/fesm2015/animations.js ***! \******************************************************************************/ /*! exports provided: AUTO_STYLE, AnimationBuilder, AnimationFactory, NoopAnimationPlayer, animate, animateChild, animation, group, keyframes, query, sequence, stagger, state, style, transition, trigger, useAnimation, ɵAnimationGroupPlayer, ɵPRE_STYLE */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; __webpack_require__.r(__webpack_exports__); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "AUTO_STYLE", function() { return AUTO_STYLE; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "AnimationBuilder", function() { return AnimationBuilder; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "AnimationFactory", function() { return AnimationFactory; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NoopAnimationPlayer", function() { return NoopAnimationPlayer; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "animate", function() { return animate; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "animateChild", function() { return animateChild; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "animation", function() { return animation; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "group", function() { return group; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "keyframes", function() { return keyframes; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "query", function() { return query; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "sequence", function() { return sequence; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "stagger", function() { return stagger; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "state", function() { return state; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "style", function() { return style; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "transition", function() { return transition; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "trigger", function() { return trigger; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "useAnimation", function() { return useAnimation; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵAnimationGroupPlayer", function() { return AnimationGroupPlayer; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵPRE_STYLE", function() { return ɵPRE_STYLE; }); /** * @license Angular v10.2.4 * (c) 2010-2020 Google LLC. https://angular.io/ * License: MIT */ /** * An injectable service that produces an animation sequence programmatically within an * Angular component or directive. * Provided by the `BrowserAnimationsModule` or `NoopAnimationsModule`. * * @usageNotes * * To use this service, add it to your component or directive as a dependency. * The service is instantiated along with your component. * * Apps do not typically need to create their own animation players, but if you * do need to, follow these steps: * * 1. Use the `build()` method to create a programmatic animation using the * `animate()` function. The method returns an `AnimationFactory` instance. * * 2. Use the factory object to create an `AnimationPlayer` and attach it to a DOM element. * * 3. Use the player object to control the animation programmatically. * * For example: * * ```ts * // import the service from BrowserAnimationsModule * import {AnimationBuilder} from '@angular/animations'; * // require the service as a dependency * class MyCmp { * constructor(private _builder: AnimationBuilder) {} * * makeAnimation(element: any) { * // first define a reusable animation * const myAnimation = this._builder.build([ * style({ width: 0 }), * animate(1000, style({ width: '100px' })) * ]); * * // use the returned factory object to create a player * const player = myAnimation.create(element); * * player.play(); * } * } * ``` * * @publicApi */ class AnimationBuilder { } /** * A factory object returned from the `AnimationBuilder`.`build()` method. * * @publicApi */ class AnimationFactory { } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Specifies automatic styling. * * @publicApi */ const AUTO_STYLE = '*'; /** * Creates a named animation trigger, containing a list of `state()` * and `transition()` entries to be evaluated when the expression * bound to the trigger changes. * * @param name An identifying string. * @param definitions An animation definition object, containing an array of `state()` * and `transition()` declarations. * * @return An object that encapsulates the trigger data. * * @usageNotes * Define an animation trigger in the `animations` section of `@Component` metadata. * In the template, reference the trigger by name and bind it to a trigger expression that * evaluates to a defined animation state, using the following format: * * `[@triggerName]="expression"` * * Animation trigger bindings convert all values to strings, and then match the * previous and current values against any linked transitions. * Booleans can be specified as `1` or `true` and `0` or `false`. * * ### Usage Example * * The following example creates an animation trigger reference based on the provided * name value. * The provided animation value is expected to be an array consisting of state and * transition declarations. * * ```typescript * @Component({ * selector: "my-component", * templateUrl: "my-component-tpl.html", * animations: [ * trigger("myAnimationTrigger", [ * state(...), * state(...), * transition(...), * transition(...) * ]) * ] * }) * class MyComponent { * myStatusExp = "something"; * } * ``` * * The template associated with this component makes use of the defined trigger * by binding to an element within its template code. * * ```html * *
...
* ``` * * ### Using an inline function * The `transition` animation method also supports reading an inline function which can decide * if its associated animation should be run. * * ```typescript * // this method is run each time the `myAnimationTrigger` trigger value changes. * function myInlineMatcherFn(fromState: string, toState: string, element: any, params: {[key: string]: any}): boolean { * // notice that `element` and `params` are also available here * return toState == 'yes-please-animate'; * } * * @Component({ * selector: 'my-component', * templateUrl: 'my-component-tpl.html', * animations: [ * trigger('myAnimationTrigger', [ * transition(myInlineMatcherFn, [ * // the animation sequence code * ]), * ]) * ] * }) * class MyComponent { * myStatusExp = "yes-please-animate"; * } * ``` * * ### Disabling Animations * When true, the special animation control binding `@.disabled` binding prevents * all animations from rendering. * Place the `@.disabled` binding on an element to disable * animations on the element itself, as well as any inner animation triggers * within the element. * * The following example shows how to use this feature: * * ```typescript * @Component({ * selector: 'my-component', * template: ` *
*
*
* `, * animations: [ * trigger("childAnimation", [ * // ... * ]) * ] * }) * class MyComponent { * isDisabled = true; * exp = '...'; * } * ``` * * When `@.disabled` is true, it prevents the `@childAnimation` trigger from animating, * along with any inner animations. * * ### Disable animations application-wide * When an area of the template is set to have animations disabled, * **all** inner components have their animations disabled as well. * This means that you can disable all animations for an app * by placing a host binding set on `@.disabled` on the topmost Angular component. * * ```typescript * import {Component, HostBinding} from '@angular/core'; * * @Component({ * selector: 'app-component', * templateUrl: 'app.component.html', * }) * class AppComponent { * @HostBinding('@.disabled') * public animationsDisabled = true; * } * ``` * * ### Overriding disablement of inner animations * Despite inner animations being disabled, a parent animation can `query()` * for inner elements located in disabled areas of the template and still animate * them if needed. This is also the case for when a sub animation is * queried by a parent and then later animated using `animateChild()`. * * ### Detecting when an animation is disabled * If a region of the DOM (or the entire application) has its animations disabled, the animation * trigger callbacks still fire, but for zero seconds. When the callback fires, it provides * an instance of an `AnimationEvent`. If animations are disabled, * the `.disabled` flag on the event is true. * * @publicApi */ function trigger(name, definitions) { return { type: 7 /* Trigger */, name, definitions, options: {} }; } /** * Defines an animation step that combines styling information with timing information. * * @param timings Sets `AnimateTimings` for the parent animation. * A string in the format "duration [delay] [easing]". * - Duration and delay are expressed as a number and optional time unit, * such as "1s" or "10ms" for one second and 10 milliseconds, respectively. * The default unit is milliseconds. * - The easing value controls how the animation accelerates and decelerates * during its runtime. Value is one of `ease`, `ease-in`, `ease-out`, * `ease-in-out`, or a `cubic-bezier()` function call. * If not supplied, no easing is applied. * * For example, the string "1s 100ms ease-out" specifies a duration of * 1000 milliseconds, and delay of 100 ms, and the "ease-out" easing style, * which decelerates near the end of the duration. * @param styles Sets AnimationStyles for the parent animation. * A function call to either `style()` or `keyframes()` * that returns a collection of CSS style entries to be applied to the parent animation. * When null, uses the styles from the destination state. * This is useful when describing an animation step that will complete an animation; * see "Animating to the final state" in `transitions()`. * @returns An object that encapsulates the animation step. * * @usageNotes * Call within an animation `sequence()`, `{@link animations/group group()}`, or * `transition()` call to specify an animation step * that applies given style data to the parent animation for a given amount of time. * * ### Syntax Examples * **Timing examples** * * The following examples show various `timings` specifications. * - `animate(500)` : Duration is 500 milliseconds. * - `animate("1s")` : Duration is 1000 milliseconds. * - `animate("100ms 0.5s")` : Duration is 100 milliseconds, delay is 500 milliseconds. * - `animate("5s ease-in")` : Duration is 5000 milliseconds, easing in. * - `animate("5s 10ms cubic-bezier(.17,.67,.88,.1)")` : Duration is 5000 milliseconds, delay is 10 * milliseconds, easing according to a bezier curve. * * **Style examples** * * The following example calls `style()` to set a single CSS style. * ```typescript * animate(500, style({ background: "red" })) * ``` * The following example calls `keyframes()` to set a CSS style * to different values for successive keyframes. * ```typescript * animate(500, keyframes( * [ * style({ background: "blue" })), * style({ background: "red" })) * ]) * ``` * * @publicApi */ function animate(timings, styles = null) { return { type: 4 /* Animate */, styles, timings }; } /** * @description Defines a list of animation steps to be run in parallel. * * @param steps An array of animation step objects. * - When steps are defined by `style()` or `animate()` * function calls, each call within the group is executed instantly. * - To specify offset styles to be applied at a later time, define steps with * `keyframes()`, or use `animate()` calls with a delay value. * For example: * * ```typescript * group([ * animate("1s", style({ background: "black" })), * animate("2s", style({ color: "white" })) * ]) * ``` * * @param options An options object containing a delay and * developer-defined parameters that provide styling defaults and * can be overridden on invocation. * * @return An object that encapsulates the group data. * * @usageNotes * Grouped animations are useful when a series of styles must be * animated at different starting times and closed off at different ending times. * * When called within a `sequence()` or a * `transition()` call, does not continue to the next * instruction until all of the inner animation steps have completed. * * @publicApi */ function group(steps, options = null) { return { type: 3 /* Group */, steps, options }; } /** * Defines a list of animation steps to be run sequentially, one by one. * * @param steps An array of animation step objects. * - Steps defined by `style()` calls apply the styling data immediately. * - Steps defined by `animate()` calls apply the styling data over time * as specified by the timing data. * * ```typescript * sequence([ * style({ opacity: 0 }), * animate("1s", style({ opacity: 1 })) * ]) * ``` * * @param options An options object containing a delay and * developer-defined parameters that provide styling defaults and * can be overridden on invocation. * * @return An object that encapsulates the sequence data. * * @usageNotes * When you pass an array of steps to a * `transition()` call, the steps run sequentially by default. * Compare this to the `{@link animations/group group()}` call, which runs animation steps in *parallel. * * When a sequence is used within a `{@link animations/group group()}` or a `transition()` call, * execution continues to the next instruction only after each of the inner animation * steps have completed. * * @publicApi **/ function sequence(steps, options = null) { return { type: 2 /* Sequence */, steps, options }; } /** * Declares a key/value object containing CSS properties/styles that * can then be used for an animation `state`, within an animation `sequence`, * or as styling data for calls to `animate()` and `keyframes()`. * * @param tokens A set of CSS styles or HTML styles associated with an animation state. * The value can be any of the following: * - A key-value style pair associating a CSS property with a value. * - An array of key-value style pairs. * - An asterisk (*), to use auto-styling, where styles are derived from the element * being animated and applied to the animation when it starts. * * Auto-styling can be used to define a state that depends on layout or other * environmental factors. * * @return An object that encapsulates the style data. * * @usageNotes * The following examples create animation styles that collect a set of * CSS property values: * * ```typescript * // string values for CSS properties * style({ background: "red", color: "blue" }) * * // numerical pixel values * style({ width: 100, height: 0 }) * ``` * * The following example uses auto-styling to allow a component to animate from * a height of 0 up to the height of the parent element: * * ``` * style({ height: 0 }), * animate("1s", style({ height: "*" })) * ``` * * @publicApi **/ function style(tokens) { return { type: 6 /* Style */, styles: tokens, offset: null }; } /** * Declares an animation state within a trigger attached to an element. * * @param name One or more names for the defined state in a comma-separated string. * The following reserved state names can be supplied to define a style for specific use * cases: * * - `void` You can associate styles with this name to be used when * the element is detached from the application. For example, when an `ngIf` evaluates * to false, the state of the associated element is void. * - `*` (asterisk) Indicates the default state. You can associate styles with this name * to be used as the fallback when the state that is being animated is not declared * within the trigger. * * @param styles A set of CSS styles associated with this state, created using the * `style()` function. * This set of styles persists on the element once the state has been reached. * @param options Parameters that can be passed to the state when it is invoked. * 0 or more key-value pairs. * @return An object that encapsulates the new state data. * * @usageNotes * Use the `trigger()` function to register states to an animation trigger. * Use the `transition()` function to animate between states. * When a state is active within a component, its associated styles persist on the element, * even when the animation ends. * * @publicApi **/ function state(name, styles, options) { return { type: 0 /* State */, name, styles, options }; } /** * Defines a set of animation styles, associating each style with an optional `offset` value. * * @param steps A set of animation styles with optional offset data. * The optional `offset` value for a style specifies a percentage of the total animation * time at which that style is applied. * @returns An object that encapsulates the keyframes data. * * @usageNotes * Use with the `animate()` call. Instead of applying animations * from the current state * to the destination state, keyframes describe how each style entry is applied and at what point * within the animation arc. * Compare [CSS Keyframe Animations](https://www.w3schools.com/css/css3_animations.asp). * * ### Usage * * In the following example, the offset values describe * when each `backgroundColor` value is applied. The color is red at the start, and changes to * blue when 20% of the total time has elapsed. * * ```typescript * // the provided offset values * animate("5s", keyframes([ * style({ backgroundColor: "red", offset: 0 }), * style({ backgroundColor: "blue", offset: 0.2 }), * style({ backgroundColor: "orange", offset: 0.3 }), * style({ backgroundColor: "black", offset: 1 }) * ])) * ``` * * If there are no `offset` values specified in the style entries, the offsets * are calculated automatically. * * ```typescript * animate("5s", keyframes([ * style({ backgroundColor: "red" }) // offset = 0 * style({ backgroundColor: "blue" }) // offset = 0.33 * style({ backgroundColor: "orange" }) // offset = 0.66 * style({ backgroundColor: "black" }) // offset = 1 * ])) *``` * @publicApi */ function keyframes(steps) { return { type: 5 /* Keyframes */, steps }; } /** * Declares an animation transition as a sequence of animation steps to run when a given * condition is satisfied. The condition is a Boolean expression or function that compares * the previous and current animation states, and returns true if this transition should occur. * When the state criteria of a defined transition are met, the associated animation is * triggered. * * @param stateChangeExpr A Boolean expression or function that compares the previous and current * animation states, and returns true if this transition should occur. Note that "true" and "false" * match 1 and 0, respectively. An expression is evaluated each time a state change occurs in the * animation trigger element. * The animation steps run when the expression evaluates to true. * * - A state-change string takes the form "state1 => state2", where each side is a defined animation * state, or an asterix (*) to refer to a dynamic start or end state. * - The expression string can contain multiple comma-separated statements; * for example "state1 => state2, state3 => state4". * - Special values `:enter` and `:leave` initiate a transition on the entry and exit states, * equivalent to "void => *" and "* => void". * - Special values `:increment` and `:decrement` initiate a transition when a numeric value has * increased or decreased in value. * - A function is executed each time a state change occurs in the animation trigger element. * The animation steps run when the function returns true. * * @param steps One or more animation objects, as returned by the `animate()` or * `sequence()` function, that form a transformation from one state to another. * A sequence is used by default when you pass an array. * @param options An options object that can contain a delay value for the start of the animation, * and additional developer-defined parameters. Provided values for additional parameters are used * as defaults, and override values can be passed to the caller on invocation. * @returns An object that encapsulates the transition data. * * @usageNotes * The template associated with a component binds an animation trigger to an element. * * ```HTML * *
...
* ``` * * All transitions are defined within an animation trigger, * along with named states that the transitions change to and from. * * ```typescript * trigger("myAnimationTrigger", [ * // define states * state("on", style({ background: "green" })), * state("off", style({ background: "grey" })), * ...] * ``` * * Note that when you call the `sequence()` function within a `{@link animations/group group()}` * or a `transition()` call, execution does not continue to the next instruction * until each of the inner animation steps have completed. * * ### Syntax examples * * The following examples define transitions between the two defined states (and default states), * using various options: * * ```typescript * // Transition occurs when the state value * // bound to "myAnimationTrigger" changes from "on" to "off" * transition("on => off", animate(500)) * // Run the same animation for both directions * transition("on <=> off", animate(500)) * // Define multiple state-change pairs separated by commas * transition("on => off, off => void", animate(500)) * ``` * * ### Special values for state-change expressions * * - Catch-all state change for when an element is inserted into the page and the * destination state is unknown: * * ```typescript * transition("void => *", [ * style({ opacity: 0 }), * animate(500) * ]) * ``` * * - Capture a state change between any states: * * `transition("* => *", animate("1s 0s"))` * * - Entry and exit transitions: * * ```typescript * transition(":enter", [ * style({ opacity: 0 }), * animate(500, style({ opacity: 1 })) * ]), * transition(":leave", [ * animate(500, style({ opacity: 0 })) * ]) * ``` * * - Use `:increment` and `:decrement` to initiate transitions: * * ```typescript * transition(":increment", group([ * query(':enter', [ * style({ left: '100%' }), * animate('0.5s ease-out', style('*')) * ]), * query(':leave', [ * animate('0.5s ease-out', style({ left: '-100%' })) * ]) * ])) * * transition(":decrement", group([ * query(':enter', [ * style({ left: '100%' }), * animate('0.5s ease-out', style('*')) * ]), * query(':leave', [ * animate('0.5s ease-out', style({ left: '-100%' })) * ]) * ])) * ``` * * ### State-change functions * * Here is an example of a `fromState` specified as a state-change function that invokes an * animation when true: * * ```typescript * transition((fromState, toState) => * { * return fromState == "off" && toState == "on"; * }, * animate("1s 0s")) * ``` * * ### Animating to the final state * * If the final step in a transition is a call to `animate()` that uses a timing value * with no style data, that step is automatically considered the final animation arc, * for the element to reach the final state. Angular automatically adds or removes * CSS styles to ensure that the element is in the correct final state. * * The following example defines a transition that starts by hiding the element, * then makes sure that it animates properly to whatever state is currently active for trigger: * * ```typescript * transition("void => *", [ * style({ opacity: 0 }), * animate(500) * ]) * ``` * ### Boolean value matching * If a trigger binding value is a Boolean, it can be matched using a transition expression * that compares true and false or 1 and 0. For example: * * ``` * // in the template *
...
* // in the component metadata * trigger('openClose', [ * state('true', style({ height: '*' })), * state('false', style({ height: '0px' })), * transition('false <=> true', animate(500)) * ]) * ``` * * @publicApi **/ function transition(stateChangeExpr, steps, options = null) { return { type: 1 /* Transition */, expr: stateChangeExpr, animation: steps, options }; } /** * Produces a reusable animation that can be invoked in another animation or sequence, * by calling the `useAnimation()` function. * * @param steps One or more animation objects, as returned by the `animate()` * or `sequence()` function, that form a transformation from one state to another. * A sequence is used by default when you pass an array. * @param options An options object that can contain a delay value for the start of the * animation, and additional developer-defined parameters. * Provided values for additional parameters are used as defaults, * and override values can be passed to the caller on invocation. * @returns An object that encapsulates the animation data. * * @usageNotes * The following example defines a reusable animation, providing some default parameter * values. * * ```typescript * var fadeAnimation = animation([ * style({ opacity: '{{ start }}' }), * animate('{{ time }}', * style({ opacity: '{{ end }}'})) * ], * { params: { time: '1000ms', start: 0, end: 1 }}); * ``` * * The following invokes the defined animation with a call to `useAnimation()`, * passing in override parameter values. * * ```js * useAnimation(fadeAnimation, { * params: { * time: '2s', * start: 1, * end: 0 * } * }) * ``` * * If any of the passed-in parameter values are missing from this call, * the default values are used. If one or more parameter values are missing before a step is * animated, `useAnimation()` throws an error. * * @publicApi */ function animation(steps, options = null) { return { type: 8 /* Reference */, animation: steps, options }; } /** * Executes a queried inner animation element within an animation sequence. * * @param options An options object that can contain a delay value for the start of the * animation, and additional override values for developer-defined parameters. * @return An object that encapsulates the child animation data. * * @usageNotes * Each time an animation is triggered in Angular, the parent animation * has priority and any child animations are blocked. In order * for a child animation to run, the parent animation must query each of the elements * containing child animations, and run them using this function. * * Note that this feature is designed to be used with `query()` and it will only work * with animations that are assigned using the Angular animation library. CSS keyframes * and transitions are not handled by this API. * * @publicApi */ function animateChild(options = null) { return { type: 9 /* AnimateChild */, options }; } /** * Starts a reusable animation that is created using the `animation()` function. * * @param animation The reusable animation to start. * @param options An options object that can contain a delay value for the start of * the animation, and additional override values for developer-defined parameters. * @return An object that contains the animation parameters. * * @publicApi */ function useAnimation(animation, options = null) { return { type: 10 /* AnimateRef */, animation, options }; } /** * Finds one or more inner elements within the current element that is * being animated within a sequence. Use with `animate()`. * * @param selector The element to query, or a set of elements that contain Angular-specific * characteristics, specified with one or more of the following tokens. * - `query(":enter")` or `query(":leave")` : Query for newly inserted/removed elements. * - `query(":animating")` : Query all currently animating elements. * - `query("@triggerName")` : Query elements that contain an animation trigger. * - `query("@*")` : Query all elements that contain an animation triggers. * - `query(":self")` : Include the current element into the animation sequence. * * @param animation One or more animation steps to apply to the queried element or elements. * An array is treated as an animation sequence. * @param options An options object. Use the 'limit' field to limit the total number of * items to collect. * @return An object that encapsulates the query data. * * @usageNotes * Tokens can be merged into a combined query selector string. For example: * * ```typescript * query(':self, .record:enter, .record:leave, @subTrigger', [...]) * ``` * * The `query()` function collects multiple elements and works internally by using * `element.querySelectorAll`. Use the `limit` field of an options object to limit * the total number of items to be collected. For example: * * ```js * query('div', [ * animate(...), * animate(...) * ], { limit: 1 }) * ``` * * By default, throws an error when zero items are found. Set the * `optional` flag to ignore this error. For example: * * ```js * query('.some-element-that-may-not-be-there', [ * animate(...), * animate(...) * ], { optional: true }) * ``` * * ### Usage Example * * The following example queries for inner elements and animates them * individually using `animate()`. * * ```typescript * @Component({ * selector: 'inner', * template: ` *
*

Title

*
* Blah blah blah *
*
* `, * animations: [ * trigger('queryAnimation', [ * transition('* => goAnimate', [ * // hide the inner elements * query('h1', style({ opacity: 0 })), * query('.content', style({ opacity: 0 })), * * // animate the inner elements in, one by one * query('h1', animate(1000, style({ opacity: 1 }))), * query('.content', animate(1000, style({ opacity: 1 }))), * ]) * ]) * ] * }) * class Cmp { * exp = ''; * * goAnimate() { * this.exp = 'goAnimate'; * } * } * ``` * * @publicApi */ function query(selector, animation, options = null) { return { type: 11 /* Query */, selector, animation, options }; } /** * Use within an animation `query()` call to issue a timing gap after * each queried item is animated. * * @param timings A delay value. * @param animation One ore more animation steps. * @returns An object that encapsulates the stagger data. * * @usageNotes * In the following example, a container element wraps a list of items stamped out * by an `ngFor`. The container element contains an animation trigger that will later be set * to query for each of the inner items. * * Each time items are added, the opacity fade-in animation runs, * and each removed item is faded out. * When either of these animations occur, the stagger effect is * applied after each item's animation is started. * * ```html * * *
*
*
* {{ item }} *
*
* ``` * * Here is the component code: * * ```typescript * import {trigger, transition, style, animate, query, stagger} from '@angular/animations'; * @Component({ * templateUrl: 'list.component.html', * animations: [ * trigger('listAnimation', [ * ... * ]) * ] * }) * class ListComponent { * items = []; * * showItems() { * this.items = [0,1,2,3,4]; * } * * hideItems() { * this.items = []; * } * * toggle() { * this.items.length ? this.hideItems() : this.showItems(); * } * } * ``` * * Here is the animation trigger code: * * ```typescript * trigger('listAnimation', [ * transition('* => *', [ // each time the binding value changes * query(':leave', [ * stagger(100, [ * animate('0.5s', style({ opacity: 0 })) * ]) * ]), * query(':enter', [ * style({ opacity: 0 }), * stagger(100, [ * animate('0.5s', style({ opacity: 1 })) * ]) * ]) * ]) * ]) * ``` * * @publicApi */ function stagger(timings, animation) { return { type: 12 /* Stagger */, timings, animation }; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ function scheduleMicroTask(cb) { Promise.resolve(null).then(cb); } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * An empty programmatic controller for reusable animations. * Used internally when animations are disabled, to avoid * checking for the null case when an animation player is expected. * * @see `animate()` * @see `AnimationPlayer` * @see `GroupPlayer` * * @publicApi */ class NoopAnimationPlayer { constructor(duration = 0, delay = 0) { this._onDoneFns = []; this._onStartFns = []; this._onDestroyFns = []; this._started = false; this._destroyed = false; this._finished = false; this.parentPlayer = null; this.totalTime = duration + delay; } _onFinish() { if (!this._finished) { this._finished = true; this._onDoneFns.forEach(fn => fn()); this._onDoneFns = []; } } onStart(fn) { this._onStartFns.push(fn); } onDone(fn) { this._onDoneFns.push(fn); } onDestroy(fn) { this._onDestroyFns.push(fn); } hasStarted() { return this._started; } init() { } play() { if (!this.hasStarted()) { this._onStart(); this.triggerMicrotask(); } this._started = true; } /** @internal */ triggerMicrotask() { scheduleMicroTask(() => this._onFinish()); } _onStart() { this._onStartFns.forEach(fn => fn()); this._onStartFns = []; } pause() { } restart() { } finish() { this._onFinish(); } destroy() { if (!this._destroyed) { this._destroyed = true; if (!this.hasStarted()) { this._onStart(); } this.finish(); this._onDestroyFns.forEach(fn => fn()); this._onDestroyFns = []; } } reset() { } setPosition(position) { } getPosition() { return 0; } /** @internal */ triggerCallback(phaseName) { const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns; methods.forEach(fn => fn()); methods.length = 0; } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * A programmatic controller for a group of reusable animations. * Used internally to control animations. * * @see `AnimationPlayer` * @see `{@link animations/group group()}` * */ class AnimationGroupPlayer { constructor(_players) { this._onDoneFns = []; this._onStartFns = []; this._finished = false; this._started = false; this._destroyed = false; this._onDestroyFns = []; this.parentPlayer = null; this.totalTime = 0; this.players = _players; let doneCount = 0; let destroyCount = 0; let startCount = 0; const total = this.players.length; if (total == 0) { scheduleMicroTask(() => this._onFinish()); } else { this.players.forEach(player => { player.onDone(() => { if (++doneCount == total) { this._onFinish(); } }); player.onDestroy(() => { if (++destroyCount == total) { this._onDestroy(); } }); player.onStart(() => { if (++startCount == total) { this._onStart(); } }); }); } this.totalTime = this.players.reduce((time, player) => Math.max(time, player.totalTime), 0); } _onFinish() { if (!this._finished) { this._finished = true; this._onDoneFns.forEach(fn => fn()); this._onDoneFns = []; } } init() { this.players.forEach(player => player.init()); } onStart(fn) { this._onStartFns.push(fn); } _onStart() { if (!this.hasStarted()) { this._started = true; this._onStartFns.forEach(fn => fn()); this._onStartFns = []; } } onDone(fn) { this._onDoneFns.push(fn); } onDestroy(fn) { this._onDestroyFns.push(fn); } hasStarted() { return this._started; } play() { if (!this.parentPlayer) { this.init(); } this._onStart(); this.players.forEach(player => player.play()); } pause() { this.players.forEach(player => player.pause()); } restart() { this.players.forEach(player => player.restart()); } finish() { this._onFinish(); this.players.forEach(player => player.finish()); } destroy() { this._onDestroy(); } _onDestroy() { if (!this._destroyed) { this._destroyed = true; this._onFinish(); this.players.forEach(player => player.destroy()); this._onDestroyFns.forEach(fn => fn()); this._onDestroyFns = []; } } reset() { this.players.forEach(player => player.reset()); this._destroyed = false; this._finished = false; this._started = false; } setPosition(p) { const timeAtPosition = p * this.totalTime; this.players.forEach(player => { const position = player.totalTime ? Math.min(1, timeAtPosition / player.totalTime) : 1; player.setPosition(position); }); } getPosition() { let min = 0; this.players.forEach(player => { const p = player.getPosition(); min = Math.min(p, min); }); return min; } beforeDestroy() { this.players.forEach(player => { if (player.beforeDestroy) { player.beforeDestroy(); } }); } /** @internal */ triggerCallback(phaseName) { const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns; methods.forEach(fn => fn()); methods.length = 0; } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ const ɵPRE_STYLE = '!'; /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Generated bundle index. Do not edit. */ //# sourceMappingURL=animations.js.map /***/ }), /***/ "./node_modules/@angular/animations/__ivy_ngcc__/fesm2015/browser.js": /*!***************************************************************************!*\ !*** ./node_modules/@angular/animations/__ivy_ngcc__/fesm2015/browser.js ***! \***************************************************************************/ /*! exports provided: AnimationDriver, ɵAnimation, ɵAnimationEngine, ɵAnimationStyleNormalizer, ɵCssKeyframesDriver, ɵCssKeyframesPlayer, ɵNoopAnimationDriver, ɵNoopAnimationStyleNormalizer, ɵWebAnimationsDriver, ɵWebAnimationsPlayer, ɵWebAnimationsStyleNormalizer, ɵallowPreviousPlayerStylesMerge, ɵangular_packages_animations_browser_browser_a, ɵcontainsElement, ɵinvokeQuery, ɵmatchesElement, ɵsupportsWebAnimations, ɵvalidateStyleProperty */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; __webpack_require__.r(__webpack_exports__); /* WEBPACK VAR INJECTION */(function(process) {/* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "AnimationDriver", function() { return AnimationDriver; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵAnimation", function() { return Animation; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵAnimationEngine", function() { return AnimationEngine; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵAnimationStyleNormalizer", function() { return AnimationStyleNormalizer; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵCssKeyframesDriver", function() { return CssKeyframesDriver; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵCssKeyframesPlayer", function() { return CssKeyframesPlayer; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵNoopAnimationDriver", function() { return NoopAnimationDriver; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵNoopAnimationStyleNormalizer", function() { return NoopAnimationStyleNormalizer; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵWebAnimationsDriver", function() { return WebAnimationsDriver; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵWebAnimationsPlayer", function() { return WebAnimationsPlayer; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵWebAnimationsStyleNormalizer", function() { return WebAnimationsStyleNormalizer; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵallowPreviousPlayerStylesMerge", function() { return allowPreviousPlayerStylesMerge; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_animations_browser_browser_a", function() { return SpecialCasedStyles; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵcontainsElement", function() { return containsElement; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵinvokeQuery", function() { return invokeQuery; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵmatchesElement", function() { return matchesElement; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵsupportsWebAnimations", function() { return supportsWebAnimations; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵvalidateStyleProperty", function() { return validateStyleProperty; }); /* harmony import */ var _angular_animations__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @angular/animations */ "./node_modules/@angular/animations/__ivy_ngcc__/fesm2015/animations.js"); /* harmony import */ var _angular_core__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! @angular/core */ "./node_modules/@angular/core/__ivy_ngcc__/fesm2015/core.js"); /** * @license Angular v10.2.4 * (c) 2010-2020 Google LLC. https://angular.io/ * License: MIT */ /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ function isBrowser() { return (typeof window !== 'undefined' && typeof window.document !== 'undefined'); } function isNode() { // Checking only for `process` isn't enough to identify whether or not we're in a Node // environment, because Webpack by default will polyfill the `process`. While we can discern // that Webpack polyfilled it by looking at `process.browser`, it's very Webpack-specific and // might not be future-proof. Instead we look at the stringified version of `process` which // is `[object process]` in Node and `[object Object]` when polyfilled. return typeof process !== 'undefined' && {}.toString.call(process) === '[object process]'; } function optimizeGroupPlayer(players) { switch (players.length) { case 0: return new _angular_animations__WEBPACK_IMPORTED_MODULE_0__["NoopAnimationPlayer"](); case 1: return players[0]; default: return new _angular_animations__WEBPACK_IMPORTED_MODULE_0__["ɵAnimationGroupPlayer"](players); } } function normalizeKeyframes(driver, normalizer, element, keyframes, preStyles = {}, postStyles = {}) { const errors = []; const normalizedKeyframes = []; let previousOffset = -1; let previousKeyframe = null; keyframes.forEach(kf => { const offset = kf['offset']; const isSameOffset = offset == previousOffset; const normalizedKeyframe = (isSameOffset && previousKeyframe) || {}; Object.keys(kf).forEach(prop => { let normalizedProp = prop; let normalizedValue = kf[prop]; if (prop !== 'offset') { normalizedProp = normalizer.normalizePropertyName(normalizedProp, errors); switch (normalizedValue) { case _angular_animations__WEBPACK_IMPORTED_MODULE_0__["ɵPRE_STYLE"]: normalizedValue = preStyles[prop]; break; case _angular_animations__WEBPACK_IMPORTED_MODULE_0__["AUTO_STYLE"]: normalizedValue = postStyles[prop]; break; default: normalizedValue = normalizer.normalizeStyleValue(prop, normalizedProp, normalizedValue, errors); break; } } normalizedKeyframe[normalizedProp] = normalizedValue; }); if (!isSameOffset) { normalizedKeyframes.push(normalizedKeyframe); } previousKeyframe = normalizedKeyframe; previousOffset = offset; }); if (errors.length) { const LINE_START = '\n - '; throw new Error(`Unable to animate due to the following errors:${LINE_START}${errors.join(LINE_START)}`); } return normalizedKeyframes; } function listenOnPlayer(player, eventName, event, callback) { switch (eventName) { case 'start': player.onStart(() => callback(event && copyAnimationEvent(event, 'start', player))); break; case 'done': player.onDone(() => callback(event && copyAnimationEvent(event, 'done', player))); break; case 'destroy': player.onDestroy(() => callback(event && copyAnimationEvent(event, 'destroy', player))); break; } } function copyAnimationEvent(e, phaseName, player) { const totalTime = player.totalTime; const disabled = player.disabled ? true : false; const event = makeAnimationEvent(e.element, e.triggerName, e.fromState, e.toState, phaseName || e.phaseName, totalTime == undefined ? e.totalTime : totalTime, disabled); const data = e['_data']; if (data != null) { event['_data'] = data; } return event; } function makeAnimationEvent(element, triggerName, fromState, toState, phaseName = '', totalTime = 0, disabled) { return { element, triggerName, fromState, toState, phaseName, totalTime, disabled: !!disabled }; } function getOrSetAsInMap(map, key, defaultValue) { let value; if (map instanceof Map) { value = map.get(key); if (!value) { map.set(key, value = defaultValue); } } else { value = map[key]; if (!value) { value = map[key] = defaultValue; } } return value; } function parseTimelineCommand(command) { const separatorPos = command.indexOf(':'); const id = command.substring(1, separatorPos); const action = command.substr(separatorPos + 1); return [id, action]; } let _contains = (elm1, elm2) => false; const ɵ0 = _contains; let _matches = (element, selector) => false; const ɵ1 = _matches; let _query = (element, selector, multi) => { return []; }; const ɵ2 = _query; // Define utility methods for browsers and platform-server(domino) where Element // and utility methods exist. const _isNode = isNode(); if (_isNode || typeof Element !== 'undefined') { // this is well supported in all browsers _contains = (elm1, elm2) => { return elm1.contains(elm2); }; _matches = (() => { if (_isNode || Element.prototype.matches) { return (element, selector) => element.matches(selector); } else { const proto = Element.prototype; const fn = proto.matchesSelector || proto.mozMatchesSelector || proto.msMatchesSelector || proto.oMatchesSelector || proto.webkitMatchesSelector; if (fn) { return (element, selector) => fn.apply(element, [selector]); } else { return _matches; } } })(); _query = (element, selector, multi) => { let results = []; if (multi) { results.push(...element.querySelectorAll(selector)); } else { const elm = element.querySelector(selector); if (elm) { results.push(elm); } } return results; }; } function containsVendorPrefix(prop) { // Webkit is the only real popular vendor prefix nowadays // cc: http://shouldiprefix.com/ return prop.substring(1, 6) == 'ebkit'; // webkit or Webkit } let _CACHED_BODY = null; let _IS_WEBKIT = false; function validateStyleProperty(prop) { if (!_CACHED_BODY) { _CACHED_BODY = getBodyNode() || {}; _IS_WEBKIT = _CACHED_BODY.style ? ('WebkitAppearance' in _CACHED_BODY.style) : false; } let result = true; if (_CACHED_BODY.style && !containsVendorPrefix(prop)) { result = prop in _CACHED_BODY.style; if (!result && _IS_WEBKIT) { const camelProp = 'Webkit' + prop.charAt(0).toUpperCase() + prop.substr(1); result = camelProp in _CACHED_BODY.style; } } return result; } function getBodyNode() { if (typeof document != 'undefined') { return document.body; } return null; } const matchesElement = _matches; const containsElement = _contains; const invokeQuery = _query; function hypenatePropsObject(object) { const newObj = {}; Object.keys(object).forEach(prop => { const newProp = prop.replace(/([a-z])([A-Z])/g, '$1-$2'); newObj[newProp] = object[prop]; }); return newObj; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @publicApi */ class NoopAnimationDriver { validateStyleProperty(prop) { return validateStyleProperty(prop); } matchesElement(element, selector) { return matchesElement(element, selector); } containsElement(elm1, elm2) { return containsElement(elm1, elm2); } query(element, selector, multi) { return invokeQuery(element, selector, multi); } computeStyle(element, prop, defaultValue) { return defaultValue || ''; } animate(element, keyframes, duration, delay, easing, previousPlayers = [], scrubberAccessRequested) { return new _angular_animations__WEBPACK_IMPORTED_MODULE_0__["NoopAnimationPlayer"](duration, delay); } } NoopAnimationDriver.ɵfac = function NoopAnimationDriver_Factory(t) { return new (t || NoopAnimationDriver)(); }; NoopAnimationDriver.ɵprov = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjectable"]({ token: NoopAnimationDriver, factory: NoopAnimationDriver.ɵfac }); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](NoopAnimationDriver, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Injectable"] }], null, null); })(); /** * @publicApi */ class AnimationDriver { } AnimationDriver.NOOP = new NoopAnimationDriver(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ const ONE_SECOND = 1000; const SUBSTITUTION_EXPR_START = '{{'; const SUBSTITUTION_EXPR_END = '}}'; const ENTER_CLASSNAME = 'ng-enter'; const LEAVE_CLASSNAME = 'ng-leave'; const ENTER_SELECTOR = '.ng-enter'; const LEAVE_SELECTOR = '.ng-leave'; const NG_TRIGGER_CLASSNAME = 'ng-trigger'; const NG_TRIGGER_SELECTOR = '.ng-trigger'; const NG_ANIMATING_CLASSNAME = 'ng-animating'; const NG_ANIMATING_SELECTOR = '.ng-animating'; function resolveTimingValue(value) { if (typeof value == 'number') return value; const matches = value.match(/^(-?[\.\d]+)(m?s)/); if (!matches || matches.length < 2) return 0; return _convertTimeValueToMS(parseFloat(matches[1]), matches[2]); } function _convertTimeValueToMS(value, unit) { switch (unit) { case 's': return value * ONE_SECOND; default: // ms or something else return value; } } function resolveTiming(timings, errors, allowNegativeValues) { return timings.hasOwnProperty('duration') ? timings : parseTimeExpression(timings, errors, allowNegativeValues); } function parseTimeExpression(exp, errors, allowNegativeValues) { const regex = /^(-?[\.\d]+)(m?s)(?:\s+(-?[\.\d]+)(m?s))?(?:\s+([-a-z]+(?:\(.+?\))?))?$/i; let duration; let delay = 0; let easing = ''; if (typeof exp === 'string') { const matches = exp.match(regex); if (matches === null) { errors.push(`The provided timing value "${exp}" is invalid.`); return { duration: 0, delay: 0, easing: '' }; } duration = _convertTimeValueToMS(parseFloat(matches[1]), matches[2]); const delayMatch = matches[3]; if (delayMatch != null) { delay = _convertTimeValueToMS(parseFloat(delayMatch), matches[4]); } const easingVal = matches[5]; if (easingVal) { easing = easingVal; } } else { duration = exp; } if (!allowNegativeValues) { let containsErrors = false; let startIndex = errors.length; if (duration < 0) { errors.push(`Duration values below 0 are not allowed for this animation step.`); containsErrors = true; } if (delay < 0) { errors.push(`Delay values below 0 are not allowed for this animation step.`); containsErrors = true; } if (containsErrors) { errors.splice(startIndex, 0, `The provided timing value "${exp}" is invalid.`); } } return { duration, delay, easing }; } function copyObj(obj, destination = {}) { Object.keys(obj).forEach(prop => { destination[prop] = obj[prop]; }); return destination; } function normalizeStyles(styles) { const normalizedStyles = {}; if (Array.isArray(styles)) { styles.forEach(data => copyStyles(data, false, normalizedStyles)); } else { copyStyles(styles, false, normalizedStyles); } return normalizedStyles; } function copyStyles(styles, readPrototype, destination = {}) { if (readPrototype) { // we make use of a for-in loop so that the // prototypically inherited properties are // revealed from the backFill map for (let prop in styles) { destination[prop] = styles[prop]; } } else { copyObj(styles, destination); } return destination; } function getStyleAttributeString(element, key, value) { // Return the key-value pair string to be added to the style attribute for the // given CSS style key. if (value) { return key + ':' + value + ';'; } else { return ''; } } function writeStyleAttribute(element) { // Read the style property of the element and manually reflect it to the // style attribute. This is needed because Domino on platform-server doesn't // understand the full set of allowed CSS properties and doesn't reflect some // of them automatically. let styleAttrValue = ''; for (let i = 0; i < element.style.length; i++) { const key = element.style.item(i); styleAttrValue += getStyleAttributeString(element, key, element.style.getPropertyValue(key)); } for (const key in element.style) { // Skip internal Domino properties that don't need to be reflected. if (!element.style.hasOwnProperty(key) || key.startsWith('_')) { continue; } const dashKey = camelCaseToDashCase(key); styleAttrValue += getStyleAttributeString(element, dashKey, element.style[key]); } element.setAttribute('style', styleAttrValue); } function setStyles(element, styles, formerStyles) { if (element['style']) { Object.keys(styles).forEach(prop => { const camelProp = dashCaseToCamelCase(prop); if (formerStyles && !formerStyles.hasOwnProperty(prop)) { formerStyles[prop] = element.style[camelProp]; } element.style[camelProp] = styles[prop]; }); // On the server set the 'style' attribute since it's not automatically reflected. if (isNode()) { writeStyleAttribute(element); } } } function eraseStyles(element, styles) { if (element['style']) { Object.keys(styles).forEach(prop => { const camelProp = dashCaseToCamelCase(prop); element.style[camelProp] = ''; }); // On the server set the 'style' attribute since it's not automatically reflected. if (isNode()) { writeStyleAttribute(element); } } } function normalizeAnimationEntry(steps) { if (Array.isArray(steps)) { if (steps.length == 1) return steps[0]; return Object(_angular_animations__WEBPACK_IMPORTED_MODULE_0__["sequence"])(steps); } return steps; } function validateStyleParams(value, options, errors) { const params = options.params || {}; const matches = extractStyleParams(value); if (matches.length) { matches.forEach(varName => { if (!params.hasOwnProperty(varName)) { errors.push(`Unable to resolve the local animation param ${varName} in the given list of values`); } }); } } const PARAM_REGEX = new RegExp(`${SUBSTITUTION_EXPR_START}\\s*(.+?)\\s*${SUBSTITUTION_EXPR_END}`, 'g'); function extractStyleParams(value) { let params = []; if (typeof value === 'string') { let match; while (match = PARAM_REGEX.exec(value)) { params.push(match[1]); } PARAM_REGEX.lastIndex = 0; } return params; } function interpolateParams(value, params, errors) { const original = value.toString(); const str = original.replace(PARAM_REGEX, (_, varName) => { let localVal = params[varName]; // this means that the value was never overridden by the data passed in by the user if (!params.hasOwnProperty(varName)) { errors.push(`Please provide a value for the animation param ${varName}`); localVal = ''; } return localVal.toString(); }); // we do this to assert that numeric values stay as they are return str == original ? value : str; } function iteratorToArray(iterator) { const arr = []; let item = iterator.next(); while (!item.done) { arr.push(item.value); item = iterator.next(); } return arr; } function mergeAnimationOptions(source, destination) { if (source.params) { const p0 = source.params; if (!destination.params) { destination.params = {}; } const p1 = destination.params; Object.keys(p0).forEach(param => { if (!p1.hasOwnProperty(param)) { p1[param] = p0[param]; } }); } return destination; } const DASH_CASE_REGEXP = /-+([a-z0-9])/g; function dashCaseToCamelCase(input) { return input.replace(DASH_CASE_REGEXP, (...m) => m[1].toUpperCase()); } function camelCaseToDashCase(input) { return input.replace(/([a-z])([A-Z])/g, '$1-$2').toLowerCase(); } function allowPreviousPlayerStylesMerge(duration, delay) { return duration === 0 || delay === 0; } function balancePreviousStylesIntoKeyframes(element, keyframes, previousStyles) { const previousStyleProps = Object.keys(previousStyles); if (previousStyleProps.length && keyframes.length) { let startingKeyframe = keyframes[0]; let missingStyleProps = []; previousStyleProps.forEach(prop => { if (!startingKeyframe.hasOwnProperty(prop)) { missingStyleProps.push(prop); } startingKeyframe[prop] = previousStyles[prop]; }); if (missingStyleProps.length) { // tslint:disable-next-line for (var i = 1; i < keyframes.length; i++) { let kf = keyframes[i]; missingStyleProps.forEach(function (prop) { kf[prop] = computeStyle(element, prop); }); } } } return keyframes; } function visitDslNode(visitor, node, context) { switch (node.type) { case 7 /* Trigger */: return visitor.visitTrigger(node, context); case 0 /* State */: return visitor.visitState(node, context); case 1 /* Transition */: return visitor.visitTransition(node, context); case 2 /* Sequence */: return visitor.visitSequence(node, context); case 3 /* Group */: return visitor.visitGroup(node, context); case 4 /* Animate */: return visitor.visitAnimate(node, context); case 5 /* Keyframes */: return visitor.visitKeyframes(node, context); case 6 /* Style */: return visitor.visitStyle(node, context); case 8 /* Reference */: return visitor.visitReference(node, context); case 9 /* AnimateChild */: return visitor.visitAnimateChild(node, context); case 10 /* AnimateRef */: return visitor.visitAnimateRef(node, context); case 11 /* Query */: return visitor.visitQuery(node, context); case 12 /* Stagger */: return visitor.visitStagger(node, context); default: throw new Error(`Unable to resolve animation metadata node #${node.type}`); } } function computeStyle(element, prop) { return window.getComputedStyle(element)[prop]; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ const ANY_STATE = '*'; function parseTransitionExpr(transitionValue, errors) { const expressions = []; if (typeof transitionValue == 'string') { transitionValue.split(/\s*,\s*/).forEach(str => parseInnerTransitionStr(str, expressions, errors)); } else { expressions.push(transitionValue); } return expressions; } function parseInnerTransitionStr(eventStr, expressions, errors) { if (eventStr[0] == ':') { const result = parseAnimationAlias(eventStr, errors); if (typeof result == 'function') { expressions.push(result); return; } eventStr = result; } const match = eventStr.match(/^(\*|[-\w]+)\s*()\s*(\*|[-\w]+)$/); if (match == null || match.length < 4) { errors.push(`The provided transition expression "${eventStr}" is not supported`); return expressions; } const fromState = match[1]; const separator = match[2]; const toState = match[3]; expressions.push(makeLambdaFromStates(fromState, toState)); const isFullAnyStateExpr = fromState == ANY_STATE && toState == ANY_STATE; if (separator[0] == '<' && !isFullAnyStateExpr) { expressions.push(makeLambdaFromStates(toState, fromState)); } } function parseAnimationAlias(alias, errors) { switch (alias) { case ':enter': return 'void => *'; case ':leave': return '* => void'; case ':increment': return (fromState, toState) => parseFloat(toState) > parseFloat(fromState); case ':decrement': return (fromState, toState) => parseFloat(toState) < parseFloat(fromState); default: errors.push(`The transition alias value "${alias}" is not supported`); return '* => *'; } } // DO NOT REFACTOR ... keep the follow set instantiations // with the values intact (closure compiler for some reason // removes follow-up lines that add the values outside of // the constructor... const TRUE_BOOLEAN_VALUES = new Set(['true', '1']); const FALSE_BOOLEAN_VALUES = new Set(['false', '0']); function makeLambdaFromStates(lhs, rhs) { const LHS_MATCH_BOOLEAN = TRUE_BOOLEAN_VALUES.has(lhs) || FALSE_BOOLEAN_VALUES.has(lhs); const RHS_MATCH_BOOLEAN = TRUE_BOOLEAN_VALUES.has(rhs) || FALSE_BOOLEAN_VALUES.has(rhs); return (fromState, toState) => { let lhsMatch = lhs == ANY_STATE || lhs == fromState; let rhsMatch = rhs == ANY_STATE || rhs == toState; if (!lhsMatch && LHS_MATCH_BOOLEAN && typeof fromState === 'boolean') { lhsMatch = fromState ? TRUE_BOOLEAN_VALUES.has(lhs) : FALSE_BOOLEAN_VALUES.has(lhs); } if (!rhsMatch && RHS_MATCH_BOOLEAN && typeof toState === 'boolean') { rhsMatch = toState ? TRUE_BOOLEAN_VALUES.has(rhs) : FALSE_BOOLEAN_VALUES.has(rhs); } return lhsMatch && rhsMatch; }; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ const SELF_TOKEN = ':self'; const SELF_TOKEN_REGEX = new RegExp(`\s*${SELF_TOKEN}\s*,?`, 'g'); /* * [Validation] * The visitor code below will traverse the animation AST generated by the animation verb functions * (the output is a tree of objects) and attempt to perform a series of validations on the data. The * following corner-cases will be validated: * * 1. Overlap of animations * Given that a CSS property cannot be animated in more than one place at the same time, it's * important that this behavior is detected and validated. The way in which this occurs is that * each time a style property is examined, a string-map containing the property will be updated with * the start and end times for when the property is used within an animation step. * * If there are two or more parallel animations that are currently running (these are invoked by the * group()) on the same element then the validator will throw an error. Since the start/end timing * values are collected for each property then if the current animation step is animating the same * property and its timing values fall anywhere into the window of time that the property is * currently being animated within then this is what causes an error. * * 2. Timing values * The validator will validate to see if a timing value of `duration delay easing` or * `durationNumber` is valid or not. * * (note that upon validation the code below will replace the timing data with an object containing * {duration,delay,easing}. * * 3. Offset Validation * Each of the style() calls are allowed to have an offset value when placed inside of keyframes(). * Offsets within keyframes() are considered valid when: * * - No offsets are used at all * - Each style() entry contains an offset value * - Each offset is between 0 and 1 * - Each offset is greater to or equal than the previous one * * Otherwise an error will be thrown. */ function buildAnimationAst(driver, metadata, errors) { return new AnimationAstBuilderVisitor(driver).build(metadata, errors); } const ROOT_SELECTOR = ''; class AnimationAstBuilderVisitor { constructor(_driver) { this._driver = _driver; } build(metadata, errors) { const context = new AnimationAstBuilderContext(errors); this._resetContextStyleTimingState(context); return visitDslNode(this, normalizeAnimationEntry(metadata), context); } _resetContextStyleTimingState(context) { context.currentQuerySelector = ROOT_SELECTOR; context.collectedStyles = {}; context.collectedStyles[ROOT_SELECTOR] = {}; context.currentTime = 0; } visitTrigger(metadata, context) { let queryCount = context.queryCount = 0; let depCount = context.depCount = 0; const states = []; const transitions = []; if (metadata.name.charAt(0) == '@') { context.errors.push('animation triggers cannot be prefixed with an `@` sign (e.g. trigger(\'@foo\', [...]))'); } metadata.definitions.forEach(def => { this._resetContextStyleTimingState(context); if (def.type == 0 /* State */) { const stateDef = def; const name = stateDef.name; name.toString().split(/\s*,\s*/).forEach(n => { stateDef.name = n; states.push(this.visitState(stateDef, context)); }); stateDef.name = name; } else if (def.type == 1 /* Transition */) { const transition = this.visitTransition(def, context); queryCount += transition.queryCount; depCount += transition.depCount; transitions.push(transition); } else { context.errors.push('only state() and transition() definitions can sit inside of a trigger()'); } }); return { type: 7 /* Trigger */, name: metadata.name, states, transitions, queryCount, depCount, options: null }; } visitState(metadata, context) { const styleAst = this.visitStyle(metadata.styles, context); const astParams = (metadata.options && metadata.options.params) || null; if (styleAst.containsDynamicStyles) { const missingSubs = new Set(); const params = astParams || {}; styleAst.styles.forEach(value => { if (isObject(value)) { const stylesObj = value; Object.keys(stylesObj).forEach(prop => { extractStyleParams(stylesObj[prop]).forEach(sub => { if (!params.hasOwnProperty(sub)) { missingSubs.add(sub); } }); }); } }); if (missingSubs.size) { const missingSubsArr = iteratorToArray(missingSubs.values()); context.errors.push(`state("${metadata .name}", ...) must define default values for all the following style substitutions: ${missingSubsArr.join(', ')}`); } } return { type: 0 /* State */, name: metadata.name, style: styleAst, options: astParams ? { params: astParams } : null }; } visitTransition(metadata, context) { context.queryCount = 0; context.depCount = 0; const animation = visitDslNode(this, normalizeAnimationEntry(metadata.animation), context); const matchers = parseTransitionExpr(metadata.expr, context.errors); return { type: 1 /* Transition */, matchers, animation, queryCount: context.queryCount, depCount: context.depCount, options: normalizeAnimationOptions(metadata.options) }; } visitSequence(metadata, context) { return { type: 2 /* Sequence */, steps: metadata.steps.map(s => visitDslNode(this, s, context)), options: normalizeAnimationOptions(metadata.options) }; } visitGroup(metadata, context) { const currentTime = context.currentTime; let furthestTime = 0; const steps = metadata.steps.map(step => { context.currentTime = currentTime; const innerAst = visitDslNode(this, step, context); furthestTime = Math.max(furthestTime, context.currentTime); return innerAst; }); context.currentTime = furthestTime; return { type: 3 /* Group */, steps, options: normalizeAnimationOptions(metadata.options) }; } visitAnimate(metadata, context) { const timingAst = constructTimingAst(metadata.timings, context.errors); context.currentAnimateTimings = timingAst; let styleAst; let styleMetadata = metadata.styles ? metadata.styles : Object(_angular_animations__WEBPACK_IMPORTED_MODULE_0__["style"])({}); if (styleMetadata.type == 5 /* Keyframes */) { styleAst = this.visitKeyframes(styleMetadata, context); } else { let styleMetadata = metadata.styles; let isEmpty = false; if (!styleMetadata) { isEmpty = true; const newStyleData = {}; if (timingAst.easing) { newStyleData['easing'] = timingAst.easing; } styleMetadata = Object(_angular_animations__WEBPACK_IMPORTED_MODULE_0__["style"])(newStyleData); } context.currentTime += timingAst.duration + timingAst.delay; const _styleAst = this.visitStyle(styleMetadata, context); _styleAst.isEmptyStep = isEmpty; styleAst = _styleAst; } context.currentAnimateTimings = null; return { type: 4 /* Animate */, timings: timingAst, style: styleAst, options: null }; } visitStyle(metadata, context) { const ast = this._makeStyleAst(metadata, context); this._validateStyleAst(ast, context); return ast; } _makeStyleAst(metadata, context) { const styles = []; if (Array.isArray(metadata.styles)) { metadata.styles.forEach(styleTuple => { if (typeof styleTuple == 'string') { if (styleTuple == _angular_animations__WEBPACK_IMPORTED_MODULE_0__["AUTO_STYLE"]) { styles.push(styleTuple); } else { context.errors.push(`The provided style string value ${styleTuple} is not allowed.`); } } else { styles.push(styleTuple); } }); } else { styles.push(metadata.styles); } let containsDynamicStyles = false; let collectedEasing = null; styles.forEach(styleData => { if (isObject(styleData)) { const styleMap = styleData; const easing = styleMap['easing']; if (easing) { collectedEasing = easing; delete styleMap['easing']; } if (!containsDynamicStyles) { for (let prop in styleMap) { const value = styleMap[prop]; if (value.toString().indexOf(SUBSTITUTION_EXPR_START) >= 0) { containsDynamicStyles = true; break; } } } } }); return { type: 6 /* Style */, styles, easing: collectedEasing, offset: metadata.offset, containsDynamicStyles, options: null }; } _validateStyleAst(ast, context) { const timings = context.currentAnimateTimings; let endTime = context.currentTime; let startTime = context.currentTime; if (timings && startTime > 0) { startTime -= timings.duration + timings.delay; } ast.styles.forEach(tuple => { if (typeof tuple == 'string') return; Object.keys(tuple).forEach(prop => { if (!this._driver.validateStyleProperty(prop)) { context.errors.push(`The provided animation property "${prop}" is not a supported CSS property for animations`); return; } const collectedStyles = context.collectedStyles[context.currentQuerySelector]; const collectedEntry = collectedStyles[prop]; let updateCollectedStyle = true; if (collectedEntry) { if (startTime != endTime && startTime >= collectedEntry.startTime && endTime <= collectedEntry.endTime) { context.errors.push(`The CSS property "${prop}" that exists between the times of "${collectedEntry.startTime}ms" and "${collectedEntry .endTime}ms" is also being animated in a parallel animation between the times of "${startTime}ms" and "${endTime}ms"`); updateCollectedStyle = false; } // we always choose the smaller start time value since we // want to have a record of the entire animation window where // the style property is being animated in between startTime = collectedEntry.startTime; } if (updateCollectedStyle) { collectedStyles[prop] = { startTime, endTime }; } if (context.options) { validateStyleParams(tuple[prop], context.options, context.errors); } }); }); } visitKeyframes(metadata, context) { const ast = { type: 5 /* Keyframes */, styles: [], options: null }; if (!context.currentAnimateTimings) { context.errors.push(`keyframes() must be placed inside of a call to animate()`); return ast; } const MAX_KEYFRAME_OFFSET = 1; let totalKeyframesWithOffsets = 0; const offsets = []; let offsetsOutOfOrder = false; let keyframesOutOfRange = false; let previousOffset = 0; const keyframes = metadata.steps.map(styles => { const style = this._makeStyleAst(styles, context); let offsetVal = style.offset != null ? style.offset : consumeOffset(style.styles); let offset = 0; if (offsetVal != null) { totalKeyframesWithOffsets++; offset = style.offset = offsetVal; } keyframesOutOfRange = keyframesOutOfRange || offset < 0 || offset > 1; offsetsOutOfOrder = offsetsOutOfOrder || offset < previousOffset; previousOffset = offset; offsets.push(offset); return style; }); if (keyframesOutOfRange) { context.errors.push(`Please ensure that all keyframe offsets are between 0 and 1`); } if (offsetsOutOfOrder) { context.errors.push(`Please ensure that all keyframe offsets are in order`); } const length = metadata.steps.length; let generatedOffset = 0; if (totalKeyframesWithOffsets > 0 && totalKeyframesWithOffsets < length) { context.errors.push(`Not all style() steps within the declared keyframes() contain offsets`); } else if (totalKeyframesWithOffsets == 0) { generatedOffset = MAX_KEYFRAME_OFFSET / (length - 1); } const limit = length - 1; const currentTime = context.currentTime; const currentAnimateTimings = context.currentAnimateTimings; const animateDuration = currentAnimateTimings.duration; keyframes.forEach((kf, i) => { const offset = generatedOffset > 0 ? (i == limit ? 1 : (generatedOffset * i)) : offsets[i]; const durationUpToThisFrame = offset * animateDuration; context.currentTime = currentTime + currentAnimateTimings.delay + durationUpToThisFrame; currentAnimateTimings.duration = durationUpToThisFrame; this._validateStyleAst(kf, context); kf.offset = offset; ast.styles.push(kf); }); return ast; } visitReference(metadata, context) { return { type: 8 /* Reference */, animation: visitDslNode(this, normalizeAnimationEntry(metadata.animation), context), options: normalizeAnimationOptions(metadata.options) }; } visitAnimateChild(metadata, context) { context.depCount++; return { type: 9 /* AnimateChild */, options: normalizeAnimationOptions(metadata.options) }; } visitAnimateRef(metadata, context) { return { type: 10 /* AnimateRef */, animation: this.visitReference(metadata.animation, context), options: normalizeAnimationOptions(metadata.options) }; } visitQuery(metadata, context) { const parentSelector = context.currentQuerySelector; const options = (metadata.options || {}); context.queryCount++; context.currentQuery = metadata; const [selector, includeSelf] = normalizeSelector(metadata.selector); context.currentQuerySelector = parentSelector.length ? (parentSelector + ' ' + selector) : selector; getOrSetAsInMap(context.collectedStyles, context.currentQuerySelector, {}); const animation = visitDslNode(this, normalizeAnimationEntry(metadata.animation), context); context.currentQuery = null; context.currentQuerySelector = parentSelector; return { type: 11 /* Query */, selector, limit: options.limit || 0, optional: !!options.optional, includeSelf, animation, originalSelector: metadata.selector, options: normalizeAnimationOptions(metadata.options) }; } visitStagger(metadata, context) { if (!context.currentQuery) { context.errors.push(`stagger() can only be used inside of query()`); } const timings = metadata.timings === 'full' ? { duration: 0, delay: 0, easing: 'full' } : resolveTiming(metadata.timings, context.errors, true); return { type: 12 /* Stagger */, animation: visitDslNode(this, normalizeAnimationEntry(metadata.animation), context), timings, options: null }; } } function normalizeSelector(selector) { const hasAmpersand = selector.split(/\s*,\s*/).find(token => token == SELF_TOKEN) ? true : false; if (hasAmpersand) { selector = selector.replace(SELF_TOKEN_REGEX, ''); } // the :enter and :leave selectors are filled in at runtime during timeline building selector = selector.replace(/@\*/g, NG_TRIGGER_SELECTOR) .replace(/@\w+/g, match => NG_TRIGGER_SELECTOR + '-' + match.substr(1)) .replace(/:animating/g, NG_ANIMATING_SELECTOR); return [selector, hasAmpersand]; } function normalizeParams(obj) { return obj ? copyObj(obj) : null; } class AnimationAstBuilderContext { constructor(errors) { this.errors = errors; this.queryCount = 0; this.depCount = 0; this.currentTransition = null; this.currentQuery = null; this.currentQuerySelector = null; this.currentAnimateTimings = null; this.currentTime = 0; this.collectedStyles = {}; this.options = null; } } function consumeOffset(styles) { if (typeof styles == 'string') return null; let offset = null; if (Array.isArray(styles)) { styles.forEach(styleTuple => { if (isObject(styleTuple) && styleTuple.hasOwnProperty('offset')) { const obj = styleTuple; offset = parseFloat(obj['offset']); delete obj['offset']; } }); } else if (isObject(styles) && styles.hasOwnProperty('offset')) { const obj = styles; offset = parseFloat(obj['offset']); delete obj['offset']; } return offset; } function isObject(value) { return !Array.isArray(value) && typeof value == 'object'; } function constructTimingAst(value, errors) { let timings = null; if (value.hasOwnProperty('duration')) { timings = value; } else if (typeof value == 'number') { const duration = resolveTiming(value, errors).duration; return makeTimingAst(duration, 0, ''); } const strValue = value; const isDynamic = strValue.split(/\s+/).some(v => v.charAt(0) == '{' && v.charAt(1) == '{'); if (isDynamic) { const ast = makeTimingAst(0, 0, ''); ast.dynamic = true; ast.strValue = strValue; return ast; } timings = timings || resolveTiming(strValue, errors); return makeTimingAst(timings.duration, timings.delay, timings.easing); } function normalizeAnimationOptions(options) { if (options) { options = copyObj(options); if (options['params']) { options['params'] = normalizeParams(options['params']); } } else { options = {}; } return options; } function makeTimingAst(duration, delay, easing) { return { duration, delay, easing }; } function createTimelineInstruction(element, keyframes, preStyleProps, postStyleProps, duration, delay, easing = null, subTimeline = false) { return { type: 1 /* TimelineAnimation */, element, keyframes, preStyleProps, postStyleProps, duration, delay, totalTime: duration + delay, easing, subTimeline }; } class ElementInstructionMap { constructor() { this._map = new Map(); } consume(element) { let instructions = this._map.get(element); if (instructions) { this._map.delete(element); } else { instructions = []; } return instructions; } append(element, instructions) { let existingInstructions = this._map.get(element); if (!existingInstructions) { this._map.set(element, existingInstructions = []); } existingInstructions.push(...instructions); } has(element) { return this._map.has(element); } clear() { this._map.clear(); } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ const ONE_FRAME_IN_MILLISECONDS = 1; const ENTER_TOKEN = ':enter'; const ENTER_TOKEN_REGEX = new RegExp(ENTER_TOKEN, 'g'); const LEAVE_TOKEN = ':leave'; const LEAVE_TOKEN_REGEX = new RegExp(LEAVE_TOKEN, 'g'); /* * The code within this file aims to generate web-animations-compatible keyframes from Angular's * animation DSL code. * * The code below will be converted from: * * ``` * sequence([ * style({ opacity: 0 }), * animate(1000, style({ opacity: 0 })) * ]) * ``` * * To: * ``` * keyframes = [{ opacity: 0, offset: 0 }, { opacity: 1, offset: 1 }] * duration = 1000 * delay = 0 * easing = '' * ``` * * For this operation to cover the combination of animation verbs (style, animate, group, etc...) a * combination of prototypical inheritance, AST traversal and merge-sort-like algorithms are used. * * [AST Traversal] * Each of the animation verbs, when executed, will return an string-map object representing what * type of action it is (style, animate, group, etc...) and the data associated with it. This means * that when functional composition mix of these functions is evaluated (like in the example above) * then it will end up producing a tree of objects representing the animation itself. * * When this animation object tree is processed by the visitor code below it will visit each of the * verb statements within the visitor. And during each visit it will build the context of the * animation keyframes by interacting with the `TimelineBuilder`. * * [TimelineBuilder] * This class is responsible for tracking the styles and building a series of keyframe objects for a * timeline between a start and end time. The builder starts off with an initial timeline and each * time the AST comes across a `group()`, `keyframes()` or a combination of the two wihtin a * `sequence()` then it will generate a sub timeline for each step as well as a new one after * they are complete. * * As the AST is traversed, the timing state on each of the timelines will be incremented. If a sub * timeline was created (based on one of the cases above) then the parent timeline will attempt to * merge the styles used within the sub timelines into itself (only with group() this will happen). * This happens with a merge operation (much like how the merge works in mergesort) and it will only * copy the most recently used styles from the sub timelines into the parent timeline. This ensures * that if the styles are used later on in another phase of the animation then they will be the most * up-to-date values. * * [How Missing Styles Are Updated] * Each timeline has a `backFill` property which is responsible for filling in new styles into * already processed keyframes if a new style shows up later within the animation sequence. * * ``` * sequence([ * style({ width: 0 }), * animate(1000, style({ width: 100 })), * animate(1000, style({ width: 200 })), * animate(1000, style({ width: 300 })) * animate(1000, style({ width: 400, height: 400 })) // notice how `height` doesn't exist anywhere * else * ]) * ``` * * What is happening here is that the `height` value is added later in the sequence, but is missing * from all previous animation steps. Therefore when a keyframe is created it would also be missing * from all previous keyframes up until where it is first used. For the timeline keyframe generation * to properly fill in the style it will place the previous value (the value from the parent * timeline) or a default value of `*` into the backFill object. Given that each of the keyframe * styles are objects that prototypically inhert from the backFill object, this means that if a * value is added into the backFill then it will automatically propagate any missing values to all * keyframes. Therefore the missing `height` value will be properly filled into the already * processed keyframes. * * When a sub-timeline is created it will have its own backFill property. This is done so that * styles present within the sub-timeline do not accidentally seep into the previous/future timeline * keyframes * * (For prototypically-inherited contents to be detected a `for(i in obj)` loop must be used.) * * [Validation] * The code in this file is not responsible for validation. That functionality happens with within * the `AnimationValidatorVisitor` code. */ function buildAnimationTimelines(driver, rootElement, ast, enterClassName, leaveClassName, startingStyles = {}, finalStyles = {}, options, subInstructions, errors = []) { return new AnimationTimelineBuilderVisitor().buildKeyframes(driver, rootElement, ast, enterClassName, leaveClassName, startingStyles, finalStyles, options, subInstructions, errors); } class AnimationTimelineBuilderVisitor { buildKeyframes(driver, rootElement, ast, enterClassName, leaveClassName, startingStyles, finalStyles, options, subInstructions, errors = []) { subInstructions = subInstructions || new ElementInstructionMap(); const context = new AnimationTimelineContext(driver, rootElement, subInstructions, enterClassName, leaveClassName, errors, []); context.options = options; context.currentTimeline.setStyles([startingStyles], null, context.errors, options); visitDslNode(this, ast, context); // this checks to see if an actual animation happened const timelines = context.timelines.filter(timeline => timeline.containsAnimation()); if (timelines.length && Object.keys(finalStyles).length) { const tl = timelines[timelines.length - 1]; if (!tl.allowOnlyTimelineStyles()) { tl.setStyles([finalStyles], null, context.errors, options); } } return timelines.length ? timelines.map(timeline => timeline.buildKeyframes()) : [createTimelineInstruction(rootElement, [], [], [], 0, 0, '', false)]; } visitTrigger(ast, context) { // these values are not visited in this AST } visitState(ast, context) { // these values are not visited in this AST } visitTransition(ast, context) { // these values are not visited in this AST } visitAnimateChild(ast, context) { const elementInstructions = context.subInstructions.consume(context.element); if (elementInstructions) { const innerContext = context.createSubContext(ast.options); const startTime = context.currentTimeline.currentTime; const endTime = this._visitSubInstructions(elementInstructions, innerContext, innerContext.options); if (startTime != endTime) { // we do this on the upper context because we created a sub context for // the sub child animations context.transformIntoNewTimeline(endTime); } } context.previousNode = ast; } visitAnimateRef(ast, context) { const innerContext = context.createSubContext(ast.options); innerContext.transformIntoNewTimeline(); this.visitReference(ast.animation, innerContext); context.transformIntoNewTimeline(innerContext.currentTimeline.currentTime); context.previousNode = ast; } _visitSubInstructions(instructions, context, options) { const startTime = context.currentTimeline.currentTime; let furthestTime = startTime; // this is a special-case for when a user wants to skip a sub // animation from being fired entirely. const duration = options.duration != null ? resolveTimingValue(options.duration) : null; const delay = options.delay != null ? resolveTimingValue(options.delay) : null; if (duration !== 0) { instructions.forEach(instruction => { const instructionTimings = context.appendInstructionToTimeline(instruction, duration, delay); furthestTime = Math.max(furthestTime, instructionTimings.duration + instructionTimings.delay); }); } return furthestTime; } visitReference(ast, context) { context.updateOptions(ast.options, true); visitDslNode(this, ast.animation, context); context.previousNode = ast; } visitSequence(ast, context) { const subContextCount = context.subContextCount; let ctx = context; const options = ast.options; if (options && (options.params || options.delay)) { ctx = context.createSubContext(options); ctx.transformIntoNewTimeline(); if (options.delay != null) { if (ctx.previousNode.type == 6 /* Style */) { ctx.currentTimeline.snapshotCurrentStyles(); ctx.previousNode = DEFAULT_NOOP_PREVIOUS_NODE; } const delay = resolveTimingValue(options.delay); ctx.delayNextStep(delay); } } if (ast.steps.length) { ast.steps.forEach(s => visitDslNode(this, s, ctx)); // this is here just incase the inner steps only contain or end with a style() call ctx.currentTimeline.applyStylesToKeyframe(); // this means that some animation function within the sequence // ended up creating a sub timeline (which means the current // timeline cannot overlap with the contents of the sequence) if (ctx.subContextCount > subContextCount) { ctx.transformIntoNewTimeline(); } } context.previousNode = ast; } visitGroup(ast, context) { const innerTimelines = []; let furthestTime = context.currentTimeline.currentTime; const delay = ast.options && ast.options.delay ? resolveTimingValue(ast.options.delay) : 0; ast.steps.forEach(s => { const innerContext = context.createSubContext(ast.options); if (delay) { innerContext.delayNextStep(delay); } visitDslNode(this, s, innerContext); furthestTime = Math.max(furthestTime, innerContext.currentTimeline.currentTime); innerTimelines.push(innerContext.currentTimeline); }); // this operation is run after the AST loop because otherwise // if the parent timeline's collected styles were updated then // it would pass in invalid data into the new-to-be forked items innerTimelines.forEach(timeline => context.currentTimeline.mergeTimelineCollectedStyles(timeline)); context.transformIntoNewTimeline(furthestTime); context.previousNode = ast; } _visitTiming(ast, context) { if (ast.dynamic) { const strValue = ast.strValue; const timingValue = context.params ? interpolateParams(strValue, context.params, context.errors) : strValue; return resolveTiming(timingValue, context.errors); } else { return { duration: ast.duration, delay: ast.delay, easing: ast.easing }; } } visitAnimate(ast, context) { const timings = context.currentAnimateTimings = this._visitTiming(ast.timings, context); const timeline = context.currentTimeline; if (timings.delay) { context.incrementTime(timings.delay); timeline.snapshotCurrentStyles(); } const style = ast.style; if (style.type == 5 /* Keyframes */) { this.visitKeyframes(style, context); } else { context.incrementTime(timings.duration); this.visitStyle(style, context); timeline.applyStylesToKeyframe(); } context.currentAnimateTimings = null; context.previousNode = ast; } visitStyle(ast, context) { const timeline = context.currentTimeline; const timings = context.currentAnimateTimings; // this is a special case for when a style() call // directly follows an animate() call (but not inside of an animate() call) if (!timings && timeline.getCurrentStyleProperties().length) { timeline.forwardFrame(); } const easing = (timings && timings.easing) || ast.easing; if (ast.isEmptyStep) { timeline.applyEmptyStep(easing); } else { timeline.setStyles(ast.styles, easing, context.errors, context.options); } context.previousNode = ast; } visitKeyframes(ast, context) { const currentAnimateTimings = context.currentAnimateTimings; const startTime = (context.currentTimeline).duration; const duration = currentAnimateTimings.duration; const innerContext = context.createSubContext(); const innerTimeline = innerContext.currentTimeline; innerTimeline.easing = currentAnimateTimings.easing; ast.styles.forEach(step => { const offset = step.offset || 0; innerTimeline.forwardTime(offset * duration); innerTimeline.setStyles(step.styles, step.easing, context.errors, context.options); innerTimeline.applyStylesToKeyframe(); }); // this will ensure that the parent timeline gets all the styles from // the child even if the new timeline below is not used context.currentTimeline.mergeTimelineCollectedStyles(innerTimeline); // we do this because the window between this timeline and the sub timeline // should ensure that the styles within are exactly the same as they were before context.transformIntoNewTimeline(startTime + duration); context.previousNode = ast; } visitQuery(ast, context) { // in the event that the first step before this is a style step we need // to ensure the styles are applied before the children are animated const startTime = context.currentTimeline.currentTime; const options = (ast.options || {}); const delay = options.delay ? resolveTimingValue(options.delay) : 0; if (delay && (context.previousNode.type === 6 /* Style */ || (startTime == 0 && context.currentTimeline.getCurrentStyleProperties().length))) { context.currentTimeline.snapshotCurrentStyles(); context.previousNode = DEFAULT_NOOP_PREVIOUS_NODE; } let furthestTime = startTime; const elms = context.invokeQuery(ast.selector, ast.originalSelector, ast.limit, ast.includeSelf, options.optional ? true : false, context.errors); context.currentQueryTotal = elms.length; let sameElementTimeline = null; elms.forEach((element, i) => { context.currentQueryIndex = i; const innerContext = context.createSubContext(ast.options, element); if (delay) { innerContext.delayNextStep(delay); } if (element === context.element) { sameElementTimeline = innerContext.currentTimeline; } visitDslNode(this, ast.animation, innerContext); // this is here just incase the inner steps only contain or end // with a style() call (which is here to signal that this is a preparatory // call to style an element before it is animated again) innerContext.currentTimeline.applyStylesToKeyframe(); const endTime = innerContext.currentTimeline.currentTime; furthestTime = Math.max(furthestTime, endTime); }); context.currentQueryIndex = 0; context.currentQueryTotal = 0; context.transformIntoNewTimeline(furthestTime); if (sameElementTimeline) { context.currentTimeline.mergeTimelineCollectedStyles(sameElementTimeline); context.currentTimeline.snapshotCurrentStyles(); } context.previousNode = ast; } visitStagger(ast, context) { const parentContext = context.parentContext; const tl = context.currentTimeline; const timings = ast.timings; const duration = Math.abs(timings.duration); const maxTime = duration * (context.currentQueryTotal - 1); let delay = duration * context.currentQueryIndex; let staggerTransformer = timings.duration < 0 ? 'reverse' : timings.easing; switch (staggerTransformer) { case 'reverse': delay = maxTime - delay; break; case 'full': delay = parentContext.currentStaggerTime; break; } const timeline = context.currentTimeline; if (delay) { timeline.delayNextStep(delay); } const startingTime = timeline.currentTime; visitDslNode(this, ast.animation, context); context.previousNode = ast; // time = duration + delay // the reason why this computation is so complex is because // the inner timeline may either have a delay value or a stretched // keyframe depending on if a subtimeline is not used or is used. parentContext.currentStaggerTime = (tl.currentTime - startingTime) + (tl.startTime - parentContext.currentTimeline.startTime); } } const DEFAULT_NOOP_PREVIOUS_NODE = {}; class AnimationTimelineContext { constructor(_driver, element, subInstructions, _enterClassName, _leaveClassName, errors, timelines, initialTimeline) { this._driver = _driver; this.element = element; this.subInstructions = subInstructions; this._enterClassName = _enterClassName; this._leaveClassName = _leaveClassName; this.errors = errors; this.timelines = timelines; this.parentContext = null; this.currentAnimateTimings = null; this.previousNode = DEFAULT_NOOP_PREVIOUS_NODE; this.subContextCount = 0; this.options = {}; this.currentQueryIndex = 0; this.currentQueryTotal = 0; this.currentStaggerTime = 0; this.currentTimeline = initialTimeline || new TimelineBuilder(this._driver, element, 0); timelines.push(this.currentTimeline); } get params() { return this.options.params; } updateOptions(options, skipIfExists) { if (!options) return; const newOptions = options; let optionsToUpdate = this.options; // NOTE: this will get patched up when other animation methods support duration overrides if (newOptions.duration != null) { optionsToUpdate.duration = resolveTimingValue(newOptions.duration); } if (newOptions.delay != null) { optionsToUpdate.delay = resolveTimingValue(newOptions.delay); } const newParams = newOptions.params; if (newParams) { let paramsToUpdate = optionsToUpdate.params; if (!paramsToUpdate) { paramsToUpdate = this.options.params = {}; } Object.keys(newParams).forEach(name => { if (!skipIfExists || !paramsToUpdate.hasOwnProperty(name)) { paramsToUpdate[name] = interpolateParams(newParams[name], paramsToUpdate, this.errors); } }); } } _copyOptions() { const options = {}; if (this.options) { const oldParams = this.options.params; if (oldParams) { const params = options['params'] = {}; Object.keys(oldParams).forEach(name => { params[name] = oldParams[name]; }); } } return options; } createSubContext(options = null, element, newTime) { const target = element || this.element; const context = new AnimationTimelineContext(this._driver, target, this.subInstructions, this._enterClassName, this._leaveClassName, this.errors, this.timelines, this.currentTimeline.fork(target, newTime || 0)); context.previousNode = this.previousNode; context.currentAnimateTimings = this.currentAnimateTimings; context.options = this._copyOptions(); context.updateOptions(options); context.currentQueryIndex = this.currentQueryIndex; context.currentQueryTotal = this.currentQueryTotal; context.parentContext = this; this.subContextCount++; return context; } transformIntoNewTimeline(newTime) { this.previousNode = DEFAULT_NOOP_PREVIOUS_NODE; this.currentTimeline = this.currentTimeline.fork(this.element, newTime); this.timelines.push(this.currentTimeline); return this.currentTimeline; } appendInstructionToTimeline(instruction, duration, delay) { const updatedTimings = { duration: duration != null ? duration : instruction.duration, delay: this.currentTimeline.currentTime + (delay != null ? delay : 0) + instruction.delay, easing: '' }; const builder = new SubTimelineBuilder(this._driver, instruction.element, instruction.keyframes, instruction.preStyleProps, instruction.postStyleProps, updatedTimings, instruction.stretchStartingKeyframe); this.timelines.push(builder); return updatedTimings; } incrementTime(time) { this.currentTimeline.forwardTime(this.currentTimeline.duration + time); } delayNextStep(delay) { // negative delays are not yet supported if (delay > 0) { this.currentTimeline.delayNextStep(delay); } } invokeQuery(selector, originalSelector, limit, includeSelf, optional, errors) { let results = []; if (includeSelf) { results.push(this.element); } if (selector.length > 0) { // if :self is only used then the selector is empty selector = selector.replace(ENTER_TOKEN_REGEX, '.' + this._enterClassName); selector = selector.replace(LEAVE_TOKEN_REGEX, '.' + this._leaveClassName); const multi = limit != 1; let elements = this._driver.query(this.element, selector, multi); if (limit !== 0) { elements = limit < 0 ? elements.slice(elements.length + limit, elements.length) : elements.slice(0, limit); } results.push(...elements); } if (!optional && results.length == 0) { errors.push(`\`query("${originalSelector}")\` returned zero elements. (Use \`query("${originalSelector}", { optional: true })\` if you wish to allow this.)`); } return results; } } class TimelineBuilder { constructor(_driver, element, startTime, _elementTimelineStylesLookup) { this._driver = _driver; this.element = element; this.startTime = startTime; this._elementTimelineStylesLookup = _elementTimelineStylesLookup; this.duration = 0; this._previousKeyframe = {}; this._currentKeyframe = {}; this._keyframes = new Map(); this._styleSummary = {}; this._pendingStyles = {}; this._backFill = {}; this._currentEmptyStepKeyframe = null; if (!this._elementTimelineStylesLookup) { this._elementTimelineStylesLookup = new Map(); } this._localTimelineStyles = Object.create(this._backFill, {}); this._globalTimelineStyles = this._elementTimelineStylesLookup.get(element); if (!this._globalTimelineStyles) { this._globalTimelineStyles = this._localTimelineStyles; this._elementTimelineStylesLookup.set(element, this._localTimelineStyles); } this._loadKeyframe(); } containsAnimation() { switch (this._keyframes.size) { case 0: return false; case 1: return this.getCurrentStyleProperties().length > 0; default: return true; } } getCurrentStyleProperties() { return Object.keys(this._currentKeyframe); } get currentTime() { return this.startTime + this.duration; } delayNextStep(delay) { // in the event that a style() step is placed right before a stagger() // and that style() step is the very first style() value in the animation // then we need to make a copy of the keyframe [0, copy, 1] so that the delay // properly applies the style() values to work with the stagger... const hasPreStyleStep = this._keyframes.size == 1 && Object.keys(this._pendingStyles).length; if (this.duration || hasPreStyleStep) { this.forwardTime(this.currentTime + delay); if (hasPreStyleStep) { this.snapshotCurrentStyles(); } } else { this.startTime += delay; } } fork(element, currentTime) { this.applyStylesToKeyframe(); return new TimelineBuilder(this._driver, element, currentTime || this.currentTime, this._elementTimelineStylesLookup); } _loadKeyframe() { if (this._currentKeyframe) { this._previousKeyframe = this._currentKeyframe; } this._currentKeyframe = this._keyframes.get(this.duration); if (!this._currentKeyframe) { this._currentKeyframe = Object.create(this._backFill, {}); this._keyframes.set(this.duration, this._currentKeyframe); } } forwardFrame() { this.duration += ONE_FRAME_IN_MILLISECONDS; this._loadKeyframe(); } forwardTime(time) { this.applyStylesToKeyframe(); this.duration = time; this._loadKeyframe(); } _updateStyle(prop, value) { this._localTimelineStyles[prop] = value; this._globalTimelineStyles[prop] = value; this._styleSummary[prop] = { time: this.currentTime, value }; } allowOnlyTimelineStyles() { return this._currentEmptyStepKeyframe !== this._currentKeyframe; } applyEmptyStep(easing) { if (easing) { this._previousKeyframe['easing'] = easing; } // special case for animate(duration): // all missing styles are filled with a `*` value then // if any destination styles are filled in later on the same // keyframe then they will override the overridden styles // We use `_globalTimelineStyles` here because there may be // styles in previous keyframes that are not present in this timeline Object.keys(this._globalTimelineStyles).forEach(prop => { this._backFill[prop] = this._globalTimelineStyles[prop] || _angular_animations__WEBPACK_IMPORTED_MODULE_0__["AUTO_STYLE"]; this._currentKeyframe[prop] = _angular_animations__WEBPACK_IMPORTED_MODULE_0__["AUTO_STYLE"]; }); this._currentEmptyStepKeyframe = this._currentKeyframe; } setStyles(input, easing, errors, options) { if (easing) { this._previousKeyframe['easing'] = easing; } const params = (options && options.params) || {}; const styles = flattenStyles(input, this._globalTimelineStyles); Object.keys(styles).forEach(prop => { const val = interpolateParams(styles[prop], params, errors); this._pendingStyles[prop] = val; if (!this._localTimelineStyles.hasOwnProperty(prop)) { this._backFill[prop] = this._globalTimelineStyles.hasOwnProperty(prop) ? this._globalTimelineStyles[prop] : _angular_animations__WEBPACK_IMPORTED_MODULE_0__["AUTO_STYLE"]; } this._updateStyle(prop, val); }); } applyStylesToKeyframe() { const styles = this._pendingStyles; const props = Object.keys(styles); if (props.length == 0) return; this._pendingStyles = {}; props.forEach(prop => { const val = styles[prop]; this._currentKeyframe[prop] = val; }); Object.keys(this._localTimelineStyles).forEach(prop => { if (!this._currentKeyframe.hasOwnProperty(prop)) { this._currentKeyframe[prop] = this._localTimelineStyles[prop]; } }); } snapshotCurrentStyles() { Object.keys(this._localTimelineStyles).forEach(prop => { const val = this._localTimelineStyles[prop]; this._pendingStyles[prop] = val; this._updateStyle(prop, val); }); } getFinalKeyframe() { return this._keyframes.get(this.duration); } get properties() { const properties = []; for (let prop in this._currentKeyframe) { properties.push(prop); } return properties; } mergeTimelineCollectedStyles(timeline) { Object.keys(timeline._styleSummary).forEach(prop => { const details0 = this._styleSummary[prop]; const details1 = timeline._styleSummary[prop]; if (!details0 || details1.time > details0.time) { this._updateStyle(prop, details1.value); } }); } buildKeyframes() { this.applyStylesToKeyframe(); const preStyleProps = new Set(); const postStyleProps = new Set(); const isEmpty = this._keyframes.size === 1 && this.duration === 0; let finalKeyframes = []; this._keyframes.forEach((keyframe, time) => { const finalKeyframe = copyStyles(keyframe, true); Object.keys(finalKeyframe).forEach(prop => { const value = finalKeyframe[prop]; if (value == _angular_animations__WEBPACK_IMPORTED_MODULE_0__["ɵPRE_STYLE"]) { preStyleProps.add(prop); } else if (value == _angular_animations__WEBPACK_IMPORTED_MODULE_0__["AUTO_STYLE"]) { postStyleProps.add(prop); } }); if (!isEmpty) { finalKeyframe['offset'] = time / this.duration; } finalKeyframes.push(finalKeyframe); }); const preProps = preStyleProps.size ? iteratorToArray(preStyleProps.values()) : []; const postProps = postStyleProps.size ? iteratorToArray(postStyleProps.values()) : []; // special case for a 0-second animation (which is designed just to place styles onscreen) if (isEmpty) { const kf0 = finalKeyframes[0]; const kf1 = copyObj(kf0); kf0['offset'] = 0; kf1['offset'] = 1; finalKeyframes = [kf0, kf1]; } return createTimelineInstruction(this.element, finalKeyframes, preProps, postProps, this.duration, this.startTime, this.easing, false); } } class SubTimelineBuilder extends TimelineBuilder { constructor(driver, element, keyframes, preStyleProps, postStyleProps, timings, _stretchStartingKeyframe = false) { super(driver, element, timings.delay); this.element = element; this.keyframes = keyframes; this.preStyleProps = preStyleProps; this.postStyleProps = postStyleProps; this._stretchStartingKeyframe = _stretchStartingKeyframe; this.timings = { duration: timings.duration, delay: timings.delay, easing: timings.easing }; } containsAnimation() { return this.keyframes.length > 1; } buildKeyframes() { let keyframes = this.keyframes; let { delay, duration, easing } = this.timings; if (this._stretchStartingKeyframe && delay) { const newKeyframes = []; const totalTime = duration + delay; const startingGap = delay / totalTime; // the original starting keyframe now starts once the delay is done const newFirstKeyframe = copyStyles(keyframes[0], false); newFirstKeyframe['offset'] = 0; newKeyframes.push(newFirstKeyframe); const oldFirstKeyframe = copyStyles(keyframes[0], false); oldFirstKeyframe['offset'] = roundOffset(startingGap); newKeyframes.push(oldFirstKeyframe); /* When the keyframe is stretched then it means that the delay before the animation starts is gone. Instead the first keyframe is placed at the start of the animation and it is then copied to where it starts when the original delay is over. This basically means nothing animates during that delay, but the styles are still renderered. For this to work the original offset values that exist in the original keyframes must be "warped" so that they can take the new keyframe + delay into account. delay=1000, duration=1000, keyframes = 0 .5 1 turns into delay=0, duration=2000, keyframes = 0 .33 .66 1 */ // offsets between 1 ... n -1 are all warped by the keyframe stretch const limit = keyframes.length - 1; for (let i = 1; i <= limit; i++) { let kf = copyStyles(keyframes[i], false); const oldOffset = kf['offset']; const timeAtKeyframe = delay + oldOffset * duration; kf['offset'] = roundOffset(timeAtKeyframe / totalTime); newKeyframes.push(kf); } // the new starting keyframe should be added at the start duration = totalTime; delay = 0; easing = ''; keyframes = newKeyframes; } return createTimelineInstruction(this.element, keyframes, this.preStyleProps, this.postStyleProps, duration, delay, easing, true); } } function roundOffset(offset, decimalPoints = 3) { const mult = Math.pow(10, decimalPoints - 1); return Math.round(offset * mult) / mult; } function flattenStyles(input, allStyles) { const styles = {}; let allProperties; input.forEach(token => { if (token === '*') { allProperties = allProperties || Object.keys(allStyles); allProperties.forEach(prop => { styles[prop] = _angular_animations__WEBPACK_IMPORTED_MODULE_0__["AUTO_STYLE"]; }); } else { copyStyles(token, false, styles); } }); return styles; } class Animation { constructor(_driver, input) { this._driver = _driver; const errors = []; const ast = buildAnimationAst(_driver, input, errors); if (errors.length) { const errorMessage = `animation validation failed:\n${errors.join('\n')}`; throw new Error(errorMessage); } this._animationAst = ast; } buildTimelines(element, startingStyles, destinationStyles, options, subInstructions) { const start = Array.isArray(startingStyles) ? normalizeStyles(startingStyles) : startingStyles; const dest = Array.isArray(destinationStyles) ? normalizeStyles(destinationStyles) : destinationStyles; const errors = []; subInstructions = subInstructions || new ElementInstructionMap(); const result = buildAnimationTimelines(this._driver, element, this._animationAst, ENTER_CLASSNAME, LEAVE_CLASSNAME, start, dest, options, subInstructions, errors); if (errors.length) { const errorMessage = `animation building failed:\n${errors.join('\n')}`; throw new Error(errorMessage); } return result; } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @publicApi */ class AnimationStyleNormalizer { } /** * @publicApi */ class NoopAnimationStyleNormalizer { normalizePropertyName(propertyName, errors) { return propertyName; } normalizeStyleValue(userProvidedProperty, normalizedProperty, value, errors) { return value; } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ class WebAnimationsStyleNormalizer extends AnimationStyleNormalizer { normalizePropertyName(propertyName, errors) { return dashCaseToCamelCase(propertyName); } normalizeStyleValue(userProvidedProperty, normalizedProperty, value, errors) { let unit = ''; const strVal = value.toString().trim(); if (DIMENSIONAL_PROP_MAP[normalizedProperty] && value !== 0 && value !== '0') { if (typeof value === 'number') { unit = 'px'; } else { const valAndSuffixMatch = value.match(/^[+-]?[\d\.]+([a-z]*)$/); if (valAndSuffixMatch && valAndSuffixMatch[1].length == 0) { errors.push(`Please provide a CSS unit value for ${userProvidedProperty}:${value}`); } } } return strVal + unit; } } const ɵ0$1 = () => makeBooleanMap('width,height,minWidth,minHeight,maxWidth,maxHeight,left,top,bottom,right,fontSize,outlineWidth,outlineOffset,paddingTop,paddingLeft,paddingBottom,paddingRight,marginTop,marginLeft,marginBottom,marginRight,borderRadius,borderWidth,borderTopWidth,borderLeftWidth,borderRightWidth,borderBottomWidth,textIndent,perspective' .split(',')); const DIMENSIONAL_PROP_MAP = (ɵ0$1)(); function makeBooleanMap(keys) { const map = {}; keys.forEach(key => map[key] = true); return map; } function createTransitionInstruction(element, triggerName, fromState, toState, isRemovalTransition, fromStyles, toStyles, timelines, queriedElements, preStyleProps, postStyleProps, totalTime, errors) { return { type: 0 /* TransitionAnimation */, element, triggerName, isRemovalTransition, fromState, fromStyles, toState, toStyles, timelines, queriedElements, preStyleProps, postStyleProps, totalTime, errors }; } const EMPTY_OBJECT = {}; class AnimationTransitionFactory { constructor(_triggerName, ast, _stateStyles) { this._triggerName = _triggerName; this.ast = ast; this._stateStyles = _stateStyles; } match(currentState, nextState, element, params) { return oneOrMoreTransitionsMatch(this.ast.matchers, currentState, nextState, element, params); } buildStyles(stateName, params, errors) { const backupStateStyler = this._stateStyles['*']; const stateStyler = this._stateStyles[stateName]; const backupStyles = backupStateStyler ? backupStateStyler.buildStyles(params, errors) : {}; return stateStyler ? stateStyler.buildStyles(params, errors) : backupStyles; } build(driver, element, currentState, nextState, enterClassName, leaveClassName, currentOptions, nextOptions, subInstructions, skipAstBuild) { const errors = []; const transitionAnimationParams = this.ast.options && this.ast.options.params || EMPTY_OBJECT; const currentAnimationParams = currentOptions && currentOptions.params || EMPTY_OBJECT; const currentStateStyles = this.buildStyles(currentState, currentAnimationParams, errors); const nextAnimationParams = nextOptions && nextOptions.params || EMPTY_OBJECT; const nextStateStyles = this.buildStyles(nextState, nextAnimationParams, errors); const queriedElements = new Set(); const preStyleMap = new Map(); const postStyleMap = new Map(); const isRemoval = nextState === 'void'; const animationOptions = { params: Object.assign(Object.assign({}, transitionAnimationParams), nextAnimationParams) }; const timelines = skipAstBuild ? [] : buildAnimationTimelines(driver, element, this.ast.animation, enterClassName, leaveClassName, currentStateStyles, nextStateStyles, animationOptions, subInstructions, errors); let totalTime = 0; timelines.forEach(tl => { totalTime = Math.max(tl.duration + tl.delay, totalTime); }); if (errors.length) { return createTransitionInstruction(element, this._triggerName, currentState, nextState, isRemoval, currentStateStyles, nextStateStyles, [], [], preStyleMap, postStyleMap, totalTime, errors); } timelines.forEach(tl => { const elm = tl.element; const preProps = getOrSetAsInMap(preStyleMap, elm, {}); tl.preStyleProps.forEach(prop => preProps[prop] = true); const postProps = getOrSetAsInMap(postStyleMap, elm, {}); tl.postStyleProps.forEach(prop => postProps[prop] = true); if (elm !== element) { queriedElements.add(elm); } }); const queriedElementsList = iteratorToArray(queriedElements.values()); return createTransitionInstruction(element, this._triggerName, currentState, nextState, isRemoval, currentStateStyles, nextStateStyles, timelines, queriedElementsList, preStyleMap, postStyleMap, totalTime); } } function oneOrMoreTransitionsMatch(matchFns, currentState, nextState, element, params) { return matchFns.some(fn => fn(currentState, nextState, element, params)); } class AnimationStateStyles { constructor(styles, defaultParams) { this.styles = styles; this.defaultParams = defaultParams; } buildStyles(params, errors) { const finalStyles = {}; const combinedParams = copyObj(this.defaultParams); Object.keys(params).forEach(key => { const value = params[key]; if (value != null) { combinedParams[key] = value; } }); this.styles.styles.forEach(value => { if (typeof value !== 'string') { const styleObj = value; Object.keys(styleObj).forEach(prop => { let val = styleObj[prop]; if (val.length > 1) { val = interpolateParams(val, combinedParams, errors); } finalStyles[prop] = val; }); } }); return finalStyles; } } /** * @publicApi */ function buildTrigger(name, ast) { return new AnimationTrigger(name, ast); } /** * @publicApi */ class AnimationTrigger { constructor(name, ast) { this.name = name; this.ast = ast; this.transitionFactories = []; this.states = {}; ast.states.forEach(ast => { const defaultParams = (ast.options && ast.options.params) || {}; this.states[ast.name] = new AnimationStateStyles(ast.style, defaultParams); }); balanceProperties(this.states, 'true', '1'); balanceProperties(this.states, 'false', '0'); ast.transitions.forEach(ast => { this.transitionFactories.push(new AnimationTransitionFactory(name, ast, this.states)); }); this.fallbackTransition = createFallbackTransition(name, this.states); } get containsQueries() { return this.ast.queryCount > 0; } matchTransition(currentState, nextState, element, params) { const entry = this.transitionFactories.find(f => f.match(currentState, nextState, element, params)); return entry || null; } matchStyles(currentState, params, errors) { return this.fallbackTransition.buildStyles(currentState, params, errors); } } function createFallbackTransition(triggerName, states) { const matchers = [(fromState, toState) => true]; const animation = { type: 2 /* Sequence */, steps: [], options: null }; const transition = { type: 1 /* Transition */, animation, matchers, options: null, queryCount: 0, depCount: 0 }; return new AnimationTransitionFactory(triggerName, transition, states); } function balanceProperties(obj, key1, key2) { if (obj.hasOwnProperty(key1)) { if (!obj.hasOwnProperty(key2)) { obj[key2] = obj[key1]; } } else if (obj.hasOwnProperty(key2)) { obj[key1] = obj[key2]; } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ const EMPTY_INSTRUCTION_MAP = new ElementInstructionMap(); class TimelineAnimationEngine { constructor(bodyNode, _driver, _normalizer) { this.bodyNode = bodyNode; this._driver = _driver; this._normalizer = _normalizer; this._animations = {}; this._playersById = {}; this.players = []; } register(id, metadata) { const errors = []; const ast = buildAnimationAst(this._driver, metadata, errors); if (errors.length) { throw new Error(`Unable to build the animation due to the following errors: ${errors.join('\n')}`); } else { this._animations[id] = ast; } } _buildPlayer(i, preStyles, postStyles) { const element = i.element; const keyframes = normalizeKeyframes(this._driver, this._normalizer, element, i.keyframes, preStyles, postStyles); return this._driver.animate(element, keyframes, i.duration, i.delay, i.easing, [], true); } create(id, element, options = {}) { const errors = []; const ast = this._animations[id]; let instructions; const autoStylesMap = new Map(); if (ast) { instructions = buildAnimationTimelines(this._driver, element, ast, ENTER_CLASSNAME, LEAVE_CLASSNAME, {}, {}, options, EMPTY_INSTRUCTION_MAP, errors); instructions.forEach(inst => { const styles = getOrSetAsInMap(autoStylesMap, inst.element, {}); inst.postStyleProps.forEach(prop => styles[prop] = null); }); } else { errors.push('The requested animation doesn\'t exist or has already been destroyed'); instructions = []; } if (errors.length) { throw new Error(`Unable to create the animation due to the following errors: ${errors.join('\n')}`); } autoStylesMap.forEach((styles, element) => { Object.keys(styles).forEach(prop => { styles[prop] = this._driver.computeStyle(element, prop, _angular_animations__WEBPACK_IMPORTED_MODULE_0__["AUTO_STYLE"]); }); }); const players = instructions.map(i => { const styles = autoStylesMap.get(i.element); return this._buildPlayer(i, {}, styles); }); const player = optimizeGroupPlayer(players); this._playersById[id] = player; player.onDestroy(() => this.destroy(id)); this.players.push(player); return player; } destroy(id) { const player = this._getPlayer(id); player.destroy(); delete this._playersById[id]; const index = this.players.indexOf(player); if (index >= 0) { this.players.splice(index, 1); } } _getPlayer(id) { const player = this._playersById[id]; if (!player) { throw new Error(`Unable to find the timeline player referenced by ${id}`); } return player; } listen(id, element, eventName, callback) { // triggerName, fromState, toState are all ignored for timeline animations const baseEvent = makeAnimationEvent(element, '', '', ''); listenOnPlayer(this._getPlayer(id), eventName, baseEvent, callback); return () => { }; } command(id, element, command, args) { if (command == 'register') { this.register(id, args[0]); return; } if (command == 'create') { const options = (args[0] || {}); this.create(id, element, options); return; } const player = this._getPlayer(id); switch (command) { case 'play': player.play(); break; case 'pause': player.pause(); break; case 'reset': player.reset(); break; case 'restart': player.restart(); break; case 'finish': player.finish(); break; case 'init': player.init(); break; case 'setPosition': player.setPosition(parseFloat(args[0])); break; case 'destroy': this.destroy(id); break; } } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ const QUEUED_CLASSNAME = 'ng-animate-queued'; const QUEUED_SELECTOR = '.ng-animate-queued'; const DISABLED_CLASSNAME = 'ng-animate-disabled'; const DISABLED_SELECTOR = '.ng-animate-disabled'; const STAR_CLASSNAME = 'ng-star-inserted'; const STAR_SELECTOR = '.ng-star-inserted'; const EMPTY_PLAYER_ARRAY = []; const NULL_REMOVAL_STATE = { namespaceId: '', setForRemoval: false, setForMove: false, hasAnimation: false, removedBeforeQueried: false }; const NULL_REMOVED_QUERIED_STATE = { namespaceId: '', setForMove: false, setForRemoval: false, hasAnimation: false, removedBeforeQueried: true }; const REMOVAL_FLAG = '__ng_removed'; class StateValue { constructor(input, namespaceId = '') { this.namespaceId = namespaceId; const isObj = input && input.hasOwnProperty('value'); const value = isObj ? input['value'] : input; this.value = normalizeTriggerValue(value); if (isObj) { const options = copyObj(input); delete options['value']; this.options = options; } else { this.options = {}; } if (!this.options.params) { this.options.params = {}; } } get params() { return this.options.params; } absorbOptions(options) { const newParams = options.params; if (newParams) { const oldParams = this.options.params; Object.keys(newParams).forEach(prop => { if (oldParams[prop] == null) { oldParams[prop] = newParams[prop]; } }); } } } const VOID_VALUE = 'void'; const DEFAULT_STATE_VALUE = new StateValue(VOID_VALUE); class AnimationTransitionNamespace { constructor(id, hostElement, _engine) { this.id = id; this.hostElement = hostElement; this._engine = _engine; this.players = []; this._triggers = {}; this._queue = []; this._elementListeners = new Map(); this._hostClassName = 'ng-tns-' + id; addClass(hostElement, this._hostClassName); } listen(element, name, phase, callback) { if (!this._triggers.hasOwnProperty(name)) { throw new Error(`Unable to listen on the animation trigger event "${phase}" because the animation trigger "${name}" doesn\'t exist!`); } if (phase == null || phase.length == 0) { throw new Error(`Unable to listen on the animation trigger "${name}" because the provided event is undefined!`); } if (!isTriggerEventValid(phase)) { throw new Error(`The provided animation trigger event "${phase}" for the animation trigger "${name}" is not supported!`); } const listeners = getOrSetAsInMap(this._elementListeners, element, []); const data = { name, phase, callback }; listeners.push(data); const triggersWithStates = getOrSetAsInMap(this._engine.statesByElement, element, {}); if (!triggersWithStates.hasOwnProperty(name)) { addClass(element, NG_TRIGGER_CLASSNAME); addClass(element, NG_TRIGGER_CLASSNAME + '-' + name); triggersWithStates[name] = DEFAULT_STATE_VALUE; } return () => { // the event listener is removed AFTER the flush has occurred such // that leave animations callbacks can fire (otherwise if the node // is removed in between then the listeners would be deregistered) this._engine.afterFlush(() => { const index = listeners.indexOf(data); if (index >= 0) { listeners.splice(index, 1); } if (!this._triggers[name]) { delete triggersWithStates[name]; } }); }; } register(name, ast) { if (this._triggers[name]) { // throw return false; } else { this._triggers[name] = ast; return true; } } _getTrigger(name) { const trigger = this._triggers[name]; if (!trigger) { throw new Error(`The provided animation trigger "${name}" has not been registered!`); } return trigger; } trigger(element, triggerName, value, defaultToFallback = true) { const trigger = this._getTrigger(triggerName); const player = new TransitionAnimationPlayer(this.id, triggerName, element); let triggersWithStates = this._engine.statesByElement.get(element); if (!triggersWithStates) { addClass(element, NG_TRIGGER_CLASSNAME); addClass(element, NG_TRIGGER_CLASSNAME + '-' + triggerName); this._engine.statesByElement.set(element, triggersWithStates = {}); } let fromState = triggersWithStates[triggerName]; const toState = new StateValue(value, this.id); const isObj = value && value.hasOwnProperty('value'); if (!isObj && fromState) { toState.absorbOptions(fromState.options); } triggersWithStates[triggerName] = toState; if (!fromState) { fromState = DEFAULT_STATE_VALUE; } const isRemoval = toState.value === VOID_VALUE; // normally this isn't reached by here, however, if an object expression // is passed in then it may be a new object each time. Comparing the value // is important since that will stay the same despite there being a new object. // The removal arc here is special cased because the same element is triggered // twice in the event that it contains animations on the outer/inner portions // of the host container if (!isRemoval && fromState.value === toState.value) { // this means that despite the value not changing, some inner params // have changed which means that the animation final styles need to be applied if (!objEquals(fromState.params, toState.params)) { const errors = []; const fromStyles = trigger.matchStyles(fromState.value, fromState.params, errors); const toStyles = trigger.matchStyles(toState.value, toState.params, errors); if (errors.length) { this._engine.reportError(errors); } else { this._engine.afterFlush(() => { eraseStyles(element, fromStyles); setStyles(element, toStyles); }); } } return; } const playersOnElement = getOrSetAsInMap(this._engine.playersByElement, element, []); playersOnElement.forEach(player => { // only remove the player if it is queued on the EXACT same trigger/namespace // we only also deal with queued players here because if the animation has // started then we want to keep the player alive until the flush happens // (which is where the previousPlayers are passed into the new palyer) if (player.namespaceId == this.id && player.triggerName == triggerName && player.queued) { player.destroy(); } }); let transition = trigger.matchTransition(fromState.value, toState.value, element, toState.params); let isFallbackTransition = false; if (!transition) { if (!defaultToFallback) return; transition = trigger.fallbackTransition; isFallbackTransition = true; } this._engine.totalQueuedPlayers++; this._queue.push({ element, triggerName, transition, fromState, toState, player, isFallbackTransition }); if (!isFallbackTransition) { addClass(element, QUEUED_CLASSNAME); player.onStart(() => { removeClass(element, QUEUED_CLASSNAME); }); } player.onDone(() => { let index = this.players.indexOf(player); if (index >= 0) { this.players.splice(index, 1); } const players = this._engine.playersByElement.get(element); if (players) { let index = players.indexOf(player); if (index >= 0) { players.splice(index, 1); } } }); this.players.push(player); playersOnElement.push(player); return player; } deregister(name) { delete this._triggers[name]; this._engine.statesByElement.forEach((stateMap, element) => { delete stateMap[name]; }); this._elementListeners.forEach((listeners, element) => { this._elementListeners.set(element, listeners.filter(entry => { return entry.name != name; })); }); } clearElementCache(element) { this._engine.statesByElement.delete(element); this._elementListeners.delete(element); const elementPlayers = this._engine.playersByElement.get(element); if (elementPlayers) { elementPlayers.forEach(player => player.destroy()); this._engine.playersByElement.delete(element); } } _signalRemovalForInnerTriggers(rootElement, context) { const elements = this._engine.driver.query(rootElement, NG_TRIGGER_SELECTOR, true); // emulate a leave animation for all inner nodes within this node. // If there are no animations found for any of the nodes then clear the cache // for the element. elements.forEach(elm => { // this means that an inner remove() operation has already kicked off // the animation on this element... if (elm[REMOVAL_FLAG]) return; const namespaces = this._engine.fetchNamespacesByElement(elm); if (namespaces.size) { namespaces.forEach(ns => ns.triggerLeaveAnimation(elm, context, false, true)); } else { this.clearElementCache(elm); } }); // If the child elements were removed along with the parent, their animations might not // have completed. Clear all the elements from the cache so we don't end up with a memory leak. this._engine.afterFlushAnimationsDone(() => elements.forEach(elm => this.clearElementCache(elm))); } triggerLeaveAnimation(element, context, destroyAfterComplete, defaultToFallback) { const triggerStates = this._engine.statesByElement.get(element); if (triggerStates) { const players = []; Object.keys(triggerStates).forEach(triggerName => { // this check is here in the event that an element is removed // twice (both on the host level and the component level) if (this._triggers[triggerName]) { const player = this.trigger(element, triggerName, VOID_VALUE, defaultToFallback); if (player) { players.push(player); } } }); if (players.length) { this._engine.markElementAsRemoved(this.id, element, true, context); if (destroyAfterComplete) { optimizeGroupPlayer(players).onDone(() => this._engine.processLeaveNode(element)); } return true; } } return false; } prepareLeaveAnimationListeners(element) { const listeners = this._elementListeners.get(element); if (listeners) { const visitedTriggers = new Set(); listeners.forEach(listener => { const triggerName = listener.name; if (visitedTriggers.has(triggerName)) return; visitedTriggers.add(triggerName); const trigger = this._triggers[triggerName]; const transition = trigger.fallbackTransition; const elementStates = this._engine.statesByElement.get(element); const fromState = elementStates[triggerName] || DEFAULT_STATE_VALUE; const toState = new StateValue(VOID_VALUE); const player = new TransitionAnimationPlayer(this.id, triggerName, element); this._engine.totalQueuedPlayers++; this._queue.push({ element, triggerName, transition, fromState, toState, player, isFallbackTransition: true }); }); } } removeNode(element, context) { const engine = this._engine; if (element.childElementCount) { this._signalRemovalForInnerTriggers(element, context); } // this means that a * => VOID animation was detected and kicked off if (this.triggerLeaveAnimation(element, context, true)) return; // find the player that is animating and make sure that the // removal is delayed until that player has completed let containsPotentialParentTransition = false; if (engine.totalAnimations) { const currentPlayers = engine.players.length ? engine.playersByQueriedElement.get(element) : []; // when this `if statement` does not continue forward it means that // a previous animation query has selected the current element and // is animating it. In this situation want to continue forwards and // allow the element to be queued up for animation later. if (currentPlayers && currentPlayers.length) { containsPotentialParentTransition = true; } else { let parent = element; while (parent = parent.parentNode) { const triggers = engine.statesByElement.get(parent); if (triggers) { containsPotentialParentTransition = true; break; } } } } // at this stage we know that the element will either get removed // during flush or will be picked up by a parent query. Either way // we need to fire the listeners for this element when it DOES get // removed (once the query parent animation is done or after flush) this.prepareLeaveAnimationListeners(element); // whether or not a parent has an animation we need to delay the deferral of the leave // operation until we have more information (which we do after flush() has been called) if (containsPotentialParentTransition) { engine.markElementAsRemoved(this.id, element, false, context); } else { const removalFlag = element[REMOVAL_FLAG]; if (!removalFlag || removalFlag === NULL_REMOVAL_STATE) { // we do this after the flush has occurred such // that the callbacks can be fired engine.afterFlush(() => this.clearElementCache(element)); engine.destroyInnerAnimations(element); engine._onRemovalComplete(element, context); } } } insertNode(element, parent) { addClass(element, this._hostClassName); } drainQueuedTransitions(microtaskId) { const instructions = []; this._queue.forEach(entry => { const player = entry.player; if (player.destroyed) return; const element = entry.element; const listeners = this._elementListeners.get(element); if (listeners) { listeners.forEach((listener) => { if (listener.name == entry.triggerName) { const baseEvent = makeAnimationEvent(element, entry.triggerName, entry.fromState.value, entry.toState.value); baseEvent['_data'] = microtaskId; listenOnPlayer(entry.player, listener.phase, baseEvent, listener.callback); } }); } if (player.markedForDestroy) { this._engine.afterFlush(() => { // now we can destroy the element properly since the event listeners have // been bound to the player player.destroy(); }); } else { instructions.push(entry); } }); this._queue = []; return instructions.sort((a, b) => { // if depCount == 0 them move to front // otherwise if a contains b then move back const d0 = a.transition.ast.depCount; const d1 = b.transition.ast.depCount; if (d0 == 0 || d1 == 0) { return d0 - d1; } return this._engine.driver.containsElement(a.element, b.element) ? 1 : -1; }); } destroy(context) { this.players.forEach(p => p.destroy()); this._signalRemovalForInnerTriggers(this.hostElement, context); } elementContainsData(element) { let containsData = false; if (this._elementListeners.has(element)) containsData = true; containsData = (this._queue.find(entry => entry.element === element) ? true : false) || containsData; return containsData; } } class TransitionAnimationEngine { constructor(bodyNode, driver, _normalizer) { this.bodyNode = bodyNode; this.driver = driver; this._normalizer = _normalizer; this.players = []; this.newHostElements = new Map(); this.playersByElement = new Map(); this.playersByQueriedElement = new Map(); this.statesByElement = new Map(); this.disabledNodes = new Set(); this.totalAnimations = 0; this.totalQueuedPlayers = 0; this._namespaceLookup = {}; this._namespaceList = []; this._flushFns = []; this._whenQuietFns = []; this.namespacesByHostElement = new Map(); this.collectedEnterElements = []; this.collectedLeaveElements = []; // this method is designed to be overridden by the code that uses this engine this.onRemovalComplete = (element, context) => { }; } /** @internal */ _onRemovalComplete(element, context) { this.onRemovalComplete(element, context); } get queuedPlayers() { const players = []; this._namespaceList.forEach(ns => { ns.players.forEach(player => { if (player.queued) { players.push(player); } }); }); return players; } createNamespace(namespaceId, hostElement) { const ns = new AnimationTransitionNamespace(namespaceId, hostElement, this); if (hostElement.parentNode) { this._balanceNamespaceList(ns, hostElement); } else { // defer this later until flush during when the host element has // been inserted so that we know exactly where to place it in // the namespace list this.newHostElements.set(hostElement, ns); // given that this host element is apart of the animation code, it // may or may not be inserted by a parent node that is an of an // animation renderer type. If this happens then we can still have // access to this item when we query for :enter nodes. If the parent // is a renderer then the set data-structure will normalize the entry this.collectEnterElement(hostElement); } return this._namespaceLookup[namespaceId] = ns; } _balanceNamespaceList(ns, hostElement) { const limit = this._namespaceList.length - 1; if (limit >= 0) { let found = false; for (let i = limit; i >= 0; i--) { const nextNamespace = this._namespaceList[i]; if (this.driver.containsElement(nextNamespace.hostElement, hostElement)) { this._namespaceList.splice(i + 1, 0, ns); found = true; break; } } if (!found) { this._namespaceList.splice(0, 0, ns); } } else { this._namespaceList.push(ns); } this.namespacesByHostElement.set(hostElement, ns); return ns; } register(namespaceId, hostElement) { let ns = this._namespaceLookup[namespaceId]; if (!ns) { ns = this.createNamespace(namespaceId, hostElement); } return ns; } registerTrigger(namespaceId, name, trigger) { let ns = this._namespaceLookup[namespaceId]; if (ns && ns.register(name, trigger)) { this.totalAnimations++; } } destroy(namespaceId, context) { if (!namespaceId) return; const ns = this._fetchNamespace(namespaceId); this.afterFlush(() => { this.namespacesByHostElement.delete(ns.hostElement); delete this._namespaceLookup[namespaceId]; const index = this._namespaceList.indexOf(ns); if (index >= 0) { this._namespaceList.splice(index, 1); } }); this.afterFlushAnimationsDone(() => ns.destroy(context)); } _fetchNamespace(id) { return this._namespaceLookup[id]; } fetchNamespacesByElement(element) { // normally there should only be one namespace per element, however // if @triggers are placed on both the component element and then // its host element (within the component code) then there will be // two namespaces returned. We use a set here to simply the dedupe // of namespaces incase there are multiple triggers both the elm and host const namespaces = new Set(); const elementStates = this.statesByElement.get(element); if (elementStates) { const keys = Object.keys(elementStates); for (let i = 0; i < keys.length; i++) { const nsId = elementStates[keys[i]].namespaceId; if (nsId) { const ns = this._fetchNamespace(nsId); if (ns) { namespaces.add(ns); } } } } return namespaces; } trigger(namespaceId, element, name, value) { if (isElementNode(element)) { const ns = this._fetchNamespace(namespaceId); if (ns) { ns.trigger(element, name, value); return true; } } return false; } insertNode(namespaceId, element, parent, insertBefore) { if (!isElementNode(element)) return; // special case for when an element is removed and reinserted (move operation) // when this occurs we do not want to use the element for deletion later const details = element[REMOVAL_FLAG]; if (details && details.setForRemoval) { details.setForRemoval = false; details.setForMove = true; const index = this.collectedLeaveElements.indexOf(element); if (index >= 0) { this.collectedLeaveElements.splice(index, 1); } } // in the event that the namespaceId is blank then the caller // code does not contain any animation code in it, but it is // just being called so that the node is marked as being inserted if (namespaceId) { const ns = this._fetchNamespace(namespaceId); // This if-statement is a workaround for router issue #21947. // The router sometimes hits a race condition where while a route // is being instantiated a new navigation arrives, triggering leave // animation of DOM that has not been fully initialized, until this // is resolved, we need to handle the scenario when DOM is not in a // consistent state during the animation. if (ns) { ns.insertNode(element, parent); } } // only *directives and host elements are inserted before if (insertBefore) { this.collectEnterElement(element); } } collectEnterElement(element) { this.collectedEnterElements.push(element); } markElementAsDisabled(element, value) { if (value) { if (!this.disabledNodes.has(element)) { this.disabledNodes.add(element); addClass(element, DISABLED_CLASSNAME); } } else if (this.disabledNodes.has(element)) { this.disabledNodes.delete(element); removeClass(element, DISABLED_CLASSNAME); } } removeNode(namespaceId, element, isHostElement, context) { if (isElementNode(element)) { const ns = namespaceId ? this._fetchNamespace(namespaceId) : null; if (ns) { ns.removeNode(element, context); } else { this.markElementAsRemoved(namespaceId, element, false, context); } if (isHostElement) { const hostNS = this.namespacesByHostElement.get(element); if (hostNS && hostNS.id !== namespaceId) { hostNS.removeNode(element, context); } } } else { this._onRemovalComplete(element, context); } } markElementAsRemoved(namespaceId, element, hasAnimation, context) { this.collectedLeaveElements.push(element); element[REMOVAL_FLAG] = { namespaceId, setForRemoval: context, hasAnimation, removedBeforeQueried: false }; } listen(namespaceId, element, name, phase, callback) { if (isElementNode(element)) { return this._fetchNamespace(namespaceId).listen(element, name, phase, callback); } return () => { }; } _buildInstruction(entry, subTimelines, enterClassName, leaveClassName, skipBuildAst) { return entry.transition.build(this.driver, entry.element, entry.fromState.value, entry.toState.value, enterClassName, leaveClassName, entry.fromState.options, entry.toState.options, subTimelines, skipBuildAst); } destroyInnerAnimations(containerElement) { let elements = this.driver.query(containerElement, NG_TRIGGER_SELECTOR, true); elements.forEach(element => this.destroyActiveAnimationsForElement(element)); if (this.playersByQueriedElement.size == 0) return; elements = this.driver.query(containerElement, NG_ANIMATING_SELECTOR, true); elements.forEach(element => this.finishActiveQueriedAnimationOnElement(element)); } destroyActiveAnimationsForElement(element) { const players = this.playersByElement.get(element); if (players) { players.forEach(player => { // special case for when an element is set for destruction, but hasn't started. // in this situation we want to delay the destruction until the flush occurs // so that any event listeners attached to the player are triggered. if (player.queued) { player.markedForDestroy = true; } else { player.destroy(); } }); } } finishActiveQueriedAnimationOnElement(element) { const players = this.playersByQueriedElement.get(element); if (players) { players.forEach(player => player.finish()); } } whenRenderingDone() { return new Promise(resolve => { if (this.players.length) { return optimizeGroupPlayer(this.players).onDone(() => resolve()); } else { resolve(); } }); } processLeaveNode(element) { const details = element[REMOVAL_FLAG]; if (details && details.setForRemoval) { // this will prevent it from removing it twice element[REMOVAL_FLAG] = NULL_REMOVAL_STATE; if (details.namespaceId) { this.destroyInnerAnimations(element); const ns = this._fetchNamespace(details.namespaceId); if (ns) { ns.clearElementCache(element); } } this._onRemovalComplete(element, details.setForRemoval); } if (this.driver.matchesElement(element, DISABLED_SELECTOR)) { this.markElementAsDisabled(element, false); } this.driver.query(element, DISABLED_SELECTOR, true).forEach(node => { this.markElementAsDisabled(node, false); }); } flush(microtaskId = -1) { let players = []; if (this.newHostElements.size) { this.newHostElements.forEach((ns, element) => this._balanceNamespaceList(ns, element)); this.newHostElements.clear(); } if (this.totalAnimations && this.collectedEnterElements.length) { for (let i = 0; i < this.collectedEnterElements.length; i++) { const elm = this.collectedEnterElements[i]; addClass(elm, STAR_CLASSNAME); } } if (this._namespaceList.length && (this.totalQueuedPlayers || this.collectedLeaveElements.length)) { const cleanupFns = []; try { players = this._flushAnimations(cleanupFns, microtaskId); } finally { for (let i = 0; i < cleanupFns.length; i++) { cleanupFns[i](); } } } else { for (let i = 0; i < this.collectedLeaveElements.length; i++) { const element = this.collectedLeaveElements[i]; this.processLeaveNode(element); } } this.totalQueuedPlayers = 0; this.collectedEnterElements.length = 0; this.collectedLeaveElements.length = 0; this._flushFns.forEach(fn => fn()); this._flushFns = []; if (this._whenQuietFns.length) { // we move these over to a variable so that // if any new callbacks are registered in another // flush they do not populate the existing set const quietFns = this._whenQuietFns; this._whenQuietFns = []; if (players.length) { optimizeGroupPlayer(players).onDone(() => { quietFns.forEach(fn => fn()); }); } else { quietFns.forEach(fn => fn()); } } } reportError(errors) { throw new Error(`Unable to process animations due to the following failed trigger transitions\n ${errors.join('\n')}`); } _flushAnimations(cleanupFns, microtaskId) { const subTimelines = new ElementInstructionMap(); const skippedPlayers = []; const skippedPlayersMap = new Map(); const queuedInstructions = []; const queriedElements = new Map(); const allPreStyleElements = new Map(); const allPostStyleElements = new Map(); const disabledElementsSet = new Set(); this.disabledNodes.forEach(node => { disabledElementsSet.add(node); const nodesThatAreDisabled = this.driver.query(node, QUEUED_SELECTOR, true); for (let i = 0; i < nodesThatAreDisabled.length; i++) { disabledElementsSet.add(nodesThatAreDisabled[i]); } }); const bodyNode = this.bodyNode; const allTriggerElements = Array.from(this.statesByElement.keys()); const enterNodeMap = buildRootMap(allTriggerElements, this.collectedEnterElements); // this must occur before the instructions are built below such that // the :enter queries match the elements (since the timeline queries // are fired during instruction building). const enterNodeMapIds = new Map(); let i = 0; enterNodeMap.forEach((nodes, root) => { const className = ENTER_CLASSNAME + i++; enterNodeMapIds.set(root, className); nodes.forEach(node => addClass(node, className)); }); const allLeaveNodes = []; const mergedLeaveNodes = new Set(); const leaveNodesWithoutAnimations = new Set(); for (let i = 0; i < this.collectedLeaveElements.length; i++) { const element = this.collectedLeaveElements[i]; const details = element[REMOVAL_FLAG]; if (details && details.setForRemoval) { allLeaveNodes.push(element); mergedLeaveNodes.add(element); if (details.hasAnimation) { this.driver.query(element, STAR_SELECTOR, true).forEach(elm => mergedLeaveNodes.add(elm)); } else { leaveNodesWithoutAnimations.add(element); } } } const leaveNodeMapIds = new Map(); const leaveNodeMap = buildRootMap(allTriggerElements, Array.from(mergedLeaveNodes)); leaveNodeMap.forEach((nodes, root) => { const className = LEAVE_CLASSNAME + i++; leaveNodeMapIds.set(root, className); nodes.forEach(node => addClass(node, className)); }); cleanupFns.push(() => { enterNodeMap.forEach((nodes, root) => { const className = enterNodeMapIds.get(root); nodes.forEach(node => removeClass(node, className)); }); leaveNodeMap.forEach((nodes, root) => { const className = leaveNodeMapIds.get(root); nodes.forEach(node => removeClass(node, className)); }); allLeaveNodes.forEach(element => { this.processLeaveNode(element); }); }); const allPlayers = []; const erroneousTransitions = []; for (let i = this._namespaceList.length - 1; i >= 0; i--) { const ns = this._namespaceList[i]; ns.drainQueuedTransitions(microtaskId).forEach(entry => { const player = entry.player; const element = entry.element; allPlayers.push(player); if (this.collectedEnterElements.length) { const details = element[REMOVAL_FLAG]; // move animations are currently not supported... if (details && details.setForMove) { player.destroy(); return; } } const nodeIsOrphaned = !bodyNode || !this.driver.containsElement(bodyNode, element); const leaveClassName = leaveNodeMapIds.get(element); const enterClassName = enterNodeMapIds.get(element); const instruction = this._buildInstruction(entry, subTimelines, enterClassName, leaveClassName, nodeIsOrphaned); if (instruction.errors && instruction.errors.length) { erroneousTransitions.push(instruction); return; } // even though the element may not be apart of the DOM, it may // still be added at a later point (due to the mechanics of content // projection and/or dynamic component insertion) therefore it's // important we still style the element. if (nodeIsOrphaned) { player.onStart(() => eraseStyles(element, instruction.fromStyles)); player.onDestroy(() => setStyles(element, instruction.toStyles)); skippedPlayers.push(player); return; } // if a unmatched transition is queued to go then it SHOULD NOT render // an animation and cancel the previously running animations. if (entry.isFallbackTransition) { player.onStart(() => eraseStyles(element, instruction.fromStyles)); player.onDestroy(() => setStyles(element, instruction.toStyles)); skippedPlayers.push(player); return; } // this means that if a parent animation uses this animation as a sub trigger // then it will instruct the timeline builder to not add a player delay, but // instead stretch the first keyframe gap up until the animation starts. The // reason this is important is to prevent extra initialization styles from being // required by the user in the animation. instruction.timelines.forEach(tl => tl.stretchStartingKeyframe = true); subTimelines.append(element, instruction.timelines); const tuple = { instruction, player, element }; queuedInstructions.push(tuple); instruction.queriedElements.forEach(element => getOrSetAsInMap(queriedElements, element, []).push(player)); instruction.preStyleProps.forEach((stringMap, element) => { const props = Object.keys(stringMap); if (props.length) { let setVal = allPreStyleElements.get(element); if (!setVal) { allPreStyleElements.set(element, setVal = new Set()); } props.forEach(prop => setVal.add(prop)); } }); instruction.postStyleProps.forEach((stringMap, element) => { const props = Object.keys(stringMap); let setVal = allPostStyleElements.get(element); if (!setVal) { allPostStyleElements.set(element, setVal = new Set()); } props.forEach(prop => setVal.add(prop)); }); }); } if (erroneousTransitions.length) { const errors = []; erroneousTransitions.forEach(instruction => { errors.push(`@${instruction.triggerName} has failed due to:\n`); instruction.errors.forEach(error => errors.push(`- ${error}\n`)); }); allPlayers.forEach(player => player.destroy()); this.reportError(errors); } const allPreviousPlayersMap = new Map(); // this map works to tell which element in the DOM tree is contained by // which animation. Further down below this map will get populated once // the players are built and in doing so it can efficiently figure out // if a sub player is skipped due to a parent player having priority. const animationElementMap = new Map(); queuedInstructions.forEach(entry => { const element = entry.element; if (subTimelines.has(element)) { animationElementMap.set(element, element); this._beforeAnimationBuild(entry.player.namespaceId, entry.instruction, allPreviousPlayersMap); } }); skippedPlayers.forEach(player => { const element = player.element; const previousPlayers = this._getPreviousPlayers(element, false, player.namespaceId, player.triggerName, null); previousPlayers.forEach(prevPlayer => { getOrSetAsInMap(allPreviousPlayersMap, element, []).push(prevPlayer); prevPlayer.destroy(); }); }); // this is a special case for nodes that will be removed (either by) // having their own leave animations or by being queried in a container // that will be removed once a parent animation is complete. The idea // here is that * styles must be identical to ! styles because of // backwards compatibility (* is also filled in by default in many places). // Otherwise * styles will return an empty value or auto since the element // that is being getComputedStyle'd will not be visible (since * = destination) const replaceNodes = allLeaveNodes.filter(node => { return replacePostStylesAsPre(node, allPreStyleElements, allPostStyleElements); }); // POST STAGE: fill the * styles const postStylesMap = new Map(); const allLeaveQueriedNodes = cloakAndComputeStyles(postStylesMap, this.driver, leaveNodesWithoutAnimations, allPostStyleElements, _angular_animations__WEBPACK_IMPORTED_MODULE_0__["AUTO_STYLE"]); allLeaveQueriedNodes.forEach(node => { if (replacePostStylesAsPre(node, allPreStyleElements, allPostStyleElements)) { replaceNodes.push(node); } }); // PRE STAGE: fill the ! styles const preStylesMap = new Map(); enterNodeMap.forEach((nodes, root) => { cloakAndComputeStyles(preStylesMap, this.driver, new Set(nodes), allPreStyleElements, _angular_animations__WEBPACK_IMPORTED_MODULE_0__["ɵPRE_STYLE"]); }); replaceNodes.forEach(node => { const post = postStylesMap.get(node); const pre = preStylesMap.get(node); postStylesMap.set(node, Object.assign(Object.assign({}, post), pre)); }); const rootPlayers = []; const subPlayers = []; const NO_PARENT_ANIMATION_ELEMENT_DETECTED = {}; queuedInstructions.forEach(entry => { const { element, player, instruction } = entry; // this means that it was never consumed by a parent animation which // means that it is independent and therefore should be set for animation if (subTimelines.has(element)) { if (disabledElementsSet.has(element)) { player.onDestroy(() => setStyles(element, instruction.toStyles)); player.disabled = true; player.overrideTotalTime(instruction.totalTime); skippedPlayers.push(player); return; } // this will flow up the DOM and query the map to figure out // if a parent animation has priority over it. In the situation // that a parent is detected then it will cancel the loop. If // nothing is detected, or it takes a few hops to find a parent, // then it will fill in the missing nodes and signal them as having // a detected parent (or a NO_PARENT value via a special constant). let parentWithAnimation = NO_PARENT_ANIMATION_ELEMENT_DETECTED; if (animationElementMap.size > 1) { let elm = element; const parentsToAdd = []; while (elm = elm.parentNode) { const detectedParent = animationElementMap.get(elm); if (detectedParent) { parentWithAnimation = detectedParent; break; } parentsToAdd.push(elm); } parentsToAdd.forEach(parent => animationElementMap.set(parent, parentWithAnimation)); } const innerPlayer = this._buildAnimation(player.namespaceId, instruction, allPreviousPlayersMap, skippedPlayersMap, preStylesMap, postStylesMap); player.setRealPlayer(innerPlayer); if (parentWithAnimation === NO_PARENT_ANIMATION_ELEMENT_DETECTED) { rootPlayers.push(player); } else { const parentPlayers = this.playersByElement.get(parentWithAnimation); if (parentPlayers && parentPlayers.length) { player.parentPlayer = optimizeGroupPlayer(parentPlayers); } skippedPlayers.push(player); } } else { eraseStyles(element, instruction.fromStyles); player.onDestroy(() => setStyles(element, instruction.toStyles)); // there still might be a ancestor player animating this // element therefore we will still add it as a sub player // even if its animation may be disabled subPlayers.push(player); if (disabledElementsSet.has(element)) { skippedPlayers.push(player); } } }); // find all of the sub players' corresponding inner animation player subPlayers.forEach(player => { // even if any players are not found for a sub animation then it // will still complete itself after the next tick since it's Noop const playersForElement = skippedPlayersMap.get(player.element); if (playersForElement && playersForElement.length) { const innerPlayer = optimizeGroupPlayer(playersForElement); player.setRealPlayer(innerPlayer); } }); // the reason why we don't actually play the animation is // because all that a skipped player is designed to do is to // fire the start/done transition callback events skippedPlayers.forEach(player => { if (player.parentPlayer) { player.syncPlayerEvents(player.parentPlayer); } else { player.destroy(); } }); // run through all of the queued removals and see if they // were picked up by a query. If not then perform the removal // operation right away unless a parent animation is ongoing. for (let i = 0; i < allLeaveNodes.length; i++) { const element = allLeaveNodes[i]; const details = element[REMOVAL_FLAG]; removeClass(element, LEAVE_CLASSNAME); // this means the element has a removal animation that is being // taken care of and therefore the inner elements will hang around // until that animation is over (or the parent queried animation) if (details && details.hasAnimation) continue; let players = []; // if this element is queried or if it contains queried children // then we want for the element not to be removed from the page // until the queried animations have finished if (queriedElements.size) { let queriedPlayerResults = queriedElements.get(element); if (queriedPlayerResults && queriedPlayerResults.length) { players.push(...queriedPlayerResults); } let queriedInnerElements = this.driver.query(element, NG_ANIMATING_SELECTOR, true); for (let j = 0; j < queriedInnerElements.length; j++) { let queriedPlayers = queriedElements.get(queriedInnerElements[j]); if (queriedPlayers && queriedPlayers.length) { players.push(...queriedPlayers); } } } const activePlayers = players.filter(p => !p.destroyed); if (activePlayers.length) { removeNodesAfterAnimationDone(this, element, activePlayers); } else { this.processLeaveNode(element); } } // this is required so the cleanup method doesn't remove them allLeaveNodes.length = 0; rootPlayers.forEach(player => { this.players.push(player); player.onDone(() => { player.destroy(); const index = this.players.indexOf(player); this.players.splice(index, 1); }); player.play(); }); return rootPlayers; } elementContainsData(namespaceId, element) { let containsData = false; const details = element[REMOVAL_FLAG]; if (details && details.setForRemoval) containsData = true; if (this.playersByElement.has(element)) containsData = true; if (this.playersByQueriedElement.has(element)) containsData = true; if (this.statesByElement.has(element)) containsData = true; return this._fetchNamespace(namespaceId).elementContainsData(element) || containsData; } afterFlush(callback) { this._flushFns.push(callback); } afterFlushAnimationsDone(callback) { this._whenQuietFns.push(callback); } _getPreviousPlayers(element, isQueriedElement, namespaceId, triggerName, toStateValue) { let players = []; if (isQueriedElement) { const queriedElementPlayers = this.playersByQueriedElement.get(element); if (queriedElementPlayers) { players = queriedElementPlayers; } } else { const elementPlayers = this.playersByElement.get(element); if (elementPlayers) { const isRemovalAnimation = !toStateValue || toStateValue == VOID_VALUE; elementPlayers.forEach(player => { if (player.queued) return; if (!isRemovalAnimation && player.triggerName != triggerName) return; players.push(player); }); } } if (namespaceId || triggerName) { players = players.filter(player => { if (namespaceId && namespaceId != player.namespaceId) return false; if (triggerName && triggerName != player.triggerName) return false; return true; }); } return players; } _beforeAnimationBuild(namespaceId, instruction, allPreviousPlayersMap) { const triggerName = instruction.triggerName; const rootElement = instruction.element; // when a removal animation occurs, ALL previous players are collected // and destroyed (even if they are outside of the current namespace) const targetNameSpaceId = instruction.isRemovalTransition ? undefined : namespaceId; const targetTriggerName = instruction.isRemovalTransition ? undefined : triggerName; for (const timelineInstruction of instruction.timelines) { const element = timelineInstruction.element; const isQueriedElement = element !== rootElement; const players = getOrSetAsInMap(allPreviousPlayersMap, element, []); const previousPlayers = this._getPreviousPlayers(element, isQueriedElement, targetNameSpaceId, targetTriggerName, instruction.toState); previousPlayers.forEach(player => { const realPlayer = player.getRealPlayer(); if (realPlayer.beforeDestroy) { realPlayer.beforeDestroy(); } player.destroy(); players.push(player); }); } // this needs to be done so that the PRE/POST styles can be // computed properly without interfering with the previous animation eraseStyles(rootElement, instruction.fromStyles); } _buildAnimation(namespaceId, instruction, allPreviousPlayersMap, skippedPlayersMap, preStylesMap, postStylesMap) { const triggerName = instruction.triggerName; const rootElement = instruction.element; // we first run this so that the previous animation player // data can be passed into the successive animation players const allQueriedPlayers = []; const allConsumedElements = new Set(); const allSubElements = new Set(); const allNewPlayers = instruction.timelines.map(timelineInstruction => { const element = timelineInstruction.element; allConsumedElements.add(element); // FIXME (matsko): make sure to-be-removed animations are removed properly const details = element[REMOVAL_FLAG]; if (details && details.removedBeforeQueried) return new _angular_animations__WEBPACK_IMPORTED_MODULE_0__["NoopAnimationPlayer"](timelineInstruction.duration, timelineInstruction.delay); const isQueriedElement = element !== rootElement; const previousPlayers = flattenGroupPlayers((allPreviousPlayersMap.get(element) || EMPTY_PLAYER_ARRAY) .map(p => p.getRealPlayer())) .filter(p => { // the `element` is not apart of the AnimationPlayer definition, but // Mock/WebAnimations // use the element within their implementation. This will be added in Angular5 to // AnimationPlayer const pp = p; return pp.element ? pp.element === element : false; }); const preStyles = preStylesMap.get(element); const postStyles = postStylesMap.get(element); const keyframes = normalizeKeyframes(this.driver, this._normalizer, element, timelineInstruction.keyframes, preStyles, postStyles); const player = this._buildPlayer(timelineInstruction, keyframes, previousPlayers); // this means that this particular player belongs to a sub trigger. It is // important that we match this player up with the corresponding (@trigger.listener) if (timelineInstruction.subTimeline && skippedPlayersMap) { allSubElements.add(element); } if (isQueriedElement) { const wrappedPlayer = new TransitionAnimationPlayer(namespaceId, triggerName, element); wrappedPlayer.setRealPlayer(player); allQueriedPlayers.push(wrappedPlayer); } return player; }); allQueriedPlayers.forEach(player => { getOrSetAsInMap(this.playersByQueriedElement, player.element, []).push(player); player.onDone(() => deleteOrUnsetInMap(this.playersByQueriedElement, player.element, player)); }); allConsumedElements.forEach(element => addClass(element, NG_ANIMATING_CLASSNAME)); const player = optimizeGroupPlayer(allNewPlayers); player.onDestroy(() => { allConsumedElements.forEach(element => removeClass(element, NG_ANIMATING_CLASSNAME)); setStyles(rootElement, instruction.toStyles); }); // this basically makes all of the callbacks for sub element animations // be dependent on the upper players for when they finish allSubElements.forEach(element => { getOrSetAsInMap(skippedPlayersMap, element, []).push(player); }); return player; } _buildPlayer(instruction, keyframes, previousPlayers) { if (keyframes.length > 0) { return this.driver.animate(instruction.element, keyframes, instruction.duration, instruction.delay, instruction.easing, previousPlayers); } // special case for when an empty transition|definition is provided // ... there is no point in rendering an empty animation return new _angular_animations__WEBPACK_IMPORTED_MODULE_0__["NoopAnimationPlayer"](instruction.duration, instruction.delay); } } class TransitionAnimationPlayer { constructor(namespaceId, triggerName, element) { this.namespaceId = namespaceId; this.triggerName = triggerName; this.element = element; this._player = new _angular_animations__WEBPACK_IMPORTED_MODULE_0__["NoopAnimationPlayer"](); this._containsRealPlayer = false; this._queuedCallbacks = {}; this.destroyed = false; this.markedForDestroy = false; this.disabled = false; this.queued = true; this.totalTime = 0; } setRealPlayer(player) { if (this._containsRealPlayer) return; this._player = player; Object.keys(this._queuedCallbacks).forEach(phase => { this._queuedCallbacks[phase].forEach(callback => listenOnPlayer(player, phase, undefined, callback)); }); this._queuedCallbacks = {}; this._containsRealPlayer = true; this.overrideTotalTime(player.totalTime); this.queued = false; } getRealPlayer() { return this._player; } overrideTotalTime(totalTime) { this.totalTime = totalTime; } syncPlayerEvents(player) { const p = this._player; if (p.triggerCallback) { player.onStart(() => p.triggerCallback('start')); } player.onDone(() => this.finish()); player.onDestroy(() => this.destroy()); } _queueEvent(name, callback) { getOrSetAsInMap(this._queuedCallbacks, name, []).push(callback); } onDone(fn) { if (this.queued) { this._queueEvent('done', fn); } this._player.onDone(fn); } onStart(fn) { if (this.queued) { this._queueEvent('start', fn); } this._player.onStart(fn); } onDestroy(fn) { if (this.queued) { this._queueEvent('destroy', fn); } this._player.onDestroy(fn); } init() { this._player.init(); } hasStarted() { return this.queued ? false : this._player.hasStarted(); } play() { !this.queued && this._player.play(); } pause() { !this.queued && this._player.pause(); } restart() { !this.queued && this._player.restart(); } finish() { this._player.finish(); } destroy() { this.destroyed = true; this._player.destroy(); } reset() { !this.queued && this._player.reset(); } setPosition(p) { if (!this.queued) { this._player.setPosition(p); } } getPosition() { return this.queued ? 0 : this._player.getPosition(); } /** @internal */ triggerCallback(phaseName) { const p = this._player; if (p.triggerCallback) { p.triggerCallback(phaseName); } } } function deleteOrUnsetInMap(map, key, value) { let currentValues; if (map instanceof Map) { currentValues = map.get(key); if (currentValues) { if (currentValues.length) { const index = currentValues.indexOf(value); currentValues.splice(index, 1); } if (currentValues.length == 0) { map.delete(key); } } } else { currentValues = map[key]; if (currentValues) { if (currentValues.length) { const index = currentValues.indexOf(value); currentValues.splice(index, 1); } if (currentValues.length == 0) { delete map[key]; } } } return currentValues; } function normalizeTriggerValue(value) { // we use `!= null` here because it's the most simple // way to test against a "falsy" value without mixing // in empty strings or a zero value. DO NOT OPTIMIZE. return value != null ? value : null; } function isElementNode(node) { return node && node['nodeType'] === 1; } function isTriggerEventValid(eventName) { return eventName == 'start' || eventName == 'done'; } function cloakElement(element, value) { const oldValue = element.style.display; element.style.display = value != null ? value : 'none'; return oldValue; } function cloakAndComputeStyles(valuesMap, driver, elements, elementPropsMap, defaultStyle) { const cloakVals = []; elements.forEach(element => cloakVals.push(cloakElement(element))); const failedElements = []; elementPropsMap.forEach((props, element) => { const styles = {}; props.forEach(prop => { const value = styles[prop] = driver.computeStyle(element, prop, defaultStyle); // there is no easy way to detect this because a sub element could be removed // by a parent animation element being detached. if (!value || value.length == 0) { element[REMOVAL_FLAG] = NULL_REMOVED_QUERIED_STATE; failedElements.push(element); } }); valuesMap.set(element, styles); }); // we use a index variable here since Set.forEach(a, i) does not return // an index value for the closure (but instead just the value) let i = 0; elements.forEach(element => cloakElement(element, cloakVals[i++])); return failedElements; } /* Since the Angular renderer code will return a collection of inserted nodes in all areas of a DOM tree, it's up to this algorithm to figure out which nodes are roots for each animation @trigger. By placing each inserted node into a Set and traversing upwards, it is possible to find the @trigger elements and well any direct *star insertion nodes, if a @trigger root is found then the enter element is placed into the Map[@trigger] spot. */ function buildRootMap(roots, nodes) { const rootMap = new Map(); roots.forEach(root => rootMap.set(root, [])); if (nodes.length == 0) return rootMap; const NULL_NODE = 1; const nodeSet = new Set(nodes); const localRootMap = new Map(); function getRoot(node) { if (!node) return NULL_NODE; let root = localRootMap.get(node); if (root) return root; const parent = node.parentNode; if (rootMap.has(parent)) { // ngIf inside @trigger root = parent; } else if (nodeSet.has(parent)) { // ngIf inside ngIf root = NULL_NODE; } else { // recurse upwards root = getRoot(parent); } localRootMap.set(node, root); return root; } nodes.forEach(node => { const root = getRoot(node); if (root !== NULL_NODE) { rootMap.get(root).push(node); } }); return rootMap; } const CLASSES_CACHE_KEY = '$$classes'; function containsClass(element, className) { if (element.classList) { return element.classList.contains(className); } else { const classes = element[CLASSES_CACHE_KEY]; return classes && classes[className]; } } function addClass(element, className) { if (element.classList) { element.classList.add(className); } else { let classes = element[CLASSES_CACHE_KEY]; if (!classes) { classes = element[CLASSES_CACHE_KEY] = {}; } classes[className] = true; } } function removeClass(element, className) { if (element.classList) { element.classList.remove(className); } else { let classes = element[CLASSES_CACHE_KEY]; if (classes) { delete classes[className]; } } } function removeNodesAfterAnimationDone(engine, element, players) { optimizeGroupPlayer(players).onDone(() => engine.processLeaveNode(element)); } function flattenGroupPlayers(players) { const finalPlayers = []; _flattenGroupPlayersRecur(players, finalPlayers); return finalPlayers; } function _flattenGroupPlayersRecur(players, finalPlayers) { for (let i = 0; i < players.length; i++) { const player = players[i]; if (player instanceof _angular_animations__WEBPACK_IMPORTED_MODULE_0__["ɵAnimationGroupPlayer"]) { _flattenGroupPlayersRecur(player.players, finalPlayers); } else { finalPlayers.push(player); } } } function objEquals(a, b) { const k1 = Object.keys(a); const k2 = Object.keys(b); if (k1.length != k2.length) return false; for (let i = 0; i < k1.length; i++) { const prop = k1[i]; if (!b.hasOwnProperty(prop) || a[prop] !== b[prop]) return false; } return true; } function replacePostStylesAsPre(element, allPreStyleElements, allPostStyleElements) { const postEntry = allPostStyleElements.get(element); if (!postEntry) return false; let preEntry = allPreStyleElements.get(element); if (preEntry) { postEntry.forEach(data => preEntry.add(data)); } else { allPreStyleElements.set(element, postEntry); } allPostStyleElements.delete(element); return true; } class AnimationEngine { constructor(bodyNode, _driver, normalizer) { this.bodyNode = bodyNode; this._driver = _driver; this._triggerCache = {}; // this method is designed to be overridden by the code that uses this engine this.onRemovalComplete = (element, context) => { }; this._transitionEngine = new TransitionAnimationEngine(bodyNode, _driver, normalizer); this._timelineEngine = new TimelineAnimationEngine(bodyNode, _driver, normalizer); this._transitionEngine.onRemovalComplete = (element, context) => this.onRemovalComplete(element, context); } registerTrigger(componentId, namespaceId, hostElement, name, metadata) { const cacheKey = componentId + '-' + name; let trigger = this._triggerCache[cacheKey]; if (!trigger) { const errors = []; const ast = buildAnimationAst(this._driver, metadata, errors); if (errors.length) { throw new Error(`The animation trigger "${name}" has failed to build due to the following errors:\n - ${errors.join('\n - ')}`); } trigger = buildTrigger(name, ast); this._triggerCache[cacheKey] = trigger; } this._transitionEngine.registerTrigger(namespaceId, name, trigger); } register(namespaceId, hostElement) { this._transitionEngine.register(namespaceId, hostElement); } destroy(namespaceId, context) { this._transitionEngine.destroy(namespaceId, context); } onInsert(namespaceId, element, parent, insertBefore) { this._transitionEngine.insertNode(namespaceId, element, parent, insertBefore); } onRemove(namespaceId, element, context, isHostElement) { this._transitionEngine.removeNode(namespaceId, element, isHostElement || false, context); } disableAnimations(element, disable) { this._transitionEngine.markElementAsDisabled(element, disable); } process(namespaceId, element, property, value) { if (property.charAt(0) == '@') { const [id, action] = parseTimelineCommand(property); const args = value; this._timelineEngine.command(id, element, action, args); } else { this._transitionEngine.trigger(namespaceId, element, property, value); } } listen(namespaceId, element, eventName, eventPhase, callback) { // @@listen if (eventName.charAt(0) == '@') { const [id, action] = parseTimelineCommand(eventName); return this._timelineEngine.listen(id, element, action, callback); } return this._transitionEngine.listen(namespaceId, element, eventName, eventPhase, callback); } flush(microtaskId = -1) { this._transitionEngine.flush(microtaskId); } get players() { return this._transitionEngine.players .concat(this._timelineEngine.players); } whenRenderingDone() { return this._transitionEngine.whenRenderingDone(); } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Returns an instance of `SpecialCasedStyles` if and when any special (non animateable) styles are * detected. * * In CSS there exist properties that cannot be animated within a keyframe animation * (whether it be via CSS keyframes or web-animations) and the animation implementation * will ignore them. This function is designed to detect those special cased styles and * return a container that will be executed at the start and end of the animation. * * @returns an instance of `SpecialCasedStyles` if any special styles are detected otherwise `null` */ function packageNonAnimatableStyles(element, styles) { let startStyles = null; let endStyles = null; if (Array.isArray(styles) && styles.length) { startStyles = filterNonAnimatableStyles(styles[0]); if (styles.length > 1) { endStyles = filterNonAnimatableStyles(styles[styles.length - 1]); } } else if (styles) { startStyles = filterNonAnimatableStyles(styles); } return (startStyles || endStyles) ? new SpecialCasedStyles(element, startStyles, endStyles) : null; } /** * Designed to be executed during a keyframe-based animation to apply any special-cased styles. * * When started (when the `start()` method is run) then the provided `startStyles` * will be applied. When finished (when the `finish()` method is called) the * `endStyles` will be applied as well any any starting styles. Finally when * `destroy()` is called then all styles will be removed. */ class SpecialCasedStyles { constructor(_element, _startStyles, _endStyles) { this._element = _element; this._startStyles = _startStyles; this._endStyles = _endStyles; this._state = 0 /* Pending */; let initialStyles = SpecialCasedStyles.initialStylesByElement.get(_element); if (!initialStyles) { SpecialCasedStyles.initialStylesByElement.set(_element, initialStyles = {}); } this._initialStyles = initialStyles; } start() { if (this._state < 1 /* Started */) { if (this._startStyles) { setStyles(this._element, this._startStyles, this._initialStyles); } this._state = 1 /* Started */; } } finish() { this.start(); if (this._state < 2 /* Finished */) { setStyles(this._element, this._initialStyles); if (this._endStyles) { setStyles(this._element, this._endStyles); this._endStyles = null; } this._state = 1 /* Started */; } } destroy() { this.finish(); if (this._state < 3 /* Destroyed */) { SpecialCasedStyles.initialStylesByElement.delete(this._element); if (this._startStyles) { eraseStyles(this._element, this._startStyles); this._endStyles = null; } if (this._endStyles) { eraseStyles(this._element, this._endStyles); this._endStyles = null; } setStyles(this._element, this._initialStyles); this._state = 3 /* Destroyed */; } } } SpecialCasedStyles.initialStylesByElement = new WeakMap(); function filterNonAnimatableStyles(styles) { let result = null; const props = Object.keys(styles); for (let i = 0; i < props.length; i++) { const prop = props[i]; if (isNonAnimatableStyle(prop)) { result = result || {}; result[prop] = styles[prop]; } } return result; } function isNonAnimatableStyle(prop) { return prop === 'display' || prop === 'position'; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ const ELAPSED_TIME_MAX_DECIMAL_PLACES = 3; const ANIMATION_PROP = 'animation'; const ANIMATIONEND_EVENT = 'animationend'; const ONE_SECOND$1 = 1000; class ElementAnimationStyleHandler { constructor(_element, _name, _duration, _delay, _easing, _fillMode, _onDoneFn) { this._element = _element; this._name = _name; this._duration = _duration; this._delay = _delay; this._easing = _easing; this._fillMode = _fillMode; this._onDoneFn = _onDoneFn; this._finished = false; this._destroyed = false; this._startTime = 0; this._position = 0; this._eventFn = (e) => this._handleCallback(e); } apply() { applyKeyframeAnimation(this._element, `${this._duration}ms ${this._easing} ${this._delay}ms 1 normal ${this._fillMode} ${this._name}`); addRemoveAnimationEvent(this._element, this._eventFn, false); this._startTime = Date.now(); } pause() { playPauseAnimation(this._element, this._name, 'paused'); } resume() { playPauseAnimation(this._element, this._name, 'running'); } setPosition(position) { const index = findIndexForAnimation(this._element, this._name); this._position = position * this._duration; setAnimationStyle(this._element, 'Delay', `-${this._position}ms`, index); } getPosition() { return this._position; } _handleCallback(event) { const timestamp = event._ngTestManualTimestamp || Date.now(); const elapsedTime = parseFloat(event.elapsedTime.toFixed(ELAPSED_TIME_MAX_DECIMAL_PLACES)) * ONE_SECOND$1; if (event.animationName == this._name && Math.max(timestamp - this._startTime, 0) >= this._delay && elapsedTime >= this._duration) { this.finish(); } } finish() { if (this._finished) return; this._finished = true; this._onDoneFn(); addRemoveAnimationEvent(this._element, this._eventFn, true); } destroy() { if (this._destroyed) return; this._destroyed = true; this.finish(); removeKeyframeAnimation(this._element, this._name); } } function playPauseAnimation(element, name, status) { const index = findIndexForAnimation(element, name); setAnimationStyle(element, 'PlayState', status, index); } function applyKeyframeAnimation(element, value) { const anim = getAnimationStyle(element, '').trim(); let index = 0; if (anim.length) { index = countChars(anim, ',') + 1; value = `${anim}, ${value}`; } setAnimationStyle(element, '', value); return index; } function removeKeyframeAnimation(element, name) { const anim = getAnimationStyle(element, ''); const tokens = anim.split(','); const index = findMatchingTokenIndex(tokens, name); if (index >= 0) { tokens.splice(index, 1); const newValue = tokens.join(','); setAnimationStyle(element, '', newValue); } } function findIndexForAnimation(element, value) { const anim = getAnimationStyle(element, ''); if (anim.indexOf(',') > 0) { const tokens = anim.split(','); return findMatchingTokenIndex(tokens, value); } return findMatchingTokenIndex([anim], value); } function findMatchingTokenIndex(tokens, searchToken) { for (let i = 0; i < tokens.length; i++) { if (tokens[i].indexOf(searchToken) >= 0) { return i; } } return -1; } function addRemoveAnimationEvent(element, fn, doRemove) { doRemove ? element.removeEventListener(ANIMATIONEND_EVENT, fn) : element.addEventListener(ANIMATIONEND_EVENT, fn); } function setAnimationStyle(element, name, value, index) { const prop = ANIMATION_PROP + name; if (index != null) { const oldValue = element.style[prop]; if (oldValue.length) { const tokens = oldValue.split(','); tokens[index] = value; value = tokens.join(','); } } element.style[prop] = value; } function getAnimationStyle(element, name) { return element.style[ANIMATION_PROP + name]; } function countChars(value, char) { let count = 0; for (let i = 0; i < value.length; i++) { const c = value.charAt(i); if (c === char) count++; } return count; } const DEFAULT_FILL_MODE = 'forwards'; const DEFAULT_EASING = 'linear'; class CssKeyframesPlayer { constructor(element, keyframes, animationName, _duration, _delay, easing, _finalStyles, _specialStyles) { this.element = element; this.keyframes = keyframes; this.animationName = animationName; this._duration = _duration; this._delay = _delay; this._finalStyles = _finalStyles; this._specialStyles = _specialStyles; this._onDoneFns = []; this._onStartFns = []; this._onDestroyFns = []; this._started = false; this.currentSnapshot = {}; this._state = 0; this.easing = easing || DEFAULT_EASING; this.totalTime = _duration + _delay; this._buildStyler(); } onStart(fn) { this._onStartFns.push(fn); } onDone(fn) { this._onDoneFns.push(fn); } onDestroy(fn) { this._onDestroyFns.push(fn); } destroy() { this.init(); if (this._state >= 4 /* DESTROYED */) return; this._state = 4 /* DESTROYED */; this._styler.destroy(); this._flushStartFns(); this._flushDoneFns(); if (this._specialStyles) { this._specialStyles.destroy(); } this._onDestroyFns.forEach(fn => fn()); this._onDestroyFns = []; } _flushDoneFns() { this._onDoneFns.forEach(fn => fn()); this._onDoneFns = []; } _flushStartFns() { this._onStartFns.forEach(fn => fn()); this._onStartFns = []; } finish() { this.init(); if (this._state >= 3 /* FINISHED */) return; this._state = 3 /* FINISHED */; this._styler.finish(); this._flushStartFns(); if (this._specialStyles) { this._specialStyles.finish(); } this._flushDoneFns(); } setPosition(value) { this._styler.setPosition(value); } getPosition() { return this._styler.getPosition(); } hasStarted() { return this._state >= 2 /* STARTED */; } init() { if (this._state >= 1 /* INITIALIZED */) return; this._state = 1 /* INITIALIZED */; const elm = this.element; this._styler.apply(); if (this._delay) { this._styler.pause(); } } play() { this.init(); if (!this.hasStarted()) { this._flushStartFns(); this._state = 2 /* STARTED */; if (this._specialStyles) { this._specialStyles.start(); } } this._styler.resume(); } pause() { this.init(); this._styler.pause(); } restart() { this.reset(); this.play(); } reset() { this._styler.destroy(); this._buildStyler(); this._styler.apply(); } _buildStyler() { this._styler = new ElementAnimationStyleHandler(this.element, this.animationName, this._duration, this._delay, this.easing, DEFAULT_FILL_MODE, () => this.finish()); } /** @internal */ triggerCallback(phaseName) { const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns; methods.forEach(fn => fn()); methods.length = 0; } beforeDestroy() { this.init(); const styles = {}; if (this.hasStarted()) { const finished = this._state >= 3 /* FINISHED */; Object.keys(this._finalStyles).forEach(prop => { if (prop != 'offset') { styles[prop] = finished ? this._finalStyles[prop] : computeStyle(this.element, prop); } }); } this.currentSnapshot = styles; } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ class DirectStylePlayer extends _angular_animations__WEBPACK_IMPORTED_MODULE_0__["NoopAnimationPlayer"] { constructor(element, styles) { super(); this.element = element; this._startingStyles = {}; this.__initialized = false; this._styles = hypenatePropsObject(styles); } init() { if (this.__initialized || !this._startingStyles) return; this.__initialized = true; Object.keys(this._styles).forEach(prop => { this._startingStyles[prop] = this.element.style[prop]; }); super.init(); } play() { if (!this._startingStyles) return; this.init(); Object.keys(this._styles) .forEach(prop => this.element.style.setProperty(prop, this._styles[prop])); super.play(); } destroy() { if (!this._startingStyles) return; Object.keys(this._startingStyles).forEach(prop => { const value = this._startingStyles[prop]; if (value) { this.element.style.setProperty(prop, value); } else { this.element.style.removeProperty(prop); } }); this._startingStyles = null; super.destroy(); } } const KEYFRAMES_NAME_PREFIX = 'gen_css_kf_'; const TAB_SPACE = ' '; class CssKeyframesDriver { constructor() { this._count = 0; this._head = document.querySelector('head'); this._warningIssued = false; } validateStyleProperty(prop) { return validateStyleProperty(prop); } matchesElement(element, selector) { return matchesElement(element, selector); } containsElement(elm1, elm2) { return containsElement(elm1, elm2); } query(element, selector, multi) { return invokeQuery(element, selector, multi); } computeStyle(element, prop, defaultValue) { return window.getComputedStyle(element)[prop]; } buildKeyframeElement(element, name, keyframes) { keyframes = keyframes.map(kf => hypenatePropsObject(kf)); let keyframeStr = `@keyframes ${name} {\n`; let tab = ''; keyframes.forEach(kf => { tab = TAB_SPACE; const offset = parseFloat(kf['offset']); keyframeStr += `${tab}${offset * 100}% {\n`; tab += TAB_SPACE; Object.keys(kf).forEach(prop => { const value = kf[prop]; switch (prop) { case 'offset': return; case 'easing': if (value) { keyframeStr += `${tab}animation-timing-function: ${value};\n`; } return; default: keyframeStr += `${tab}${prop}: ${value};\n`; return; } }); keyframeStr += `${tab}}\n`; }); keyframeStr += `}\n`; const kfElm = document.createElement('style'); kfElm.textContent = keyframeStr; return kfElm; } animate(element, keyframes, duration, delay, easing, previousPlayers = [], scrubberAccessRequested) { if (scrubberAccessRequested) { this._notifyFaultyScrubber(); } const previousCssKeyframePlayers = previousPlayers.filter(player => player instanceof CssKeyframesPlayer); const previousStyles = {}; if (allowPreviousPlayerStylesMerge(duration, delay)) { previousCssKeyframePlayers.forEach(player => { let styles = player.currentSnapshot; Object.keys(styles).forEach(prop => previousStyles[prop] = styles[prop]); }); } keyframes = balancePreviousStylesIntoKeyframes(element, keyframes, previousStyles); const finalStyles = flattenKeyframesIntoStyles(keyframes); // if there is no animation then there is no point in applying // styles and waiting for an event to get fired. This causes lag. // It's better to just directly apply the styles to the element // via the direct styling animation player. if (duration == 0) { return new DirectStylePlayer(element, finalStyles); } const animationName = `${KEYFRAMES_NAME_PREFIX}${this._count++}`; const kfElm = this.buildKeyframeElement(element, animationName, keyframes); document.querySelector('head').appendChild(kfElm); const specialStyles = packageNonAnimatableStyles(element, keyframes); const player = new CssKeyframesPlayer(element, keyframes, animationName, duration, delay, easing, finalStyles, specialStyles); player.onDestroy(() => removeElement(kfElm)); return player; } _notifyFaultyScrubber() { if (!this._warningIssued) { console.warn('@angular/animations: please load the web-animations.js polyfill to allow programmatic access...\n', ' visit http://bit.ly/IWukam to learn more about using the web-animation-js polyfill.'); this._warningIssued = true; } } } function flattenKeyframesIntoStyles(keyframes) { let flatKeyframes = {}; if (keyframes) { const kfs = Array.isArray(keyframes) ? keyframes : [keyframes]; kfs.forEach(kf => { Object.keys(kf).forEach(prop => { if (prop == 'offset' || prop == 'easing') return; flatKeyframes[prop] = kf[prop]; }); }); } return flatKeyframes; } function removeElement(node) { node.parentNode.removeChild(node); } class WebAnimationsPlayer { constructor(element, keyframes, options, _specialStyles) { this.element = element; this.keyframes = keyframes; this.options = options; this._specialStyles = _specialStyles; this._onDoneFns = []; this._onStartFns = []; this._onDestroyFns = []; this._initialized = false; this._finished = false; this._started = false; this._destroyed = false; this.time = 0; this.parentPlayer = null; this.currentSnapshot = {}; this._duration = options['duration']; this._delay = options['delay'] || 0; this.time = this._duration + this._delay; } _onFinish() { if (!this._finished) { this._finished = true; this._onDoneFns.forEach(fn => fn()); this._onDoneFns = []; } } init() { this._buildPlayer(); this._preparePlayerBeforeStart(); } _buildPlayer() { if (this._initialized) return; this._initialized = true; const keyframes = this.keyframes; this.domPlayer = this._triggerWebAnimation(this.element, keyframes, this.options); this._finalKeyframe = keyframes.length ? keyframes[keyframes.length - 1] : {}; this.domPlayer.addEventListener('finish', () => this._onFinish()); } _preparePlayerBeforeStart() { // this is required so that the player doesn't start to animate right away if (this._delay) { this._resetDomPlayerState(); } else { this.domPlayer.pause(); } } /** @internal */ _triggerWebAnimation(element, keyframes, options) { // jscompiler doesn't seem to know animate is a native property because it's not fully // supported yet across common browsers (we polyfill it for Edge/Safari) [CL #143630929] return element['animate'](keyframes, options); } onStart(fn) { this._onStartFns.push(fn); } onDone(fn) { this._onDoneFns.push(fn); } onDestroy(fn) { this._onDestroyFns.push(fn); } play() { this._buildPlayer(); if (!this.hasStarted()) { this._onStartFns.forEach(fn => fn()); this._onStartFns = []; this._started = true; if (this._specialStyles) { this._specialStyles.start(); } } this.domPlayer.play(); } pause() { this.init(); this.domPlayer.pause(); } finish() { this.init(); if (this._specialStyles) { this._specialStyles.finish(); } this._onFinish(); this.domPlayer.finish(); } reset() { this._resetDomPlayerState(); this._destroyed = false; this._finished = false; this._started = false; } _resetDomPlayerState() { if (this.domPlayer) { this.domPlayer.cancel(); } } restart() { this.reset(); this.play(); } hasStarted() { return this._started; } destroy() { if (!this._destroyed) { this._destroyed = true; this._resetDomPlayerState(); this._onFinish(); if (this._specialStyles) { this._specialStyles.destroy(); } this._onDestroyFns.forEach(fn => fn()); this._onDestroyFns = []; } } setPosition(p) { this.domPlayer.currentTime = p * this.time; } getPosition() { return this.domPlayer.currentTime / this.time; } get totalTime() { return this._delay + this._duration; } beforeDestroy() { const styles = {}; if (this.hasStarted()) { Object.keys(this._finalKeyframe).forEach(prop => { if (prop != 'offset') { styles[prop] = this._finished ? this._finalKeyframe[prop] : computeStyle(this.element, prop); } }); } this.currentSnapshot = styles; } /** @internal */ triggerCallback(phaseName) { const methods = phaseName == 'start' ? this._onStartFns : this._onDoneFns; methods.forEach(fn => fn()); methods.length = 0; } } class WebAnimationsDriver { constructor() { this._isNativeImpl = /\{\s*\[native\s+code\]\s*\}/.test(getElementAnimateFn().toString()); this._cssKeyframesDriver = new CssKeyframesDriver(); } validateStyleProperty(prop) { return validateStyleProperty(prop); } matchesElement(element, selector) { return matchesElement(element, selector); } containsElement(elm1, elm2) { return containsElement(elm1, elm2); } query(element, selector, multi) { return invokeQuery(element, selector, multi); } computeStyle(element, prop, defaultValue) { return window.getComputedStyle(element)[prop]; } overrideWebAnimationsSupport(supported) { this._isNativeImpl = supported; } animate(element, keyframes, duration, delay, easing, previousPlayers = [], scrubberAccessRequested) { const useKeyframes = !scrubberAccessRequested && !this._isNativeImpl; if (useKeyframes) { return this._cssKeyframesDriver.animate(element, keyframes, duration, delay, easing, previousPlayers); } const fill = delay == 0 ? 'both' : 'forwards'; const playerOptions = { duration, delay, fill }; // we check for this to avoid having a null|undefined value be present // for the easing (which results in an error for certain browsers #9752) if (easing) { playerOptions['easing'] = easing; } const previousStyles = {}; const previousWebAnimationPlayers = previousPlayers.filter(player => player instanceof WebAnimationsPlayer); if (allowPreviousPlayerStylesMerge(duration, delay)) { previousWebAnimationPlayers.forEach(player => { let styles = player.currentSnapshot; Object.keys(styles).forEach(prop => previousStyles[prop] = styles[prop]); }); } keyframes = keyframes.map(styles => copyStyles(styles, false)); keyframes = balancePreviousStylesIntoKeyframes(element, keyframes, previousStyles); const specialStyles = packageNonAnimatableStyles(element, keyframes); return new WebAnimationsPlayer(element, keyframes, playerOptions, specialStyles); } } function supportsWebAnimations() { return typeof getElementAnimateFn() === 'function'; } function getElementAnimateFn() { return (isBrowser() && Element.prototype['animate']) || {}; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Generated bundle index. Do not edit. */ //# sourceMappingURL=browser.js.map /* WEBPACK VAR INJECTION */}.call(this, __webpack_require__(/*! ./../../../../process/browser.js */ "./node_modules/process/browser.js"))) /***/ }), /***/ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/a11y.js": /*!*****************************************************************!*\ !*** ./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/a11y.js ***! \*****************************************************************/ /*! exports provided: A11yModule, ActiveDescendantKeyManager, AriaDescriber, CDK_DESCRIBEDBY_HOST_ATTRIBUTE, CDK_DESCRIBEDBY_ID_PREFIX, CdkAriaLive, CdkMonitorFocus, CdkTrapFocus, ConfigurableFocusTrap, ConfigurableFocusTrapFactory, EventListenerFocusTrapInertStrategy, FOCUS_MONITOR_DEFAULT_OPTIONS, FOCUS_TRAP_INERT_STRATEGY, FocusKeyManager, FocusMonitor, FocusTrap, FocusTrapFactory, HighContrastModeDetector, InteractivityChecker, IsFocusableConfig, LIVE_ANNOUNCER_DEFAULT_OPTIONS, LIVE_ANNOUNCER_ELEMENT_TOKEN, LIVE_ANNOUNCER_ELEMENT_TOKEN_FACTORY, ListKeyManager, LiveAnnouncer, MESSAGES_CONTAINER_ID, TOUCH_BUFFER_MS, isFakeMousedownFromScreenReader, ɵangular_material_src_cdk_a11y_a11y_a, ɵangular_material_src_cdk_a11y_a11y_b */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; __webpack_require__.r(__webpack_exports__); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "A11yModule", function() { return A11yModule; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ActiveDescendantKeyManager", function() { return ActiveDescendantKeyManager; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "AriaDescriber", function() { return AriaDescriber; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CDK_DESCRIBEDBY_HOST_ATTRIBUTE", function() { return CDK_DESCRIBEDBY_HOST_ATTRIBUTE; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CDK_DESCRIBEDBY_ID_PREFIX", function() { return CDK_DESCRIBEDBY_ID_PREFIX; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkAriaLive", function() { return CdkAriaLive; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkMonitorFocus", function() { return CdkMonitorFocus; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkTrapFocus", function() { return CdkTrapFocus; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ConfigurableFocusTrap", function() { return ConfigurableFocusTrap; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ConfigurableFocusTrapFactory", function() { return ConfigurableFocusTrapFactory; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "EventListenerFocusTrapInertStrategy", function() { return EventListenerFocusTrapInertStrategy; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "FOCUS_MONITOR_DEFAULT_OPTIONS", function() { return FOCUS_MONITOR_DEFAULT_OPTIONS; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "FOCUS_TRAP_INERT_STRATEGY", function() { return FOCUS_TRAP_INERT_STRATEGY; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "FocusKeyManager", function() { return FocusKeyManager; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "FocusMonitor", function() { return FocusMonitor; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "FocusTrap", function() { return FocusTrap; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "FocusTrapFactory", function() { return FocusTrapFactory; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HighContrastModeDetector", function() { return HighContrastModeDetector; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "InteractivityChecker", function() { return InteractivityChecker; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "IsFocusableConfig", function() { return IsFocusableConfig; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "LIVE_ANNOUNCER_DEFAULT_OPTIONS", function() { return LIVE_ANNOUNCER_DEFAULT_OPTIONS; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "LIVE_ANNOUNCER_ELEMENT_TOKEN", function() { return LIVE_ANNOUNCER_ELEMENT_TOKEN; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "LIVE_ANNOUNCER_ELEMENT_TOKEN_FACTORY", function() { return LIVE_ANNOUNCER_ELEMENT_TOKEN_FACTORY; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ListKeyManager", function() { return ListKeyManager; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "LiveAnnouncer", function() { return LiveAnnouncer; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "MESSAGES_CONTAINER_ID", function() { return MESSAGES_CONTAINER_ID; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "TOUCH_BUFFER_MS", function() { return TOUCH_BUFFER_MS; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "isFakeMousedownFromScreenReader", function() { return isFakeMousedownFromScreenReader; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_material_src_cdk_a11y_a11y_a", function() { return FocusTrapManager; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_material_src_cdk_a11y_a11y_b", function() { return ConfigurableFocusTrapConfig; }); /* harmony import */ var _angular_common__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @angular/common */ "./node_modules/@angular/common/__ivy_ngcc__/fesm2015/common.js"); /* harmony import */ var _angular_core__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! @angular/core */ "./node_modules/@angular/core/__ivy_ngcc__/fesm2015/core.js"); /* harmony import */ var _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(/*! @angular/cdk/platform */ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/platform.js"); /* harmony import */ var rxjs__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(/*! rxjs */ "./node_modules/rxjs/_esm2015/index.js"); /* harmony import */ var _angular_cdk_keycodes__WEBPACK_IMPORTED_MODULE_4__ = __webpack_require__(/*! @angular/cdk/keycodes */ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/keycodes.js"); /* harmony import */ var rxjs_operators__WEBPACK_IMPORTED_MODULE_5__ = __webpack_require__(/*! rxjs/operators */ "./node_modules/rxjs/_esm2015/operators/index.js"); /* harmony import */ var _angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_6__ = __webpack_require__(/*! @angular/cdk/coercion */ "./node_modules/@angular/cdk/fesm2015/coercion.js"); /* harmony import */ var _angular_cdk_observers__WEBPACK_IMPORTED_MODULE_7__ = __webpack_require__(/*! @angular/cdk/observers */ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/observers.js"); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** IDs are delimited by an empty space, as per the spec. */ const ID_DELIMITER = ' '; /** * Adds the given ID to the specified ARIA attribute on an element. * Used for attributes such as aria-labelledby, aria-owns, etc. */ function addAriaReferencedId(el, attr, id) { const ids = getAriaReferenceIds(el, attr); if (ids.some(existingId => existingId.trim() == id.trim())) { return; } ids.push(id.trim()); el.setAttribute(attr, ids.join(ID_DELIMITER)); } /** * Removes the given ID from the specified ARIA attribute on an element. * Used for attributes such as aria-labelledby, aria-owns, etc. */ function removeAriaReferencedId(el, attr, id) { const ids = getAriaReferenceIds(el, attr); const filteredIds = ids.filter(val => val != id.trim()); if (filteredIds.length) { el.setAttribute(attr, filteredIds.join(ID_DELIMITER)); } else { el.removeAttribute(attr); } } /** * Gets the list of IDs referenced by the given ARIA attribute on an element. * Used for attributes such as aria-labelledby, aria-owns, etc. */ function getAriaReferenceIds(el, attr) { // Get string array of all individual ids (whitespace delimited) in the attribute value return (el.getAttribute(attr) || '').match(/\S+/g) || []; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** ID used for the body container where all messages are appended. */ const MESSAGES_CONTAINER_ID = 'cdk-describedby-message-container'; /** ID prefix used for each created message element. */ const CDK_DESCRIBEDBY_ID_PREFIX = 'cdk-describedby-message'; /** Attribute given to each host element that is described by a message element. */ const CDK_DESCRIBEDBY_HOST_ATTRIBUTE = 'cdk-describedby-host'; /** Global incremental identifier for each registered message element. */ let nextId = 0; /** Global map of all registered message elements that have been placed into the document. */ const messageRegistry = new Map(); /** Container for all registered messages. */ let messagesContainer = null; /** * Utility that creates visually hidden elements with a message content. Useful for elements that * want to use aria-describedby to further describe themselves without adding additional visual * content. */ class AriaDescriber { constructor(_document, /** * @breaking-change 8.0.0 `_platform` parameter to be made required. */ _platform) { this._platform = _platform; this._document = _document; } /** * Adds to the host element an aria-describedby reference to a hidden element that contains * the message. If the same message has already been registered, then it will reuse the created * message element. */ describe(hostElement, message) { if (!this._canBeDescribed(hostElement, message)) { return; } if (typeof message !== 'string') { // We need to ensure that the element has an ID. this._setMessageId(message); messageRegistry.set(message, { messageElement: message, referenceCount: 0 }); } else if (!messageRegistry.has(message)) { this._createMessageElement(message); } if (!this._isElementDescribedByMessage(hostElement, message)) { this._addMessageReference(hostElement, message); } } /** Removes the host element's aria-describedby reference to the message element. */ removeDescription(hostElement, message) { if (!message || !this._isElementNode(hostElement)) { return; } if (this._isElementDescribedByMessage(hostElement, message)) { this._removeMessageReference(hostElement, message); } // If the message is a string, it means that it's one that we created for the // consumer so we can remove it safely, otherwise we should leave it in place. if (typeof message === 'string') { const registeredMessage = messageRegistry.get(message); if (registeredMessage && registeredMessage.referenceCount === 0) { this._deleteMessageElement(message); } } if (messagesContainer && messagesContainer.childNodes.length === 0) { this._deleteMessagesContainer(); } } /** Unregisters all created message elements and removes the message container. */ ngOnDestroy() { const describedElements = this._document.querySelectorAll(`[${CDK_DESCRIBEDBY_HOST_ATTRIBUTE}]`); for (let i = 0; i < describedElements.length; i++) { this._removeCdkDescribedByReferenceIds(describedElements[i]); describedElements[i].removeAttribute(CDK_DESCRIBEDBY_HOST_ATTRIBUTE); } if (messagesContainer) { this._deleteMessagesContainer(); } messageRegistry.clear(); } /** * Creates a new element in the visually hidden message container element with the message * as its content and adds it to the message registry. */ _createMessageElement(message) { const messageElement = this._document.createElement('div'); this._setMessageId(messageElement); messageElement.textContent = message; this._createMessagesContainer(); messagesContainer.appendChild(messageElement); messageRegistry.set(message, { messageElement, referenceCount: 0 }); } /** Assigns a unique ID to an element, if it doesn't have one already. */ _setMessageId(element) { if (!element.id) { element.id = `${CDK_DESCRIBEDBY_ID_PREFIX}-${nextId++}`; } } /** Deletes the message element from the global messages container. */ _deleteMessageElement(message) { const registeredMessage = messageRegistry.get(message); const messageElement = registeredMessage && registeredMessage.messageElement; if (messagesContainer && messageElement) { messagesContainer.removeChild(messageElement); } messageRegistry.delete(message); } /** Creates the global container for all aria-describedby messages. */ _createMessagesContainer() { if (!messagesContainer) { // @breaking-change 8.0.0 `_platform` null check can be removed once the parameter is required const canBeAriaHidden = !this._platform || (!this._platform.EDGE && !this._platform.TRIDENT); const preExistingContainer = this._document.getElementById(MESSAGES_CONTAINER_ID); // When going from the server to the client, we may end up in a situation where there's // already a container on the page, but we don't have a reference to it. Clear the // old container so we don't get duplicates. Doing this, instead of emptying the previous // container, should be slightly faster. if (preExistingContainer && preExistingContainer.parentNode) { preExistingContainer.parentNode.removeChild(preExistingContainer); } messagesContainer = this._document.createElement('div'); messagesContainer.id = MESSAGES_CONTAINER_ID; messagesContainer.classList.add('cdk-visually-hidden'); // IE and Edge won't read out the messages if they're in an `aria-hidden` container. // We only disable `aria-hidden` for these platforms, because it comes with the // disadvantage that people might hit the messages when they've navigated past // the end of the document using the arrow keys. messagesContainer.setAttribute('aria-hidden', canBeAriaHidden + ''); this._document.body.appendChild(messagesContainer); } } /** Deletes the global messages container. */ _deleteMessagesContainer() { if (messagesContainer && messagesContainer.parentNode) { messagesContainer.parentNode.removeChild(messagesContainer); messagesContainer = null; } } /** Removes all cdk-describedby messages that are hosted through the element. */ _removeCdkDescribedByReferenceIds(element) { // Remove all aria-describedby reference IDs that are prefixed by CDK_DESCRIBEDBY_ID_PREFIX const originalReferenceIds = getAriaReferenceIds(element, 'aria-describedby') .filter(id => id.indexOf(CDK_DESCRIBEDBY_ID_PREFIX) != 0); element.setAttribute('aria-describedby', originalReferenceIds.join(' ')); } /** * Adds a message reference to the element using aria-describedby and increments the registered * message's reference count. */ _addMessageReference(element, message) { const registeredMessage = messageRegistry.get(message); // Add the aria-describedby reference and set the // describedby_host attribute to mark the element. addAriaReferencedId(element, 'aria-describedby', registeredMessage.messageElement.id); element.setAttribute(CDK_DESCRIBEDBY_HOST_ATTRIBUTE, ''); registeredMessage.referenceCount++; } /** * Removes a message reference from the element using aria-describedby * and decrements the registered message's reference count. */ _removeMessageReference(element, message) { const registeredMessage = messageRegistry.get(message); registeredMessage.referenceCount--; removeAriaReferencedId(element, 'aria-describedby', registeredMessage.messageElement.id); element.removeAttribute(CDK_DESCRIBEDBY_HOST_ATTRIBUTE); } /** Returns true if the element has been described by the provided message ID. */ _isElementDescribedByMessage(element, message) { const referenceIds = getAriaReferenceIds(element, 'aria-describedby'); const registeredMessage = messageRegistry.get(message); const messageId = registeredMessage && registeredMessage.messageElement.id; return !!messageId && referenceIds.indexOf(messageId) != -1; } /** Determines whether a message can be described on a particular element. */ _canBeDescribed(element, message) { if (!this._isElementNode(element)) { return false; } if (message && typeof message === 'object') { // We'd have to make some assumptions about the description element's text, if the consumer // passed in an element. Assume that if an element is passed in, the consumer has verified // that it can be used as a description. return true; } const trimmedMessage = message == null ? '' : `${message}`.trim(); const ariaLabel = element.getAttribute('aria-label'); // We shouldn't set descriptions if they're exactly the same as the `aria-label` of the // element, because screen readers will end up reading out the same text twice in a row. return trimmedMessage ? (!ariaLabel || ariaLabel.trim() !== trimmedMessage) : false; } /** Checks whether a node is an Element node. */ _isElementNode(element) { return element.nodeType === this._document.ELEMENT_NODE; } } AriaDescriber.ɵfac = function AriaDescriber_Factory(t) { return new (t || AriaDescriber)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"])); }; AriaDescriber.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjectable"])({ factory: function AriaDescriber_Factory() { return new AriaDescriber(Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"]), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"])); }, token: AriaDescriber, providedIn: "root" }); AriaDescriber.ctorParameters = () => [ { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"],] }] }, { type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](AriaDescriber, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Injectable"], args: [{ providedIn: 'root' }] }], function () { return [{ type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"]] }] }, { type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"] }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * This class manages keyboard events for selectable lists. If you pass it a query list * of items, it will set the active item correctly when arrow events occur. */ class ListKeyManager { constructor(_items) { this._items = _items; this._activeItemIndex = -1; this._activeItem = null; this._wrap = false; this._letterKeyStream = new rxjs__WEBPACK_IMPORTED_MODULE_3__["Subject"](); this._typeaheadSubscription = rxjs__WEBPACK_IMPORTED_MODULE_3__["Subscription"].EMPTY; this._vertical = true; this._allowedModifierKeys = []; this._homeAndEnd = false; /** * Predicate function that can be used to check whether an item should be skipped * by the key manager. By default, disabled items are skipped. */ this._skipPredicateFn = (item) => item.disabled; // Buffer for the letters that the user has pressed when the typeahead option is turned on. this._pressedLetters = []; /** * Stream that emits any time the TAB key is pressed, so components can react * when focus is shifted off of the list. */ this.tabOut = new rxjs__WEBPACK_IMPORTED_MODULE_3__["Subject"](); /** Stream that emits whenever the active item of the list manager changes. */ this.change = new rxjs__WEBPACK_IMPORTED_MODULE_3__["Subject"](); // We allow for the items to be an array because, in some cases, the consumer may // not have access to a QueryList of the items they want to manage (e.g. when the // items aren't being collected via `ViewChildren` or `ContentChildren`). if (_items instanceof _angular_core__WEBPACK_IMPORTED_MODULE_1__["QueryList"]) { _items.changes.subscribe((newItems) => { if (this._activeItem) { const itemArray = newItems.toArray(); const newIndex = itemArray.indexOf(this._activeItem); if (newIndex > -1 && newIndex !== this._activeItemIndex) { this._activeItemIndex = newIndex; } } }); } } /** * Sets the predicate function that determines which items should be skipped by the * list key manager. * @param predicate Function that determines whether the given item should be skipped. */ skipPredicate(predicate) { this._skipPredicateFn = predicate; return this; } /** * Configures wrapping mode, which determines whether the active item will wrap to * the other end of list when there are no more items in the given direction. * @param shouldWrap Whether the list should wrap when reaching the end. */ withWrap(shouldWrap = true) { this._wrap = shouldWrap; return this; } /** * Configures whether the key manager should be able to move the selection vertically. * @param enabled Whether vertical selection should be enabled. */ withVerticalOrientation(enabled = true) { this._vertical = enabled; return this; } /** * Configures the key manager to move the selection horizontally. * Passing in `null` will disable horizontal movement. * @param direction Direction in which the selection can be moved. */ withHorizontalOrientation(direction) { this._horizontal = direction; return this; } /** * Modifier keys which are allowed to be held down and whose default actions will be prevented * as the user is pressing the arrow keys. Defaults to not allowing any modifier keys. */ withAllowedModifierKeys(keys) { this._allowedModifierKeys = keys; return this; } /** * Turns on typeahead mode which allows users to set the active item by typing. * @param debounceInterval Time to wait after the last keystroke before setting the active item. */ withTypeAhead(debounceInterval = 200) { if ((typeof ngDevMode === 'undefined' || ngDevMode) && (this._items.length && this._items.some(item => typeof item.getLabel !== 'function'))) { throw Error('ListKeyManager items in typeahead mode must implement the `getLabel` method.'); } this._typeaheadSubscription.unsubscribe(); // Debounce the presses of non-navigational keys, collect the ones that correspond to letters // and convert those letters back into a string. Afterwards find the first item that starts // with that string and select it. this._typeaheadSubscription = this._letterKeyStream.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_5__["tap"])(letter => this._pressedLetters.push(letter)), Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_5__["debounceTime"])(debounceInterval), Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_5__["filter"])(() => this._pressedLetters.length > 0), Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_5__["map"])(() => this._pressedLetters.join(''))).subscribe(inputString => { const items = this._getItemsArray(); // Start at 1 because we want to start searching at the item immediately // following the current active item. for (let i = 1; i < items.length + 1; i++) { const index = (this._activeItemIndex + i) % items.length; const item = items[index]; if (!this._skipPredicateFn(item) && item.getLabel().toUpperCase().trim().indexOf(inputString) === 0) { this.setActiveItem(index); break; } } this._pressedLetters = []; }); return this; } /** * Configures the key manager to activate the first and last items * respectively when the Home or End key is pressed. * @param enabled Whether pressing the Home or End key activates the first/last item. */ withHomeAndEnd(enabled = true) { this._homeAndEnd = enabled; return this; } setActiveItem(item) { const previousActiveItem = this._activeItem; this.updateActiveItem(item); if (this._activeItem !== previousActiveItem) { this.change.next(this._activeItemIndex); } } /** * Sets the active item depending on the key event passed in. * @param event Keyboard event to be used for determining which element should be active. */ onKeydown(event) { const keyCode = event.keyCode; const modifiers = ['altKey', 'ctrlKey', 'metaKey', 'shiftKey']; const isModifierAllowed = modifiers.every(modifier => { return !event[modifier] || this._allowedModifierKeys.indexOf(modifier) > -1; }); switch (keyCode) { case _angular_cdk_keycodes__WEBPACK_IMPORTED_MODULE_4__["TAB"]: this.tabOut.next(); return; case _angular_cdk_keycodes__WEBPACK_IMPORTED_MODULE_4__["DOWN_ARROW"]: if (this._vertical && isModifierAllowed) { this.setNextItemActive(); break; } else { return; } case _angular_cdk_keycodes__WEBPACK_IMPORTED_MODULE_4__["UP_ARROW"]: if (this._vertical && isModifierAllowed) { this.setPreviousItemActive(); break; } else { return; } case _angular_cdk_keycodes__WEBPACK_IMPORTED_MODULE_4__["RIGHT_ARROW"]: if (this._horizontal && isModifierAllowed) { this._horizontal === 'rtl' ? this.setPreviousItemActive() : this.setNextItemActive(); break; } else { return; } case _angular_cdk_keycodes__WEBPACK_IMPORTED_MODULE_4__["LEFT_ARROW"]: if (this._horizontal && isModifierAllowed) { this._horizontal === 'rtl' ? this.setNextItemActive() : this.setPreviousItemActive(); break; } else { return; } case _angular_cdk_keycodes__WEBPACK_IMPORTED_MODULE_4__["HOME"]: if (this._homeAndEnd && isModifierAllowed) { this.setFirstItemActive(); break; } else { return; } case _angular_cdk_keycodes__WEBPACK_IMPORTED_MODULE_4__["END"]: if (this._homeAndEnd && isModifierAllowed) { this.setLastItemActive(); break; } else { return; } default: if (isModifierAllowed || Object(_angular_cdk_keycodes__WEBPACK_IMPORTED_MODULE_4__["hasModifierKey"])(event, 'shiftKey')) { // Attempt to use the `event.key` which also maps it to the user's keyboard language, // otherwise fall back to resolving alphanumeric characters via the keyCode. if (event.key && event.key.length === 1) { this._letterKeyStream.next(event.key.toLocaleUpperCase()); } else if ((keyCode >= _angular_cdk_keycodes__WEBPACK_IMPORTED_MODULE_4__["A"] && keyCode <= _angular_cdk_keycodes__WEBPACK_IMPORTED_MODULE_4__["Z"]) || (keyCode >= _angular_cdk_keycodes__WEBPACK_IMPORTED_MODULE_4__["ZERO"] && keyCode <= _angular_cdk_keycodes__WEBPACK_IMPORTED_MODULE_4__["NINE"])) { this._letterKeyStream.next(String.fromCharCode(keyCode)); } } // Note that we return here, in order to avoid preventing // the default action of non-navigational keys. return; } this._pressedLetters = []; event.preventDefault(); } /** Index of the currently active item. */ get activeItemIndex() { return this._activeItemIndex; } /** The active item. */ get activeItem() { return this._activeItem; } /** Gets whether the user is currently typing into the manager using the typeahead feature. */ isTyping() { return this._pressedLetters.length > 0; } /** Sets the active item to the first enabled item in the list. */ setFirstItemActive() { this._setActiveItemByIndex(0, 1); } /** Sets the active item to the last enabled item in the list. */ setLastItemActive() { this._setActiveItemByIndex(this._items.length - 1, -1); } /** Sets the active item to the next enabled item in the list. */ setNextItemActive() { this._activeItemIndex < 0 ? this.setFirstItemActive() : this._setActiveItemByDelta(1); } /** Sets the active item to a previous enabled item in the list. */ setPreviousItemActive() { this._activeItemIndex < 0 && this._wrap ? this.setLastItemActive() : this._setActiveItemByDelta(-1); } updateActiveItem(item) { const itemArray = this._getItemsArray(); const index = typeof item === 'number' ? item : itemArray.indexOf(item); const activeItem = itemArray[index]; // Explicitly check for `null` and `undefined` because other falsy values are valid. this._activeItem = activeItem == null ? null : activeItem; this._activeItemIndex = index; } /** * This method sets the active item, given a list of items and the delta between the * currently active item and the new active item. It will calculate differently * depending on whether wrap mode is turned on. */ _setActiveItemByDelta(delta) { this._wrap ? this._setActiveInWrapMode(delta) : this._setActiveInDefaultMode(delta); } /** * Sets the active item properly given "wrap" mode. In other words, it will continue to move * down the list until it finds an item that is not disabled, and it will wrap if it * encounters either end of the list. */ _setActiveInWrapMode(delta) { const items = this._getItemsArray(); for (let i = 1; i <= items.length; i++) { const index = (this._activeItemIndex + (delta * i) + items.length) % items.length; const item = items[index]; if (!this._skipPredicateFn(item)) { this.setActiveItem(index); return; } } } /** * Sets the active item properly given the default mode. In other words, it will * continue to move down the list until it finds an item that is not disabled. If * it encounters either end of the list, it will stop and not wrap. */ _setActiveInDefaultMode(delta) { this._setActiveItemByIndex(this._activeItemIndex + delta, delta); } /** * Sets the active item to the first enabled item starting at the index specified. If the * item is disabled, it will move in the fallbackDelta direction until it either * finds an enabled item or encounters the end of the list. */ _setActiveItemByIndex(index, fallbackDelta) { const items = this._getItemsArray(); if (!items[index]) { return; } while (this._skipPredicateFn(items[index])) { index += fallbackDelta; if (!items[index]) { return; } } this.setActiveItem(index); } /** Returns the items as an array. */ _getItemsArray() { return this._items instanceof _angular_core__WEBPACK_IMPORTED_MODULE_1__["QueryList"] ? this._items.toArray() : this._items; } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ class ActiveDescendantKeyManager extends ListKeyManager { setActiveItem(index) { if (this.activeItem) { this.activeItem.setInactiveStyles(); } super.setActiveItem(index); if (this.activeItem) { this.activeItem.setActiveStyles(); } } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ class FocusKeyManager extends ListKeyManager { constructor() { super(...arguments); this._origin = 'program'; } /** * Sets the focus origin that will be passed in to the items for any subsequent `focus` calls. * @param origin Focus origin to be used when focusing items. */ setFocusOrigin(origin) { this._origin = origin; return this; } setActiveItem(item) { super.setActiveItem(item); if (this.activeItem) { this.activeItem.focus(this._origin); } } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Configuration for the isFocusable method. */ class IsFocusableConfig { constructor() { /** * Whether to count an element as focusable even if it is not currently visible. */ this.ignoreVisibility = false; } } // The InteractivityChecker leans heavily on the ally.js accessibility utilities. // Methods like `isTabbable` are only covering specific edge-cases for the browsers which are // supported. /** * Utility for checking the interactivity of an element, such as whether is is focusable or * tabbable. */ class InteractivityChecker { constructor(_platform) { this._platform = _platform; } /** * Gets whether an element is disabled. * * @param element Element to be checked. * @returns Whether the element is disabled. */ isDisabled(element) { // This does not capture some cases, such as a non-form control with a disabled attribute or // a form control inside of a disabled form, but should capture the most common cases. return element.hasAttribute('disabled'); } /** * Gets whether an element is visible for the purposes of interactivity. * * This will capture states like `display: none` and `visibility: hidden`, but not things like * being clipped by an `overflow: hidden` parent or being outside the viewport. * * @returns Whether the element is visible. */ isVisible(element) { return hasGeometry(element) && getComputedStyle(element).visibility === 'visible'; } /** * Gets whether an element can be reached via Tab key. * Assumes that the element has already been checked with isFocusable. * * @param element Element to be checked. * @returns Whether the element is tabbable. */ isTabbable(element) { // Nothing is tabbable on the server 😎 if (!this._platform.isBrowser) { return false; } const frameElement = getFrameElement(getWindow(element)); if (frameElement) { // Frame elements inherit their tabindex onto all child elements. if (getTabIndexValue(frameElement) === -1) { return false; } // Browsers disable tabbing to an element inside of an invisible frame. if (!this.isVisible(frameElement)) { return false; } } let nodeName = element.nodeName.toLowerCase(); let tabIndexValue = getTabIndexValue(element); if (element.hasAttribute('contenteditable')) { return tabIndexValue !== -1; } if (nodeName === 'iframe' || nodeName === 'object') { // The frame or object's content may be tabbable depending on the content, but it's // not possibly to reliably detect the content of the frames. We always consider such // elements as non-tabbable. return false; } // In iOS, the browser only considers some specific elements as tabbable. if (this._platform.WEBKIT && this._platform.IOS && !isPotentiallyTabbableIOS(element)) { return false; } if (nodeName === 'audio') { // Audio elements without controls enabled are never tabbable, regardless // of the tabindex attribute explicitly being set. if (!element.hasAttribute('controls')) { return false; } // Audio elements with controls are by default tabbable unless the // tabindex attribute is set to `-1` explicitly. return tabIndexValue !== -1; } if (nodeName === 'video') { // For all video elements, if the tabindex attribute is set to `-1`, the video // is not tabbable. Note: We cannot rely on the default `HTMLElement.tabIndex` // property as that one is set to `-1` in Chrome, Edge and Safari v13.1. The // tabindex attribute is the source of truth here. if (tabIndexValue === -1) { return false; } // If the tabindex is explicitly set, and not `-1` (as per check before), the // video element is always tabbable (regardless of whether it has controls or not). if (tabIndexValue !== null) { return true; } // Otherwise (when no explicit tabindex is set), a video is only tabbable if it // has controls enabled. Firefox is special as videos are always tabbable regardless // of whether there are controls or not. return this._platform.FIREFOX || element.hasAttribute('controls'); } return element.tabIndex >= 0; } /** * Gets whether an element can be focused by the user. * * @param element Element to be checked. * @param config The config object with options to customize this method's behavior * @returns Whether the element is focusable. */ isFocusable(element, config) { // Perform checks in order of left to most expensive. // Again, naive approach that does not capture many edge cases and browser quirks. return isPotentiallyFocusable(element) && !this.isDisabled(element) && ((config === null || config === void 0 ? void 0 : config.ignoreVisibility) || this.isVisible(element)); } } InteractivityChecker.ɵfac = function InteractivityChecker_Factory(t) { return new (t || InteractivityChecker)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"])); }; InteractivityChecker.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjectable"])({ factory: function InteractivityChecker_Factory() { return new InteractivityChecker(Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"])); }, token: InteractivityChecker, providedIn: "root" }); InteractivityChecker.ctorParameters = () => [ { type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](InteractivityChecker, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Injectable"], args: [{ providedIn: 'root' }] }], function () { return [{ type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"] }]; }, null); })(); /** * Returns the frame element from a window object. Since browsers like MS Edge throw errors if * the frameElement property is being accessed from a different host address, this property * should be accessed carefully. */ function getFrameElement(window) { try { return window.frameElement; } catch (_a) { return null; } } /** Checks whether the specified element has any geometry / rectangles. */ function hasGeometry(element) { // Use logic from jQuery to check for an invisible element. // See https://github.com/jquery/jquery/blob/master/src/css/hiddenVisibleSelectors.js#L12 return !!(element.offsetWidth || element.offsetHeight || (typeof element.getClientRects === 'function' && element.getClientRects().length)); } /** Gets whether an element's */ function isNativeFormElement(element) { let nodeName = element.nodeName.toLowerCase(); return nodeName === 'input' || nodeName === 'select' || nodeName === 'button' || nodeName === 'textarea'; } /** Gets whether an element is an ``. */ function isHiddenInput(element) { return isInputElement(element) && element.type == 'hidden'; } /** Gets whether an element is an anchor that has an href attribute. */ function isAnchorWithHref(element) { return isAnchorElement(element) && element.hasAttribute('href'); } /** Gets whether an element is an input element. */ function isInputElement(element) { return element.nodeName.toLowerCase() == 'input'; } /** Gets whether an element is an anchor element. */ function isAnchorElement(element) { return element.nodeName.toLowerCase() == 'a'; } /** Gets whether an element has a valid tabindex. */ function hasValidTabIndex(element) { if (!element.hasAttribute('tabindex') || element.tabIndex === undefined) { return false; } let tabIndex = element.getAttribute('tabindex'); // IE11 parses tabindex="" as the value "-32768" if (tabIndex == '-32768') { return false; } return !!(tabIndex && !isNaN(parseInt(tabIndex, 10))); } /** * Returns the parsed tabindex from the element attributes instead of returning the * evaluated tabindex from the browsers defaults. */ function getTabIndexValue(element) { if (!hasValidTabIndex(element)) { return null; } // See browser issue in Gecko https://bugzilla.mozilla.org/show_bug.cgi?id=1128054 const tabIndex = parseInt(element.getAttribute('tabindex') || '', 10); return isNaN(tabIndex) ? -1 : tabIndex; } /** Checks whether the specified element is potentially tabbable on iOS */ function isPotentiallyTabbableIOS(element) { let nodeName = element.nodeName.toLowerCase(); let inputType = nodeName === 'input' && element.type; return inputType === 'text' || inputType === 'password' || nodeName === 'select' || nodeName === 'textarea'; } /** * Gets whether an element is potentially focusable without taking current visible/disabled state * into account. */ function isPotentiallyFocusable(element) { // Inputs are potentially focusable *unless* they're type="hidden". if (isHiddenInput(element)) { return false; } return isNativeFormElement(element) || isAnchorWithHref(element) || element.hasAttribute('contenteditable') || hasValidTabIndex(element); } /** Gets the parent window of a DOM node with regards of being inside of an iframe. */ function getWindow(node) { // ownerDocument is null if `node` itself *is* a document. return node.ownerDocument && node.ownerDocument.defaultView || window; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Class that allows for trapping focus within a DOM element. * * This class currently uses a relatively simple approach to focus trapping. * It assumes that the tab order is the same as DOM order, which is not necessarily true. * Things like `tabIndex > 0`, flex `order`, and shadow roots can cause the two to misalign. * * @deprecated Use `ConfigurableFocusTrap` instead. * @breaking-change for 11.0.0 Remove this class. */ class FocusTrap { constructor(_element, _checker, _ngZone, _document, deferAnchors = false) { this._element = _element; this._checker = _checker; this._ngZone = _ngZone; this._document = _document; this._hasAttached = false; // Event listeners for the anchors. Need to be regular functions so that we can unbind them later. this.startAnchorListener = () => this.focusLastTabbableElement(); this.endAnchorListener = () => this.focusFirstTabbableElement(); this._enabled = true; if (!deferAnchors) { this.attachAnchors(); } } /** Whether the focus trap is active. */ get enabled() { return this._enabled; } set enabled(value) { this._enabled = value; if (this._startAnchor && this._endAnchor) { this._toggleAnchorTabIndex(value, this._startAnchor); this._toggleAnchorTabIndex(value, this._endAnchor); } } /** Destroys the focus trap by cleaning up the anchors. */ destroy() { const startAnchor = this._startAnchor; const endAnchor = this._endAnchor; if (startAnchor) { startAnchor.removeEventListener('focus', this.startAnchorListener); if (startAnchor.parentNode) { startAnchor.parentNode.removeChild(startAnchor); } } if (endAnchor) { endAnchor.removeEventListener('focus', this.endAnchorListener); if (endAnchor.parentNode) { endAnchor.parentNode.removeChild(endAnchor); } } this._startAnchor = this._endAnchor = null; this._hasAttached = false; } /** * Inserts the anchors into the DOM. This is usually done automatically * in the constructor, but can be deferred for cases like directives with `*ngIf`. * @returns Whether the focus trap managed to attach successfuly. This may not be the case * if the target element isn't currently in the DOM. */ attachAnchors() { // If we're not on the browser, there can be no focus to trap. if (this._hasAttached) { return true; } this._ngZone.runOutsideAngular(() => { if (!this._startAnchor) { this._startAnchor = this._createAnchor(); this._startAnchor.addEventListener('focus', this.startAnchorListener); } if (!this._endAnchor) { this._endAnchor = this._createAnchor(); this._endAnchor.addEventListener('focus', this.endAnchorListener); } }); if (this._element.parentNode) { this._element.parentNode.insertBefore(this._startAnchor, this._element); this._element.parentNode.insertBefore(this._endAnchor, this._element.nextSibling); this._hasAttached = true; } return this._hasAttached; } /** * Waits for the zone to stabilize, then either focuses the first element that the * user specified, or the first tabbable element. * @returns Returns a promise that resolves with a boolean, depending * on whether focus was moved successfuly. */ focusInitialElementWhenReady() { return new Promise(resolve => { this._executeOnStable(() => resolve(this.focusInitialElement())); }); } /** * Waits for the zone to stabilize, then focuses * the first tabbable element within the focus trap region. * @returns Returns a promise that resolves with a boolean, depending * on whether focus was moved successfuly. */ focusFirstTabbableElementWhenReady() { return new Promise(resolve => { this._executeOnStable(() => resolve(this.focusFirstTabbableElement())); }); } /** * Waits for the zone to stabilize, then focuses * the last tabbable element within the focus trap region. * @returns Returns a promise that resolves with a boolean, depending * on whether focus was moved successfuly. */ focusLastTabbableElementWhenReady() { return new Promise(resolve => { this._executeOnStable(() => resolve(this.focusLastTabbableElement())); }); } /** * Get the specified boundary element of the trapped region. * @param bound The boundary to get (start or end of trapped region). * @returns The boundary element. */ _getRegionBoundary(bound) { // Contains the deprecated version of selector, for temporary backwards comparability. let markers = this._element.querySelectorAll(`[cdk-focus-region-${bound}], ` + `[cdkFocusRegion${bound}], ` + `[cdk-focus-${bound}]`); for (let i = 0; i < markers.length; i++) { // @breaking-change 8.0.0 if (markers[i].hasAttribute(`cdk-focus-${bound}`)) { console.warn(`Found use of deprecated attribute 'cdk-focus-${bound}', ` + `use 'cdkFocusRegion${bound}' instead. The deprecated ` + `attribute will be removed in 8.0.0.`, markers[i]); } else if (markers[i].hasAttribute(`cdk-focus-region-${bound}`)) { console.warn(`Found use of deprecated attribute 'cdk-focus-region-${bound}', ` + `use 'cdkFocusRegion${bound}' instead. The deprecated attribute ` + `will be removed in 8.0.0.`, markers[i]); } } if (bound == 'start') { return markers.length ? markers[0] : this._getFirstTabbableElement(this._element); } return markers.length ? markers[markers.length - 1] : this._getLastTabbableElement(this._element); } /** * Focuses the element that should be focused when the focus trap is initialized. * @returns Whether focus was moved successfuly. */ focusInitialElement() { // Contains the deprecated version of selector, for temporary backwards comparability. const redirectToElement = this._element.querySelector(`[cdk-focus-initial], ` + `[cdkFocusInitial]`); if (redirectToElement) { // @breaking-change 8.0.0 if (redirectToElement.hasAttribute(`cdk-focus-initial`)) { console.warn(`Found use of deprecated attribute 'cdk-focus-initial', ` + `use 'cdkFocusInitial' instead. The deprecated attribute ` + `will be removed in 8.0.0`, redirectToElement); } // Warn the consumer if the element they've pointed to // isn't focusable, when not in production mode. if ((typeof ngDevMode === 'undefined' || ngDevMode) && !this._checker.isFocusable(redirectToElement)) { console.warn(`Element matching '[cdkFocusInitial]' is not focusable.`, redirectToElement); } redirectToElement.focus(); return true; } return this.focusFirstTabbableElement(); } /** * Focuses the first tabbable element within the focus trap region. * @returns Whether focus was moved successfuly. */ focusFirstTabbableElement() { const redirectToElement = this._getRegionBoundary('start'); if (redirectToElement) { redirectToElement.focus(); } return !!redirectToElement; } /** * Focuses the last tabbable element within the focus trap region. * @returns Whether focus was moved successfuly. */ focusLastTabbableElement() { const redirectToElement = this._getRegionBoundary('end'); if (redirectToElement) { redirectToElement.focus(); } return !!redirectToElement; } /** * Checks whether the focus trap has successfuly been attached. */ hasAttached() { return this._hasAttached; } /** Get the first tabbable element from a DOM subtree (inclusive). */ _getFirstTabbableElement(root) { if (this._checker.isFocusable(root) && this._checker.isTabbable(root)) { return root; } // Iterate in DOM order. Note that IE doesn't have `children` for SVG so we fall // back to `childNodes` which includes text nodes, comments etc. let children = root.children || root.childNodes; for (let i = 0; i < children.length; i++) { let tabbableChild = children[i].nodeType === this._document.ELEMENT_NODE ? this._getFirstTabbableElement(children[i]) : null; if (tabbableChild) { return tabbableChild; } } return null; } /** Get the last tabbable element from a DOM subtree (inclusive). */ _getLastTabbableElement(root) { if (this._checker.isFocusable(root) && this._checker.isTabbable(root)) { return root; } // Iterate in reverse DOM order. let children = root.children || root.childNodes; for (let i = children.length - 1; i >= 0; i--) { let tabbableChild = children[i].nodeType === this._document.ELEMENT_NODE ? this._getLastTabbableElement(children[i]) : null; if (tabbableChild) { return tabbableChild; } } return null; } /** Creates an anchor element. */ _createAnchor() { const anchor = this._document.createElement('div'); this._toggleAnchorTabIndex(this._enabled, anchor); anchor.classList.add('cdk-visually-hidden'); anchor.classList.add('cdk-focus-trap-anchor'); anchor.setAttribute('aria-hidden', 'true'); return anchor; } /** * Toggles the `tabindex` of an anchor, based on the enabled state of the focus trap. * @param isEnabled Whether the focus trap is enabled. * @param anchor Anchor on which to toggle the tabindex. */ _toggleAnchorTabIndex(isEnabled, anchor) { // Remove the tabindex completely, rather than setting it to -1, because if the // element has a tabindex, the user might still hit it when navigating with the arrow keys. isEnabled ? anchor.setAttribute('tabindex', '0') : anchor.removeAttribute('tabindex'); } /** * Toggles the`tabindex` of both anchors to either trap Tab focus or allow it to escape. * @param enabled: Whether the anchors should trap Tab. */ toggleAnchors(enabled) { if (this._startAnchor && this._endAnchor) { this._toggleAnchorTabIndex(enabled, this._startAnchor); this._toggleAnchorTabIndex(enabled, this._endAnchor); } } /** Executes a function when the zone is stable. */ _executeOnStable(fn) { if (this._ngZone.isStable) { fn(); } else { this._ngZone.onStable.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_5__["take"])(1)).subscribe(fn); } } } /** * Factory that allows easy instantiation of focus traps. * @deprecated Use `ConfigurableFocusTrapFactory` instead. * @breaking-change for 11.0.0 Remove this class. */ class FocusTrapFactory { constructor(_checker, _ngZone, _document) { this._checker = _checker; this._ngZone = _ngZone; this._document = _document; } /** * Creates a focus-trapped region around the given element. * @param element The element around which focus will be trapped. * @param deferCaptureElements Defers the creation of focus-capturing elements to be done * manually by the user. * @returns The created focus trap instance. */ create(element, deferCaptureElements = false) { return new FocusTrap(element, this._checker, this._ngZone, this._document, deferCaptureElements); } } FocusTrapFactory.ɵfac = function FocusTrapFactory_Factory(t) { return new (t || FocusTrapFactory)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](InteractivityChecker), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"])); }; FocusTrapFactory.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjectable"])({ factory: function FocusTrapFactory_Factory() { return new FocusTrapFactory(Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(InteractivityChecker), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"]), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"])); }, token: FocusTrapFactory, providedIn: "root" }); FocusTrapFactory.ctorParameters = () => [ { type: InteractivityChecker }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"],] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](FocusTrapFactory, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Injectable"], args: [{ providedIn: 'root' }] }], function () { return [{ type: InteractivityChecker }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"]] }] }]; }, null); })(); /** Directive for trapping focus within a region. */ class CdkTrapFocus { constructor(_elementRef, _focusTrapFactory, _document) { this._elementRef = _elementRef; this._focusTrapFactory = _focusTrapFactory; /** Previously focused element to restore focus to upon destroy when using autoCapture. */ this._previouslyFocusedElement = null; this._document = _document; this.focusTrap = this._focusTrapFactory.create(this._elementRef.nativeElement, true); } /** Whether the focus trap is active. */ get enabled() { return this.focusTrap.enabled; } set enabled(value) { this.focusTrap.enabled = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_6__["coerceBooleanProperty"])(value); } /** * Whether the directive should automatially move focus into the trapped region upon * initialization and return focus to the previous activeElement upon destruction. */ get autoCapture() { return this._autoCapture; } set autoCapture(value) { this._autoCapture = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_6__["coerceBooleanProperty"])(value); } ngOnDestroy() { this.focusTrap.destroy(); // If we stored a previously focused element when using autoCapture, return focus to that // element now that the trapped region is being destroyed. if (this._previouslyFocusedElement) { this._previouslyFocusedElement.focus(); this._previouslyFocusedElement = null; } } ngAfterContentInit() { this.focusTrap.attachAnchors(); if (this.autoCapture) { this._captureFocus(); } } ngDoCheck() { if (!this.focusTrap.hasAttached()) { this.focusTrap.attachAnchors(); } } ngOnChanges(changes) { const autoCaptureChange = changes['autoCapture']; if (autoCaptureChange && !autoCaptureChange.firstChange && this.autoCapture && this.focusTrap.hasAttached()) { this._captureFocus(); } } _captureFocus() { this._previouslyFocusedElement = this._document.activeElement; this.focusTrap.focusInitialElementWhenReady(); } } CdkTrapFocus.ɵfac = function CdkTrapFocus_Factory(t) { return new (t || CdkTrapFocus)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](FocusTrapFactory), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"])); }; CdkTrapFocus.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineDirective"]({ type: CdkTrapFocus, selectors: [["", "cdkTrapFocus", ""]], inputs: { enabled: ["cdkTrapFocus", "enabled"], autoCapture: ["cdkTrapFocusAutoCapture", "autoCapture"] }, exportAs: ["cdkTrapFocus"], features: [_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵNgOnChangesFeature"]] }); CdkTrapFocus.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"] }, { type: FocusTrapFactory }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"],] }] } ]; CdkTrapFocus.propDecorators = { enabled: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkTrapFocus',] }], autoCapture: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkTrapFocusAutoCapture',] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](CdkTrapFocus, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Directive"], args: [{ selector: '[cdkTrapFocus]', exportAs: 'cdkTrapFocus' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"] }, { type: FocusTrapFactory }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"]] }] }]; }, { enabled: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkTrapFocus'] }], autoCapture: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkTrapFocusAutoCapture'] }] }); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Class that allows for trapping focus within a DOM element. * * This class uses a strategy pattern that determines how it traps focus. * See FocusTrapInertStrategy. */ class ConfigurableFocusTrap extends FocusTrap { constructor(_element, _checker, _ngZone, _document, _focusTrapManager, _inertStrategy, config) { super(_element, _checker, _ngZone, _document, config.defer); this._focusTrapManager = _focusTrapManager; this._inertStrategy = _inertStrategy; this._focusTrapManager.register(this); } /** Whether the FocusTrap is enabled. */ get enabled() { return this._enabled; } set enabled(value) { this._enabled = value; if (this._enabled) { this._focusTrapManager.register(this); } else { this._focusTrapManager.deregister(this); } } /** Notifies the FocusTrapManager that this FocusTrap will be destroyed. */ destroy() { this._focusTrapManager.deregister(this); super.destroy(); } /** @docs-private Implemented as part of ManagedFocusTrap. */ _enable() { this._inertStrategy.preventFocus(this); this.toggleAnchors(true); } /** @docs-private Implemented as part of ManagedFocusTrap. */ _disable() { this._inertStrategy.allowFocus(this); this.toggleAnchors(false); } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** IE 11 compatible closest implementation that is able to start from non-Element Nodes. */ function closest(element, selector) { if (!(element instanceof Node)) { return null; } let curr = element; while (curr != null && !(curr instanceof Element)) { curr = curr.parentNode; } return curr && (hasNativeClosest ? curr.closest(selector) : polyfillClosest(curr, selector)); } /** Polyfill for browsers without Element.closest. */ function polyfillClosest(element, selector) { let curr = element; while (curr != null && !(curr instanceof Element && matches(curr, selector))) { curr = curr.parentNode; } return (curr || null); } const hasNativeClosest = typeof Element != 'undefined' && !!Element.prototype.closest; /** IE 11 compatible matches implementation. */ function matches(element, selector) { return element.matches ? element.matches(selector) : element['msMatchesSelector'](selector); } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Lightweight FocusTrapInertStrategy that adds a document focus event * listener to redirect focus back inside the FocusTrap. */ class EventListenerFocusTrapInertStrategy { constructor() { /** Focus event handler. */ this._listener = null; } /** Adds a document event listener that keeps focus inside the FocusTrap. */ preventFocus(focusTrap) { // Ensure there's only one listener per document if (this._listener) { focusTrap._document.removeEventListener('focus', this._listener, true); } this._listener = (e) => this._trapFocus(focusTrap, e); focusTrap._ngZone.runOutsideAngular(() => { focusTrap._document.addEventListener('focus', this._listener, true); }); } /** Removes the event listener added in preventFocus. */ allowFocus(focusTrap) { if (!this._listener) { return; } focusTrap._document.removeEventListener('focus', this._listener, true); this._listener = null; } /** * Refocuses the first element in the FocusTrap if the focus event target was outside * the FocusTrap. * * This is an event listener callback. The event listener is added in runOutsideAngular, * so all this code runs outside Angular as well. */ _trapFocus(focusTrap, event) { const target = event.target; const focusTrapRoot = focusTrap._element; // Don't refocus if target was in an overlay, because the overlay might be associated // with an element inside the FocusTrap, ex. mat-select. if (!focusTrapRoot.contains(target) && closest(target, 'div.cdk-overlay-pane') === null) { // Some legacy FocusTrap usages have logic that focuses some element on the page // just before FocusTrap is destroyed. For backwards compatibility, wait // to be sure FocusTrap is still enabled before refocusing. setTimeout(() => { // Check whether focus wasn't put back into the focus trap while the timeout was pending. if (focusTrap.enabled && !focusTrapRoot.contains(focusTrap._document.activeElement)) { focusTrap.focusFirstTabbableElement(); } }); } } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Configuration for creating a ConfigurableFocusTrap. */ class ConfigurableFocusTrapConfig { constructor() { /** * Whether to defer the creation of FocusTrap elements to be * done manually by the user. Default is to create them * automatically. */ this.defer = false; } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** The injection token used to specify the inert strategy. */ const FOCUS_TRAP_INERT_STRATEGY = new _angular_core__WEBPACK_IMPORTED_MODULE_1__["InjectionToken"]('FOCUS_TRAP_INERT_STRATEGY'); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** Injectable that ensures only the most recently enabled FocusTrap is active. */ class FocusTrapManager { constructor() { // A stack of the FocusTraps on the page. Only the FocusTrap at the // top of the stack is active. this._focusTrapStack = []; } /** * Disables the FocusTrap at the top of the stack, and then pushes * the new FocusTrap onto the stack. */ register(focusTrap) { // Dedupe focusTraps that register multiple times. this._focusTrapStack = this._focusTrapStack.filter((ft) => ft !== focusTrap); let stack = this._focusTrapStack; if (stack.length) { stack[stack.length - 1]._disable(); } stack.push(focusTrap); focusTrap._enable(); } /** * Removes the FocusTrap from the stack, and activates the * FocusTrap that is the new top of the stack. */ deregister(focusTrap) { focusTrap._disable(); const stack = this._focusTrapStack; const i = stack.indexOf(focusTrap); if (i !== -1) { stack.splice(i, 1); if (stack.length) { stack[stack.length - 1]._enable(); } } } } FocusTrapManager.ɵfac = function FocusTrapManager_Factory(t) { return new (t || FocusTrapManager)(); }; FocusTrapManager.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjectable"])({ factory: function FocusTrapManager_Factory() { return new FocusTrapManager(); }, token: FocusTrapManager, providedIn: "root" }); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](FocusTrapManager, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Injectable"], args: [{ providedIn: 'root' }] }], function () { return []; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** Factory that allows easy instantiation of configurable focus traps. */ class ConfigurableFocusTrapFactory { constructor(_checker, _ngZone, _focusTrapManager, _document, _inertStrategy) { this._checker = _checker; this._ngZone = _ngZone; this._focusTrapManager = _focusTrapManager; this._document = _document; // TODO split up the strategies into different modules, similar to DateAdapter. this._inertStrategy = _inertStrategy || new EventListenerFocusTrapInertStrategy(); } create(element, config = new ConfigurableFocusTrapConfig()) { let configObject; if (typeof config === 'boolean') { configObject = new ConfigurableFocusTrapConfig(); configObject.defer = config; } else { configObject = config; } return new ConfigurableFocusTrap(element, this._checker, this._ngZone, this._document, this._focusTrapManager, this._inertStrategy, configObject); } } ConfigurableFocusTrapFactory.ɵfac = function ConfigurableFocusTrapFactory_Factory(t) { return new (t || ConfigurableFocusTrapFactory)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](InteractivityChecker), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](FocusTrapManager), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](FOCUS_TRAP_INERT_STRATEGY, 8)); }; ConfigurableFocusTrapFactory.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjectable"])({ factory: function ConfigurableFocusTrapFactory_Factory() { return new ConfigurableFocusTrapFactory(Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(InteractivityChecker), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"]), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(FocusTrapManager), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"]), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(FOCUS_TRAP_INERT_STRATEGY, 8)); }, token: ConfigurableFocusTrapFactory, providedIn: "root" }); ConfigurableFocusTrapFactory.ctorParameters = () => [ { type: InteractivityChecker }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }, { type: FocusTrapManager }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"],] }] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [FOCUS_TRAP_INERT_STRATEGY,] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](ConfigurableFocusTrapFactory, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Injectable"], args: [{ providedIn: 'root' }] }], function () { return [{ type: InteractivityChecker }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }, { type: FocusTrapManager }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"]] }] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [FOCUS_TRAP_INERT_STRATEGY] }] }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ const LIVE_ANNOUNCER_ELEMENT_TOKEN = new _angular_core__WEBPACK_IMPORTED_MODULE_1__["InjectionToken"]('liveAnnouncerElement', { providedIn: 'root', factory: LIVE_ANNOUNCER_ELEMENT_TOKEN_FACTORY, }); /** @docs-private */ function LIVE_ANNOUNCER_ELEMENT_TOKEN_FACTORY() { return null; } /** Injection token that can be used to configure the default options for the LiveAnnouncer. */ const LIVE_ANNOUNCER_DEFAULT_OPTIONS = new _angular_core__WEBPACK_IMPORTED_MODULE_1__["InjectionToken"]('LIVE_ANNOUNCER_DEFAULT_OPTIONS'); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ class LiveAnnouncer { constructor(elementToken, _ngZone, _document, _defaultOptions) { this._ngZone = _ngZone; this._defaultOptions = _defaultOptions; // We inject the live element and document as `any` because the constructor signature cannot // reference browser globals (HTMLElement, Document) on non-browser environments, since having // a class decorator causes TypeScript to preserve the constructor signature types. this._document = _document; this._liveElement = elementToken || this._createLiveElement(); } announce(message, ...args) { const defaultOptions = this._defaultOptions; let politeness; let duration; if (args.length === 1 && typeof args[0] === 'number') { duration = args[0]; } else { [politeness, duration] = args; } this.clear(); clearTimeout(this._previousTimeout); if (!politeness) { politeness = (defaultOptions && defaultOptions.politeness) ? defaultOptions.politeness : 'polite'; } if (duration == null && defaultOptions) { duration = defaultOptions.duration; } // TODO: ensure changing the politeness works on all environments we support. this._liveElement.setAttribute('aria-live', politeness); // This 100ms timeout is necessary for some browser + screen-reader combinations: // - Both JAWS and NVDA over IE11 will not announce anything without a non-zero timeout. // - With Chrome and IE11 with NVDA or JAWS, a repeated (identical) message won't be read a // second time without clearing and then using a non-zero delay. // (using JAWS 17 at time of this writing). return this._ngZone.runOutsideAngular(() => { return new Promise(resolve => { clearTimeout(this._previousTimeout); this._previousTimeout = setTimeout(() => { this._liveElement.textContent = message; resolve(); if (typeof duration === 'number') { this._previousTimeout = setTimeout(() => this.clear(), duration); } }, 100); }); }); } /** * Clears the current text from the announcer element. Can be used to prevent * screen readers from reading the text out again while the user is going * through the page landmarks. */ clear() { if (this._liveElement) { this._liveElement.textContent = ''; } } ngOnDestroy() { clearTimeout(this._previousTimeout); if (this._liveElement && this._liveElement.parentNode) { this._liveElement.parentNode.removeChild(this._liveElement); this._liveElement = null; } } _createLiveElement() { const elementClass = 'cdk-live-announcer-element'; const previousElements = this._document.getElementsByClassName(elementClass); const liveEl = this._document.createElement('div'); // Remove any old containers. This can happen when coming in from a server-side-rendered page. for (let i = 0; i < previousElements.length; i++) { previousElements[i].parentNode.removeChild(previousElements[i]); } liveEl.classList.add(elementClass); liveEl.classList.add('cdk-visually-hidden'); liveEl.setAttribute('aria-atomic', 'true'); liveEl.setAttribute('aria-live', 'polite'); this._document.body.appendChild(liveEl); return liveEl; } } LiveAnnouncer.ɵfac = function LiveAnnouncer_Factory(t) { return new (t || LiveAnnouncer)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](LIVE_ANNOUNCER_ELEMENT_TOKEN, 8), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](LIVE_ANNOUNCER_DEFAULT_OPTIONS, 8)); }; LiveAnnouncer.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjectable"])({ factory: function LiveAnnouncer_Factory() { return new LiveAnnouncer(Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(LIVE_ANNOUNCER_ELEMENT_TOKEN, 8), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"]), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"]), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(LIVE_ANNOUNCER_DEFAULT_OPTIONS, 8)); }, token: LiveAnnouncer, providedIn: "root" }); LiveAnnouncer.ctorParameters = () => [ { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [LIVE_ANNOUNCER_ELEMENT_TOKEN,] }] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"],] }] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [LIVE_ANNOUNCER_DEFAULT_OPTIONS,] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](LiveAnnouncer, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Injectable"], args: [{ providedIn: 'root' }] }], function () { return [{ type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [LIVE_ANNOUNCER_ELEMENT_TOKEN] }] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"]] }] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [LIVE_ANNOUNCER_DEFAULT_OPTIONS] }] }]; }, null); })(); /** * A directive that works similarly to aria-live, but uses the LiveAnnouncer to ensure compatibility * with a wider range of browsers and screen readers. */ class CdkAriaLive { constructor(_elementRef, _liveAnnouncer, _contentObserver, _ngZone) { this._elementRef = _elementRef; this._liveAnnouncer = _liveAnnouncer; this._contentObserver = _contentObserver; this._ngZone = _ngZone; this._politeness = 'polite'; } /** The aria-live politeness level to use when announcing messages. */ get politeness() { return this._politeness; } set politeness(value) { this._politeness = value === 'off' || value === 'assertive' ? value : 'polite'; if (this._politeness === 'off') { if (this._subscription) { this._subscription.unsubscribe(); this._subscription = null; } } else if (!this._subscription) { this._subscription = this._ngZone.runOutsideAngular(() => { return this._contentObserver .observe(this._elementRef) .subscribe(() => { // Note that we use textContent here, rather than innerText, in order to avoid a reflow. const elementText = this._elementRef.nativeElement.textContent; // The `MutationObserver` fires also for attribute // changes which we don't want to announce. if (elementText !== this._previousAnnouncedText) { this._liveAnnouncer.announce(elementText, this._politeness); this._previousAnnouncedText = elementText; } }); }); } } ngOnDestroy() { if (this._subscription) { this._subscription.unsubscribe(); } } } CdkAriaLive.ɵfac = function CdkAriaLive_Factory(t) { return new (t || CdkAriaLive)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](LiveAnnouncer), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_cdk_observers__WEBPACK_IMPORTED_MODULE_7__["ContentObserver"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"])); }; CdkAriaLive.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineDirective"]({ type: CdkAriaLive, selectors: [["", "cdkAriaLive", ""]], inputs: { politeness: ["cdkAriaLive", "politeness"] }, exportAs: ["cdkAriaLive"] }); CdkAriaLive.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"] }, { type: LiveAnnouncer }, { type: _angular_cdk_observers__WEBPACK_IMPORTED_MODULE_7__["ContentObserver"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] } ]; CdkAriaLive.propDecorators = { politeness: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkAriaLive',] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](CdkAriaLive, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Directive"], args: [{ selector: '[cdkAriaLive]', exportAs: 'cdkAriaLive' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"] }, { type: LiveAnnouncer }, { type: _angular_cdk_observers__WEBPACK_IMPORTED_MODULE_7__["ContentObserver"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }]; }, { politeness: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkAriaLive'] }] }); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Screenreaders will often fire fake mousedown events when a focusable element * is activated using the keyboard. We can typically distinguish between these faked * mousedown events and real mousedown events using the "buttons" property. While * real mousedowns will indicate the mouse button that was pressed (e.g. "1" for * the left mouse button), faked mousedowns will usually set the property value to 0. */ function isFakeMousedownFromScreenReader(event) { return event.buttons === 0; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ // This is the value used by AngularJS Material. Through trial and error (on iPhone 6S) they found // that a value of around 650ms seems appropriate. const TOUCH_BUFFER_MS = 650; /** InjectionToken for FocusMonitorOptions. */ const FOCUS_MONITOR_DEFAULT_OPTIONS = new _angular_core__WEBPACK_IMPORTED_MODULE_1__["InjectionToken"]('cdk-focus-monitor-default-options'); /** * Event listener options that enable capturing and also * mark the listener as passive if the browser supports it. */ const captureEventListenerOptions = Object(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["normalizePassiveListenerOptions"])({ passive: true, capture: true }); /** Monitors mouse and keyboard events to determine the cause of focus events. */ class FocusMonitor { constructor(_ngZone, _platform, /** @breaking-change 11.0.0 make document required */ document, options) { this._ngZone = _ngZone; this._platform = _platform; /** The focus origin that the next focus event is a result of. */ this._origin = null; /** Whether the window has just been focused. */ this._windowFocused = false; /** Map of elements being monitored to their info. */ this._elementInfo = new Map(); /** The number of elements currently being monitored. */ this._monitoredElementCount = 0; /** * Keeps track of the root nodes to which we've currently bound a focus/blur handler, * as well as the number of monitored elements that they contain. We have to treat focus/blur * handlers differently from the rest of the events, because the browser won't emit events * to the document when focus moves inside of a shadow root. */ this._rootNodeFocusListenerCount = new Map(); /** * Event listener for `keydown` events on the document. * Needs to be an arrow function in order to preserve the context when it gets bound. */ this._documentKeydownListener = () => { // On keydown record the origin and clear any touch event that may be in progress. this._lastTouchTarget = null; this._setOriginForCurrentEventQueue('keyboard'); }; /** * Event listener for `mousedown` events on the document. * Needs to be an arrow function in order to preserve the context when it gets bound. */ this._documentMousedownListener = (event) => { // On mousedown record the origin only if there is not touch // target, since a mousedown can happen as a result of a touch event. if (!this._lastTouchTarget) { // In some cases screen readers fire fake `mousedown` events instead of `keydown`. // Resolve the focus source to `keyboard` if we detect one of them. const source = isFakeMousedownFromScreenReader(event) ? 'keyboard' : 'mouse'; this._setOriginForCurrentEventQueue(source); } }; /** * Event listener for `touchstart` events on the document. * Needs to be an arrow function in order to preserve the context when it gets bound. */ this._documentTouchstartListener = (event) => { // When the touchstart event fires the focus event is not yet in the event queue. This means // we can't rely on the trick used above (setting timeout of 1ms). Instead we wait 650ms to // see if a focus happens. if (this._touchTimeoutId != null) { clearTimeout(this._touchTimeoutId); } this._lastTouchTarget = getTarget(event); this._touchTimeoutId = setTimeout(() => this._lastTouchTarget = null, TOUCH_BUFFER_MS); }; /** * Event listener for `focus` events on the window. * Needs to be an arrow function in order to preserve the context when it gets bound. */ this._windowFocusListener = () => { // Make a note of when the window regains focus, so we can // restore the origin info for the focused element. this._windowFocused = true; this._windowFocusTimeoutId = setTimeout(() => this._windowFocused = false); }; /** * Event listener for `focus` and 'blur' events on the document. * Needs to be an arrow function in order to preserve the context when it gets bound. */ this._rootNodeFocusAndBlurListener = (event) => { const target = getTarget(event); const handler = event.type === 'focus' ? this._onFocus : this._onBlur; // We need to walk up the ancestor chain in order to support `checkChildren`. for (let element = target; element; element = element.parentElement) { handler.call(this, event, element); } }; this._document = document; this._detectionMode = (options === null || options === void 0 ? void 0 : options.detectionMode) || 0 /* IMMEDIATE */; } monitor(element, checkChildren = false) { const nativeElement = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_6__["coerceElement"])(element); // Do nothing if we're not on the browser platform or the passed in node isn't an element. if (!this._platform.isBrowser || nativeElement.nodeType !== 1) { return Object(rxjs__WEBPACK_IMPORTED_MODULE_3__["of"])(null); } // If the element is inside the shadow DOM, we need to bind our focus/blur listeners to // the shadow root, rather than the `document`, because the browser won't emit focus events // to the `document`, if focus is moving within the same shadow root. const rootNode = Object(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["_getShadowRoot"])(nativeElement) || this._getDocument(); const cachedInfo = this._elementInfo.get(nativeElement); // Check if we're already monitoring this element. if (cachedInfo) { if (checkChildren) { // TODO(COMP-318): this can be problematic, because it'll turn all non-checkChildren // observers into ones that behave as if `checkChildren` was turned on. We need a more // robust solution. cachedInfo.checkChildren = true; } return cachedInfo.subject; } // Create monitored element info. const info = { checkChildren: checkChildren, subject: new rxjs__WEBPACK_IMPORTED_MODULE_3__["Subject"](), rootNode }; this._elementInfo.set(nativeElement, info); this._registerGlobalListeners(info); return info.subject; } stopMonitoring(element) { const nativeElement = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_6__["coerceElement"])(element); const elementInfo = this._elementInfo.get(nativeElement); if (elementInfo) { elementInfo.subject.complete(); this._setClasses(nativeElement); this._elementInfo.delete(nativeElement); this._removeGlobalListeners(elementInfo); } } focusVia(element, origin, options) { const nativeElement = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_6__["coerceElement"])(element); this._setOriginForCurrentEventQueue(origin); // `focus` isn't available on the server if (typeof nativeElement.focus === 'function') { // Cast the element to `any`, because the TS typings don't have the `options` parameter yet. nativeElement.focus(options); } } ngOnDestroy() { this._elementInfo.forEach((_info, element) => this.stopMonitoring(element)); } /** Access injected document if available or fallback to global document reference */ _getDocument() { return this._document || document; } /** Use defaultView of injected document if available or fallback to global window reference */ _getWindow() { const doc = this._getDocument(); return doc.defaultView || window; } _toggleClass(element, className, shouldSet) { if (shouldSet) { element.classList.add(className); } else { element.classList.remove(className); } } _getFocusOrigin(event) { // If we couldn't detect a cause for the focus event, it's due to one of three reasons: // 1) The window has just regained focus, in which case we want to restore the focused state of // the element from before the window blurred. // 2) It was caused by a touch event, in which case we mark the origin as 'touch'. // 3) The element was programmatically focused, in which case we should mark the origin as // 'program'. if (this._origin) { return this._origin; } if (this._windowFocused && this._lastFocusOrigin) { return this._lastFocusOrigin; } else if (this._wasCausedByTouch(event)) { return 'touch'; } else { return 'program'; } } /** * Sets the focus classes on the element based on the given focus origin. * @param element The element to update the classes on. * @param origin The focus origin. */ _setClasses(element, origin) { this._toggleClass(element, 'cdk-focused', !!origin); this._toggleClass(element, 'cdk-touch-focused', origin === 'touch'); this._toggleClass(element, 'cdk-keyboard-focused', origin === 'keyboard'); this._toggleClass(element, 'cdk-mouse-focused', origin === 'mouse'); this._toggleClass(element, 'cdk-program-focused', origin === 'program'); } /** * Sets the origin and schedules an async function to clear it at the end of the event queue. * If the detection mode is 'eventual', the origin is never cleared. * @param origin The origin to set. */ _setOriginForCurrentEventQueue(origin) { this._ngZone.runOutsideAngular(() => { this._origin = origin; if (this._detectionMode === 0 /* IMMEDIATE */) { // Sometimes the focus origin won't be valid in Firefox because Firefox seems to focus *one* // tick after the interaction event fired. To ensure the focus origin is always correct, // the focus origin will be determined at the beginning of the next tick. this._originTimeoutId = setTimeout(() => this._origin = null, 1); } }); } /** * Checks whether the given focus event was caused by a touchstart event. * @param event The focus event to check. * @returns Whether the event was caused by a touch. */ _wasCausedByTouch(event) { // Note(mmalerba): This implementation is not quite perfect, there is a small edge case. // Consider the following dom structure: // //
//
//
// // If the user touches the #child element and the #parent is programmatically focused as a // result, this code will still consider it to have been caused by the touch event and will // apply the cdk-touch-focused class rather than the cdk-program-focused class. This is a // relatively small edge-case that can be worked around by using // focusVia(parentEl, 'program') to focus the parent element. // // If we decide that we absolutely must handle this case correctly, we can do so by listening // for the first focus event after the touchstart, and then the first blur event after that // focus event. When that blur event fires we know that whatever follows is not a result of the // touchstart. const focusTarget = getTarget(event); return this._lastTouchTarget instanceof Node && focusTarget instanceof Node && (focusTarget === this._lastTouchTarget || focusTarget.contains(this._lastTouchTarget)); } /** * Handles focus events on a registered element. * @param event The focus event. * @param element The monitored element. */ _onFocus(event, element) { // NOTE(mmalerba): We currently set the classes based on the focus origin of the most recent // focus event affecting the monitored element. If we want to use the origin of the first event // instead we should check for the cdk-focused class here and return if the element already has // it. (This only matters for elements that have includesChildren = true). // If we are not counting child-element-focus as focused, make sure that the event target is the // monitored element itself. const elementInfo = this._elementInfo.get(element); if (!elementInfo || (!elementInfo.checkChildren && element !== getTarget(event))) { return; } const origin = this._getFocusOrigin(event); this._setClasses(element, origin); this._emitOrigin(elementInfo.subject, origin); this._lastFocusOrigin = origin; } /** * Handles blur events on a registered element. * @param event The blur event. * @param element The monitored element. */ _onBlur(event, element) { // If we are counting child-element-focus as focused, make sure that we aren't just blurring in // order to focus another child of the monitored element. const elementInfo = this._elementInfo.get(element); if (!elementInfo || (elementInfo.checkChildren && event.relatedTarget instanceof Node && element.contains(event.relatedTarget))) { return; } this._setClasses(element); this._emitOrigin(elementInfo.subject, null); } _emitOrigin(subject, origin) { this._ngZone.run(() => subject.next(origin)); } _registerGlobalListeners(elementInfo) { if (!this._platform.isBrowser) { return; } const rootNode = elementInfo.rootNode; const rootNodeFocusListeners = this._rootNodeFocusListenerCount.get(rootNode) || 0; if (!rootNodeFocusListeners) { this._ngZone.runOutsideAngular(() => { rootNode.addEventListener('focus', this._rootNodeFocusAndBlurListener, captureEventListenerOptions); rootNode.addEventListener('blur', this._rootNodeFocusAndBlurListener, captureEventListenerOptions); }); } this._rootNodeFocusListenerCount.set(rootNode, rootNodeFocusListeners + 1); // Register global listeners when first element is monitored. if (++this._monitoredElementCount === 1) { // Note: we listen to events in the capture phase so we // can detect them even if the user stops propagation. this._ngZone.runOutsideAngular(() => { const document = this._getDocument(); const window = this._getWindow(); document.addEventListener('keydown', this._documentKeydownListener, captureEventListenerOptions); document.addEventListener('mousedown', this._documentMousedownListener, captureEventListenerOptions); document.addEventListener('touchstart', this._documentTouchstartListener, captureEventListenerOptions); window.addEventListener('focus', this._windowFocusListener); }); } } _removeGlobalListeners(elementInfo) { const rootNode = elementInfo.rootNode; if (this._rootNodeFocusListenerCount.has(rootNode)) { const rootNodeFocusListeners = this._rootNodeFocusListenerCount.get(rootNode); if (rootNodeFocusListeners > 1) { this._rootNodeFocusListenerCount.set(rootNode, rootNodeFocusListeners - 1); } else { rootNode.removeEventListener('focus', this._rootNodeFocusAndBlurListener, captureEventListenerOptions); rootNode.removeEventListener('blur', this._rootNodeFocusAndBlurListener, captureEventListenerOptions); this._rootNodeFocusListenerCount.delete(rootNode); } } // Unregister global listeners when last element is unmonitored. if (!--this._monitoredElementCount) { const document = this._getDocument(); const window = this._getWindow(); document.removeEventListener('keydown', this._documentKeydownListener, captureEventListenerOptions); document.removeEventListener('mousedown', this._documentMousedownListener, captureEventListenerOptions); document.removeEventListener('touchstart', this._documentTouchstartListener, captureEventListenerOptions); window.removeEventListener('focus', this._windowFocusListener); // Clear timeouts for all potentially pending timeouts to prevent the leaks. clearTimeout(this._windowFocusTimeoutId); clearTimeout(this._touchTimeoutId); clearTimeout(this._originTimeoutId); } } } FocusMonitor.ɵfac = function FocusMonitor_Factory(t) { return new (t || FocusMonitor)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"], 8), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](FOCUS_MONITOR_DEFAULT_OPTIONS, 8)); }; FocusMonitor.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjectable"])({ factory: function FocusMonitor_Factory() { return new FocusMonitor(Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"]), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"]), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"], 8), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(FOCUS_MONITOR_DEFAULT_OPTIONS, 8)); }, token: FocusMonitor, providedIn: "root" }); FocusMonitor.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }, { type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"],] }] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [FOCUS_MONITOR_DEFAULT_OPTIONS,] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](FocusMonitor, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Injectable"], args: [{ providedIn: 'root' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }, { type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"]] }] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [FOCUS_MONITOR_DEFAULT_OPTIONS] }] }]; }, null); })(); /** Gets the target of an event, accounting for Shadow DOM. */ function getTarget(event) { // If an event is bound outside the Shadow DOM, the `event.target` will // point to the shadow root so we have to use `composedPath` instead. return (event.composedPath ? event.composedPath()[0] : event.target); } /** * Directive that determines how a particular element was focused (via keyboard, mouse, touch, or * programmatically) and adds corresponding classes to the element. * * There are two variants of this directive: * 1) cdkMonitorElementFocus: does not consider an element to be focused if one of its children is * focused. * 2) cdkMonitorSubtreeFocus: considers an element focused if it or any of its children are focused. */ class CdkMonitorFocus { constructor(_elementRef, _focusMonitor) { this._elementRef = _elementRef; this._focusMonitor = _focusMonitor; this.cdkFocusChange = new _angular_core__WEBPACK_IMPORTED_MODULE_1__["EventEmitter"](); } ngAfterViewInit() { const element = this._elementRef.nativeElement; this._monitorSubscription = this._focusMonitor.monitor(element, element.nodeType === 1 && element.hasAttribute('cdkMonitorSubtreeFocus')) .subscribe(origin => this.cdkFocusChange.emit(origin)); } ngOnDestroy() { this._focusMonitor.stopMonitoring(this._elementRef); if (this._monitorSubscription) { this._monitorSubscription.unsubscribe(); } } } CdkMonitorFocus.ɵfac = function CdkMonitorFocus_Factory(t) { return new (t || CdkMonitorFocus)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](FocusMonitor)); }; CdkMonitorFocus.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineDirective"]({ type: CdkMonitorFocus, selectors: [["", "cdkMonitorElementFocus", ""], ["", "cdkMonitorSubtreeFocus", ""]], outputs: { cdkFocusChange: "cdkFocusChange" } }); CdkMonitorFocus.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"] }, { type: FocusMonitor } ]; CdkMonitorFocus.propDecorators = { cdkFocusChange: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Output"] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](CdkMonitorFocus, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Directive"], args: [{ selector: '[cdkMonitorElementFocus], [cdkMonitorSubtreeFocus]' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"] }, { type: FocusMonitor }]; }, { cdkFocusChange: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Output"] }] }); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** CSS class applied to the document body when in black-on-white high-contrast mode. */ const BLACK_ON_WHITE_CSS_CLASS = 'cdk-high-contrast-black-on-white'; /** CSS class applied to the document body when in white-on-black high-contrast mode. */ const WHITE_ON_BLACK_CSS_CLASS = 'cdk-high-contrast-white-on-black'; /** CSS class applied to the document body when in high-contrast mode. */ const HIGH_CONTRAST_MODE_ACTIVE_CSS_CLASS = 'cdk-high-contrast-active'; /** * Service to determine whether the browser is currently in a high-contrast-mode environment. * * Microsoft Windows supports an accessibility feature called "High Contrast Mode". This mode * changes the appearance of all applications, including web applications, to dramatically increase * contrast. * * IE, Edge, and Firefox currently support this mode. Chrome does not support Windows High Contrast * Mode. This service does not detect high-contrast mode as added by the Chrome "High Contrast" * browser extension. */ class HighContrastModeDetector { constructor(_platform, document) { this._platform = _platform; this._document = document; } /** Gets the current high-contrast-mode for the page. */ getHighContrastMode() { if (!this._platform.isBrowser) { return 0 /* NONE */; } // Create a test element with an arbitrary background-color that is neither black nor // white; high-contrast mode will coerce the color to either black or white. Also ensure that // appending the test element to the DOM does not affect layout by absolutely positioning it const testElement = this._document.createElement('div'); testElement.style.backgroundColor = 'rgb(1,2,3)'; testElement.style.position = 'absolute'; this._document.body.appendChild(testElement); // Get the computed style for the background color, collapsing spaces to normalize between // browsers. Once we get this color, we no longer need the test element. Access the `window` // via the document so we can fake it in tests. Note that we have extra null checks, because // this logic will likely run during app bootstrap and throwing can break the entire app. const documentWindow = this._document.defaultView || window; const computedStyle = (documentWindow && documentWindow.getComputedStyle) ? documentWindow.getComputedStyle(testElement) : null; const computedColor = (computedStyle && computedStyle.backgroundColor || '').replace(/ /g, ''); this._document.body.removeChild(testElement); switch (computedColor) { case 'rgb(0,0,0)': return 2 /* WHITE_ON_BLACK */; case 'rgb(255,255,255)': return 1 /* BLACK_ON_WHITE */; } return 0 /* NONE */; } /** Applies CSS classes indicating high-contrast mode to document body (browser-only). */ _applyBodyHighContrastModeCssClasses() { if (this._platform.isBrowser && this._document.body) { const bodyClasses = this._document.body.classList; // IE11 doesn't support `classList` operations with multiple arguments bodyClasses.remove(HIGH_CONTRAST_MODE_ACTIVE_CSS_CLASS); bodyClasses.remove(BLACK_ON_WHITE_CSS_CLASS); bodyClasses.remove(WHITE_ON_BLACK_CSS_CLASS); const mode = this.getHighContrastMode(); if (mode === 1 /* BLACK_ON_WHITE */) { bodyClasses.add(HIGH_CONTRAST_MODE_ACTIVE_CSS_CLASS); bodyClasses.add(BLACK_ON_WHITE_CSS_CLASS); } else if (mode === 2 /* WHITE_ON_BLACK */) { bodyClasses.add(HIGH_CONTRAST_MODE_ACTIVE_CSS_CLASS); bodyClasses.add(WHITE_ON_BLACK_CSS_CLASS); } } } } HighContrastModeDetector.ɵfac = function HighContrastModeDetector_Factory(t) { return new (t || HighContrastModeDetector)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"])); }; HighContrastModeDetector.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjectable"])({ factory: function HighContrastModeDetector_Factory() { return new HighContrastModeDetector(Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"]), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"])); }, token: HighContrastModeDetector, providedIn: "root" }); HighContrastModeDetector.ctorParameters = () => [ { type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"],] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](HighContrastModeDetector, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Injectable"], args: [{ providedIn: 'root' }] }], function () { return [{ type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_0__["DOCUMENT"]] }] }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ class A11yModule { constructor(highContrastModeDetector) { highContrastModeDetector._applyBodyHighContrastModeCssClasses(); } } A11yModule.ɵmod = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineNgModule"]({ type: A11yModule }); A11yModule.ɵinj = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjector"]({ factory: function A11yModule_Factory(t) { return new (t || A11yModule)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](HighContrastModeDetector)); }, imports: [[_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["PlatformModule"], _angular_cdk_observers__WEBPACK_IMPORTED_MODULE_7__["ObserversModule"]]] }); A11yModule.ctorParameters = () => [ { type: HighContrastModeDetector } ]; (function () { (typeof ngJitMode === "undefined" || ngJitMode) && _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵsetNgModuleScope"](A11yModule, { declarations: function () { return [CdkAriaLive, CdkTrapFocus, CdkMonitorFocus]; }, imports: function () { return [_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["PlatformModule"], _angular_cdk_observers__WEBPACK_IMPORTED_MODULE_7__["ObserversModule"]]; }, exports: function () { return [CdkAriaLive, CdkTrapFocus, CdkMonitorFocus]; } }); })(); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](A11yModule, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgModule"], args: [{ imports: [_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["PlatformModule"], _angular_cdk_observers__WEBPACK_IMPORTED_MODULE_7__["ObserversModule"]], declarations: [CdkAriaLive, CdkTrapFocus, CdkMonitorFocus], exports: [CdkAriaLive, CdkTrapFocus, CdkMonitorFocus] }] }], function () { return [{ type: HighContrastModeDetector }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Generated bundle index. Do not edit. */ //# sourceMappingURL=a11y.js.map /***/ }), /***/ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/bidi.js": /*!*****************************************************************!*\ !*** ./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/bidi.js ***! \*****************************************************************/ /*! exports provided: BidiModule, DIR_DOCUMENT, Dir, Directionality, ɵangular_material_src_cdk_bidi_bidi_a */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; __webpack_require__.r(__webpack_exports__); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "BidiModule", function() { return BidiModule; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "DIR_DOCUMENT", function() { return DIR_DOCUMENT; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "Dir", function() { return Dir; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "Directionality", function() { return Directionality; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_material_src_cdk_bidi_bidi_a", function() { return DIR_DOCUMENT_FACTORY; }); /* harmony import */ var _angular_core__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @angular/core */ "./node_modules/@angular/core/__ivy_ngcc__/fesm2015/core.js"); /* harmony import */ var _angular_common__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! @angular/common */ "./node_modules/@angular/common/__ivy_ngcc__/fesm2015/common.js"); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Injection token used to inject the document into Directionality. * This is used so that the value can be faked in tests. * * We can't use the real document in tests because changing the real `dir` causes geometry-based * tests in Safari to fail. * * We also can't re-provide the DOCUMENT token from platform-brower because the unit tests * themselves use things like `querySelector` in test code. * * This token is defined in a separate file from Directionality as a workaround for * https://github.com/angular/angular/issues/22559 * * @docs-private */ const DIR_DOCUMENT = new _angular_core__WEBPACK_IMPORTED_MODULE_0__["InjectionToken"]('cdk-dir-doc', { providedIn: 'root', factory: DIR_DOCUMENT_FACTORY, }); /** @docs-private */ function DIR_DOCUMENT_FACTORY() { return Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["inject"])(_angular_common__WEBPACK_IMPORTED_MODULE_1__["DOCUMENT"]); } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * The directionality (LTR / RTL) context for the application (or a subtree of it). * Exposes the current direction and a stream of direction changes. */ class Directionality { constructor(_document) { /** The current 'ltr' or 'rtl' value. */ this.value = 'ltr'; /** Stream that emits whenever the 'ltr' / 'rtl' state changes. */ this.change = new _angular_core__WEBPACK_IMPORTED_MODULE_0__["EventEmitter"](); if (_document) { // TODO: handle 'auto' value - // We still need to account for dir="auto". // It looks like HTMLElemenet.dir is also "auto" when that's set to the attribute, // but getComputedStyle return either "ltr" or "rtl". avoiding getComputedStyle for now const bodyDir = _document.body ? _document.body.dir : null; const htmlDir = _document.documentElement ? _document.documentElement.dir : null; const value = bodyDir || htmlDir; this.value = (value === 'ltr' || value === 'rtl') ? value : 'ltr'; } } ngOnDestroy() { this.change.complete(); } } Directionality.ɵfac = function Directionality_Factory(t) { return new (t || Directionality)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](DIR_DOCUMENT, 8)); }; Directionality.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"])({ factory: function Directionality_Factory() { return new Directionality(Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(DIR_DOCUMENT, 8)); }, token: Directionality, providedIn: "root" }); Directionality.ctorParameters = () => [ { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Inject"], args: [DIR_DOCUMENT,] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](Directionality, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Injectable"], args: [{ providedIn: 'root' }] }], function () { return [{ type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Inject"], args: [DIR_DOCUMENT] }] }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Directive to listen for changes of direction of part of the DOM. * * Provides itself as Directionality such that descendant directives only need to ever inject * Directionality to get the closest direction. */ class Dir { constructor() { /** Normalized direction that accounts for invalid/unsupported values. */ this._dir = 'ltr'; /** Whether the `value` has been set to its initial value. */ this._isInitialized = false; /** Event emitted when the direction changes. */ this.change = new _angular_core__WEBPACK_IMPORTED_MODULE_0__["EventEmitter"](); } /** @docs-private */ get dir() { return this._dir; } set dir(value) { const old = this._dir; const normalizedValue = value ? value.toLowerCase() : value; this._rawDir = value; this._dir = (normalizedValue === 'ltr' || normalizedValue === 'rtl') ? normalizedValue : 'ltr'; if (old !== this._dir && this._isInitialized) { this.change.emit(this._dir); } } /** Current layout direction of the element. */ get value() { return this.dir; } /** Initialize once default value has been set. */ ngAfterContentInit() { this._isInitialized = true; } ngOnDestroy() { this.change.complete(); } } Dir.ɵfac = function Dir_Factory(t) { return new (t || Dir)(); }; Dir.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: Dir, selectors: [["", "dir", ""]], hostVars: 1, hostBindings: function Dir_HostBindings(rf, ctx) { if (rf & 2) { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵattribute"]("dir", ctx._rawDir); } }, inputs: { dir: "dir" }, outputs: { change: "dirChange" }, exportAs: ["dir"], features: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵProvidersFeature"]([{ provide: Directionality, useExisting: Dir }])] }); Dir.propDecorators = { change: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Output"], args: ['dirChange',] }], dir: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](Dir, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Directive"], args: [{ selector: '[dir]', providers: [{ provide: Directionality, useExisting: Dir }], host: { '[attr.dir]': '_rawDir' }, exportAs: 'dir' }] }], function () { return []; }, { change: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Output"], args: ['dirChange'] }], dir: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }] }); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ class BidiModule { } BidiModule.ɵmod = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineNgModule"]({ type: BidiModule }); BidiModule.ɵinj = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjector"]({ factory: function BidiModule_Factory(t) { return new (t || BidiModule)(); } }); (function () { (typeof ngJitMode === "undefined" || ngJitMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵsetNgModuleScope"](BidiModule, { declarations: [Dir], exports: [Dir] }); })(); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](BidiModule, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["NgModule"], args: [{ exports: [Dir], declarations: [Dir] }] }], null, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Generated bundle index. Do not edit. */ //# sourceMappingURL=bidi.js.map /***/ }), /***/ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/collections.js": /*!************************************************************************!*\ !*** ./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/collections.js ***! \************************************************************************/ /*! exports provided: ArrayDataSource, DataSource, SelectionModel, UniqueSelectionDispatcher, _DisposeViewRepeaterStrategy, _RecycleViewRepeaterStrategy, _VIEW_REPEATER_STRATEGY, getMultipleValuesInSingleSelectionError, isDataSource */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; __webpack_require__.r(__webpack_exports__); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ArrayDataSource", function() { return ArrayDataSource; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "DataSource", function() { return DataSource; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "SelectionModel", function() { return SelectionModel; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "UniqueSelectionDispatcher", function() { return UniqueSelectionDispatcher; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "_DisposeViewRepeaterStrategy", function() { return _DisposeViewRepeaterStrategy; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "_RecycleViewRepeaterStrategy", function() { return _RecycleViewRepeaterStrategy; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "_VIEW_REPEATER_STRATEGY", function() { return _VIEW_REPEATER_STRATEGY; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getMultipleValuesInSingleSelectionError", function() { return getMultipleValuesInSingleSelectionError; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "isDataSource", function() { return isDataSource; }); /* harmony import */ var rxjs__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! rxjs */ "./node_modules/rxjs/_esm2015/index.js"); /* harmony import */ var _angular_core__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! @angular/core */ "./node_modules/@angular/core/__ivy_ngcc__/fesm2015/core.js"); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ class DataSource { } /** Checks whether an object is a data source. */ function isDataSource(value) { // Check if the value is a DataSource by observing if it has a connect function. Cannot // be checked as an `instanceof DataSource` since people could create their own sources // that match the interface, but don't extend DataSource. return value && typeof value.connect === 'function'; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** DataSource wrapper for a native array. */ class ArrayDataSource extends DataSource { constructor(_data) { super(); this._data = _data; } connect() { return Object(rxjs__WEBPACK_IMPORTED_MODULE_0__["isObservable"])(this._data) ? this._data : Object(rxjs__WEBPACK_IMPORTED_MODULE_0__["of"])(this._data); } disconnect() { } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * A repeater that destroys views when they are removed from a * {@link ViewContainerRef}. When new items are inserted into the container, * the repeater will always construct a new embedded view for each item. * * @template T The type for the embedded view's $implicit property. * @template R The type for the item in each IterableDiffer change record. * @template C The type for the context passed to each embedded view. */ class _DisposeViewRepeaterStrategy { applyChanges(changes, viewContainerRef, itemContextFactory, itemValueResolver, itemViewChanged) { changes.forEachOperation((record, adjustedPreviousIndex, currentIndex) => { let view; let operation; if (record.previousIndex == null) { const insertContext = itemContextFactory(record, adjustedPreviousIndex, currentIndex); view = viewContainerRef.createEmbeddedView(insertContext.templateRef, insertContext.context, insertContext.index); operation = 1 /* INSERTED */; } else if (currentIndex == null) { viewContainerRef.remove(adjustedPreviousIndex); operation = 3 /* REMOVED */; } else { view = viewContainerRef.get(adjustedPreviousIndex); viewContainerRef.move(view, currentIndex); operation = 2 /* MOVED */; } if (itemViewChanged) { itemViewChanged({ context: view === null || view === void 0 ? void 0 : view.context, operation, record, }); } }); } detach() { } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * A repeater that caches views when they are removed from a * {@link ViewContainerRef}. When new items are inserted into the container, * the repeater will reuse one of the cached views instead of creating a new * embedded view. Recycling cached views reduces the quantity of expensive DOM * inserts. * * @template T The type for the embedded view's $implicit property. * @template R The type for the item in each IterableDiffer change record. * @template C The type for the context passed to each embedded view. */ class _RecycleViewRepeaterStrategy { constructor() { /** * The size of the cache used to store unused views. * Setting the cache size to `0` will disable caching. Defaults to 20 views. */ this.viewCacheSize = 20; /** * View cache that stores embedded view instances that have been previously stamped out, * but don't are not currently rendered. The view repeater will reuse these views rather than * creating brand new ones. * * TODO(michaeljamesparsons) Investigate whether using a linked list would improve performance. */ this._viewCache = []; } /** Apply changes to the DOM. */ applyChanges(changes, viewContainerRef, itemContextFactory, itemValueResolver, itemViewChanged) { // Rearrange the views to put them in the right location. changes.forEachOperation((record, adjustedPreviousIndex, currentIndex) => { let view; let operation; if (record.previousIndex == null) { // Item added. const viewArgsFactory = () => itemContextFactory(record, adjustedPreviousIndex, currentIndex); view = this._insertView(viewArgsFactory, currentIndex, viewContainerRef, itemValueResolver(record)); operation = view ? 1 /* INSERTED */ : 0 /* REPLACED */; } else if (currentIndex == null) { // Item removed. this._detachAndCacheView(adjustedPreviousIndex, viewContainerRef); operation = 3 /* REMOVED */; } else { // Item moved. view = this._moveView(adjustedPreviousIndex, currentIndex, viewContainerRef, itemValueResolver(record)); operation = 2 /* MOVED */; } if (itemViewChanged) { itemViewChanged({ context: view === null || view === void 0 ? void 0 : view.context, operation, record, }); } }); } detach() { for (const view of this._viewCache) { view.destroy(); } } /** * Inserts a view for a new item, either from the cache or by creating a new * one. Returns `undefined` if the item was inserted into a cached view. */ _insertView(viewArgsFactory, currentIndex, viewContainerRef, value) { let cachedView = this._insertViewFromCache(currentIndex, viewContainerRef); if (cachedView) { cachedView.context.$implicit = value; return undefined; } const viewArgs = viewArgsFactory(); return viewContainerRef.createEmbeddedView(viewArgs.templateRef, viewArgs.context, viewArgs.index); } /** Detaches the view at the given index and inserts into the view cache. */ _detachAndCacheView(index, viewContainerRef) { const detachedView = this._detachView(index, viewContainerRef); this._maybeCacheView(detachedView, viewContainerRef); } /** Moves view at the previous index to the current index. */ _moveView(adjustedPreviousIndex, currentIndex, viewContainerRef, value) { const view = viewContainerRef.get(adjustedPreviousIndex); viewContainerRef.move(view, currentIndex); view.context.$implicit = value; return view; } /** * Cache the given detached view. If the cache is full, the view will be * destroyed. */ _maybeCacheView(view, viewContainerRef) { if (this._viewCache.length < this.viewCacheSize) { this._viewCache.push(view); } else { const index = viewContainerRef.indexOf(view); // The host component could remove views from the container outside of // the view repeater. It's unlikely this will occur, but just in case, // destroy the view on its own, otherwise destroy it through the // container to ensure that all the references are removed. if (index === -1) { view.destroy(); } else { viewContainerRef.remove(index); } } } /** Inserts a recycled view from the cache at the given index. */ _insertViewFromCache(index, viewContainerRef) { const cachedView = this._viewCache.pop(); if (cachedView) { viewContainerRef.insert(cachedView, index); } return cachedView || null; } /** Detaches the embedded view at the given index. */ _detachView(index, viewContainerRef) { return viewContainerRef.detach(index); } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Class to be used to power selecting one or more options from a list. */ class SelectionModel { constructor(_multiple = false, initiallySelectedValues, _emitChanges = true) { this._multiple = _multiple; this._emitChanges = _emitChanges; /** Currently-selected values. */ this._selection = new Set(); /** Keeps track of the deselected options that haven't been emitted by the change event. */ this._deselectedToEmit = []; /** Keeps track of the selected options that haven't been emitted by the change event. */ this._selectedToEmit = []; /** Event emitted when the value has changed. */ this.changed = new rxjs__WEBPACK_IMPORTED_MODULE_0__["Subject"](); if (initiallySelectedValues && initiallySelectedValues.length) { if (_multiple) { initiallySelectedValues.forEach(value => this._markSelected(value)); } else { this._markSelected(initiallySelectedValues[0]); } // Clear the array in order to avoid firing the change event for preselected values. this._selectedToEmit.length = 0; } } /** Selected values. */ get selected() { if (!this._selected) { this._selected = Array.from(this._selection.values()); } return this._selected; } /** * Selects a value or an array of values. */ select(...values) { this._verifyValueAssignment(values); values.forEach(value => this._markSelected(value)); this._emitChangeEvent(); } /** * Deselects a value or an array of values. */ deselect(...values) { this._verifyValueAssignment(values); values.forEach(value => this._unmarkSelected(value)); this._emitChangeEvent(); } /** * Toggles a value between selected and deselected. */ toggle(value) { this.isSelected(value) ? this.deselect(value) : this.select(value); } /** * Clears all of the selected values. */ clear() { this._unmarkAll(); this._emitChangeEvent(); } /** * Determines whether a value is selected. */ isSelected(value) { return this._selection.has(value); } /** * Determines whether the model does not have a value. */ isEmpty() { return this._selection.size === 0; } /** * Determines whether the model has a value. */ hasValue() { return !this.isEmpty(); } /** * Sorts the selected values based on a predicate function. */ sort(predicate) { if (this._multiple && this.selected) { this._selected.sort(predicate); } } /** * Gets whether multiple values can be selected. */ isMultipleSelection() { return this._multiple; } /** Emits a change event and clears the records of selected and deselected values. */ _emitChangeEvent() { // Clear the selected values so they can be re-cached. this._selected = null; if (this._selectedToEmit.length || this._deselectedToEmit.length) { this.changed.next({ source: this, added: this._selectedToEmit, removed: this._deselectedToEmit }); this._deselectedToEmit = []; this._selectedToEmit = []; } } /** Selects a value. */ _markSelected(value) { if (!this.isSelected(value)) { if (!this._multiple) { this._unmarkAll(); } this._selection.add(value); if (this._emitChanges) { this._selectedToEmit.push(value); } } } /** Deselects a value. */ _unmarkSelected(value) { if (this.isSelected(value)) { this._selection.delete(value); if (this._emitChanges) { this._deselectedToEmit.push(value); } } } /** Clears out the selected values. */ _unmarkAll() { if (!this.isEmpty()) { this._selection.forEach(value => this._unmarkSelected(value)); } } /** * Verifies the value assignment and throws an error if the specified value array is * including multiple values while the selection model is not supporting multiple values. */ _verifyValueAssignment(values) { if (values.length > 1 && !this._multiple && (typeof ngDevMode === 'undefined' || ngDevMode)) { throw getMultipleValuesInSingleSelectionError(); } } } /** * Returns an error that reports that multiple values are passed into a selection model * with a single value. * @docs-private */ function getMultipleValuesInSingleSelectionError() { return Error('Cannot pass multiple values into SelectionModel with single-value mode.'); } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Class to coordinate unique selection based on name. * Intended to be consumed as an Angular service. * This service is needed because native radio change events are only fired on the item currently * being selected, and we still need to uncheck the previous selection. * * This service does not *store* any IDs and names because they may change at any time, so it is * less error-prone if they are simply passed through when the events occur. */ class UniqueSelectionDispatcher { constructor() { this._listeners = []; } /** * Notify other items that selection for the given name has been set. * @param id ID of the item. * @param name Name of the item. */ notify(id, name) { for (let listener of this._listeners) { listener(id, name); } } /** * Listen for future changes to item selection. * @return Function used to deregister listener */ listen(listener) { this._listeners.push(listener); return () => { this._listeners = this._listeners.filter((registered) => { return listener !== registered; }); }; } ngOnDestroy() { this._listeners = []; } } UniqueSelectionDispatcher.ɵfac = function UniqueSelectionDispatcher_Factory(t) { return new (t || UniqueSelectionDispatcher)(); }; UniqueSelectionDispatcher.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjectable"])({ factory: function UniqueSelectionDispatcher_Factory() { return new UniqueSelectionDispatcher(); }, token: UniqueSelectionDispatcher, providedIn: "root" }); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](UniqueSelectionDispatcher, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Injectable"], args: [{ providedIn: 'root' }] }], function () { return []; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Injection token for {@link _ViewRepeater}. This token is for use by Angular Material only. * @docs-private */ const _VIEW_REPEATER_STRATEGY = new _angular_core__WEBPACK_IMPORTED_MODULE_1__["InjectionToken"]('_ViewRepeater'); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Generated bundle index. Do not edit. */ //# sourceMappingURL=collections.js.map /***/ }), /***/ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/keycodes.js": /*!*********************************************************************!*\ !*** ./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/keycodes.js ***! \*********************************************************************/ /*! exports provided: A, ALT, APOSTROPHE, AT_SIGN, B, BACKSLASH, BACKSPACE, C, CAPS_LOCK, CLOSE_SQUARE_BRACKET, COMMA, CONTEXT_MENU, CONTROL, D, DASH, DELETE, DOWN_ARROW, E, EIGHT, END, ENTER, EQUALS, ESCAPE, F, F1, F10, F11, F12, F2, F3, F4, F5, F6, F7, F8, F9, FF_EQUALS, FF_MINUS, FF_MUTE, FF_SEMICOLON, FF_VOLUME_DOWN, FF_VOLUME_UP, FIRST_MEDIA, FIVE, FOUR, G, H, HOME, I, INSERT, J, K, L, LAST_MEDIA, LEFT_ARROW, M, MAC_ENTER, MAC_META, MAC_WK_CMD_LEFT, MAC_WK_CMD_RIGHT, META, MUTE, N, NINE, NUMPAD_DIVIDE, NUMPAD_EIGHT, NUMPAD_FIVE, NUMPAD_FOUR, NUMPAD_MINUS, NUMPAD_MULTIPLY, NUMPAD_NINE, NUMPAD_ONE, NUMPAD_PERIOD, NUMPAD_PLUS, NUMPAD_SEVEN, NUMPAD_SIX, NUMPAD_THREE, NUMPAD_TWO, NUMPAD_ZERO, NUM_CENTER, NUM_LOCK, O, ONE, OPEN_SQUARE_BRACKET, P, PAGE_DOWN, PAGE_UP, PAUSE, PLUS_SIGN, PRINT_SCREEN, Q, QUESTION_MARK, R, RIGHT_ARROW, S, SCROLL_LOCK, SEMICOLON, SEVEN, SHIFT, SINGLE_QUOTE, SIX, SLASH, SPACE, T, TAB, THREE, TILDE, TWO, U, UP_ARROW, V, VOLUME_DOWN, VOLUME_UP, W, X, Y, Z, ZERO, hasModifierKey */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; __webpack_require__.r(__webpack_exports__); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "A", function() { return A; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ALT", function() { return ALT; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "APOSTROPHE", function() { return APOSTROPHE; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "AT_SIGN", function() { return AT_SIGN; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "B", function() { return B; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "BACKSLASH", function() { return BACKSLASH; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "BACKSPACE", function() { return BACKSPACE; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "C", function() { return C; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CAPS_LOCK", function() { return CAPS_LOCK; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CLOSE_SQUARE_BRACKET", function() { return CLOSE_SQUARE_BRACKET; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "COMMA", function() { return COMMA; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CONTEXT_MENU", function() { return CONTEXT_MENU; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CONTROL", function() { return CONTROL; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "D", function() { return D; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "DASH", function() { return DASH; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "DELETE", function() { return DELETE; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "DOWN_ARROW", function() { return DOWN_ARROW; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "E", function() { return E; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "EIGHT", function() { return EIGHT; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "END", function() { return END; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ENTER", function() { return ENTER; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "EQUALS", function() { return EQUALS; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ESCAPE", function() { return ESCAPE; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "F", function() { return F; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "F1", function() { return F1; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "F10", function() { return F10; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "F11", function() { return F11; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "F12", function() { return F12; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "F2", function() { return F2; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "F3", function() { return F3; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "F4", function() { return F4; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "F5", function() { return F5; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "F6", function() { return F6; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "F7", function() { return F7; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "F8", function() { return F8; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "F9", function() { return F9; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "FF_EQUALS", function() { return FF_EQUALS; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "FF_MINUS", function() { return FF_MINUS; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "FF_MUTE", function() { return FF_MUTE; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "FF_SEMICOLON", function() { return FF_SEMICOLON; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "FF_VOLUME_DOWN", function() { return FF_VOLUME_DOWN; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "FF_VOLUME_UP", function() { return FF_VOLUME_UP; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "FIRST_MEDIA", function() { return FIRST_MEDIA; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "FIVE", function() { return FIVE; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "FOUR", function() { return FOUR; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "G", function() { return G; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "H", function() { return H; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HOME", function() { return HOME; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "I", function() { return I; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "INSERT", function() { return INSERT; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "J", function() { return J; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "K", function() { return K; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "L", function() { return L; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "LAST_MEDIA", function() { return LAST_MEDIA; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "LEFT_ARROW", function() { return LEFT_ARROW; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "M", function() { return M; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "MAC_ENTER", function() { return MAC_ENTER; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "MAC_META", function() { return MAC_META; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "MAC_WK_CMD_LEFT", function() { return MAC_WK_CMD_LEFT; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "MAC_WK_CMD_RIGHT", function() { return MAC_WK_CMD_RIGHT; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "META", function() { return META; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "MUTE", function() { return MUTE; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "N", function() { return N; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NINE", function() { return NINE; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NUMPAD_DIVIDE", function() { return NUMPAD_DIVIDE; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NUMPAD_EIGHT", function() { return NUMPAD_EIGHT; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NUMPAD_FIVE", function() { return NUMPAD_FIVE; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NUMPAD_FOUR", function() { return NUMPAD_FOUR; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NUMPAD_MINUS", function() { return NUMPAD_MINUS; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NUMPAD_MULTIPLY", function() { return NUMPAD_MULTIPLY; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NUMPAD_NINE", function() { return NUMPAD_NINE; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NUMPAD_ONE", function() { return NUMPAD_ONE; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NUMPAD_PERIOD", function() { return NUMPAD_PERIOD; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NUMPAD_PLUS", function() { return NUMPAD_PLUS; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NUMPAD_SEVEN", function() { return NUMPAD_SEVEN; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NUMPAD_SIX", function() { return NUMPAD_SIX; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NUMPAD_THREE", function() { return NUMPAD_THREE; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NUMPAD_TWO", function() { return NUMPAD_TWO; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NUMPAD_ZERO", function() { return NUMPAD_ZERO; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NUM_CENTER", function() { return NUM_CENTER; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NUM_LOCK", function() { return NUM_LOCK; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "O", function() { return O; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ONE", function() { return ONE; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "OPEN_SQUARE_BRACKET", function() { return OPEN_SQUARE_BRACKET; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "P", function() { return P; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "PAGE_DOWN", function() { return PAGE_DOWN; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "PAGE_UP", function() { return PAGE_UP; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "PAUSE", function() { return PAUSE; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "PLUS_SIGN", function() { return PLUS_SIGN; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "PRINT_SCREEN", function() { return PRINT_SCREEN; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "Q", function() { return Q; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "QUESTION_MARK", function() { return QUESTION_MARK; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "R", function() { return R; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "RIGHT_ARROW", function() { return RIGHT_ARROW; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "S", function() { return S; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "SCROLL_LOCK", function() { return SCROLL_LOCK; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "SEMICOLON", function() { return SEMICOLON; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "SEVEN", function() { return SEVEN; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "SHIFT", function() { return SHIFT; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "SINGLE_QUOTE", function() { return SINGLE_QUOTE; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "SIX", function() { return SIX; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "SLASH", function() { return SLASH; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "SPACE", function() { return SPACE; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "T", function() { return T; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "TAB", function() { return TAB; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "THREE", function() { return THREE; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "TILDE", function() { return TILDE; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "TWO", function() { return TWO; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "U", function() { return U; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "UP_ARROW", function() { return UP_ARROW; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "V", function() { return V; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "VOLUME_DOWN", function() { return VOLUME_DOWN; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "VOLUME_UP", function() { return VOLUME_UP; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "W", function() { return W; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "X", function() { return X; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "Y", function() { return Y; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "Z", function() { return Z; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ZERO", function() { return ZERO; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "hasModifierKey", function() { return hasModifierKey; }); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ const MAC_ENTER = 3; const BACKSPACE = 8; const TAB = 9; const NUM_CENTER = 12; const ENTER = 13; const SHIFT = 16; const CONTROL = 17; const ALT = 18; const PAUSE = 19; const CAPS_LOCK = 20; const ESCAPE = 27; const SPACE = 32; const PAGE_UP = 33; const PAGE_DOWN = 34; const END = 35; const HOME = 36; const LEFT_ARROW = 37; const UP_ARROW = 38; const RIGHT_ARROW = 39; const DOWN_ARROW = 40; const PLUS_SIGN = 43; const PRINT_SCREEN = 44; const INSERT = 45; const DELETE = 46; const ZERO = 48; const ONE = 49; const TWO = 50; const THREE = 51; const FOUR = 52; const FIVE = 53; const SIX = 54; const SEVEN = 55; const EIGHT = 56; const NINE = 57; const FF_SEMICOLON = 59; // Firefox (Gecko) fires this for semicolon instead of 186 const FF_EQUALS = 61; // Firefox (Gecko) fires this for equals instead of 187 const QUESTION_MARK = 63; const AT_SIGN = 64; const A = 65; const B = 66; const C = 67; const D = 68; const E = 69; const F = 70; const G = 71; const H = 72; const I = 73; const J = 74; const K = 75; const L = 76; const M = 77; const N = 78; const O = 79; const P = 80; const Q = 81; const R = 82; const S = 83; const T = 84; const U = 85; const V = 86; const W = 87; const X = 88; const Y = 89; const Z = 90; const META = 91; // WIN_KEY_LEFT const MAC_WK_CMD_LEFT = 91; const MAC_WK_CMD_RIGHT = 93; const CONTEXT_MENU = 93; const NUMPAD_ZERO = 96; const NUMPAD_ONE = 97; const NUMPAD_TWO = 98; const NUMPAD_THREE = 99; const NUMPAD_FOUR = 100; const NUMPAD_FIVE = 101; const NUMPAD_SIX = 102; const NUMPAD_SEVEN = 103; const NUMPAD_EIGHT = 104; const NUMPAD_NINE = 105; const NUMPAD_MULTIPLY = 106; const NUMPAD_PLUS = 107; const NUMPAD_MINUS = 109; const NUMPAD_PERIOD = 110; const NUMPAD_DIVIDE = 111; const F1 = 112; const F2 = 113; const F3 = 114; const F4 = 115; const F5 = 116; const F6 = 117; const F7 = 118; const F8 = 119; const F9 = 120; const F10 = 121; const F11 = 122; const F12 = 123; const NUM_LOCK = 144; const SCROLL_LOCK = 145; const FIRST_MEDIA = 166; const FF_MINUS = 173; const MUTE = 173; // Firefox (Gecko) fires 181 for MUTE const VOLUME_DOWN = 174; // Firefox (Gecko) fires 182 for VOLUME_DOWN const VOLUME_UP = 175; // Firefox (Gecko) fires 183 for VOLUME_UP const FF_MUTE = 181; const FF_VOLUME_DOWN = 182; const LAST_MEDIA = 183; const FF_VOLUME_UP = 183; const SEMICOLON = 186; // Firefox (Gecko) fires 59 for SEMICOLON const EQUALS = 187; // Firefox (Gecko) fires 61 for EQUALS const COMMA = 188; const DASH = 189; // Firefox (Gecko) fires 173 for DASH/MINUS const SLASH = 191; const APOSTROPHE = 192; const TILDE = 192; const OPEN_SQUARE_BRACKET = 219; const BACKSLASH = 220; const CLOSE_SQUARE_BRACKET = 221; const SINGLE_QUOTE = 222; const MAC_META = 224; /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Checks whether a modifier key is pressed. * @param event Event to be checked. */ function hasModifierKey(event, ...modifiers) { if (modifiers.length) { return modifiers.some(modifier => event[modifier]); } return event.altKey || event.shiftKey || event.ctrlKey || event.metaKey; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Generated bundle index. Do not edit. */ //# sourceMappingURL=keycodes.js.map /***/ }), /***/ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/layout.js": /*!*******************************************************************!*\ !*** ./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/layout.js ***! \*******************************************************************/ /*! exports provided: BreakpointObserver, Breakpoints, LayoutModule, MediaMatcher */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; __webpack_require__.r(__webpack_exports__); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "BreakpointObserver", function() { return BreakpointObserver; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "Breakpoints", function() { return Breakpoints; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "LayoutModule", function() { return LayoutModule; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "MediaMatcher", function() { return MediaMatcher; }); /* harmony import */ var _angular_core__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @angular/core */ "./node_modules/@angular/core/__ivy_ngcc__/fesm2015/core.js"); /* harmony import */ var _angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! @angular/cdk/coercion */ "./node_modules/@angular/cdk/fesm2015/coercion.js"); /* harmony import */ var rxjs__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(/*! rxjs */ "./node_modules/rxjs/_esm2015/index.js"); /* harmony import */ var rxjs_operators__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(/*! rxjs/operators */ "./node_modules/rxjs/_esm2015/operators/index.js"); /* harmony import */ var _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__ = __webpack_require__(/*! @angular/cdk/platform */ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/platform.js"); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ class LayoutModule { } LayoutModule.ɵmod = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineNgModule"]({ type: LayoutModule }); LayoutModule.ɵinj = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjector"]({ factory: function LayoutModule_Factory(t) { return new (t || LayoutModule)(); } }); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](LayoutModule, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["NgModule"], args: [{}] }], null, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** Global registry for all dynamically-created, injected media queries. */ const mediaQueriesForWebkitCompatibility = new Set(); /** Style tag that holds all of the dynamically-created media queries. */ let mediaQueryStyleNode; /** A utility for calling matchMedia queries. */ class MediaMatcher { constructor(_platform) { this._platform = _platform; this._matchMedia = this._platform.isBrowser && window.matchMedia ? // matchMedia is bound to the window scope intentionally as it is an illegal invocation to // call it from a different scope. window.matchMedia.bind(window) : noopMatchMedia; } /** * Evaluates the given media query and returns the native MediaQueryList from which results * can be retrieved. * Confirms the layout engine will trigger for the selector query provided and returns the * MediaQueryList for the query provided. */ matchMedia(query) { if (this._platform.WEBKIT) { createEmptyStyleRule(query); } return this._matchMedia(query); } } MediaMatcher.ɵfac = function MediaMatcher_Factory(t) { return new (t || MediaMatcher)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["Platform"])); }; MediaMatcher.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"])({ factory: function MediaMatcher_Factory() { return new MediaMatcher(Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["Platform"])); }, token: MediaMatcher, providedIn: "root" }); MediaMatcher.ctorParameters = () => [ { type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["Platform"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](MediaMatcher, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Injectable"], args: [{ providedIn: 'root' }] }], function () { return [{ type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["Platform"] }]; }, null); })(); /** * For Webkit engines that only trigger the MediaQueryListListener when * there is at least one CSS selector for the respective media query. */ function createEmptyStyleRule(query) { if (mediaQueriesForWebkitCompatibility.has(query)) { return; } try { if (!mediaQueryStyleNode) { mediaQueryStyleNode = document.createElement('style'); mediaQueryStyleNode.setAttribute('type', 'text/css'); document.head.appendChild(mediaQueryStyleNode); } if (mediaQueryStyleNode.sheet) { mediaQueryStyleNode.sheet .insertRule(`@media ${query} {.fx-query-test{ }}`, 0); mediaQueriesForWebkitCompatibility.add(query); } } catch (e) { console.error(e); } } /** No-op matchMedia replacement for non-browser platforms. */ function noopMatchMedia(query) { // Use `as any` here to avoid adding additional necessary properties for // the noop matcher. return { matches: query === 'all' || query === '', media: query, addListener: () => { }, removeListener: () => { } }; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** Utility for checking the matching state of @media queries. */ class BreakpointObserver { constructor(_mediaMatcher, _zone) { this._mediaMatcher = _mediaMatcher; this._zone = _zone; /** A map of all media queries currently being listened for. */ this._queries = new Map(); /** A subject for all other observables to takeUntil based on. */ this._destroySubject = new rxjs__WEBPACK_IMPORTED_MODULE_2__["Subject"](); } /** Completes the active subject, signalling to all other observables to complete. */ ngOnDestroy() { this._destroySubject.next(); this._destroySubject.complete(); } /** * Whether one or more media queries match the current viewport size. * @param value One or more media queries to check. * @returns Whether any of the media queries match. */ isMatched(value) { const queries = splitQueries(Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_1__["coerceArray"])(value)); return queries.some(mediaQuery => this._registerQuery(mediaQuery).mql.matches); } /** * Gets an observable of results for the given queries that will emit new results for any changes * in matching of the given queries. * @param value One or more media queries to check. * @returns A stream of matches for the given queries. */ observe(value) { const queries = splitQueries(Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_1__["coerceArray"])(value)); const observables = queries.map(query => this._registerQuery(query).observable); let stateObservable = Object(rxjs__WEBPACK_IMPORTED_MODULE_2__["combineLatest"])(observables); // Emit the first state immediately, and then debounce the subsequent emissions. stateObservable = Object(rxjs__WEBPACK_IMPORTED_MODULE_2__["concat"])(stateObservable.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["take"])(1)), stateObservable.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["skip"])(1), Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["debounceTime"])(0))); return stateObservable.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["map"])(breakpointStates => { const response = { matches: false, breakpoints: {}, }; breakpointStates.forEach(({ matches, query }) => { response.matches = response.matches || matches; response.breakpoints[query] = matches; }); return response; })); } /** Registers a specific query to be listened for. */ _registerQuery(query) { // Only set up a new MediaQueryList if it is not already being listened for. if (this._queries.has(query)) { return this._queries.get(query); } const mql = this._mediaMatcher.matchMedia(query); // Create callback for match changes and add it is as a listener. const queryObservable = new rxjs__WEBPACK_IMPORTED_MODULE_2__["Observable"]((observer) => { // Listener callback methods are wrapped to be placed back in ngZone. Callbacks must be placed // back into the zone because matchMedia is only included in Zone.js by loading the // webapis-media-query.js file alongside the zone.js file. Additionally, some browsers do not // have MediaQueryList inherit from EventTarget, which causes inconsistencies in how Zone.js // patches it. const handler = (e) => this._zone.run(() => observer.next(e)); mql.addListener(handler); return () => { mql.removeListener(handler); }; }).pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["startWith"])(mql), Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["map"])(({ matches }) => ({ query, matches })), Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["takeUntil"])(this._destroySubject)); // Add the MediaQueryList to the set of queries. const output = { observable: queryObservable, mql }; this._queries.set(query, output); return output; } } BreakpointObserver.ɵfac = function BreakpointObserver_Factory(t) { return new (t || BreakpointObserver)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](MediaMatcher), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["NgZone"])); }; BreakpointObserver.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"])({ factory: function BreakpointObserver_Factory() { return new BreakpointObserver(Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(MediaMatcher), Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(_angular_core__WEBPACK_IMPORTED_MODULE_0__["NgZone"])); }, token: BreakpointObserver, providedIn: "root" }); BreakpointObserver.ctorParameters = () => [ { type: MediaMatcher }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["NgZone"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](BreakpointObserver, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Injectable"], args: [{ providedIn: 'root' }] }], function () { return [{ type: MediaMatcher }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["NgZone"] }]; }, null); })(); /** * Split each query string into separate query strings if two queries are provided as comma * separated. */ function splitQueries(queries) { return queries.map(query => query.split(',')) .reduce((a1, a2) => a1.concat(a2)) .map(query => query.trim()); } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ // PascalCase is being used as Breakpoints is used like an enum. // tslint:disable-next-line:variable-name const Breakpoints = { XSmall: '(max-width: 599.99px)', Small: '(min-width: 600px) and (max-width: 959.99px)', Medium: '(min-width: 960px) and (max-width: 1279.99px)', Large: '(min-width: 1280px) and (max-width: 1919.99px)', XLarge: '(min-width: 1920px)', Handset: '(max-width: 599.99px) and (orientation: portrait), ' + '(max-width: 959.99px) and (orientation: landscape)', Tablet: '(min-width: 600px) and (max-width: 839.99px) and (orientation: portrait), ' + '(min-width: 960px) and (max-width: 1279.99px) and (orientation: landscape)', Web: '(min-width: 840px) and (orientation: portrait), ' + '(min-width: 1280px) and (orientation: landscape)', HandsetPortrait: '(max-width: 599.99px) and (orientation: portrait)', TabletPortrait: '(min-width: 600px) and (max-width: 839.99px) and (orientation: portrait)', WebPortrait: '(min-width: 840px) and (orientation: portrait)', HandsetLandscape: '(max-width: 959.99px) and (orientation: landscape)', TabletLandscape: '(min-width: 960px) and (max-width: 1279.99px) and (orientation: landscape)', WebLandscape: '(min-width: 1280px) and (orientation: landscape)', }; /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Generated bundle index. Do not edit. */ //# sourceMappingURL=layout.js.map /***/ }), /***/ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/observers.js": /*!**********************************************************************!*\ !*** ./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/observers.js ***! \**********************************************************************/ /*! exports provided: CdkObserveContent, ContentObserver, MutationObserverFactory, ObserversModule */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; __webpack_require__.r(__webpack_exports__); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkObserveContent", function() { return CdkObserveContent; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ContentObserver", function() { return ContentObserver; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "MutationObserverFactory", function() { return MutationObserverFactory; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ObserversModule", function() { return ObserversModule; }); /* harmony import */ var _angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @angular/cdk/coercion */ "./node_modules/@angular/cdk/fesm2015/coercion.js"); /* harmony import */ var _angular_core__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! @angular/core */ "./node_modules/@angular/core/__ivy_ngcc__/fesm2015/core.js"); /* harmony import */ var rxjs__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(/*! rxjs */ "./node_modules/rxjs/_esm2015/index.js"); /* harmony import */ var rxjs_operators__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(/*! rxjs/operators */ "./node_modules/rxjs/_esm2015/operators/index.js"); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Factory that creates a new MutationObserver and allows us to stub it out in unit tests. * @docs-private */ class MutationObserverFactory { create(callback) { return typeof MutationObserver === 'undefined' ? null : new MutationObserver(callback); } } MutationObserverFactory.ɵfac = function MutationObserverFactory_Factory(t) { return new (t || MutationObserverFactory)(); }; MutationObserverFactory.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjectable"])({ factory: function MutationObserverFactory_Factory() { return new MutationObserverFactory(); }, token: MutationObserverFactory, providedIn: "root" }); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](MutationObserverFactory, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Injectable"], args: [{ providedIn: 'root' }] }], null, null); })(); /** An injectable service that allows watching elements for changes to their content. */ class ContentObserver { constructor(_mutationObserverFactory) { this._mutationObserverFactory = _mutationObserverFactory; /** Keeps track of the existing MutationObservers so they can be reused. */ this._observedElements = new Map(); } ngOnDestroy() { this._observedElements.forEach((_, element) => this._cleanupObserver(element)); } observe(elementOrRef) { const element = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_0__["coerceElement"])(elementOrRef); return new rxjs__WEBPACK_IMPORTED_MODULE_2__["Observable"]((observer) => { const stream = this._observeElement(element); const subscription = stream.subscribe(observer); return () => { subscription.unsubscribe(); this._unobserveElement(element); }; }); } /** * Observes the given element by using the existing MutationObserver if available, or creating a * new one if not. */ _observeElement(element) { if (!this._observedElements.has(element)) { const stream = new rxjs__WEBPACK_IMPORTED_MODULE_2__["Subject"](); const observer = this._mutationObserverFactory.create(mutations => stream.next(mutations)); if (observer) { observer.observe(element, { characterData: true, childList: true, subtree: true }); } this._observedElements.set(element, { observer, stream, count: 1 }); } else { this._observedElements.get(element).count++; } return this._observedElements.get(element).stream; } /** * Un-observes the given element and cleans up the underlying MutationObserver if nobody else is * observing this element. */ _unobserveElement(element) { if (this._observedElements.has(element)) { this._observedElements.get(element).count--; if (!this._observedElements.get(element).count) { this._cleanupObserver(element); } } } /** Clean up the underlying MutationObserver for the specified element. */ _cleanupObserver(element) { if (this._observedElements.has(element)) { const { observer, stream } = this._observedElements.get(element); if (observer) { observer.disconnect(); } stream.complete(); this._observedElements.delete(element); } } } ContentObserver.ɵfac = function ContentObserver_Factory(t) { return new (t || ContentObserver)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](MutationObserverFactory)); }; ContentObserver.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjectable"])({ factory: function ContentObserver_Factory() { return new ContentObserver(Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(MutationObserverFactory)); }, token: ContentObserver, providedIn: "root" }); ContentObserver.ctorParameters = () => [ { type: MutationObserverFactory } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](ContentObserver, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Injectable"], args: [{ providedIn: 'root' }] }], function () { return [{ type: MutationObserverFactory }]; }, null); })(); /** * Directive that triggers a callback whenever the content of * its associated element has changed. */ class CdkObserveContent { constructor(_contentObserver, _elementRef, _ngZone) { this._contentObserver = _contentObserver; this._elementRef = _elementRef; this._ngZone = _ngZone; /** Event emitted for each change in the element's content. */ this.event = new _angular_core__WEBPACK_IMPORTED_MODULE_1__["EventEmitter"](); this._disabled = false; this._currentSubscription = null; } /** * Whether observing content is disabled. This option can be used * to disconnect the underlying MutationObserver until it is needed. */ get disabled() { return this._disabled; } set disabled(value) { this._disabled = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_0__["coerceBooleanProperty"])(value); this._disabled ? this._unsubscribe() : this._subscribe(); } /** Debounce interval for emitting the changes. */ get debounce() { return this._debounce; } set debounce(value) { this._debounce = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_0__["coerceNumberProperty"])(value); this._subscribe(); } ngAfterContentInit() { if (!this._currentSubscription && !this.disabled) { this._subscribe(); } } ngOnDestroy() { this._unsubscribe(); } _subscribe() { this._unsubscribe(); const stream = this._contentObserver.observe(this._elementRef); // TODO(mmalerba): We shouldn't be emitting on this @Output() outside the zone. // Consider brining it back inside the zone next time we're making breaking changes. // Bringing it back inside can cause things like infinite change detection loops and changed // after checked errors if people's code isn't handling it properly. this._ngZone.runOutsideAngular(() => { this._currentSubscription = (this.debounce ? stream.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["debounceTime"])(this.debounce)) : stream).subscribe(this.event); }); } _unsubscribe() { if (this._currentSubscription) { this._currentSubscription.unsubscribe(); } } } CdkObserveContent.ɵfac = function CdkObserveContent_Factory(t) { return new (t || CdkObserveContent)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](ContentObserver), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"])); }; CdkObserveContent.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineDirective"]({ type: CdkObserveContent, selectors: [["", "cdkObserveContent", ""]], inputs: { disabled: ["cdkObserveContentDisabled", "disabled"], debounce: "debounce" }, outputs: { event: "cdkObserveContent" }, exportAs: ["cdkObserveContent"] }); CdkObserveContent.ctorParameters = () => [ { type: ContentObserver }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] } ]; CdkObserveContent.propDecorators = { event: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Output"], args: ['cdkObserveContent',] }], disabled: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkObserveContentDisabled',] }], debounce: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](CdkObserveContent, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Directive"], args: [{ selector: '[cdkObserveContent]', exportAs: 'cdkObserveContent' }] }], function () { return [{ type: ContentObserver }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }]; }, { event: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Output"], args: ['cdkObserveContent'] }], disabled: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkObserveContentDisabled'] }], debounce: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"] }] }); })(); class ObserversModule { } ObserversModule.ɵmod = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineNgModule"]({ type: ObserversModule }); ObserversModule.ɵinj = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjector"]({ factory: function ObserversModule_Factory(t) { return new (t || ObserversModule)(); }, providers: [MutationObserverFactory] }); (function () { (typeof ngJitMode === "undefined" || ngJitMode) && _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵsetNgModuleScope"](ObserversModule, { declarations: [CdkObserveContent], exports: [CdkObserveContent] }); })(); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](ObserversModule, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgModule"], args: [{ exports: [CdkObserveContent], declarations: [CdkObserveContent], providers: [MutationObserverFactory] }] }], null, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Generated bundle index. Do not edit. */ //# sourceMappingURL=observers.js.map /***/ }), /***/ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/overlay.js": /*!********************************************************************!*\ !*** ./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/overlay.js ***! \********************************************************************/ /*! exports provided: CdkScrollable, ScrollDispatcher, ViewportRuler, BlockScrollStrategy, CdkConnectedOverlay, CdkOverlayOrigin, CloseScrollStrategy, ConnectedOverlayPositionChange, ConnectedPositionStrategy, ConnectionPositionPair, FlexibleConnectedPositionStrategy, FullscreenOverlayContainer, GlobalPositionStrategy, NoopScrollStrategy, OVERLAY_PROVIDERS, Overlay, OverlayConfig, OverlayContainer, OverlayKeyboardDispatcher, OverlayModule, OverlayOutsideClickDispatcher, OverlayPositionBuilder, OverlayRef, RepositionScrollStrategy, ScrollStrategyOptions, ScrollingVisibility, validateHorizontalPosition, validateVerticalPosition, ɵangular_material_src_cdk_overlay_overlay_a, ɵangular_material_src_cdk_overlay_overlay_b, ɵangular_material_src_cdk_overlay_overlay_c, ɵangular_material_src_cdk_overlay_overlay_d, ɵangular_material_src_cdk_overlay_overlay_e, ɵangular_material_src_cdk_overlay_overlay_f, ɵangular_material_src_cdk_overlay_overlay_g, ɵangular_material_src_cdk_overlay_overlay_h */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; __webpack_require__.r(__webpack_exports__); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "BlockScrollStrategy", function() { return BlockScrollStrategy; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkConnectedOverlay", function() { return CdkConnectedOverlay; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkOverlayOrigin", function() { return CdkOverlayOrigin; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CloseScrollStrategy", function() { return CloseScrollStrategy; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ConnectedOverlayPositionChange", function() { return ConnectedOverlayPositionChange; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ConnectedPositionStrategy", function() { return ConnectedPositionStrategy; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ConnectionPositionPair", function() { return ConnectionPositionPair; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "FlexibleConnectedPositionStrategy", function() { return FlexibleConnectedPositionStrategy; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "FullscreenOverlayContainer", function() { return FullscreenOverlayContainer; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "GlobalPositionStrategy", function() { return GlobalPositionStrategy; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NoopScrollStrategy", function() { return NoopScrollStrategy; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "OVERLAY_PROVIDERS", function() { return OVERLAY_PROVIDERS; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "Overlay", function() { return Overlay; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "OverlayConfig", function() { return OverlayConfig; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "OverlayContainer", function() { return OverlayContainer; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "OverlayKeyboardDispatcher", function() { return OverlayKeyboardDispatcher; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "OverlayModule", function() { return OverlayModule; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "OverlayOutsideClickDispatcher", function() { return OverlayOutsideClickDispatcher; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "OverlayPositionBuilder", function() { return OverlayPositionBuilder; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "OverlayRef", function() { return OverlayRef; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "RepositionScrollStrategy", function() { return RepositionScrollStrategy; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ScrollStrategyOptions", function() { return ScrollStrategyOptions; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ScrollingVisibility", function() { return ScrollingVisibility; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "validateHorizontalPosition", function() { return validateHorizontalPosition; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "validateVerticalPosition", function() { return validateVerticalPosition; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_material_src_cdk_overlay_overlay_a", function() { return OVERLAY_KEYBOARD_DISPATCHER_PROVIDER_FACTORY; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_material_src_cdk_overlay_overlay_b", function() { return OVERLAY_KEYBOARD_DISPATCHER_PROVIDER; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_material_src_cdk_overlay_overlay_c", function() { return OVERLAY_CONTAINER_PROVIDER_FACTORY; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_material_src_cdk_overlay_overlay_d", function() { return OVERLAY_CONTAINER_PROVIDER; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_material_src_cdk_overlay_overlay_e", function() { return CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_material_src_cdk_overlay_overlay_f", function() { return CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER_FACTORY; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_material_src_cdk_overlay_overlay_g", function() { return CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_material_src_cdk_overlay_overlay_h", function() { return BaseOverlayDispatcher; }); /* harmony import */ var _angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @angular/cdk/scrolling */ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/scrolling.js"); /* harmony import */ var _angular_core__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! @angular/core */ "./node_modules/@angular/core/__ivy_ngcc__/fesm2015/core.js"); /* harmony import */ var _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(/*! @angular/cdk/platform */ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/platform.js"); /* harmony import */ var _angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(/*! @angular/cdk/bidi */ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/bidi.js"); /* harmony import */ var _angular_common__WEBPACK_IMPORTED_MODULE_4__ = __webpack_require__(/*! @angular/common */ "./node_modules/@angular/common/__ivy_ngcc__/fesm2015/common.js"); /* harmony reexport (safe) */ __webpack_require__.d(__webpack_exports__, "CdkScrollable", function() { return _angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_0__["CdkScrollable"]; }); /* harmony reexport (safe) */ __webpack_require__.d(__webpack_exports__, "ScrollDispatcher", function() { return _angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_0__["ScrollDispatcher"]; }); /* harmony reexport (safe) */ __webpack_require__.d(__webpack_exports__, "ViewportRuler", function() { return _angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_0__["ViewportRuler"]; }); /* harmony import */ var _angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__ = __webpack_require__(/*! @angular/cdk/coercion */ "./node_modules/@angular/cdk/fesm2015/coercion.js"); /* harmony import */ var _angular_cdk_portal__WEBPACK_IMPORTED_MODULE_6__ = __webpack_require__(/*! @angular/cdk/portal */ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/portal.js"); /* harmony import */ var rxjs__WEBPACK_IMPORTED_MODULE_7__ = __webpack_require__(/*! rxjs */ "./node_modules/rxjs/_esm2015/index.js"); /* harmony import */ var rxjs_operators__WEBPACK_IMPORTED_MODULE_8__ = __webpack_require__(/*! rxjs/operators */ "./node_modules/rxjs/_esm2015/operators/index.js"); /* harmony import */ var _angular_cdk_keycodes__WEBPACK_IMPORTED_MODULE_9__ = __webpack_require__(/*! @angular/cdk/keycodes */ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/keycodes.js"); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Strategy that will prevent the user from scrolling while the overlay is visible. */ class BlockScrollStrategy { constructor(_viewportRuler, document) { this._viewportRuler = _viewportRuler; this._previousHTMLStyles = { top: '', left: '' }; this._isEnabled = false; this._document = document; } /** Attaches this scroll strategy to an overlay. */ attach() { } /** Blocks page-level scroll while the attached overlay is open. */ enable() { if (this._canBeEnabled()) { const root = this._document.documentElement; this._previousScrollPosition = this._viewportRuler.getViewportScrollPosition(); // Cache the previous inline styles in case the user had set them. this._previousHTMLStyles.left = root.style.left || ''; this._previousHTMLStyles.top = root.style.top || ''; // Note: we're using the `html` node, instead of the `body`, because the `body` may // have the user agent margin, whereas the `html` is guaranteed not to have one. root.style.left = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceCssPixelValue"])(-this._previousScrollPosition.left); root.style.top = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceCssPixelValue"])(-this._previousScrollPosition.top); root.classList.add('cdk-global-scrollblock'); this._isEnabled = true; } } /** Unblocks page-level scroll while the attached overlay is open. */ disable() { if (this._isEnabled) { const html = this._document.documentElement; const body = this._document.body; const htmlStyle = html.style; const bodyStyle = body.style; const previousHtmlScrollBehavior = htmlStyle.scrollBehavior || ''; const previousBodyScrollBehavior = bodyStyle.scrollBehavior || ''; this._isEnabled = false; htmlStyle.left = this._previousHTMLStyles.left; htmlStyle.top = this._previousHTMLStyles.top; html.classList.remove('cdk-global-scrollblock'); // Disable user-defined smooth scrolling temporarily while we restore the scroll position. // See https://developer.mozilla.org/en-US/docs/Web/CSS/scroll-behavior htmlStyle.scrollBehavior = bodyStyle.scrollBehavior = 'auto'; window.scroll(this._previousScrollPosition.left, this._previousScrollPosition.top); htmlStyle.scrollBehavior = previousHtmlScrollBehavior; bodyStyle.scrollBehavior = previousBodyScrollBehavior; } } _canBeEnabled() { // Since the scroll strategies can't be singletons, we have to use a global CSS class // (`cdk-global-scrollblock`) to make sure that we don't try to disable global // scrolling multiple times. const html = this._document.documentElement; if (html.classList.contains('cdk-global-scrollblock') || this._isEnabled) { return false; } const body = this._document.body; const viewport = this._viewportRuler.getViewportSize(); return body.scrollHeight > viewport.height || body.scrollWidth > viewport.width; } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Returns an error to be thrown when attempting to attach an already-attached scroll strategy. */ function getMatScrollStrategyAlreadyAttachedError() { return Error(`Scroll strategy has already been attached.`); } /** * Strategy that will close the overlay as soon as the user starts scrolling. */ class CloseScrollStrategy { constructor(_scrollDispatcher, _ngZone, _viewportRuler, _config) { this._scrollDispatcher = _scrollDispatcher; this._ngZone = _ngZone; this._viewportRuler = _viewportRuler; this._config = _config; this._scrollSubscription = null; /** Detaches the overlay ref and disables the scroll strategy. */ this._detach = () => { this.disable(); if (this._overlayRef.hasAttached()) { this._ngZone.run(() => this._overlayRef.detach()); } }; } /** Attaches this scroll strategy to an overlay. */ attach(overlayRef) { if (this._overlayRef && (typeof ngDevMode === 'undefined' || ngDevMode)) { throw getMatScrollStrategyAlreadyAttachedError(); } this._overlayRef = overlayRef; } /** Enables the closing of the attached overlay on scroll. */ enable() { if (this._scrollSubscription) { return; } const stream = this._scrollDispatcher.scrolled(0); if (this._config && this._config.threshold && this._config.threshold > 1) { this._initialScrollPosition = this._viewportRuler.getViewportScrollPosition().top; this._scrollSubscription = stream.subscribe(() => { const scrollPosition = this._viewportRuler.getViewportScrollPosition().top; if (Math.abs(scrollPosition - this._initialScrollPosition) > this._config.threshold) { this._detach(); } else { this._overlayRef.updatePosition(); } }); } else { this._scrollSubscription = stream.subscribe(this._detach); } } /** Disables the closing the attached overlay on scroll. */ disable() { if (this._scrollSubscription) { this._scrollSubscription.unsubscribe(); this._scrollSubscription = null; } } detach() { this.disable(); this._overlayRef = null; } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** Scroll strategy that doesn't do anything. */ class NoopScrollStrategy { /** Does nothing, as this scroll strategy is a no-op. */ enable() { } /** Does nothing, as this scroll strategy is a no-op. */ disable() { } /** Does nothing, as this scroll strategy is a no-op. */ attach() { } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ // TODO(jelbourn): move this to live with the rest of the scrolling code // TODO(jelbourn): someday replace this with IntersectionObservers /** * Gets whether an element is scrolled outside of view by any of its parent scrolling containers. * @param element Dimensions of the element (from getBoundingClientRect) * @param scrollContainers Dimensions of element's scrolling containers (from getBoundingClientRect) * @returns Whether the element is scrolled out of view * @docs-private */ function isElementScrolledOutsideView(element, scrollContainers) { return scrollContainers.some(containerBounds => { const outsideAbove = element.bottom < containerBounds.top; const outsideBelow = element.top > containerBounds.bottom; const outsideLeft = element.right < containerBounds.left; const outsideRight = element.left > containerBounds.right; return outsideAbove || outsideBelow || outsideLeft || outsideRight; }); } /** * Gets whether an element is clipped by any of its scrolling containers. * @param element Dimensions of the element (from getBoundingClientRect) * @param scrollContainers Dimensions of element's scrolling containers (from getBoundingClientRect) * @returns Whether the element is clipped * @docs-private */ function isElementClippedByScrolling(element, scrollContainers) { return scrollContainers.some(scrollContainerRect => { const clippedAbove = element.top < scrollContainerRect.top; const clippedBelow = element.bottom > scrollContainerRect.bottom; const clippedLeft = element.left < scrollContainerRect.left; const clippedRight = element.right > scrollContainerRect.right; return clippedAbove || clippedBelow || clippedLeft || clippedRight; }); } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Strategy that will update the element position as the user is scrolling. */ class RepositionScrollStrategy { constructor(_scrollDispatcher, _viewportRuler, _ngZone, _config) { this._scrollDispatcher = _scrollDispatcher; this._viewportRuler = _viewportRuler; this._ngZone = _ngZone; this._config = _config; this._scrollSubscription = null; } /** Attaches this scroll strategy to an overlay. */ attach(overlayRef) { if (this._overlayRef && (typeof ngDevMode === 'undefined' || ngDevMode)) { throw getMatScrollStrategyAlreadyAttachedError(); } this._overlayRef = overlayRef; } /** Enables repositioning of the attached overlay on scroll. */ enable() { if (!this._scrollSubscription) { const throttle = this._config ? this._config.scrollThrottle : 0; this._scrollSubscription = this._scrollDispatcher.scrolled(throttle).subscribe(() => { this._overlayRef.updatePosition(); // TODO(crisbeto): make `close` on by default once all components can handle it. if (this._config && this._config.autoClose) { const overlayRect = this._overlayRef.overlayElement.getBoundingClientRect(); const { width, height } = this._viewportRuler.getViewportSize(); // TODO(crisbeto): include all ancestor scroll containers here once // we have a way of exposing the trigger element to the scroll strategy. const parentRects = [{ width, height, bottom: height, right: width, top: 0, left: 0 }]; if (isElementScrolledOutsideView(overlayRect, parentRects)) { this.disable(); this._ngZone.run(() => this._overlayRef.detach()); } } }); } } /** Disables repositioning of the attached overlay on scroll. */ disable() { if (this._scrollSubscription) { this._scrollSubscription.unsubscribe(); this._scrollSubscription = null; } } detach() { this.disable(); this._overlayRef = null; } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Options for how an overlay will handle scrolling. * * Users can provide a custom value for `ScrollStrategyOptions` to replace the default * behaviors. This class primarily acts as a factory for ScrollStrategy instances. */ class ScrollStrategyOptions { constructor(_scrollDispatcher, _viewportRuler, _ngZone, document) { this._scrollDispatcher = _scrollDispatcher; this._viewportRuler = _viewportRuler; this._ngZone = _ngZone; /** Do nothing on scroll. */ this.noop = () => new NoopScrollStrategy(); /** * Close the overlay as soon as the user scrolls. * @param config Configuration to be used inside the scroll strategy. */ this.close = (config) => new CloseScrollStrategy(this._scrollDispatcher, this._ngZone, this._viewportRuler, config); /** Block scrolling. */ this.block = () => new BlockScrollStrategy(this._viewportRuler, this._document); /** * Update the overlay's position on scroll. * @param config Configuration to be used inside the scroll strategy. * Allows debouncing the reposition calls. */ this.reposition = (config) => new RepositionScrollStrategy(this._scrollDispatcher, this._viewportRuler, this._ngZone, config); this._document = document; } } ScrollStrategyOptions.ɵfac = function ScrollStrategyOptions_Factory(t) { return new (t || ScrollStrategyOptions)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_0__["ScrollDispatcher"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_0__["ViewportRuler"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"])); }; ScrollStrategyOptions.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjectable"])({ factory: function ScrollStrategyOptions_Factory() { return new ScrollStrategyOptions(Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_0__["ScrollDispatcher"]), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_0__["ViewportRuler"]), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"]), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"])); }, token: ScrollStrategyOptions, providedIn: "root" }); ScrollStrategyOptions.ctorParameters = () => [ { type: _angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_0__["ScrollDispatcher"] }, { type: _angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_0__["ViewportRuler"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"],] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](ScrollStrategyOptions, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Injectable"], args: [{ providedIn: 'root' }] }], function () { return [{ type: _angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_0__["ScrollDispatcher"] }, { type: _angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_0__["ViewportRuler"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"]] }] }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** Initial configuration used when creating an overlay. */ class OverlayConfig { constructor(config) { /** Strategy to be used when handling scroll events while the overlay is open. */ this.scrollStrategy = new NoopScrollStrategy(); /** Custom class to add to the overlay pane. */ this.panelClass = ''; /** Whether the overlay has a backdrop. */ this.hasBackdrop = false; /** Custom class to add to the backdrop */ this.backdropClass = 'cdk-overlay-dark-backdrop'; /** * Whether the overlay should be disposed of when the user goes backwards/forwards in history. * Note that this usually doesn't include clicking on links (unless the user is using * the `HashLocationStrategy`). */ this.disposeOnNavigation = false; if (config) { // Use `Iterable` instead of `Array` because TypeScript, as of 3.6.3, // loses the array generic type in the `for of`. But we *also* have to use `Array` because // typescript won't iterate over an `Iterable` unless you compile with `--downlevelIteration` const configKeys = Object.keys(config); for (const key of configKeys) { if (config[key] !== undefined) { // TypeScript, as of version 3.5, sees the left-hand-side of this expression // as "I don't know *which* key this is, so the only valid value is the intersection // of all the posible values." In this case, that happens to be `undefined`. TypeScript // is not smart enough to see that the right-hand-side is actually an access of the same // exact type with the same exact key, meaning that the value type must be identical. // So we use `any` to work around this. this[key] = config[key]; } } } } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** The points of the origin element and the overlay element to connect. */ class ConnectionPositionPair { constructor(origin, overlay, /** Offset along the X axis. */ offsetX, /** Offset along the Y axis. */ offsetY, /** Class(es) to be applied to the panel while this position is active. */ panelClass) { this.offsetX = offsetX; this.offsetY = offsetY; this.panelClass = panelClass; this.originX = origin.originX; this.originY = origin.originY; this.overlayX = overlay.overlayX; this.overlayY = overlay.overlayY; } } /** * Set of properties regarding the position of the origin and overlay relative to the viewport * with respect to the containing Scrollable elements. * * The overlay and origin are clipped if any part of their bounding client rectangle exceeds the * bounds of any one of the strategy's Scrollable's bounding client rectangle. * * The overlay and origin are outside view if there is no overlap between their bounding client * rectangle and any one of the strategy's Scrollable's bounding client rectangle. * * ----------- ----------- * | outside | | clipped | * | view | -------------------------- * | | | | | | * ---------- | ----------- | * -------------------------- | | * | | | Scrollable | * | | | | * | | -------------------------- * | Scrollable | * | | * -------------------------- * * @docs-private */ class ScrollingVisibility { } /** The change event emitted by the strategy when a fallback position is used. */ class ConnectedOverlayPositionChange { constructor( /** The position used as a result of this change. */ connectionPair, /** @docs-private */ scrollableViewProperties) { this.connectionPair = connectionPair; this.scrollableViewProperties = scrollableViewProperties; } } ConnectedOverlayPositionChange.ctorParameters = () => [ { type: ConnectionPositionPair }, { type: ScrollingVisibility, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"] }] } ]; /** * Validates whether a vertical position property matches the expected values. * @param property Name of the property being validated. * @param value Value of the property being validated. * @docs-private */ function validateVerticalPosition(property, value) { if (value !== 'top' && value !== 'bottom' && value !== 'center') { throw Error(`ConnectedPosition: Invalid ${property} "${value}". ` + `Expected "top", "bottom" or "center".`); } } /** * Validates whether a horizontal position property matches the expected values. * @param property Name of the property being validated. * @param value Value of the property being validated. * @docs-private */ function validateHorizontalPosition(property, value) { if (value !== 'start' && value !== 'end' && value !== 'center') { throw Error(`ConnectedPosition: Invalid ${property} "${value}". ` + `Expected "start", "end" or "center".`); } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Service for dispatching events that land on the body to appropriate overlay ref, * if any. It maintains a list of attached overlays to determine best suited overlay based * on event target and order of overlay opens. */ class BaseOverlayDispatcher { constructor(document) { /** Currently attached overlays in the order they were attached. */ this._attachedOverlays = []; this._document = document; } ngOnDestroy() { this.detach(); } /** Add a new overlay to the list of attached overlay refs. */ add(overlayRef) { // Ensure that we don't get the same overlay multiple times. this.remove(overlayRef); this._attachedOverlays.push(overlayRef); } /** Remove an overlay from the list of attached overlay refs. */ remove(overlayRef) { const index = this._attachedOverlays.indexOf(overlayRef); if (index > -1) { this._attachedOverlays.splice(index, 1); } // Remove the global listener once there are no more overlays. if (this._attachedOverlays.length === 0) { this.detach(); } } } BaseOverlayDispatcher.ɵfac = function BaseOverlayDispatcher_Factory(t) { return new (t || BaseOverlayDispatcher)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"])); }; BaseOverlayDispatcher.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjectable"])({ factory: function BaseOverlayDispatcher_Factory() { return new BaseOverlayDispatcher(Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"])); }, token: BaseOverlayDispatcher, providedIn: "root" }); BaseOverlayDispatcher.ctorParameters = () => [ { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"],] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](BaseOverlayDispatcher, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Injectable"], args: [{ providedIn: 'root' }] }], function () { return [{ type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"]] }] }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Service for dispatching keyboard events that land on the body to appropriate overlay ref, * if any. It maintains a list of attached overlays to determine best suited overlay based * on event target and order of overlay opens. */ class OverlayKeyboardDispatcher extends BaseOverlayDispatcher { constructor(document) { super(document); /** Keyboard event listener that will be attached to the body. */ this._keydownListener = (event) => { const overlays = this._attachedOverlays; for (let i = overlays.length - 1; i > -1; i--) { // Dispatch the keydown event to the top overlay which has subscribers to its keydown events. // We want to target the most recent overlay, rather than trying to match where the event came // from, because some components might open an overlay, but keep focus on a trigger element // (e.g. for select and autocomplete). We skip overlays without keydown event subscriptions, // because we don't want overlays that don't handle keyboard events to block the ones below // them that do. if (overlays[i]._keydownEvents.observers.length > 0) { overlays[i]._keydownEvents.next(event); break; } } }; } /** Add a new overlay to the list of attached overlay refs. */ add(overlayRef) { super.add(overlayRef); // Lazily start dispatcher once first overlay is added if (!this._isAttached) { this._document.body.addEventListener('keydown', this._keydownListener); this._isAttached = true; } } /** Detaches the global keyboard event listener. */ detach() { if (this._isAttached) { this._document.body.removeEventListener('keydown', this._keydownListener); this._isAttached = false; } } } OverlayKeyboardDispatcher.ɵfac = function OverlayKeyboardDispatcher_Factory(t) { return new (t || OverlayKeyboardDispatcher)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"])); }; OverlayKeyboardDispatcher.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjectable"])({ factory: function OverlayKeyboardDispatcher_Factory() { return new OverlayKeyboardDispatcher(Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"])); }, token: OverlayKeyboardDispatcher, providedIn: "root" }); OverlayKeyboardDispatcher.ctorParameters = () => [ { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"],] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](OverlayKeyboardDispatcher, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Injectable"], args: [{ providedIn: 'root' }] }], function () { return [{ type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"]] }] }]; }, null); })(); /** @docs-private @deprecated @breaking-change 8.0.0 */ function OVERLAY_KEYBOARD_DISPATCHER_PROVIDER_FACTORY(dispatcher, _document) { return dispatcher || new OverlayKeyboardDispatcher(_document); } /** @docs-private @deprecated @breaking-change 8.0.0 */ const OVERLAY_KEYBOARD_DISPATCHER_PROVIDER = { // If there is already an OverlayKeyboardDispatcher available, use that. // Otherwise, provide a new one. provide: OverlayKeyboardDispatcher, deps: [ [new _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"](), new _angular_core__WEBPACK_IMPORTED_MODULE_1__["SkipSelf"](), OverlayKeyboardDispatcher], // Coerce to `InjectionToken` so that the `deps` match the "shape" // of the type expected by Angular _angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"] ], useFactory: OVERLAY_KEYBOARD_DISPATCHER_PROVIDER_FACTORY }; /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Service for dispatching mouse click events that land on the body to appropriate overlay ref, * if any. It maintains a list of attached overlays to determine best suited overlay based * on event target and order of overlay opens. */ class OverlayOutsideClickDispatcher extends BaseOverlayDispatcher { constructor(document, _platform) { super(document); this._platform = _platform; this._cursorStyleIsSet = false; /** Click event listener that will be attached to the body propagate phase. */ this._clickListener = (event) => { // Get the target through the `composedPath` if possible to account for shadow DOM. const target = event.composedPath ? event.composedPath()[0] : event.target; // We copy the array because the original may be modified asynchronously if the // outsidePointerEvents listener decides to detach overlays resulting in index errors inside // the for loop. const overlays = this._attachedOverlays.slice(); // Dispatch the mouse event to the top overlay which has subscribers to its mouse events. // We want to target all overlays for which the click could be considered as outside click. // As soon as we reach an overlay for which the click is not outside click we break off // the loop. for (let i = overlays.length - 1; i > -1; i--) { const overlayRef = overlays[i]; if (overlayRef._outsidePointerEvents.observers.length < 1 || !overlayRef.hasAttached()) { continue; } // If it's a click inside the overlay, just break - we should do nothing // If it's an outside click dispatch the mouse event, and proceed with the next overlay if (overlayRef.overlayElement.contains(target)) { break; } overlayRef._outsidePointerEvents.next(event); } }; } /** Add a new overlay to the list of attached overlay refs. */ add(overlayRef) { super.add(overlayRef); // tslint:disable: max-line-length // Safari on iOS does not generate click events for non-interactive // elements. However, we want to receive a click for any element outside // the overlay. We can force a "clickable" state by setting // `cursor: pointer` on the document body. // See https://developer.mozilla.org/en-US/docs/Web/API/Element/click_event#Safari_Mobile // and https://developer.apple.com/library/archive/documentation/AppleApplications/Reference/SafariWebContent/HandlingEvents/HandlingEvents.html // tslint:enable: max-line-length if (!this._isAttached) { this._document.body.addEventListener('click', this._clickListener, true); this._document.body.addEventListener('contextmenu', this._clickListener, true); // click event is not fired on iOS. To make element "clickable" we are // setting the cursor to pointer if (this._platform.IOS && !this._cursorStyleIsSet) { this._cursorOriginalValue = this._document.body.style.cursor; this._document.body.style.cursor = 'pointer'; this._cursorStyleIsSet = true; } this._isAttached = true; } } /** Detaches the global keyboard event listener. */ detach() { if (this._isAttached) { this._document.body.removeEventListener('click', this._clickListener, true); this._document.body.removeEventListener('contextmenu', this._clickListener, true); if (this._platform.IOS && this._cursorStyleIsSet) { this._document.body.style.cursor = this._cursorOriginalValue; this._cursorStyleIsSet = false; } this._isAttached = false; } } } OverlayOutsideClickDispatcher.ɵfac = function OverlayOutsideClickDispatcher_Factory(t) { return new (t || OverlayOutsideClickDispatcher)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"])); }; OverlayOutsideClickDispatcher.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjectable"])({ factory: function OverlayOutsideClickDispatcher_Factory() { return new OverlayOutsideClickDispatcher(Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"]), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"])); }, token: OverlayOutsideClickDispatcher, providedIn: "root" }); OverlayOutsideClickDispatcher.ctorParameters = () => [ { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"],] }] }, { type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](OverlayOutsideClickDispatcher, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Injectable"], args: [{ providedIn: 'root' }] }], function () { return [{ type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"]] }] }, { type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"] }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Whether we're in a testing environment. * TODO(crisbeto): remove this once we have an overlay testing module. */ const isTestEnvironment = typeof window !== 'undefined' && !!window && !!(window.__karma__ || window.jasmine); /** Container inside which all overlays will render. */ class OverlayContainer { constructor(document, /** * @deprecated `platform` parameter to become required. * @breaking-change 10.0.0 */ _platform) { this._platform = _platform; this._document = document; } ngOnDestroy() { const container = this._containerElement; if (container && container.parentNode) { container.parentNode.removeChild(container); } } /** * This method returns the overlay container element. It will lazily * create the element the first time it is called to facilitate using * the container in non-browser environments. * @returns the container element */ getContainerElement() { if (!this._containerElement) { this._createContainer(); } return this._containerElement; } /** * Create the overlay container element, which is simply a div * with the 'cdk-overlay-container' class on the document body. */ _createContainer() { // @breaking-change 10.0.0 Remove null check for `_platform`. const isBrowser = this._platform ? this._platform.isBrowser : typeof window !== 'undefined'; const containerClass = 'cdk-overlay-container'; if (isBrowser || isTestEnvironment) { const oppositePlatformContainers = this._document.querySelectorAll(`.${containerClass}[platform="server"], ` + `.${containerClass}[platform="test"]`); // Remove any old containers from the opposite platform. // This can happen when transitioning from the server to the client. for (let i = 0; i < oppositePlatformContainers.length; i++) { oppositePlatformContainers[i].parentNode.removeChild(oppositePlatformContainers[i]); } } const container = this._document.createElement('div'); container.classList.add(containerClass); // A long time ago we kept adding new overlay containers whenever a new app was instantiated, // but at some point we added logic which clears the duplicate ones in order to avoid leaks. // The new logic was a little too aggressive since it was breaking some legitimate use cases. // To mitigate the problem we made it so that only containers from a different platform are // cleared, but the side-effect was that people started depending on the overly-aggressive // logic to clean up their tests for them. Until we can introduce an overlay-specific testing // module which does the cleanup, we try to detect that we're in a test environment and we // always clear the container. See #17006. // TODO(crisbeto): remove the test environment check once we have an overlay testing module. if (isTestEnvironment) { container.setAttribute('platform', 'test'); } else if (!isBrowser) { container.setAttribute('platform', 'server'); } this._document.body.appendChild(container); this._containerElement = container; } } OverlayContainer.ɵfac = function OverlayContainer_Factory(t) { return new (t || OverlayContainer)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"])); }; OverlayContainer.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjectable"])({ factory: function OverlayContainer_Factory() { return new OverlayContainer(Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"]), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"])); }, token: OverlayContainer, providedIn: "root" }); OverlayContainer.ctorParameters = () => [ { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"],] }] }, { type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](OverlayContainer, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Injectable"], args: [{ providedIn: 'root' }] }], function () { return [{ type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"]] }] }, { type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"] }]; }, null); })(); /** @docs-private @deprecated @breaking-change 8.0.0 */ function OVERLAY_CONTAINER_PROVIDER_FACTORY(parentContainer, _document) { return parentContainer || new OverlayContainer(_document); } /** @docs-private @deprecated @breaking-change 8.0.0 */ const OVERLAY_CONTAINER_PROVIDER = { // If there is already an OverlayContainer available, use that. Otherwise, provide a new one. provide: OverlayContainer, deps: [ [new _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"](), new _angular_core__WEBPACK_IMPORTED_MODULE_1__["SkipSelf"](), OverlayContainer], _angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"] // We need to use the InjectionToken somewhere to keep TS happy ], useFactory: OVERLAY_CONTAINER_PROVIDER_FACTORY }; /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Reference to an overlay that has been created with the Overlay service. * Used to manipulate or dispose of said overlay. */ class OverlayRef { constructor(_portalOutlet, _host, _pane, _config, _ngZone, _keyboardDispatcher, _document, // @breaking-change 8.0.0 `_location` parameter to be made required. _location, // @breaking-change 9.0.0 `_mouseClickDispatcher` parameter to be made required. _outsideClickDispatcher) { this._portalOutlet = _portalOutlet; this._host = _host; this._pane = _pane; this._config = _config; this._ngZone = _ngZone; this._keyboardDispatcher = _keyboardDispatcher; this._document = _document; this._location = _location; this._outsideClickDispatcher = _outsideClickDispatcher; this._backdropElement = null; this._backdropClick = new rxjs__WEBPACK_IMPORTED_MODULE_7__["Subject"](); this._attachments = new rxjs__WEBPACK_IMPORTED_MODULE_7__["Subject"](); this._detachments = new rxjs__WEBPACK_IMPORTED_MODULE_7__["Subject"](); this._locationChanges = rxjs__WEBPACK_IMPORTED_MODULE_7__["Subscription"].EMPTY; this._backdropClickHandler = (event) => this._backdropClick.next(event); /** Stream of keydown events dispatched to this overlay. */ this._keydownEvents = new rxjs__WEBPACK_IMPORTED_MODULE_7__["Subject"](); /** Stream of mouse outside events dispatched to this overlay. */ this._outsidePointerEvents = new rxjs__WEBPACK_IMPORTED_MODULE_7__["Subject"](); if (_config.scrollStrategy) { this._scrollStrategy = _config.scrollStrategy; this._scrollStrategy.attach(this); } this._positionStrategy = _config.positionStrategy; } /** The overlay's HTML element */ get overlayElement() { return this._pane; } /** The overlay's backdrop HTML element. */ get backdropElement() { return this._backdropElement; } /** * Wrapper around the panel element. Can be used for advanced * positioning where a wrapper with specific styling is * required around the overlay pane. */ get hostElement() { return this._host; } /** * Attaches content, given via a Portal, to the overlay. * If the overlay is configured to have a backdrop, it will be created. * * @param portal Portal instance to which to attach the overlay. * @returns The portal attachment result. */ attach(portal) { let attachResult = this._portalOutlet.attach(portal); // Update the pane element with the given configuration. if (!this._host.parentElement && this._previousHostParent) { this._previousHostParent.appendChild(this._host); } if (this._positionStrategy) { this._positionStrategy.attach(this); } this._updateStackingOrder(); this._updateElementSize(); this._updateElementDirection(); if (this._scrollStrategy) { this._scrollStrategy.enable(); } // Update the position once the zone is stable so that the overlay will be fully rendered // before attempting to position it, as the position may depend on the size of the rendered // content. this._ngZone.onStable .pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_8__["take"])(1)) .subscribe(() => { // The overlay could've been detached before the zone has stabilized. if (this.hasAttached()) { this.updatePosition(); } }); // Enable pointer events for the overlay pane element. this._togglePointerEvents(true); if (this._config.hasBackdrop) { this._attachBackdrop(); } if (this._config.panelClass) { this._toggleClasses(this._pane, this._config.panelClass, true); } // Only emit the `attachments` event once all other setup is done. this._attachments.next(); // Track this overlay by the keyboard dispatcher this._keyboardDispatcher.add(this); // @breaking-change 8.0.0 remove the null check for `_location` // once the constructor parameter is made required. if (this._config.disposeOnNavigation && this._location) { this._locationChanges = this._location.subscribe(() => this.dispose()); } // @breaking-change 9.0.0 remove the null check for `_mouseClickDispatcher` if (this._outsideClickDispatcher) { this._outsideClickDispatcher.add(this); } return attachResult; } /** * Detaches an overlay from a portal. * @returns The portal detachment result. */ detach() { if (!this.hasAttached()) { return; } this.detachBackdrop(); // When the overlay is detached, the pane element should disable pointer events. // This is necessary because otherwise the pane element will cover the page and disable // pointer events therefore. Depends on the position strategy and the applied pane boundaries. this._togglePointerEvents(false); if (this._positionStrategy && this._positionStrategy.detach) { this._positionStrategy.detach(); } if (this._scrollStrategy) { this._scrollStrategy.disable(); } const detachmentResult = this._portalOutlet.detach(); // Only emit after everything is detached. this._detachments.next(); // Remove this overlay from keyboard dispatcher tracking. this._keyboardDispatcher.remove(this); // Keeping the host element in the DOM can cause scroll jank, because it still gets // rendered, even though it's transparent and unclickable which is why we remove it. this._detachContentWhenStable(); // Stop listening for location changes. this._locationChanges.unsubscribe(); // @breaking-change 9.0.0 remove the null check for `_outsideClickDispatcher` if (this._outsideClickDispatcher) { this._outsideClickDispatcher.remove(this); } return detachmentResult; } /** Cleans up the overlay from the DOM. */ dispose() { const isAttached = this.hasAttached(); if (this._positionStrategy) { this._positionStrategy.dispose(); } this._disposeScrollStrategy(); this.detachBackdrop(); this._locationChanges.unsubscribe(); this._keyboardDispatcher.remove(this); this._portalOutlet.dispose(); this._attachments.complete(); this._backdropClick.complete(); this._keydownEvents.complete(); this._outsidePointerEvents.complete(); // @breaking-change 9.0.0 remove the null check for `_outsideClickDispatcher` if (this._outsideClickDispatcher) { this._outsideClickDispatcher.remove(this); } if (this._host && this._host.parentNode) { this._host.parentNode.removeChild(this._host); this._host = null; } this._previousHostParent = this._pane = null; if (isAttached) { this._detachments.next(); } this._detachments.complete(); } /** Whether the overlay has attached content. */ hasAttached() { return this._portalOutlet.hasAttached(); } /** Gets an observable that emits when the backdrop has been clicked. */ backdropClick() { return this._backdropClick; } /** Gets an observable that emits when the overlay has been attached. */ attachments() { return this._attachments; } /** Gets an observable that emits when the overlay has been detached. */ detachments() { return this._detachments; } /** Gets an observable of keydown events targeted to this overlay. */ keydownEvents() { return this._keydownEvents; } /** Gets an observable of pointer events targeted outside this overlay. */ outsidePointerEvents() { return this._outsidePointerEvents; } /** Gets the current overlay configuration, which is immutable. */ getConfig() { return this._config; } /** Updates the position of the overlay based on the position strategy. */ updatePosition() { if (this._positionStrategy) { this._positionStrategy.apply(); } } /** Switches to a new position strategy and updates the overlay position. */ updatePositionStrategy(strategy) { if (strategy === this._positionStrategy) { return; } if (this._positionStrategy) { this._positionStrategy.dispose(); } this._positionStrategy = strategy; if (this.hasAttached()) { strategy.attach(this); this.updatePosition(); } } /** Update the size properties of the overlay. */ updateSize(sizeConfig) { this._config = Object.assign(Object.assign({}, this._config), sizeConfig); this._updateElementSize(); } /** Sets the LTR/RTL direction for the overlay. */ setDirection(dir) { this._config = Object.assign(Object.assign({}, this._config), { direction: dir }); this._updateElementDirection(); } /** Add a CSS class or an array of classes to the overlay pane. */ addPanelClass(classes) { if (this._pane) { this._toggleClasses(this._pane, classes, true); } } /** Remove a CSS class or an array of classes from the overlay pane. */ removePanelClass(classes) { if (this._pane) { this._toggleClasses(this._pane, classes, false); } } /** * Returns the layout direction of the overlay panel. */ getDirection() { const direction = this._config.direction; if (!direction) { return 'ltr'; } return typeof direction === 'string' ? direction : direction.value; } /** Switches to a new scroll strategy. */ updateScrollStrategy(strategy) { if (strategy === this._scrollStrategy) { return; } this._disposeScrollStrategy(); this._scrollStrategy = strategy; if (this.hasAttached()) { strategy.attach(this); strategy.enable(); } } /** Updates the text direction of the overlay panel. */ _updateElementDirection() { this._host.setAttribute('dir', this.getDirection()); } /** Updates the size of the overlay element based on the overlay config. */ _updateElementSize() { if (!this._pane) { return; } const style = this._pane.style; style.width = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceCssPixelValue"])(this._config.width); style.height = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceCssPixelValue"])(this._config.height); style.minWidth = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceCssPixelValue"])(this._config.minWidth); style.minHeight = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceCssPixelValue"])(this._config.minHeight); style.maxWidth = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceCssPixelValue"])(this._config.maxWidth); style.maxHeight = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceCssPixelValue"])(this._config.maxHeight); } /** Toggles the pointer events for the overlay pane element. */ _togglePointerEvents(enablePointer) { this._pane.style.pointerEvents = enablePointer ? 'auto' : 'none'; } /** Attaches a backdrop for this overlay. */ _attachBackdrop() { const showingClass = 'cdk-overlay-backdrop-showing'; this._backdropElement = this._document.createElement('div'); this._backdropElement.classList.add('cdk-overlay-backdrop'); if (this._config.backdropClass) { this._toggleClasses(this._backdropElement, this._config.backdropClass, true); } // Insert the backdrop before the pane in the DOM order, // in order to handle stacked overlays properly. this._host.parentElement.insertBefore(this._backdropElement, this._host); // Forward backdrop clicks such that the consumer of the overlay can perform whatever // action desired when such a click occurs (usually closing the overlay). this._backdropElement.addEventListener('click', this._backdropClickHandler); // Add class to fade-in the backdrop after one frame. if (typeof requestAnimationFrame !== 'undefined') { this._ngZone.runOutsideAngular(() => { requestAnimationFrame(() => { if (this._backdropElement) { this._backdropElement.classList.add(showingClass); } }); }); } else { this._backdropElement.classList.add(showingClass); } } /** * Updates the stacking order of the element, moving it to the top if necessary. * This is required in cases where one overlay was detached, while another one, * that should be behind it, was destroyed. The next time both of them are opened, * the stacking will be wrong, because the detached element's pane will still be * in its original DOM position. */ _updateStackingOrder() { if (this._host.nextSibling) { this._host.parentNode.appendChild(this._host); } } /** Detaches the backdrop (if any) associated with the overlay. */ detachBackdrop() { let backdropToDetach = this._backdropElement; if (!backdropToDetach) { return; } let timeoutId; let finishDetach = () => { // It may not be attached to anything in certain cases (e.g. unit tests). if (backdropToDetach) { backdropToDetach.removeEventListener('click', this._backdropClickHandler); backdropToDetach.removeEventListener('transitionend', finishDetach); if (backdropToDetach.parentNode) { backdropToDetach.parentNode.removeChild(backdropToDetach); } } // It is possible that a new portal has been attached to this overlay since we started // removing the backdrop. If that is the case, only clear the backdrop reference if it // is still the same instance that we started to remove. if (this._backdropElement == backdropToDetach) { this._backdropElement = null; } if (this._config.backdropClass) { this._toggleClasses(backdropToDetach, this._config.backdropClass, false); } clearTimeout(timeoutId); }; backdropToDetach.classList.remove('cdk-overlay-backdrop-showing'); this._ngZone.runOutsideAngular(() => { backdropToDetach.addEventListener('transitionend', finishDetach); }); // If the backdrop doesn't have a transition, the `transitionend` event won't fire. // In this case we make it unclickable and we try to remove it after a delay. backdropToDetach.style.pointerEvents = 'none'; // Run this outside the Angular zone because there's nothing that Angular cares about. // If it were to run inside the Angular zone, every test that used Overlay would have to be // either async or fakeAsync. timeoutId = this._ngZone.runOutsideAngular(() => setTimeout(finishDetach, 500)); } /** Toggles a single CSS class or an array of classes on an element. */ _toggleClasses(element, cssClasses, isAdd) { const classList = element.classList; Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceArray"])(cssClasses).forEach(cssClass => { // We can't do a spread here, because IE doesn't support setting multiple classes. // Also trying to add an empty string to a DOMTokenList will throw. if (cssClass) { isAdd ? classList.add(cssClass) : classList.remove(cssClass); } }); } /** Detaches the overlay content next time the zone stabilizes. */ _detachContentWhenStable() { // Normally we wouldn't have to explicitly run this outside the `NgZone`, however // if the consumer is using `zone-patch-rxjs`, the `Subscription.unsubscribe` call will // be patched to run inside the zone, which will throw us into an infinite loop. this._ngZone.runOutsideAngular(() => { // We can't remove the host here immediately, because the overlay pane's content // might still be animating. This stream helps us avoid interrupting the animation // by waiting for the pane to become empty. const subscription = this._ngZone.onStable .pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_8__["takeUntil"])(Object(rxjs__WEBPACK_IMPORTED_MODULE_7__["merge"])(this._attachments, this._detachments))) .subscribe(() => { // Needs a couple of checks for the pane and host, because // they may have been removed by the time the zone stabilizes. if (!this._pane || !this._host || this._pane.children.length === 0) { if (this._pane && this._config.panelClass) { this._toggleClasses(this._pane, this._config.panelClass, false); } if (this._host && this._host.parentElement) { this._previousHostParent = this._host.parentElement; this._previousHostParent.removeChild(this._host); } subscription.unsubscribe(); } }); }); } /** Disposes of a scroll strategy. */ _disposeScrollStrategy() { const scrollStrategy = this._scrollStrategy; if (scrollStrategy) { scrollStrategy.disable(); if (scrollStrategy.detach) { scrollStrategy.detach(); } } } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ // TODO: refactor clipping detection into a separate thing (part of scrolling module) // TODO: doesn't handle both flexible width and height when it has to scroll along both axis. /** Class to be added to the overlay bounding box. */ const boundingBoxClass = 'cdk-overlay-connected-position-bounding-box'; /** Regex used to split a string on its CSS units. */ const cssUnitPattern = /([A-Za-z%]+)$/; /** * A strategy for positioning overlays. Using this strategy, an overlay is given an * implicit position relative some origin element. The relative position is defined in terms of * a point on the origin element that is connected to a point on the overlay element. For example, * a basic dropdown is connecting the bottom-left corner of the origin to the top-left corner * of the overlay. */ class FlexibleConnectedPositionStrategy { constructor(connectedTo, _viewportRuler, _document, _platform, _overlayContainer) { this._viewportRuler = _viewportRuler; this._document = _document; this._platform = _platform; this._overlayContainer = _overlayContainer; /** Last size used for the bounding box. Used to avoid resizing the overlay after open. */ this._lastBoundingBoxSize = { width: 0, height: 0 }; /** Whether the overlay was pushed in a previous positioning. */ this._isPushed = false; /** Whether the overlay can be pushed on-screen on the initial open. */ this._canPush = true; /** Whether the overlay can grow via flexible width/height after the initial open. */ this._growAfterOpen = false; /** Whether the overlay's width and height can be constrained to fit within the viewport. */ this._hasFlexibleDimensions = true; /** Whether the overlay position is locked. */ this._positionLocked = false; /** Amount of space that must be maintained between the overlay and the edge of the viewport. */ this._viewportMargin = 0; /** The Scrollable containers used to check scrollable view properties on position change. */ this._scrollables = []; /** Ordered list of preferred positions, from most to least desirable. */ this._preferredPositions = []; /** Subject that emits whenever the position changes. */ this._positionChanges = new rxjs__WEBPACK_IMPORTED_MODULE_7__["Subject"](); /** Subscription to viewport size changes. */ this._resizeSubscription = rxjs__WEBPACK_IMPORTED_MODULE_7__["Subscription"].EMPTY; /** Default offset for the overlay along the x axis. */ this._offsetX = 0; /** Default offset for the overlay along the y axis. */ this._offsetY = 0; /** Keeps track of the CSS classes that the position strategy has applied on the overlay panel. */ this._appliedPanelClasses = []; /** Observable sequence of position changes. */ this.positionChanges = this._positionChanges; this.setOrigin(connectedTo); } /** Ordered list of preferred positions, from most to least desirable. */ get positions() { return this._preferredPositions; } /** Attaches this position strategy to an overlay. */ attach(overlayRef) { if (this._overlayRef && overlayRef !== this._overlayRef && (typeof ngDevMode === 'undefined' || ngDevMode)) { throw Error('This position strategy is already attached to an overlay'); } this._validatePositions(); overlayRef.hostElement.classList.add(boundingBoxClass); this._overlayRef = overlayRef; this._boundingBox = overlayRef.hostElement; this._pane = overlayRef.overlayElement; this._isDisposed = false; this._isInitialRender = true; this._lastPosition = null; this._resizeSubscription.unsubscribe(); this._resizeSubscription = this._viewportRuler.change().subscribe(() => { // When the window is resized, we want to trigger the next reposition as if it // was an initial render, in order for the strategy to pick a new optimal position, // otherwise position locking will cause it to stay at the old one. this._isInitialRender = true; this.apply(); }); } /** * Updates the position of the overlay element, using whichever preferred position relative * to the origin best fits on-screen. * * The selection of a position goes as follows: * - If any positions fit completely within the viewport as-is, * choose the first position that does so. * - If flexible dimensions are enabled and at least one satifies the given minimum width/height, * choose the position with the greatest available size modified by the positions' weight. * - If pushing is enabled, take the position that went off-screen the least and push it * on-screen. * - If none of the previous criteria were met, use the position that goes off-screen the least. * @docs-private */ apply() { // We shouldn't do anything if the strategy was disposed or we're on the server. if (this._isDisposed || !this._platform.isBrowser) { return; } // If the position has been applied already (e.g. when the overlay was opened) and the // consumer opted into locking in the position, re-use the old position, in order to // prevent the overlay from jumping around. if (!this._isInitialRender && this._positionLocked && this._lastPosition) { this.reapplyLastPosition(); return; } this._clearPanelClasses(); this._resetOverlayElementStyles(); this._resetBoundingBoxStyles(); // We need the bounding rects for the origin and the overlay to determine how to position // the overlay relative to the origin. // We use the viewport rect to determine whether a position would go off-screen. this._viewportRect = this._getNarrowedViewportRect(); this._originRect = this._getOriginRect(); this._overlayRect = this._pane.getBoundingClientRect(); const originRect = this._originRect; const overlayRect = this._overlayRect; const viewportRect = this._viewportRect; // Positions where the overlay will fit with flexible dimensions. const flexibleFits = []; // Fallback if none of the preferred positions fit within the viewport. let fallback; // Go through each of the preferred positions looking for a good fit. // If a good fit is found, it will be applied immediately. for (let pos of this._preferredPositions) { // Get the exact (x, y) coordinate for the point-of-origin on the origin element. let originPoint = this._getOriginPoint(originRect, pos); // From that point-of-origin, get the exact (x, y) coordinate for the top-left corner of the // overlay in this position. We use the top-left corner for calculations and later translate // this into an appropriate (top, left, bottom, right) style. let overlayPoint = this._getOverlayPoint(originPoint, overlayRect, pos); // Calculate how well the overlay would fit into the viewport with this point. let overlayFit = this._getOverlayFit(overlayPoint, overlayRect, viewportRect, pos); // If the overlay, without any further work, fits into the viewport, use this position. if (overlayFit.isCompletelyWithinViewport) { this._isPushed = false; this._applyPosition(pos, originPoint); return; } // If the overlay has flexible dimensions, we can use this position // so long as there's enough space for the minimum dimensions. if (this._canFitWithFlexibleDimensions(overlayFit, overlayPoint, viewportRect)) { // Save positions where the overlay will fit with flexible dimensions. We will use these // if none of the positions fit *without* flexible dimensions. flexibleFits.push({ position: pos, origin: originPoint, overlayRect, boundingBoxRect: this._calculateBoundingBoxRect(originPoint, pos) }); continue; } // If the current preferred position does not fit on the screen, remember the position // if it has more visible area on-screen than we've seen and move onto the next preferred // position. if (!fallback || fallback.overlayFit.visibleArea < overlayFit.visibleArea) { fallback = { overlayFit, overlayPoint, originPoint, position: pos, overlayRect }; } } // If there are any positions where the overlay would fit with flexible dimensions, choose the // one that has the greatest area available modified by the position's weight if (flexibleFits.length) { let bestFit = null; let bestScore = -1; for (const fit of flexibleFits) { const score = fit.boundingBoxRect.width * fit.boundingBoxRect.height * (fit.position.weight || 1); if (score > bestScore) { bestScore = score; bestFit = fit; } } this._isPushed = false; this._applyPosition(bestFit.position, bestFit.origin); return; } // When none of the preferred positions fit within the viewport, take the position // that went off-screen the least and attempt to push it on-screen. if (this._canPush) { // TODO(jelbourn): after pushing, the opening "direction" of the overlay might not make sense. this._isPushed = true; this._applyPosition(fallback.position, fallback.originPoint); return; } // All options for getting the overlay within the viewport have been exhausted, so go with the // position that went off-screen the least. this._applyPosition(fallback.position, fallback.originPoint); } detach() { this._clearPanelClasses(); this._lastPosition = null; this._previousPushAmount = null; this._resizeSubscription.unsubscribe(); } /** Cleanup after the element gets destroyed. */ dispose() { if (this._isDisposed) { return; } // We can't use `_resetBoundingBoxStyles` here, because it resets // some properties to zero, rather than removing them. if (this._boundingBox) { extendStyles(this._boundingBox.style, { top: '', left: '', right: '', bottom: '', height: '', width: '', alignItems: '', justifyContent: '', }); } if (this._pane) { this._resetOverlayElementStyles(); } if (this._overlayRef) { this._overlayRef.hostElement.classList.remove(boundingBoxClass); } this.detach(); this._positionChanges.complete(); this._overlayRef = this._boundingBox = null; this._isDisposed = true; } /** * This re-aligns the overlay element with the trigger in its last calculated position, * even if a position higher in the "preferred positions" list would now fit. This * allows one to re-align the panel without changing the orientation of the panel. */ reapplyLastPosition() { if (!this._isDisposed && (!this._platform || this._platform.isBrowser)) { this._originRect = this._getOriginRect(); this._overlayRect = this._pane.getBoundingClientRect(); this._viewportRect = this._getNarrowedViewportRect(); const lastPosition = this._lastPosition || this._preferredPositions[0]; const originPoint = this._getOriginPoint(this._originRect, lastPosition); this._applyPosition(lastPosition, originPoint); } } /** * Sets the list of Scrollable containers that host the origin element so that * on reposition we can evaluate if it or the overlay has been clipped or outside view. Every * Scrollable must be an ancestor element of the strategy's origin element. */ withScrollableContainers(scrollables) { this._scrollables = scrollables; return this; } /** * Adds new preferred positions. * @param positions List of positions options for this overlay. */ withPositions(positions) { this._preferredPositions = positions; // If the last calculated position object isn't part of the positions anymore, clear // it in order to avoid it being picked up if the consumer tries to re-apply. if (positions.indexOf(this._lastPosition) === -1) { this._lastPosition = null; } this._validatePositions(); return this; } /** * Sets a minimum distance the overlay may be positioned to the edge of the viewport. * @param margin Required margin between the overlay and the viewport edge in pixels. */ withViewportMargin(margin) { this._viewportMargin = margin; return this; } /** Sets whether the overlay's width and height can be constrained to fit within the viewport. */ withFlexibleDimensions(flexibleDimensions = true) { this._hasFlexibleDimensions = flexibleDimensions; return this; } /** Sets whether the overlay can grow after the initial open via flexible width/height. */ withGrowAfterOpen(growAfterOpen = true) { this._growAfterOpen = growAfterOpen; return this; } /** Sets whether the overlay can be pushed on-screen if none of the provided positions fit. */ withPush(canPush = true) { this._canPush = canPush; return this; } /** * Sets whether the overlay's position should be locked in after it is positioned * initially. When an overlay is locked in, it won't attempt to reposition itself * when the position is re-applied (e.g. when the user scrolls away). * @param isLocked Whether the overlay should locked in. */ withLockedPosition(isLocked = true) { this._positionLocked = isLocked; return this; } /** * Sets the origin, relative to which to position the overlay. * Using an element origin is useful for building components that need to be positioned * relatively to a trigger (e.g. dropdown menus or tooltips), whereas using a point can be * used for cases like contextual menus which open relative to the user's pointer. * @param origin Reference to the new origin. */ setOrigin(origin) { this._origin = origin; return this; } /** * Sets the default offset for the overlay's connection point on the x-axis. * @param offset New offset in the X axis. */ withDefaultOffsetX(offset) { this._offsetX = offset; return this; } /** * Sets the default offset for the overlay's connection point on the y-axis. * @param offset New offset in the Y axis. */ withDefaultOffsetY(offset) { this._offsetY = offset; return this; } /** * Configures that the position strategy should set a `transform-origin` on some elements * inside the overlay, depending on the current position that is being applied. This is * useful for the cases where the origin of an animation can change depending on the * alignment of the overlay. * @param selector CSS selector that will be used to find the target * elements onto which to set the transform origin. */ withTransformOriginOn(selector) { this._transformOriginSelector = selector; return this; } /** * Gets the (x, y) coordinate of a connection point on the origin based on a relative position. */ _getOriginPoint(originRect, pos) { let x; if (pos.originX == 'center') { // Note: when centering we should always use the `left` // offset, otherwise the position will be wrong in RTL. x = originRect.left + (originRect.width / 2); } else { const startX = this._isRtl() ? originRect.right : originRect.left; const endX = this._isRtl() ? originRect.left : originRect.right; x = pos.originX == 'start' ? startX : endX; } let y; if (pos.originY == 'center') { y = originRect.top + (originRect.height / 2); } else { y = pos.originY == 'top' ? originRect.top : originRect.bottom; } return { x, y }; } /** * Gets the (x, y) coordinate of the top-left corner of the overlay given a given position and * origin point to which the overlay should be connected. */ _getOverlayPoint(originPoint, overlayRect, pos) { // Calculate the (overlayStartX, overlayStartY), the start of the // potential overlay position relative to the origin point. let overlayStartX; if (pos.overlayX == 'center') { overlayStartX = -overlayRect.width / 2; } else if (pos.overlayX === 'start') { overlayStartX = this._isRtl() ? -overlayRect.width : 0; } else { overlayStartX = this._isRtl() ? 0 : -overlayRect.width; } let overlayStartY; if (pos.overlayY == 'center') { overlayStartY = -overlayRect.height / 2; } else { overlayStartY = pos.overlayY == 'top' ? 0 : -overlayRect.height; } // The (x, y) coordinates of the overlay. return { x: originPoint.x + overlayStartX, y: originPoint.y + overlayStartY, }; } /** Gets how well an overlay at the given point will fit within the viewport. */ _getOverlayFit(point, overlay, viewport, position) { let { x, y } = point; let offsetX = this._getOffset(position, 'x'); let offsetY = this._getOffset(position, 'y'); // Account for the offsets since they could push the overlay out of the viewport. if (offsetX) { x += offsetX; } if (offsetY) { y += offsetY; } // How much the overlay would overflow at this position, on each side. let leftOverflow = 0 - x; let rightOverflow = (x + overlay.width) - viewport.width; let topOverflow = 0 - y; let bottomOverflow = (y + overlay.height) - viewport.height; // Visible parts of the element on each axis. let visibleWidth = this._subtractOverflows(overlay.width, leftOverflow, rightOverflow); let visibleHeight = this._subtractOverflows(overlay.height, topOverflow, bottomOverflow); let visibleArea = visibleWidth * visibleHeight; return { visibleArea, isCompletelyWithinViewport: (overlay.width * overlay.height) === visibleArea, fitsInViewportVertically: visibleHeight === overlay.height, fitsInViewportHorizontally: visibleWidth == overlay.width, }; } /** * Whether the overlay can fit within the viewport when it may resize either its width or height. * @param fit How well the overlay fits in the viewport at some position. * @param point The (x, y) coordinates of the overlat at some position. * @param viewport The geometry of the viewport. */ _canFitWithFlexibleDimensions(fit, point, viewport) { if (this._hasFlexibleDimensions) { const availableHeight = viewport.bottom - point.y; const availableWidth = viewport.right - point.x; const minHeight = getPixelValue(this._overlayRef.getConfig().minHeight); const minWidth = getPixelValue(this._overlayRef.getConfig().minWidth); const verticalFit = fit.fitsInViewportVertically || (minHeight != null && minHeight <= availableHeight); const horizontalFit = fit.fitsInViewportHorizontally || (minWidth != null && minWidth <= availableWidth); return verticalFit && horizontalFit; } return false; } /** * Gets the point at which the overlay can be "pushed" on-screen. If the overlay is larger than * the viewport, the top-left corner will be pushed on-screen (with overflow occuring on the * right and bottom). * * @param start Starting point from which the overlay is pushed. * @param overlay Dimensions of the overlay. * @param scrollPosition Current viewport scroll position. * @returns The point at which to position the overlay after pushing. This is effectively a new * originPoint. */ _pushOverlayOnScreen(start, overlay, scrollPosition) { // If the position is locked and we've pushed the overlay already, reuse the previous push // amount, rather than pushing it again. If we were to continue pushing, the element would // remain in the viewport, which goes against the expectations when position locking is enabled. if (this._previousPushAmount && this._positionLocked) { return { x: start.x + this._previousPushAmount.x, y: start.y + this._previousPushAmount.y }; } const viewport = this._viewportRect; // Determine how much the overlay goes outside the viewport on each // side, which we'll use to decide which direction to push it. const overflowRight = Math.max(start.x + overlay.width - viewport.width, 0); const overflowBottom = Math.max(start.y + overlay.height - viewport.height, 0); const overflowTop = Math.max(viewport.top - scrollPosition.top - start.y, 0); const overflowLeft = Math.max(viewport.left - scrollPosition.left - start.x, 0); // Amount by which to push the overlay in each axis such that it remains on-screen. let pushX = 0; let pushY = 0; // If the overlay fits completely within the bounds of the viewport, push it from whichever // direction is goes off-screen. Otherwise, push the top-left corner such that its in the // viewport and allow for the trailing end of the overlay to go out of bounds. if (overlay.width <= viewport.width) { pushX = overflowLeft || -overflowRight; } else { pushX = start.x < this._viewportMargin ? (viewport.left - scrollPosition.left) - start.x : 0; } if (overlay.height <= viewport.height) { pushY = overflowTop || -overflowBottom; } else { pushY = start.y < this._viewportMargin ? (viewport.top - scrollPosition.top) - start.y : 0; } this._previousPushAmount = { x: pushX, y: pushY }; return { x: start.x + pushX, y: start.y + pushY, }; } /** * Applies a computed position to the overlay and emits a position change. * @param position The position preference * @param originPoint The point on the origin element where the overlay is connected. */ _applyPosition(position, originPoint) { this._setTransformOrigin(position); this._setOverlayElementStyles(originPoint, position); this._setBoundingBoxStyles(originPoint, position); if (position.panelClass) { this._addPanelClasses(position.panelClass); } // Save the last connected position in case the position needs to be re-calculated. this._lastPosition = position; // Notify that the position has been changed along with its change properties. // We only emit if we've got any subscriptions, because the scroll visibility // calculcations can be somewhat expensive. if (this._positionChanges.observers.length) { const scrollableViewProperties = this._getScrollVisibility(); const changeEvent = new ConnectedOverlayPositionChange(position, scrollableViewProperties); this._positionChanges.next(changeEvent); } this._isInitialRender = false; } /** Sets the transform origin based on the configured selector and the passed-in position. */ _setTransformOrigin(position) { if (!this._transformOriginSelector) { return; } const elements = this._boundingBox.querySelectorAll(this._transformOriginSelector); let xOrigin; let yOrigin = position.overlayY; if (position.overlayX === 'center') { xOrigin = 'center'; } else if (this._isRtl()) { xOrigin = position.overlayX === 'start' ? 'right' : 'left'; } else { xOrigin = position.overlayX === 'start' ? 'left' : 'right'; } for (let i = 0; i < elements.length; i++) { elements[i].style.transformOrigin = `${xOrigin} ${yOrigin}`; } } /** * Gets the position and size of the overlay's sizing container. * * This method does no measuring and applies no styles so that we can cheaply compute the * bounds for all positions and choose the best fit based on these results. */ _calculateBoundingBoxRect(origin, position) { const viewport = this._viewportRect; const isRtl = this._isRtl(); let height, top, bottom; if (position.overlayY === 'top') { // Overlay is opening "downward" and thus is bound by the bottom viewport edge. top = origin.y; height = viewport.height - top + this._viewportMargin; } else if (position.overlayY === 'bottom') { // Overlay is opening "upward" and thus is bound by the top viewport edge. We need to add // the viewport margin back in, because the viewport rect is narrowed down to remove the // margin, whereas the `origin` position is calculated based on its `ClientRect`. bottom = viewport.height - origin.y + this._viewportMargin * 2; height = viewport.height - bottom + this._viewportMargin; } else { // If neither top nor bottom, it means that the overlay is vertically centered on the // origin point. Note that we want the position relative to the viewport, rather than // the page, which is why we don't use something like `viewport.bottom - origin.y` and // `origin.y - viewport.top`. const smallestDistanceToViewportEdge = Math.min(viewport.bottom - origin.y + viewport.top, origin.y); const previousHeight = this._lastBoundingBoxSize.height; height = smallestDistanceToViewportEdge * 2; top = origin.y - smallestDistanceToViewportEdge; if (height > previousHeight && !this._isInitialRender && !this._growAfterOpen) { top = origin.y - (previousHeight / 2); } } // The overlay is opening 'right-ward' (the content flows to the right). const isBoundedByRightViewportEdge = (position.overlayX === 'start' && !isRtl) || (position.overlayX === 'end' && isRtl); // The overlay is opening 'left-ward' (the content flows to the left). const isBoundedByLeftViewportEdge = (position.overlayX === 'end' && !isRtl) || (position.overlayX === 'start' && isRtl); let width, left, right; if (isBoundedByLeftViewportEdge) { right = viewport.width - origin.x + this._viewportMargin; width = origin.x - this._viewportMargin; } else if (isBoundedByRightViewportEdge) { left = origin.x; width = viewport.right - origin.x; } else { // If neither start nor end, it means that the overlay is horizontally centered on the // origin point. Note that we want the position relative to the viewport, rather than // the page, which is why we don't use something like `viewport.right - origin.x` and // `origin.x - viewport.left`. const smallestDistanceToViewportEdge = Math.min(viewport.right - origin.x + viewport.left, origin.x); const previousWidth = this._lastBoundingBoxSize.width; width = smallestDistanceToViewportEdge * 2; left = origin.x - smallestDistanceToViewportEdge; if (width > previousWidth && !this._isInitialRender && !this._growAfterOpen) { left = origin.x - (previousWidth / 2); } } return { top: top, left: left, bottom: bottom, right: right, width, height }; } /** * Sets the position and size of the overlay's sizing wrapper. The wrapper is positioned on the * origin's connection point and stetches to the bounds of the viewport. * * @param origin The point on the origin element where the overlay is connected. * @param position The position preference */ _setBoundingBoxStyles(origin, position) { const boundingBoxRect = this._calculateBoundingBoxRect(origin, position); // It's weird if the overlay *grows* while scrolling, so we take the last size into account // when applying a new size. if (!this._isInitialRender && !this._growAfterOpen) { boundingBoxRect.height = Math.min(boundingBoxRect.height, this._lastBoundingBoxSize.height); boundingBoxRect.width = Math.min(boundingBoxRect.width, this._lastBoundingBoxSize.width); } const styles = {}; if (this._hasExactPosition()) { styles.top = styles.left = '0'; styles.bottom = styles.right = styles.maxHeight = styles.maxWidth = ''; styles.width = styles.height = '100%'; } else { const maxHeight = this._overlayRef.getConfig().maxHeight; const maxWidth = this._overlayRef.getConfig().maxWidth; styles.height = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceCssPixelValue"])(boundingBoxRect.height); styles.top = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceCssPixelValue"])(boundingBoxRect.top); styles.bottom = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceCssPixelValue"])(boundingBoxRect.bottom); styles.width = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceCssPixelValue"])(boundingBoxRect.width); styles.left = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceCssPixelValue"])(boundingBoxRect.left); styles.right = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceCssPixelValue"])(boundingBoxRect.right); // Push the pane content towards the proper direction. if (position.overlayX === 'center') { styles.alignItems = 'center'; } else { styles.alignItems = position.overlayX === 'end' ? 'flex-end' : 'flex-start'; } if (position.overlayY === 'center') { styles.justifyContent = 'center'; } else { styles.justifyContent = position.overlayY === 'bottom' ? 'flex-end' : 'flex-start'; } if (maxHeight) { styles.maxHeight = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceCssPixelValue"])(maxHeight); } if (maxWidth) { styles.maxWidth = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceCssPixelValue"])(maxWidth); } } this._lastBoundingBoxSize = boundingBoxRect; extendStyles(this._boundingBox.style, styles); } /** Resets the styles for the bounding box so that a new positioning can be computed. */ _resetBoundingBoxStyles() { extendStyles(this._boundingBox.style, { top: '0', left: '0', right: '0', bottom: '0', height: '', width: '', alignItems: '', justifyContent: '', }); } /** Resets the styles for the overlay pane so that a new positioning can be computed. */ _resetOverlayElementStyles() { extendStyles(this._pane.style, { top: '', left: '', bottom: '', right: '', position: '', transform: '', }); } /** Sets positioning styles to the overlay element. */ _setOverlayElementStyles(originPoint, position) { const styles = {}; const hasExactPosition = this._hasExactPosition(); const hasFlexibleDimensions = this._hasFlexibleDimensions; const config = this._overlayRef.getConfig(); if (hasExactPosition) { const scrollPosition = this._viewportRuler.getViewportScrollPosition(); extendStyles(styles, this._getExactOverlayY(position, originPoint, scrollPosition)); extendStyles(styles, this._getExactOverlayX(position, originPoint, scrollPosition)); } else { styles.position = 'static'; } // Use a transform to apply the offsets. We do this because the `center` positions rely on // being in the normal flex flow and setting a `top` / `left` at all will completely throw // off the position. We also can't use margins, because they won't have an effect in some // cases where the element doesn't have anything to "push off of". Finally, this works // better both with flexible and non-flexible positioning. let transformString = ''; let offsetX = this._getOffset(position, 'x'); let offsetY = this._getOffset(position, 'y'); if (offsetX) { transformString += `translateX(${offsetX}px) `; } if (offsetY) { transformString += `translateY(${offsetY}px)`; } styles.transform = transformString.trim(); // If a maxWidth or maxHeight is specified on the overlay, we remove them. We do this because // we need these values to both be set to "100%" for the automatic flexible sizing to work. // The maxHeight and maxWidth are set on the boundingBox in order to enforce the constraint. // Note that this doesn't apply when we have an exact position, in which case we do want to // apply them because they'll be cleared from the bounding box. if (config.maxHeight) { if (hasExactPosition) { styles.maxHeight = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceCssPixelValue"])(config.maxHeight); } else if (hasFlexibleDimensions) { styles.maxHeight = ''; } } if (config.maxWidth) { if (hasExactPosition) { styles.maxWidth = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceCssPixelValue"])(config.maxWidth); } else if (hasFlexibleDimensions) { styles.maxWidth = ''; } } extendStyles(this._pane.style, styles); } /** Gets the exact top/bottom for the overlay when not using flexible sizing or when pushing. */ _getExactOverlayY(position, originPoint, scrollPosition) { // Reset any existing styles. This is necessary in case the // preferred position has changed since the last `apply`. let styles = { top: '', bottom: '' }; let overlayPoint = this._getOverlayPoint(originPoint, this._overlayRect, position); if (this._isPushed) { overlayPoint = this._pushOverlayOnScreen(overlayPoint, this._overlayRect, scrollPosition); } let virtualKeyboardOffset = this._overlayContainer.getContainerElement().getBoundingClientRect().top; // Normally this would be zero, however when the overlay is attached to an input (e.g. in an // autocomplete), mobile browsers will shift everything in order to put the input in the middle // of the screen and to make space for the virtual keyboard. We need to account for this offset, // otherwise our positioning will be thrown off. overlayPoint.y -= virtualKeyboardOffset; // We want to set either `top` or `bottom` based on whether the overlay wants to appear // above or below the origin and the direction in which the element will expand. if (position.overlayY === 'bottom') { // When using `bottom`, we adjust the y position such that it is the distance // from the bottom of the viewport rather than the top. const documentHeight = this._document.documentElement.clientHeight; styles.bottom = `${documentHeight - (overlayPoint.y + this._overlayRect.height)}px`; } else { styles.top = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceCssPixelValue"])(overlayPoint.y); } return styles; } /** Gets the exact left/right for the overlay when not using flexible sizing or when pushing. */ _getExactOverlayX(position, originPoint, scrollPosition) { // Reset any existing styles. This is necessary in case the preferred position has // changed since the last `apply`. let styles = { left: '', right: '' }; let overlayPoint = this._getOverlayPoint(originPoint, this._overlayRect, position); if (this._isPushed) { overlayPoint = this._pushOverlayOnScreen(overlayPoint, this._overlayRect, scrollPosition); } // We want to set either `left` or `right` based on whether the overlay wants to appear "before" // or "after" the origin, which determines the direction in which the element will expand. // For the horizontal axis, the meaning of "before" and "after" change based on whether the // page is in RTL or LTR. let horizontalStyleProperty; if (this._isRtl()) { horizontalStyleProperty = position.overlayX === 'end' ? 'left' : 'right'; } else { horizontalStyleProperty = position.overlayX === 'end' ? 'right' : 'left'; } // When we're setting `right`, we adjust the x position such that it is the distance // from the right edge of the viewport rather than the left edge. if (horizontalStyleProperty === 'right') { const documentWidth = this._document.documentElement.clientWidth; styles.right = `${documentWidth - (overlayPoint.x + this._overlayRect.width)}px`; } else { styles.left = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceCssPixelValue"])(overlayPoint.x); } return styles; } /** * Gets the view properties of the trigger and overlay, including whether they are clipped * or completely outside the view of any of the strategy's scrollables. */ _getScrollVisibility() { // Note: needs fresh rects since the position could've changed. const originBounds = this._getOriginRect(); const overlayBounds = this._pane.getBoundingClientRect(); // TODO(jelbourn): instead of needing all of the client rects for these scrolling containers // every time, we should be able to use the scrollTop of the containers if the size of those // containers hasn't changed. const scrollContainerBounds = this._scrollables.map(scrollable => { return scrollable.getElementRef().nativeElement.getBoundingClientRect(); }); return { isOriginClipped: isElementClippedByScrolling(originBounds, scrollContainerBounds), isOriginOutsideView: isElementScrolledOutsideView(originBounds, scrollContainerBounds), isOverlayClipped: isElementClippedByScrolling(overlayBounds, scrollContainerBounds), isOverlayOutsideView: isElementScrolledOutsideView(overlayBounds, scrollContainerBounds), }; } /** Subtracts the amount that an element is overflowing on an axis from its length. */ _subtractOverflows(length, ...overflows) { return overflows.reduce((currentValue, currentOverflow) => { return currentValue - Math.max(currentOverflow, 0); }, length); } /** Narrows the given viewport rect by the current _viewportMargin. */ _getNarrowedViewportRect() { // We recalculate the viewport rect here ourselves, rather than using the ViewportRuler, // because we want to use the `clientWidth` and `clientHeight` as the base. The difference // being that the client properties don't include the scrollbar, as opposed to `innerWidth` // and `innerHeight` that do. This is necessary, because the overlay container uses // 100% `width` and `height` which don't include the scrollbar either. const width = this._document.documentElement.clientWidth; const height = this._document.documentElement.clientHeight; const scrollPosition = this._viewportRuler.getViewportScrollPosition(); return { top: scrollPosition.top + this._viewportMargin, left: scrollPosition.left + this._viewportMargin, right: scrollPosition.left + width - this._viewportMargin, bottom: scrollPosition.top + height - this._viewportMargin, width: width - (2 * this._viewportMargin), height: height - (2 * this._viewportMargin), }; } /** Whether the we're dealing with an RTL context */ _isRtl() { return this._overlayRef.getDirection() === 'rtl'; } /** Determines whether the overlay uses exact or flexible positioning. */ _hasExactPosition() { return !this._hasFlexibleDimensions || this._isPushed; } /** Retrieves the offset of a position along the x or y axis. */ _getOffset(position, axis) { if (axis === 'x') { // We don't do something like `position['offset' + axis]` in // order to avoid breking minifiers that rename properties. return position.offsetX == null ? this._offsetX : position.offsetX; } return position.offsetY == null ? this._offsetY : position.offsetY; } /** Validates that the current position match the expected values. */ _validatePositions() { if (typeof ngDevMode === 'undefined' || ngDevMode) { if (!this._preferredPositions.length) { throw Error('FlexibleConnectedPositionStrategy: At least one position is required.'); } // TODO(crisbeto): remove these once Angular's template type // checking is advanced enough to catch these cases. this._preferredPositions.forEach(pair => { validateHorizontalPosition('originX', pair.originX); validateVerticalPosition('originY', pair.originY); validateHorizontalPosition('overlayX', pair.overlayX); validateVerticalPosition('overlayY', pair.overlayY); }); } } /** Adds a single CSS class or an array of classes on the overlay panel. */ _addPanelClasses(cssClasses) { if (this._pane) { Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceArray"])(cssClasses).forEach(cssClass => { if (cssClass !== '' && this._appliedPanelClasses.indexOf(cssClass) === -1) { this._appliedPanelClasses.push(cssClass); this._pane.classList.add(cssClass); } }); } } /** Clears the classes that the position strategy has applied from the overlay panel. */ _clearPanelClasses() { if (this._pane) { this._appliedPanelClasses.forEach(cssClass => { this._pane.classList.remove(cssClass); }); this._appliedPanelClasses = []; } } /** Returns the ClientRect of the current origin. */ _getOriginRect() { const origin = this._origin; if (origin instanceof _angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"]) { return origin.nativeElement.getBoundingClientRect(); } // Check for Element so SVG elements are also supported. if (origin instanceof Element) { return origin.getBoundingClientRect(); } const width = origin.width || 0; const height = origin.height || 0; // If the origin is a point, return a client rect as if it was a 0x0 element at the point. return { top: origin.y, bottom: origin.y + height, left: origin.x, right: origin.x + width, height, width }; } } /** Shallow-extends a stylesheet object with another stylesheet object. */ function extendStyles(destination, source) { for (let key in source) { if (source.hasOwnProperty(key)) { destination[key] = source[key]; } } return destination; } /** * Extracts the pixel value as a number from a value, if it's a number * or a CSS pixel string (e.g. `1337px`). Otherwise returns null. */ function getPixelValue(input) { if (typeof input !== 'number' && input != null) { const [value, units] = input.split(cssUnitPattern); return (!units || units === 'px') ? parseFloat(value) : null; } return input || null; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * A strategy for positioning overlays. Using this strategy, an overlay is given an * implicit position relative to some origin element. The relative position is defined in terms of * a point on the origin element that is connected to a point on the overlay element. For example, * a basic dropdown is connecting the bottom-left corner of the origin to the top-left corner * of the overlay. * @deprecated Use `FlexibleConnectedPositionStrategy` instead. * @breaking-change 8.0.0 */ class ConnectedPositionStrategy { constructor(originPos, overlayPos, connectedTo, viewportRuler, document, platform, overlayContainer) { /** Ordered list of preferred positions, from most to least desirable. */ this._preferredPositions = []; // Since the `ConnectedPositionStrategy` is deprecated and we don't want to maintain // the extra logic, we create an instance of the positioning strategy that has some // defaults that make it behave as the old position strategy and to which we'll // proxy all of the API calls. this._positionStrategy = new FlexibleConnectedPositionStrategy(connectedTo, viewportRuler, document, platform, overlayContainer) .withFlexibleDimensions(false) .withPush(false) .withViewportMargin(0); this.withFallbackPosition(originPos, overlayPos); this.onPositionChange = this._positionStrategy.positionChanges; } /** Ordered list of preferred positions, from most to least desirable. */ get positions() { return this._preferredPositions; } /** Attach this position strategy to an overlay. */ attach(overlayRef) { this._overlayRef = overlayRef; this._positionStrategy.attach(overlayRef); if (this._direction) { overlayRef.setDirection(this._direction); this._direction = null; } } /** Disposes all resources used by the position strategy. */ dispose() { this._positionStrategy.dispose(); } /** @docs-private */ detach() { this._positionStrategy.detach(); } /** * Updates the position of the overlay element, using whichever preferred position relative * to the origin fits on-screen. * @docs-private */ apply() { this._positionStrategy.apply(); } /** * Re-positions the overlay element with the trigger in its last calculated position, * even if a position higher in the "preferred positions" list would now fit. This * allows one to re-align the panel without changing the orientation of the panel. */ recalculateLastPosition() { this._positionStrategy.reapplyLastPosition(); } /** * Sets the list of Scrollable containers that host the origin element so that * on reposition we can evaluate if it or the overlay has been clipped or outside view. Every * Scrollable must be an ancestor element of the strategy's origin element. */ withScrollableContainers(scrollables) { this._positionStrategy.withScrollableContainers(scrollables); } /** * Adds a new preferred fallback position. * @param originPos * @param overlayPos */ withFallbackPosition(originPos, overlayPos, offsetX, offsetY) { const position = new ConnectionPositionPair(originPos, overlayPos, offsetX, offsetY); this._preferredPositions.push(position); this._positionStrategy.withPositions(this._preferredPositions); return this; } /** * Sets the layout direction so the overlay's position can be adjusted to match. * @param dir New layout direction. */ withDirection(dir) { // Since the direction might be declared before the strategy is attached, // we save the value in a temporary property and we'll transfer it to the // overlay ref on attachment. if (this._overlayRef) { this._overlayRef.setDirection(dir); } else { this._direction = dir; } return this; } /** * Sets an offset for the overlay's connection point on the x-axis * @param offset New offset in the X axis. */ withOffsetX(offset) { this._positionStrategy.withDefaultOffsetX(offset); return this; } /** * Sets an offset for the overlay's connection point on the y-axis * @param offset New offset in the Y axis. */ withOffsetY(offset) { this._positionStrategy.withDefaultOffsetY(offset); return this; } /** * Sets whether the overlay's position should be locked in after it is positioned * initially. When an overlay is locked in, it won't attempt to reposition itself * when the position is re-applied (e.g. when the user scrolls away). * @param isLocked Whether the overlay should locked in. */ withLockedPosition(isLocked) { this._positionStrategy.withLockedPosition(isLocked); return this; } /** * Overwrites the current set of positions with an array of new ones. * @param positions Position pairs to be set on the strategy. */ withPositions(positions) { this._preferredPositions = positions.slice(); this._positionStrategy.withPositions(this._preferredPositions); return this; } /** * Sets the origin element, relative to which to position the overlay. * @param origin Reference to the new origin element. */ setOrigin(origin) { this._positionStrategy.setOrigin(origin); return this; } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** Class to be added to the overlay pane wrapper. */ const wrapperClass = 'cdk-global-overlay-wrapper'; /** * A strategy for positioning overlays. Using this strategy, an overlay is given an * explicit position relative to the browser's viewport. We use flexbox, instead of * transforms, in order to avoid issues with subpixel rendering which can cause the * element to become blurry. */ class GlobalPositionStrategy { constructor() { this._cssPosition = 'static'; this._topOffset = ''; this._bottomOffset = ''; this._leftOffset = ''; this._rightOffset = ''; this._alignItems = ''; this._justifyContent = ''; this._width = ''; this._height = ''; } attach(overlayRef) { const config = overlayRef.getConfig(); this._overlayRef = overlayRef; if (this._width && !config.width) { overlayRef.updateSize({ width: this._width }); } if (this._height && !config.height) { overlayRef.updateSize({ height: this._height }); } overlayRef.hostElement.classList.add(wrapperClass); this._isDisposed = false; } /** * Sets the top position of the overlay. Clears any previously set vertical position. * @param value New top offset. */ top(value = '') { this._bottomOffset = ''; this._topOffset = value; this._alignItems = 'flex-start'; return this; } /** * Sets the left position of the overlay. Clears any previously set horizontal position. * @param value New left offset. */ left(value = '') { this._rightOffset = ''; this._leftOffset = value; this._justifyContent = 'flex-start'; return this; } /** * Sets the bottom position of the overlay. Clears any previously set vertical position. * @param value New bottom offset. */ bottom(value = '') { this._topOffset = ''; this._bottomOffset = value; this._alignItems = 'flex-end'; return this; } /** * Sets the right position of the overlay. Clears any previously set horizontal position. * @param value New right offset. */ right(value = '') { this._leftOffset = ''; this._rightOffset = value; this._justifyContent = 'flex-end'; return this; } /** * Sets the overlay width and clears any previously set width. * @param value New width for the overlay * @deprecated Pass the `width` through the `OverlayConfig`. * @breaking-change 8.0.0 */ width(value = '') { if (this._overlayRef) { this._overlayRef.updateSize({ width: value }); } else { this._width = value; } return this; } /** * Sets the overlay height and clears any previously set height. * @param value New height for the overlay * @deprecated Pass the `height` through the `OverlayConfig`. * @breaking-change 8.0.0 */ height(value = '') { if (this._overlayRef) { this._overlayRef.updateSize({ height: value }); } else { this._height = value; } return this; } /** * Centers the overlay horizontally with an optional offset. * Clears any previously set horizontal position. * * @param offset Overlay offset from the horizontal center. */ centerHorizontally(offset = '') { this.left(offset); this._justifyContent = 'center'; return this; } /** * Centers the overlay vertically with an optional offset. * Clears any previously set vertical position. * * @param offset Overlay offset from the vertical center. */ centerVertically(offset = '') { this.top(offset); this._alignItems = 'center'; return this; } /** * Apply the position to the element. * @docs-private */ apply() { // Since the overlay ref applies the strategy asynchronously, it could // have been disposed before it ends up being applied. If that is the // case, we shouldn't do anything. if (!this._overlayRef || !this._overlayRef.hasAttached()) { return; } const styles = this._overlayRef.overlayElement.style; const parentStyles = this._overlayRef.hostElement.style; const config = this._overlayRef.getConfig(); const { width, height, maxWidth, maxHeight } = config; const shouldBeFlushHorizontally = (width === '100%' || width === '100vw') && (!maxWidth || maxWidth === '100%' || maxWidth === '100vw'); const shouldBeFlushVertically = (height === '100%' || height === '100vh') && (!maxHeight || maxHeight === '100%' || maxHeight === '100vh'); styles.position = this._cssPosition; styles.marginLeft = shouldBeFlushHorizontally ? '0' : this._leftOffset; styles.marginTop = shouldBeFlushVertically ? '0' : this._topOffset; styles.marginBottom = this._bottomOffset; styles.marginRight = this._rightOffset; if (shouldBeFlushHorizontally) { parentStyles.justifyContent = 'flex-start'; } else if (this._justifyContent === 'center') { parentStyles.justifyContent = 'center'; } else if (this._overlayRef.getConfig().direction === 'rtl') { // In RTL the browser will invert `flex-start` and `flex-end` automatically, but we // don't want that because our positioning is explicitly `left` and `right`, hence // why we do another inversion to ensure that the overlay stays in the same position. // TODO: reconsider this if we add `start` and `end` methods. if (this._justifyContent === 'flex-start') { parentStyles.justifyContent = 'flex-end'; } else if (this._justifyContent === 'flex-end') { parentStyles.justifyContent = 'flex-start'; } } else { parentStyles.justifyContent = this._justifyContent; } parentStyles.alignItems = shouldBeFlushVertically ? 'flex-start' : this._alignItems; } /** * Cleans up the DOM changes from the position strategy. * @docs-private */ dispose() { if (this._isDisposed || !this._overlayRef) { return; } const styles = this._overlayRef.overlayElement.style; const parent = this._overlayRef.hostElement; const parentStyles = parent.style; parent.classList.remove(wrapperClass); parentStyles.justifyContent = parentStyles.alignItems = styles.marginTop = styles.marginBottom = styles.marginLeft = styles.marginRight = styles.position = ''; this._overlayRef = null; this._isDisposed = true; } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** Builder for overlay position strategy. */ class OverlayPositionBuilder { constructor(_viewportRuler, _document, _platform, _overlayContainer) { this._viewportRuler = _viewportRuler; this._document = _document; this._platform = _platform; this._overlayContainer = _overlayContainer; } /** * Creates a global position strategy. */ global() { return new GlobalPositionStrategy(); } /** * Creates a relative position strategy. * @param elementRef * @param originPos * @param overlayPos * @deprecated Use `flexibleConnectedTo` instead. * @breaking-change 8.0.0 */ connectedTo(elementRef, originPos, overlayPos) { return new ConnectedPositionStrategy(originPos, overlayPos, elementRef, this._viewportRuler, this._document, this._platform, this._overlayContainer); } /** * Creates a flexible position strategy. * @param origin Origin relative to which to position the overlay. */ flexibleConnectedTo(origin) { return new FlexibleConnectedPositionStrategy(origin, this._viewportRuler, this._document, this._platform, this._overlayContainer); } } OverlayPositionBuilder.ɵfac = function OverlayPositionBuilder_Factory(t) { return new (t || OverlayPositionBuilder)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_0__["ViewportRuler"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](OverlayContainer)); }; OverlayPositionBuilder.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjectable"])({ factory: function OverlayPositionBuilder_Factory() { return new OverlayPositionBuilder(Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_0__["ViewportRuler"]), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"]), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"]), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(OverlayContainer)); }, token: OverlayPositionBuilder, providedIn: "root" }); OverlayPositionBuilder.ctorParameters = () => [ { type: _angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_0__["ViewportRuler"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"],] }] }, { type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"] }, { type: OverlayContainer } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](OverlayPositionBuilder, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Injectable"], args: [{ providedIn: 'root' }] }], function () { return [{ type: _angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_0__["ViewportRuler"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"]] }] }, { type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"] }, { type: OverlayContainer }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** Next overlay unique ID. */ let nextUniqueId = 0; // Note that Overlay is *not* scoped to the app root because of the ComponentFactoryResolver // which needs to be different depending on where OverlayModule is imported. /** * Service to create Overlays. Overlays are dynamically added pieces of floating UI, meant to be * used as a low-level building block for other components. Dialogs, tooltips, menus, * selects, etc. can all be built using overlays. The service should primarily be used by authors * of re-usable components rather than developers building end-user applications. * * An overlay *is* a PortalOutlet, so any kind of Portal can be loaded into one. */ class Overlay { constructor( /** Scrolling strategies that can be used when creating an overlay. */ scrollStrategies, _overlayContainer, _componentFactoryResolver, _positionBuilder, _keyboardDispatcher, _injector, _ngZone, _document, _directionality, // @breaking-change 8.0.0 `_location` parameter to be made required. _location, // @breaking-change 9.0.0 `_outsideClickDispatcher` parameter to be made required. _outsideClickDispatcher) { this.scrollStrategies = scrollStrategies; this._overlayContainer = _overlayContainer; this._componentFactoryResolver = _componentFactoryResolver; this._positionBuilder = _positionBuilder; this._keyboardDispatcher = _keyboardDispatcher; this._injector = _injector; this._ngZone = _ngZone; this._document = _document; this._directionality = _directionality; this._location = _location; this._outsideClickDispatcher = _outsideClickDispatcher; } /** * Creates an overlay. * @param config Configuration applied to the overlay. * @returns Reference to the created overlay. */ create(config) { const host = this._createHostElement(); const pane = this._createPaneElement(host); const portalOutlet = this._createPortalOutlet(pane); const overlayConfig = new OverlayConfig(config); overlayConfig.direction = overlayConfig.direction || this._directionality.value; return new OverlayRef(portalOutlet, host, pane, overlayConfig, this._ngZone, this._keyboardDispatcher, this._document, this._location, this._outsideClickDispatcher); } /** * Gets a position builder that can be used, via fluent API, * to construct and configure a position strategy. * @returns An overlay position builder. */ position() { return this._positionBuilder; } /** * Creates the DOM element for an overlay and appends it to the overlay container. * @returns Newly-created pane element */ _createPaneElement(host) { const pane = this._document.createElement('div'); pane.id = `cdk-overlay-${nextUniqueId++}`; pane.classList.add('cdk-overlay-pane'); host.appendChild(pane); return pane; } /** * Creates the host element that wraps around an overlay * and can be used for advanced positioning. * @returns Newly-create host element. */ _createHostElement() { const host = this._document.createElement('div'); this._overlayContainer.getContainerElement().appendChild(host); return host; } /** * Create a DomPortalOutlet into which the overlay content can be loaded. * @param pane The DOM element to turn into a portal outlet. * @returns A portal outlet for the given DOM element. */ _createPortalOutlet(pane) { // We have to resolve the ApplicationRef later in order to allow people // to use overlay-based providers during app initialization. if (!this._appRef) { this._appRef = this._injector.get(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ApplicationRef"]); } return new _angular_cdk_portal__WEBPACK_IMPORTED_MODULE_6__["DomPortalOutlet"](pane, this._componentFactoryResolver, this._appRef, this._injector, this._document); } } Overlay.ɵfac = function Overlay_Factory(t) { return new (t || Overlay)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](ScrollStrategyOptions), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](OverlayContainer), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["ComponentFactoryResolver"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](OverlayPositionBuilder), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](OverlayKeyboardDispatcher), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["Injector"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_3__["Directionality"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_common__WEBPACK_IMPORTED_MODULE_4__["Location"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](OverlayOutsideClickDispatcher)); }; Overlay.ɵprov = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjectable"]({ token: Overlay, factory: Overlay.ɵfac }); Overlay.ctorParameters = () => [ { type: ScrollStrategyOptions }, { type: OverlayContainer }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ComponentFactoryResolver"] }, { type: OverlayPositionBuilder }, { type: OverlayKeyboardDispatcher }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Injector"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"],] }] }, { type: _angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_3__["Directionality"] }, { type: _angular_common__WEBPACK_IMPORTED_MODULE_4__["Location"] }, { type: OverlayOutsideClickDispatcher } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](Overlay, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Injectable"] }], function () { return [{ type: ScrollStrategyOptions }, { type: OverlayContainer }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ComponentFactoryResolver"] }, { type: OverlayPositionBuilder }, { type: OverlayKeyboardDispatcher }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Injector"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"]] }] }, { type: _angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_3__["Directionality"] }, { type: _angular_common__WEBPACK_IMPORTED_MODULE_4__["Location"] }, { type: OverlayOutsideClickDispatcher }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** Default set of positions for the overlay. Follows the behavior of a dropdown. */ const defaultPositionList = [ { originX: 'start', originY: 'bottom', overlayX: 'start', overlayY: 'top' }, { originX: 'start', originY: 'top', overlayX: 'start', overlayY: 'bottom' }, { originX: 'end', originY: 'top', overlayX: 'end', overlayY: 'bottom' }, { originX: 'end', originY: 'bottom', overlayX: 'end', overlayY: 'top' } ]; /** Injection token that determines the scroll handling while the connected overlay is open. */ const CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY = new _angular_core__WEBPACK_IMPORTED_MODULE_1__["InjectionToken"]('cdk-connected-overlay-scroll-strategy'); /** @docs-private @deprecated @breaking-change 8.0.0 */ function CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_FACTORY(overlay) { return (config) => overlay.scrollStrategies.reposition(config); } /** * Directive applied to an element to make it usable as an origin for an Overlay using a * ConnectedPositionStrategy. */ class CdkOverlayOrigin { constructor( /** Reference to the element on which the directive is applied. */ elementRef) { this.elementRef = elementRef; } } CdkOverlayOrigin.ɵfac = function CdkOverlayOrigin_Factory(t) { return new (t || CdkOverlayOrigin)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"])); }; CdkOverlayOrigin.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineDirective"]({ type: CdkOverlayOrigin, selectors: [["", "cdk-overlay-origin", ""], ["", "overlay-origin", ""], ["", "cdkOverlayOrigin", ""]], exportAs: ["cdkOverlayOrigin"] }); CdkOverlayOrigin.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](CdkOverlayOrigin, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Directive"], args: [{ selector: '[cdk-overlay-origin], [overlay-origin], [cdkOverlayOrigin]', exportAs: 'cdkOverlayOrigin' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"] }]; }, null); })(); /** * Directive to facilitate declarative creation of an * Overlay using a FlexibleConnectedPositionStrategy. */ class CdkConnectedOverlay { // TODO(jelbourn): inputs for size, scroll behavior, animation, etc. constructor(_overlay, templateRef, viewContainerRef, scrollStrategyFactory, _dir) { this._overlay = _overlay; this._dir = _dir; this._hasBackdrop = false; this._lockPosition = false; this._growAfterOpen = false; this._flexibleDimensions = false; this._push = false; this._backdropSubscription = rxjs__WEBPACK_IMPORTED_MODULE_7__["Subscription"].EMPTY; this._attachSubscription = rxjs__WEBPACK_IMPORTED_MODULE_7__["Subscription"].EMPTY; this._detachSubscription = rxjs__WEBPACK_IMPORTED_MODULE_7__["Subscription"].EMPTY; this._positionSubscription = rxjs__WEBPACK_IMPORTED_MODULE_7__["Subscription"].EMPTY; /** Margin between the overlay and the viewport edges. */ this.viewportMargin = 0; /** Whether the overlay is open. */ this.open = false; /** Event emitted when the backdrop is clicked. */ this.backdropClick = new _angular_core__WEBPACK_IMPORTED_MODULE_1__["EventEmitter"](); /** Event emitted when the position has changed. */ this.positionChange = new _angular_core__WEBPACK_IMPORTED_MODULE_1__["EventEmitter"](); /** Event emitted when the overlay has been attached. */ this.attach = new _angular_core__WEBPACK_IMPORTED_MODULE_1__["EventEmitter"](); /** Event emitted when the overlay has been detached. */ this.detach = new _angular_core__WEBPACK_IMPORTED_MODULE_1__["EventEmitter"](); /** Emits when there are keyboard events that are targeted at the overlay. */ this.overlayKeydown = new _angular_core__WEBPACK_IMPORTED_MODULE_1__["EventEmitter"](); /** Emits when there are mouse outside click events that are targeted at the overlay. */ this.overlayOutsideClick = new _angular_core__WEBPACK_IMPORTED_MODULE_1__["EventEmitter"](); this._templatePortal = new _angular_cdk_portal__WEBPACK_IMPORTED_MODULE_6__["TemplatePortal"](templateRef, viewContainerRef); this._scrollStrategyFactory = scrollStrategyFactory; this.scrollStrategy = this._scrollStrategyFactory(); } /** The offset in pixels for the overlay connection point on the x-axis */ get offsetX() { return this._offsetX; } set offsetX(offsetX) { this._offsetX = offsetX; if (this._position) { this._updatePositionStrategy(this._position); } } /** The offset in pixels for the overlay connection point on the y-axis */ get offsetY() { return this._offsetY; } set offsetY(offsetY) { this._offsetY = offsetY; if (this._position) { this._updatePositionStrategy(this._position); } } /** Whether or not the overlay should attach a backdrop. */ get hasBackdrop() { return this._hasBackdrop; } set hasBackdrop(value) { this._hasBackdrop = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceBooleanProperty"])(value); } /** Whether or not the overlay should be locked when scrolling. */ get lockPosition() { return this._lockPosition; } set lockPosition(value) { this._lockPosition = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceBooleanProperty"])(value); } /** Whether the overlay's width and height can be constrained to fit within the viewport. */ get flexibleDimensions() { return this._flexibleDimensions; } set flexibleDimensions(value) { this._flexibleDimensions = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceBooleanProperty"])(value); } /** Whether the overlay can grow after the initial open when flexible positioning is turned on. */ get growAfterOpen() { return this._growAfterOpen; } set growAfterOpen(value) { this._growAfterOpen = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceBooleanProperty"])(value); } /** Whether the overlay can be pushed on-screen if none of the provided positions fit. */ get push() { return this._push; } set push(value) { this._push = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_5__["coerceBooleanProperty"])(value); } /** The associated overlay reference. */ get overlayRef() { return this._overlayRef; } /** The element's layout direction. */ get dir() { return this._dir ? this._dir.value : 'ltr'; } ngOnDestroy() { this._attachSubscription.unsubscribe(); this._detachSubscription.unsubscribe(); this._backdropSubscription.unsubscribe(); this._positionSubscription.unsubscribe(); if (this._overlayRef) { this._overlayRef.dispose(); } } ngOnChanges(changes) { if (this._position) { this._updatePositionStrategy(this._position); this._overlayRef.updateSize({ width: this.width, minWidth: this.minWidth, height: this.height, minHeight: this.minHeight, }); if (changes['origin'] && this.open) { this._position.apply(); } } if (changes['open']) { this.open ? this._attachOverlay() : this._detachOverlay(); } } /** Creates an overlay */ _createOverlay() { if (!this.positions || !this.positions.length) { this.positions = defaultPositionList; } const overlayRef = this._overlayRef = this._overlay.create(this._buildConfig()); this._attachSubscription = overlayRef.attachments().subscribe(() => this.attach.emit()); this._detachSubscription = overlayRef.detachments().subscribe(() => this.detach.emit()); overlayRef.keydownEvents().subscribe((event) => { this.overlayKeydown.next(event); if (event.keyCode === _angular_cdk_keycodes__WEBPACK_IMPORTED_MODULE_9__["ESCAPE"] && !Object(_angular_cdk_keycodes__WEBPACK_IMPORTED_MODULE_9__["hasModifierKey"])(event)) { event.preventDefault(); this._detachOverlay(); } }); this._overlayRef.outsidePointerEvents().subscribe((event) => { this.overlayOutsideClick.next(event); }); } /** Builds the overlay config based on the directive's inputs */ _buildConfig() { const positionStrategy = this._position = this.positionStrategy || this._createPositionStrategy(); const overlayConfig = new OverlayConfig({ direction: this._dir, positionStrategy, scrollStrategy: this.scrollStrategy, hasBackdrop: this.hasBackdrop }); if (this.width || this.width === 0) { overlayConfig.width = this.width; } if (this.height || this.height === 0) { overlayConfig.height = this.height; } if (this.minWidth || this.minWidth === 0) { overlayConfig.minWidth = this.minWidth; } if (this.minHeight || this.minHeight === 0) { overlayConfig.minHeight = this.minHeight; } if (this.backdropClass) { overlayConfig.backdropClass = this.backdropClass; } if (this.panelClass) { overlayConfig.panelClass = this.panelClass; } return overlayConfig; } /** Updates the state of a position strategy, based on the values of the directive inputs. */ _updatePositionStrategy(positionStrategy) { const positions = this.positions.map(currentPosition => ({ originX: currentPosition.originX, originY: currentPosition.originY, overlayX: currentPosition.overlayX, overlayY: currentPosition.overlayY, offsetX: currentPosition.offsetX || this.offsetX, offsetY: currentPosition.offsetY || this.offsetY, panelClass: currentPosition.panelClass || undefined, })); return positionStrategy .setOrigin(this.origin.elementRef) .withPositions(positions) .withFlexibleDimensions(this.flexibleDimensions) .withPush(this.push) .withGrowAfterOpen(this.growAfterOpen) .withViewportMargin(this.viewportMargin) .withLockedPosition(this.lockPosition) .withTransformOriginOn(this.transformOriginSelector); } /** Returns the position strategy of the overlay to be set on the overlay config */ _createPositionStrategy() { const strategy = this._overlay.position().flexibleConnectedTo(this.origin.elementRef); this._updatePositionStrategy(strategy); return strategy; } /** Attaches the overlay and subscribes to backdrop clicks if backdrop exists */ _attachOverlay() { if (!this._overlayRef) { this._createOverlay(); } else { // Update the overlay size, in case the directive's inputs have changed this._overlayRef.getConfig().hasBackdrop = this.hasBackdrop; } if (!this._overlayRef.hasAttached()) { this._overlayRef.attach(this._templatePortal); } if (this.hasBackdrop) { this._backdropSubscription = this._overlayRef.backdropClick().subscribe(event => { this.backdropClick.emit(event); }); } else { this._backdropSubscription.unsubscribe(); } this._positionSubscription.unsubscribe(); // Only subscribe to `positionChanges` if requested, because putting // together all the information for it can be expensive. if (this.positionChange.observers.length > 0) { this._positionSubscription = this._position.positionChanges .pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_8__["takeWhile"])(() => this.positionChange.observers.length > 0)) .subscribe(position => { this.positionChange.emit(position); if (this.positionChange.observers.length === 0) { this._positionSubscription.unsubscribe(); } }); } } /** Detaches the overlay and unsubscribes to backdrop clicks if backdrop exists */ _detachOverlay() { if (this._overlayRef) { this._overlayRef.detach(); } this._backdropSubscription.unsubscribe(); this._positionSubscription.unsubscribe(); } } CdkConnectedOverlay.ɵfac = function CdkConnectedOverlay_Factory(t) { return new (t || CdkConnectedOverlay)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](Overlay), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["TemplateRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["ViewContainerRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_3__["Directionality"], 8)); }; CdkConnectedOverlay.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineDirective"]({ type: CdkConnectedOverlay, selectors: [["", "cdk-connected-overlay", ""], ["", "connected-overlay", ""], ["", "cdkConnectedOverlay", ""]], inputs: { viewportMargin: ["cdkConnectedOverlayViewportMargin", "viewportMargin"], open: ["cdkConnectedOverlayOpen", "open"], scrollStrategy: ["cdkConnectedOverlayScrollStrategy", "scrollStrategy"], offsetX: ["cdkConnectedOverlayOffsetX", "offsetX"], offsetY: ["cdkConnectedOverlayOffsetY", "offsetY"], hasBackdrop: ["cdkConnectedOverlayHasBackdrop", "hasBackdrop"], lockPosition: ["cdkConnectedOverlayLockPosition", "lockPosition"], flexibleDimensions: ["cdkConnectedOverlayFlexibleDimensions", "flexibleDimensions"], growAfterOpen: ["cdkConnectedOverlayGrowAfterOpen", "growAfterOpen"], push: ["cdkConnectedOverlayPush", "push"], positions: ["cdkConnectedOverlayPositions", "positions"], origin: ["cdkConnectedOverlayOrigin", "origin"], positionStrategy: ["cdkConnectedOverlayPositionStrategy", "positionStrategy"], width: ["cdkConnectedOverlayWidth", "width"], height: ["cdkConnectedOverlayHeight", "height"], minWidth: ["cdkConnectedOverlayMinWidth", "minWidth"], minHeight: ["cdkConnectedOverlayMinHeight", "minHeight"], backdropClass: ["cdkConnectedOverlayBackdropClass", "backdropClass"], panelClass: ["cdkConnectedOverlayPanelClass", "panelClass"], transformOriginSelector: ["cdkConnectedOverlayTransformOriginOn", "transformOriginSelector"] }, outputs: { backdropClick: "backdropClick", positionChange: "positionChange", attach: "attach", detach: "detach", overlayKeydown: "overlayKeydown", overlayOutsideClick: "overlayOutsideClick" }, exportAs: ["cdkConnectedOverlay"], features: [_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵNgOnChangesFeature"]] }); CdkConnectedOverlay.ctorParameters = () => [ { type: Overlay }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["TemplateRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ViewContainerRef"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY,] }] }, { type: _angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_3__["Directionality"], decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"] }] } ]; CdkConnectedOverlay.propDecorators = { origin: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayOrigin',] }], positions: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayPositions',] }], positionStrategy: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayPositionStrategy',] }], offsetX: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayOffsetX',] }], offsetY: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayOffsetY',] }], width: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayWidth',] }], height: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayHeight',] }], minWidth: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayMinWidth',] }], minHeight: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayMinHeight',] }], backdropClass: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayBackdropClass',] }], panelClass: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayPanelClass',] }], viewportMargin: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayViewportMargin',] }], scrollStrategy: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayScrollStrategy',] }], open: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayOpen',] }], transformOriginSelector: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayTransformOriginOn',] }], hasBackdrop: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayHasBackdrop',] }], lockPosition: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayLockPosition',] }], flexibleDimensions: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayFlexibleDimensions',] }], growAfterOpen: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayGrowAfterOpen',] }], push: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayPush',] }], backdropClick: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Output"] }], positionChange: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Output"] }], attach: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Output"] }], detach: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Output"] }], overlayKeydown: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Output"] }], overlayOutsideClick: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Output"] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](CdkConnectedOverlay, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Directive"], args: [{ selector: '[cdk-connected-overlay], [connected-overlay], [cdkConnectedOverlay]', exportAs: 'cdkConnectedOverlay' }] }], function () { return [{ type: Overlay }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["TemplateRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ViewContainerRef"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY] }] }, { type: _angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_3__["Directionality"], decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"] }] }]; }, { viewportMargin: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayViewportMargin'] }], open: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayOpen'] }], backdropClick: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Output"] }], positionChange: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Output"] }], attach: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Output"] }], detach: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Output"] }], overlayKeydown: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Output"] }], overlayOutsideClick: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Output"] }], scrollStrategy: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayScrollStrategy'] }], offsetX: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayOffsetX'] }], offsetY: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayOffsetY'] }], hasBackdrop: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayHasBackdrop'] }], lockPosition: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayLockPosition'] }], flexibleDimensions: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayFlexibleDimensions'] }], growAfterOpen: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayGrowAfterOpen'] }], push: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayPush'] }], positions: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayPositions'] }], origin: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayOrigin'] }], positionStrategy: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayPositionStrategy'] }], width: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayWidth'] }], height: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayHeight'] }], minWidth: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayMinWidth'] }], minHeight: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayMinHeight'] }], backdropClass: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayBackdropClass'] }], panelClass: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayPanelClass'] }], transformOriginSelector: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkConnectedOverlayTransformOriginOn'] }] }); })(); /** @docs-private */ function CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER_FACTORY(overlay) { return () => overlay.scrollStrategies.reposition(); } /** @docs-private */ const CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER = { provide: CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY, deps: [Overlay], useFactory: CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER_FACTORY, }; /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ class OverlayModule { } OverlayModule.ɵmod = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineNgModule"]({ type: OverlayModule }); OverlayModule.ɵinj = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjector"]({ factory: function OverlayModule_Factory(t) { return new (t || OverlayModule)(); }, providers: [ Overlay, CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER, ], imports: [[_angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_3__["BidiModule"], _angular_cdk_portal__WEBPACK_IMPORTED_MODULE_6__["PortalModule"], _angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_0__["ScrollingModule"]], _angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_0__["ScrollingModule"]] }); (function () { (typeof ngJitMode === "undefined" || ngJitMode) && _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵsetNgModuleScope"](OverlayModule, { declarations: function () { return [CdkConnectedOverlay, CdkOverlayOrigin]; }, imports: function () { return [_angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_3__["BidiModule"], _angular_cdk_portal__WEBPACK_IMPORTED_MODULE_6__["PortalModule"], _angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_0__["ScrollingModule"]]; }, exports: function () { return [CdkConnectedOverlay, CdkOverlayOrigin, _angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_0__["ScrollingModule"]]; } }); })(); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](OverlayModule, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgModule"], args: [{ imports: [_angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_3__["BidiModule"], _angular_cdk_portal__WEBPACK_IMPORTED_MODULE_6__["PortalModule"], _angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_0__["ScrollingModule"]], exports: [CdkConnectedOverlay, CdkOverlayOrigin, _angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_0__["ScrollingModule"]], declarations: [CdkConnectedOverlay, CdkOverlayOrigin], providers: [ Overlay, CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER, ] }] }], null, null); })(); /** * @deprecated Use `OverlayModule` instead. * @breaking-change 8.0.0 * @docs-private */ const OVERLAY_PROVIDERS = [ Overlay, OverlayPositionBuilder, OVERLAY_KEYBOARD_DISPATCHER_PROVIDER, OVERLAY_CONTAINER_PROVIDER, CDK_CONNECTED_OVERLAY_SCROLL_STRATEGY_PROVIDER, ]; /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Alternative to OverlayContainer that supports correct displaying of overlay elements in * Fullscreen mode * https://developer.mozilla.org/en-US/docs/Web/API/Element/requestFullScreen * * Should be provided in the root component. */ class FullscreenOverlayContainer extends OverlayContainer { constructor(_document, /** * @deprecated `platform` parameter to become required. * @breaking-change 10.0.0 */ platform) { super(_document, platform); } ngOnDestroy() { super.ngOnDestroy(); if (this._fullScreenEventName && this._fullScreenListener) { this._document.removeEventListener(this._fullScreenEventName, this._fullScreenListener); } } _createContainer() { super._createContainer(); this._adjustParentForFullscreenChange(); this._addFullscreenChangeListener(() => this._adjustParentForFullscreenChange()); } _adjustParentForFullscreenChange() { if (!this._containerElement) { return; } const fullscreenElement = this.getFullscreenElement(); const parent = fullscreenElement || this._document.body; parent.appendChild(this._containerElement); } _addFullscreenChangeListener(fn) { const eventName = this._getEventName(); if (eventName) { if (this._fullScreenListener) { this._document.removeEventListener(eventName, this._fullScreenListener); } this._document.addEventListener(eventName, fn); this._fullScreenListener = fn; } } _getEventName() { if (!this._fullScreenEventName) { const _document = this._document; if (_document.fullscreenEnabled) { this._fullScreenEventName = 'fullscreenchange'; } else if (_document.webkitFullscreenEnabled) { this._fullScreenEventName = 'webkitfullscreenchange'; } else if (_document.mozFullScreenEnabled) { this._fullScreenEventName = 'mozfullscreenchange'; } else if (_document.msFullscreenEnabled) { this._fullScreenEventName = 'MSFullscreenChange'; } } return this._fullScreenEventName; } /** * When the page is put into fullscreen mode, a specific element is specified. * Only that element and its children are visible when in fullscreen mode. */ getFullscreenElement() { const _document = this._document; return _document.fullscreenElement || _document.webkitFullscreenElement || _document.mozFullScreenElement || _document.msFullscreenElement || null; } } FullscreenOverlayContainer.ɵfac = function FullscreenOverlayContainer_Factory(t) { return new (t || FullscreenOverlayContainer)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"])); }; FullscreenOverlayContainer.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjectable"])({ factory: function FullscreenOverlayContainer_Factory() { return new FullscreenOverlayContainer(Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"]), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"])); }, token: FullscreenOverlayContainer, providedIn: "root" }); FullscreenOverlayContainer.ctorParameters = () => [ { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"],] }] }, { type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](FullscreenOverlayContainer, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Injectable"], args: [{ providedIn: 'root' }] }], function () { return [{ type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_4__["DOCUMENT"]] }] }, { type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_2__["Platform"] }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Generated bundle index. Do not edit. */ //# sourceMappingURL=overlay.js.map /***/ }), /***/ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/platform.js": /*!*********************************************************************!*\ !*** ./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/platform.js ***! \*********************************************************************/ /*! exports provided: Platform, PlatformModule, _getShadowRoot, _supportsShadowDom, getRtlScrollAxisType, getSupportedInputTypes, normalizePassiveListenerOptions, supportsPassiveEventListeners, supportsScrollBehavior */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; __webpack_require__.r(__webpack_exports__); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "Platform", function() { return Platform; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "PlatformModule", function() { return PlatformModule; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "_getShadowRoot", function() { return _getShadowRoot; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "_supportsShadowDom", function() { return _supportsShadowDom; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getRtlScrollAxisType", function() { return getRtlScrollAxisType; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getSupportedInputTypes", function() { return getSupportedInputTypes; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "normalizePassiveListenerOptions", function() { return normalizePassiveListenerOptions; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "supportsPassiveEventListeners", function() { return supportsPassiveEventListeners; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "supportsScrollBehavior", function() { return supportsScrollBehavior; }); /* harmony import */ var _angular_core__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @angular/core */ "./node_modules/@angular/core/__ivy_ngcc__/fesm2015/core.js"); /* harmony import */ var _angular_common__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! @angular/common */ "./node_modules/@angular/common/__ivy_ngcc__/fesm2015/common.js"); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ // Whether the current platform supports the V8 Break Iterator. The V8 check // is necessary to detect all Blink based browsers. let hasV8BreakIterator; // We need a try/catch around the reference to `Intl`, because accessing it in some cases can // cause IE to throw. These cases are tied to particular versions of Windows and can happen if // the consumer is providing a polyfilled `Map`. See: // https://github.com/Microsoft/ChakraCore/issues/3189 // https://github.com/angular/components/issues/15687 try { hasV8BreakIterator = (typeof Intl !== 'undefined' && Intl.v8BreakIterator); } catch (_a) { hasV8BreakIterator = false; } /** * Service to detect the current platform by comparing the userAgent strings and * checking browser-specific global properties. */ class Platform { constructor(_platformId) { this._platformId = _platformId; // We want to use the Angular platform check because if the Document is shimmed // without the navigator, the following checks will fail. This is preferred because // sometimes the Document may be shimmed without the user's knowledge or intention /** Whether the Angular application is being rendered in the browser. */ this.isBrowser = this._platformId ? Object(_angular_common__WEBPACK_IMPORTED_MODULE_1__["isPlatformBrowser"])(this._platformId) : typeof document === 'object' && !!document; /** Whether the current browser is Microsoft Edge. */ this.EDGE = this.isBrowser && /(edge)/i.test(navigator.userAgent); /** Whether the current rendering engine is Microsoft Trident. */ this.TRIDENT = this.isBrowser && /(msie|trident)/i.test(navigator.userAgent); // EdgeHTML and Trident mock Blink specific things and need to be excluded from this check. /** Whether the current rendering engine is Blink. */ this.BLINK = this.isBrowser && (!!(window.chrome || hasV8BreakIterator) && typeof CSS !== 'undefined' && !this.EDGE && !this.TRIDENT); // Webkit is part of the userAgent in EdgeHTML, Blink and Trident. Therefore we need to // ensure that Webkit runs standalone and is not used as another engine's base. /** Whether the current rendering engine is WebKit. */ this.WEBKIT = this.isBrowser && /AppleWebKit/i.test(navigator.userAgent) && !this.BLINK && !this.EDGE && !this.TRIDENT; /** Whether the current platform is Apple iOS. */ this.IOS = this.isBrowser && /iPad|iPhone|iPod/.test(navigator.userAgent) && !('MSStream' in window); // It's difficult to detect the plain Gecko engine, because most of the browsers identify // them self as Gecko-like browsers and modify the userAgent's according to that. // Since we only cover one explicit Firefox case, we can simply check for Firefox // instead of having an unstable check for Gecko. /** Whether the current browser is Firefox. */ this.FIREFOX = this.isBrowser && /(firefox|minefield)/i.test(navigator.userAgent); /** Whether the current platform is Android. */ // Trident on mobile adds the android platform to the userAgent to trick detections. this.ANDROID = this.isBrowser && /android/i.test(navigator.userAgent) && !this.TRIDENT; // Safari browsers will include the Safari keyword in their userAgent. Some browsers may fake // this and just place the Safari keyword in the userAgent. To be more safe about Safari every // Safari browser should also use Webkit as its layout engine. /** Whether the current browser is Safari. */ this.SAFARI = this.isBrowser && /safari/i.test(navigator.userAgent) && this.WEBKIT; } } Platform.ɵfac = function Platform_Factory(t) { return new (t || Platform)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["PLATFORM_ID"])); }; Platform.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"])({ factory: function Platform_Factory() { return new Platform(Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(_angular_core__WEBPACK_IMPORTED_MODULE_0__["PLATFORM_ID"])); }, token: Platform, providedIn: "root" }); Platform.ctorParameters = () => [ { type: Object, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Inject"], args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["PLATFORM_ID"],] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](Platform, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Injectable"], args: [{ providedIn: 'root' }] }], function () { return [{ type: Object, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Inject"], args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["PLATFORM_ID"]] }] }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ class PlatformModule { } PlatformModule.ɵmod = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineNgModule"]({ type: PlatformModule }); PlatformModule.ɵinj = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjector"]({ factory: function PlatformModule_Factory(t) { return new (t || PlatformModule)(); } }); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](PlatformModule, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["NgModule"], args: [{}] }], null, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** Cached result Set of input types support by the current browser. */ let supportedInputTypes; /** Types of `` that *might* be supported. */ const candidateInputTypes = [ // `color` must come first. Chrome 56 shows a warning if we change the type to `color` after // first changing it to something else: // The specified value "" does not conform to the required format. // The format is "#rrggbb" where rr, gg, bb are two-digit hexadecimal numbers. 'color', 'button', 'checkbox', 'date', 'datetime-local', 'email', 'file', 'hidden', 'image', 'month', 'number', 'password', 'radio', 'range', 'reset', 'search', 'submit', 'tel', 'text', 'time', 'url', 'week', ]; /** @returns The input types supported by this browser. */ function getSupportedInputTypes() { // Result is cached. if (supportedInputTypes) { return supportedInputTypes; } // We can't check if an input type is not supported until we're on the browser, so say that // everything is supported when not on the browser. We don't use `Platform` here since it's // just a helper function and can't inject it. if (typeof document !== 'object' || !document) { supportedInputTypes = new Set(candidateInputTypes); return supportedInputTypes; } let featureTestInput = document.createElement('input'); supportedInputTypes = new Set(candidateInputTypes.filter(value => { featureTestInput.setAttribute('type', value); return featureTestInput.type === value; })); return supportedInputTypes; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** Cached result of whether the user's browser supports passive event listeners. */ let supportsPassiveEvents; /** * Checks whether the user's browser supports passive event listeners. * See: https://github.com/WICG/EventListenerOptions/blob/gh-pages/explainer.md */ function supportsPassiveEventListeners() { if (supportsPassiveEvents == null && typeof window !== 'undefined') { try { window.addEventListener('test', null, Object.defineProperty({}, 'passive', { get: () => supportsPassiveEvents = true })); } finally { supportsPassiveEvents = supportsPassiveEvents || false; } } return supportsPassiveEvents; } /** * Normalizes an `AddEventListener` object to something that can be passed * to `addEventListener` on any browser, no matter whether it supports the * `options` parameter. * @param options Object to be normalized. */ function normalizePassiveListenerOptions(options) { return supportsPassiveEventListeners() ? options : !!options.capture; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** Cached result of the way the browser handles the horizontal scroll axis in RTL mode. */ let rtlScrollAxisType; /** Cached result of the check that indicates whether the browser supports scroll behaviors. */ let scrollBehaviorSupported; /** Check whether the browser supports scroll behaviors. */ function supportsScrollBehavior() { if (scrollBehaviorSupported == null) { // If we're not in the browser, it can't be supported. if (typeof document !== 'object' || !document) { scrollBehaviorSupported = false; } // If the element can have a `scrollBehavior` style, we can be sure that it's supported. if ('scrollBehavior' in document.documentElement.style) { scrollBehaviorSupported = true; } else { // At this point we have 3 possibilities: `scrollTo` isn't supported at all, it's // supported but it doesn't handle scroll behavior, or it has been polyfilled. const scrollToFunction = Element.prototype.scrollTo; if (scrollToFunction) { // We can detect if the function has been polyfilled by calling `toString` on it. Native // functions are obfuscated using `[native code]`, whereas if it was overwritten we'd get // the actual function source. Via https://davidwalsh.name/detect-native-function. Consider // polyfilled functions as supporting scroll behavior. scrollBehaviorSupported = !/\{\s*\[native code\]\s*\}/.test(scrollToFunction.toString()); } else { scrollBehaviorSupported = false; } } } return scrollBehaviorSupported; } /** * Checks the type of RTL scroll axis used by this browser. As of time of writing, Chrome is NORMAL, * Firefox & Safari are NEGATED, and IE & Edge are INVERTED. */ function getRtlScrollAxisType() { // We can't check unless we're on the browser. Just assume 'normal' if we're not. if (typeof document !== 'object' || !document) { return 0 /* NORMAL */; } if (rtlScrollAxisType == null) { // Create a 1px wide scrolling container and a 2px wide content element. const scrollContainer = document.createElement('div'); const containerStyle = scrollContainer.style; scrollContainer.dir = 'rtl'; containerStyle.width = '1px'; containerStyle.overflow = 'auto'; containerStyle.visibility = 'hidden'; containerStyle.pointerEvents = 'none'; containerStyle.position = 'absolute'; const content = document.createElement('div'); const contentStyle = content.style; contentStyle.width = '2px'; contentStyle.height = '1px'; scrollContainer.appendChild(content); document.body.appendChild(scrollContainer); rtlScrollAxisType = 0 /* NORMAL */; // The viewport starts scrolled all the way to the right in RTL mode. If we are in a NORMAL // browser this would mean that the scrollLeft should be 1. If it's zero instead we know we're // dealing with one of the other two types of browsers. if (scrollContainer.scrollLeft === 0) { // In a NEGATED browser the scrollLeft is always somewhere in [-maxScrollAmount, 0]. For an // INVERTED browser it is always somewhere in [0, maxScrollAmount]. We can determine which by // setting to the scrollLeft to 1. This is past the max for a NEGATED browser, so it will // return 0 when we read it again. scrollContainer.scrollLeft = 1; rtlScrollAxisType = scrollContainer.scrollLeft === 0 ? 1 /* NEGATED */ : 2 /* INVERTED */; } scrollContainer.parentNode.removeChild(scrollContainer); } return rtlScrollAxisType; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ let shadowDomIsSupported; /** Checks whether the user's browser support Shadow DOM. */ function _supportsShadowDom() { if (shadowDomIsSupported == null) { const head = typeof document !== 'undefined' ? document.head : null; shadowDomIsSupported = !!(head && (head.createShadowRoot || head.attachShadow)); } return shadowDomIsSupported; } /** Gets the shadow root of an element, if supported and the element is inside the Shadow DOM. */ function _getShadowRoot(element) { if (_supportsShadowDom()) { const rootNode = element.getRootNode ? element.getRootNode() : null; // Note that this should be caught by `_supportsShadowDom`, but some // teams have been able to hit this code path on unsupported browsers. if (typeof ShadowRoot !== 'undefined' && ShadowRoot && rootNode instanceof ShadowRoot) { return rootNode; } } return null; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Generated bundle index. Do not edit. */ //# sourceMappingURL=platform.js.map /***/ }), /***/ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/portal.js": /*!*******************************************************************!*\ !*** ./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/portal.js ***! \*******************************************************************/ /*! exports provided: BasePortalHost, BasePortalOutlet, CdkPortal, CdkPortalOutlet, ComponentPortal, DomPortal, DomPortalHost, DomPortalOutlet, Portal, PortalHostDirective, PortalInjector, PortalModule, TemplatePortal, TemplatePortalDirective */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; __webpack_require__.r(__webpack_exports__); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "BasePortalHost", function() { return BasePortalHost; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "BasePortalOutlet", function() { return BasePortalOutlet; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkPortal", function() { return CdkPortal; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkPortalOutlet", function() { return CdkPortalOutlet; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ComponentPortal", function() { return ComponentPortal; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "DomPortal", function() { return DomPortal; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "DomPortalHost", function() { return DomPortalHost; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "DomPortalOutlet", function() { return DomPortalOutlet; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "Portal", function() { return Portal; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "PortalHostDirective", function() { return PortalHostDirective; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "PortalInjector", function() { return PortalInjector; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "PortalModule", function() { return PortalModule; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "TemplatePortal", function() { return TemplatePortal; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "TemplatePortalDirective", function() { return TemplatePortalDirective; }); /* harmony import */ var _angular_core__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @angular/core */ "./node_modules/@angular/core/__ivy_ngcc__/fesm2015/core.js"); /* harmony import */ var _angular_common__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! @angular/common */ "./node_modules/@angular/common/__ivy_ngcc__/fesm2015/common.js"); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Throws an exception when attempting to attach a null portal to a host. * @docs-private */ function throwNullPortalError() { throw Error('Must provide a portal to attach'); } /** * Throws an exception when attempting to attach a portal to a host that is already attached. * @docs-private */ function throwPortalAlreadyAttachedError() { throw Error('Host already has a portal attached'); } /** * Throws an exception when attempting to attach a portal to an already-disposed host. * @docs-private */ function throwPortalOutletAlreadyDisposedError() { throw Error('This PortalOutlet has already been disposed'); } /** * Throws an exception when attempting to attach an unknown portal type. * @docs-private */ function throwUnknownPortalTypeError() { throw Error('Attempting to attach an unknown Portal type. BasePortalOutlet accepts either ' + 'a ComponentPortal or a TemplatePortal.'); } /** * Throws an exception when attempting to attach a portal to a null host. * @docs-private */ function throwNullPortalOutletError() { throw Error('Attempting to attach a portal to a null PortalOutlet'); } /** * Throws an exception when attempting to detach a portal that is not attached. * @docs-private */ function throwNoPortalAttachedError() { throw Error('Attempting to detach a portal that is not attached to a host'); } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * A `Portal` is something that you want to render somewhere else. * It can be attach to / detached from a `PortalOutlet`. */ class Portal { /** Attach this portal to a host. */ attach(host) { if (typeof ngDevMode === 'undefined' || ngDevMode) { if (host == null) { throwNullPortalOutletError(); } if (host.hasAttached()) { throwPortalAlreadyAttachedError(); } } this._attachedHost = host; return host.attach(this); } /** Detach this portal from its host */ detach() { let host = this._attachedHost; if (host != null) { this._attachedHost = null; host.detach(); } else if (typeof ngDevMode === 'undefined' || ngDevMode) { throwNoPortalAttachedError(); } } /** Whether this portal is attached to a host. */ get isAttached() { return this._attachedHost != null; } /** * Sets the PortalOutlet reference without performing `attach()`. This is used directly by * the PortalOutlet when it is performing an `attach()` or `detach()`. */ setAttachedHost(host) { this._attachedHost = host; } } /** * A `ComponentPortal` is a portal that instantiates some Component upon attachment. */ class ComponentPortal extends Portal { constructor(component, viewContainerRef, injector, componentFactoryResolver) { super(); this.component = component; this.viewContainerRef = viewContainerRef; this.injector = injector; this.componentFactoryResolver = componentFactoryResolver; } } /** * A `TemplatePortal` is a portal that represents some embedded template (TemplateRef). */ class TemplatePortal extends Portal { constructor(template, viewContainerRef, context) { super(); this.templateRef = template; this.viewContainerRef = viewContainerRef; this.context = context; } get origin() { return this.templateRef.elementRef; } /** * Attach the portal to the provided `PortalOutlet`. * When a context is provided it will override the `context` property of the `TemplatePortal` * instance. */ attach(host, context = this.context) { this.context = context; return super.attach(host); } detach() { this.context = undefined; return super.detach(); } } /** * A `DomPortal` is a portal whose DOM element will be taken from its current position * in the DOM and moved into a portal outlet, when it is attached. On detach, the content * will be restored to its original position. */ class DomPortal extends Portal { constructor(element) { super(); this.element = element instanceof _angular_core__WEBPACK_IMPORTED_MODULE_0__["ElementRef"] ? element.nativeElement : element; } } /** * Partial implementation of PortalOutlet that handles attaching * ComponentPortal and TemplatePortal. */ class BasePortalOutlet { constructor() { /** Whether this host has already been permanently disposed. */ this._isDisposed = false; // @breaking-change 10.0.0 `attachDomPortal` to become a required abstract method. this.attachDomPortal = null; } /** Whether this host has an attached portal. */ hasAttached() { return !!this._attachedPortal; } /** Attaches a portal. */ attach(portal) { if (typeof ngDevMode === 'undefined' || ngDevMode) { if (!portal) { throwNullPortalError(); } if (this.hasAttached()) { throwPortalAlreadyAttachedError(); } if (this._isDisposed) { throwPortalOutletAlreadyDisposedError(); } } if (portal instanceof ComponentPortal) { this._attachedPortal = portal; return this.attachComponentPortal(portal); } else if (portal instanceof TemplatePortal) { this._attachedPortal = portal; return this.attachTemplatePortal(portal); // @breaking-change 10.0.0 remove null check for `this.attachDomPortal`. } else if (this.attachDomPortal && portal instanceof DomPortal) { this._attachedPortal = portal; return this.attachDomPortal(portal); } if (typeof ngDevMode === 'undefined' || ngDevMode) { throwUnknownPortalTypeError(); } } /** Detaches a previously attached portal. */ detach() { if (this._attachedPortal) { this._attachedPortal.setAttachedHost(null); this._attachedPortal = null; } this._invokeDisposeFn(); } /** Permanently dispose of this portal host. */ dispose() { if (this.hasAttached()) { this.detach(); } this._invokeDisposeFn(); this._isDisposed = true; } /** @docs-private */ setDisposeFn(fn) { this._disposeFn = fn; } _invokeDisposeFn() { if (this._disposeFn) { this._disposeFn(); this._disposeFn = null; } } } /** * @deprecated Use `BasePortalOutlet` instead. * @breaking-change 9.0.0 */ class BasePortalHost extends BasePortalOutlet { } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * A PortalOutlet for attaching portals to an arbitrary DOM element outside of the Angular * application context. */ class DomPortalOutlet extends BasePortalOutlet { constructor( /** Element into which the content is projected. */ outletElement, _componentFactoryResolver, _appRef, _defaultInjector, /** * @deprecated `_document` Parameter to be made required. * @breaking-change 10.0.0 */ _document) { super(); this.outletElement = outletElement; this._componentFactoryResolver = _componentFactoryResolver; this._appRef = _appRef; this._defaultInjector = _defaultInjector; /** * Attaches a DOM portal by transferring its content into the outlet. * @param portal Portal to be attached. * @deprecated To be turned into a method. * @breaking-change 10.0.0 */ this.attachDomPortal = (portal) => { // @breaking-change 10.0.0 Remove check and error once the // `_document` constructor parameter is required. if (!this._document && (typeof ngDevMode === 'undefined' || ngDevMode)) { throw Error('Cannot attach DOM portal without _document constructor parameter'); } const element = portal.element; if (!element.parentNode && (typeof ngDevMode === 'undefined' || ngDevMode)) { throw Error('DOM portal content must be attached to a parent node.'); } // Anchor used to save the element's previous position so // that we can restore it when the portal is detached. const anchorNode = this._document.createComment('dom-portal'); element.parentNode.insertBefore(anchorNode, element); this.outletElement.appendChild(element); super.setDisposeFn(() => { // We can't use `replaceWith` here because IE doesn't support it. if (anchorNode.parentNode) { anchorNode.parentNode.replaceChild(element, anchorNode); } }); }; this._document = _document; } /** * Attach the given ComponentPortal to DOM element using the ComponentFactoryResolver. * @param portal Portal to be attached * @returns Reference to the created component. */ attachComponentPortal(portal) { const resolver = portal.componentFactoryResolver || this._componentFactoryResolver; const componentFactory = resolver.resolveComponentFactory(portal.component); let componentRef; // If the portal specifies a ViewContainerRef, we will use that as the attachment point // for the component (in terms of Angular's component tree, not rendering). // When the ViewContainerRef is missing, we use the factory to create the component directly // and then manually attach the view to the application. if (portal.viewContainerRef) { componentRef = portal.viewContainerRef.createComponent(componentFactory, portal.viewContainerRef.length, portal.injector || portal.viewContainerRef.injector); this.setDisposeFn(() => componentRef.destroy()); } else { componentRef = componentFactory.create(portal.injector || this._defaultInjector); this._appRef.attachView(componentRef.hostView); this.setDisposeFn(() => { this._appRef.detachView(componentRef.hostView); componentRef.destroy(); }); } // At this point the component has been instantiated, so we move it to the location in the DOM // where we want it to be rendered. this.outletElement.appendChild(this._getComponentRootNode(componentRef)); return componentRef; } /** * Attaches a template portal to the DOM as an embedded view. * @param portal Portal to be attached. * @returns Reference to the created embedded view. */ attachTemplatePortal(portal) { let viewContainer = portal.viewContainerRef; let viewRef = viewContainer.createEmbeddedView(portal.templateRef, portal.context); // The method `createEmbeddedView` will add the view as a child of the viewContainer. // But for the DomPortalOutlet the view can be added everywhere in the DOM // (e.g Overlay Container) To move the view to the specified host element. We just // re-append the existing root nodes. viewRef.rootNodes.forEach(rootNode => this.outletElement.appendChild(rootNode)); // Note that we want to detect changes after the nodes have been moved so that // any directives inside the portal that are looking at the DOM inside a lifecycle // hook won't be invoked too early. viewRef.detectChanges(); this.setDisposeFn((() => { let index = viewContainer.indexOf(viewRef); if (index !== -1) { viewContainer.remove(index); } })); // TODO(jelbourn): Return locals from view. return viewRef; } /** * Clears out a portal from the DOM. */ dispose() { super.dispose(); if (this.outletElement.parentNode != null) { this.outletElement.parentNode.removeChild(this.outletElement); } } /** Gets the root HTMLElement for an instantiated component. */ _getComponentRootNode(componentRef) { return componentRef.hostView.rootNodes[0]; } } /** * @deprecated Use `DomPortalOutlet` instead. * @breaking-change 9.0.0 */ class DomPortalHost extends DomPortalOutlet { } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Directive version of a `TemplatePortal`. Because the directive *is* a TemplatePortal, * the directive instance itself can be attached to a host, enabling declarative use of portals. */ class CdkPortal extends TemplatePortal { constructor(templateRef, viewContainerRef) { super(templateRef, viewContainerRef); } } CdkPortal.ɵfac = function CdkPortal_Factory(t) { return new (t || CdkPortal)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["TemplateRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"])); }; CdkPortal.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: CdkPortal, selectors: [["", "cdkPortal", ""]], exportAs: ["cdkPortal"], features: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵInheritDefinitionFeature"]] }); CdkPortal.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["TemplateRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](CdkPortal, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Directive"], args: [{ selector: '[cdkPortal]', exportAs: 'cdkPortal' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["TemplateRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"] }]; }, null); })(); /** * @deprecated Use `CdkPortal` instead. * @breaking-change 9.0.0 */ class TemplatePortalDirective extends CdkPortal { } TemplatePortalDirective.ɵfac = function TemplatePortalDirective_Factory(t) { return ɵTemplatePortalDirective_BaseFactory(t || TemplatePortalDirective); }; TemplatePortalDirective.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: TemplatePortalDirective, selectors: [["", "cdk-portal", ""], ["", "portal", ""]], exportAs: ["cdkPortal"], features: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵProvidersFeature"]([{ provide: CdkPortal, useExisting: TemplatePortalDirective }]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵInheritDefinitionFeature"]] }); const ɵTemplatePortalDirective_BaseFactory = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵgetInheritedFactory"](TemplatePortalDirective); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](TemplatePortalDirective, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Directive"], args: [{ selector: '[cdk-portal], [portal]', exportAs: 'cdkPortal', providers: [{ provide: CdkPortal, useExisting: TemplatePortalDirective }] }] }], null, null); })(); /** * Directive version of a PortalOutlet. Because the directive *is* a PortalOutlet, portals can be * directly attached to it, enabling declarative use. * * Usage: * `` */ class CdkPortalOutlet extends BasePortalOutlet { constructor(_componentFactoryResolver, _viewContainerRef, /** * @deprecated `_document` parameter to be made required. * @breaking-change 9.0.0 */ _document) { super(); this._componentFactoryResolver = _componentFactoryResolver; this._viewContainerRef = _viewContainerRef; /** Whether the portal component is initialized. */ this._isInitialized = false; /** Emits when a portal is attached to the outlet. */ this.attached = new _angular_core__WEBPACK_IMPORTED_MODULE_0__["EventEmitter"](); /** * Attaches the given DomPortal to this PortalHost by moving all of the portal content into it. * @param portal Portal to be attached. * @deprecated To be turned into a method. * @breaking-change 10.0.0 */ this.attachDomPortal = (portal) => { // @breaking-change 9.0.0 Remove check and error once the // `_document` constructor parameter is required. if (!this._document && (typeof ngDevMode === 'undefined' || ngDevMode)) { throw Error('Cannot attach DOM portal without _document constructor parameter'); } const element = portal.element; if (!element.parentNode && (typeof ngDevMode === 'undefined' || ngDevMode)) { throw Error('DOM portal content must be attached to a parent node.'); } // Anchor used to save the element's previous position so // that we can restore it when the portal is detached. const anchorNode = this._document.createComment('dom-portal'); portal.setAttachedHost(this); element.parentNode.insertBefore(anchorNode, element); this._getRootNode().appendChild(element); super.setDisposeFn(() => { if (anchorNode.parentNode) { anchorNode.parentNode.replaceChild(element, anchorNode); } }); }; this._document = _document; } /** Portal associated with the Portal outlet. */ get portal() { return this._attachedPortal; } set portal(portal) { // Ignore the cases where the `portal` is set to a falsy value before the lifecycle hooks have // run. This handles the cases where the user might do something like `
` // and attach a portal programmatically in the parent component. When Angular does the first CD // round, it will fire the setter with empty string, causing the user's content to be cleared. if (this.hasAttached() && !portal && !this._isInitialized) { return; } if (this.hasAttached()) { super.detach(); } if (portal) { super.attach(portal); } this._attachedPortal = portal; } /** Component or view reference that is attached to the portal. */ get attachedRef() { return this._attachedRef; } ngOnInit() { this._isInitialized = true; } ngOnDestroy() { super.dispose(); this._attachedPortal = null; this._attachedRef = null; } /** * Attach the given ComponentPortal to this PortalOutlet using the ComponentFactoryResolver. * * @param portal Portal to be attached to the portal outlet. * @returns Reference to the created component. */ attachComponentPortal(portal) { portal.setAttachedHost(this); // If the portal specifies an origin, use that as the logical location of the component // in the application tree. Otherwise use the location of this PortalOutlet. const viewContainerRef = portal.viewContainerRef != null ? portal.viewContainerRef : this._viewContainerRef; const resolver = portal.componentFactoryResolver || this._componentFactoryResolver; const componentFactory = resolver.resolveComponentFactory(portal.component); const ref = viewContainerRef.createComponent(componentFactory, viewContainerRef.length, portal.injector || viewContainerRef.injector); // If we're using a view container that's different from the injected one (e.g. when the portal // specifies its own) we need to move the component into the outlet, otherwise it'll be rendered // inside of the alternate view container. if (viewContainerRef !== this._viewContainerRef) { this._getRootNode().appendChild(ref.hostView.rootNodes[0]); } super.setDisposeFn(() => ref.destroy()); this._attachedPortal = portal; this._attachedRef = ref; this.attached.emit(ref); return ref; } /** * Attach the given TemplatePortal to this PortalHost as an embedded View. * @param portal Portal to be attached. * @returns Reference to the created embedded view. */ attachTemplatePortal(portal) { portal.setAttachedHost(this); const viewRef = this._viewContainerRef.createEmbeddedView(portal.templateRef, portal.context); super.setDisposeFn(() => this._viewContainerRef.clear()); this._attachedPortal = portal; this._attachedRef = viewRef; this.attached.emit(viewRef); return viewRef; } /** Gets the root node of the portal outlet. */ _getRootNode() { const nativeElement = this._viewContainerRef.element.nativeElement; // The directive could be set on a template which will result in a comment // node being the root. Use the comment's parent node if that is the case. return (nativeElement.nodeType === nativeElement.ELEMENT_NODE ? nativeElement : nativeElement.parentNode); } } CdkPortalOutlet.ɵfac = function CdkPortalOutlet_Factory(t) { return new (t || CdkPortalOutlet)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ComponentFactoryResolver"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_common__WEBPACK_IMPORTED_MODULE_1__["DOCUMENT"])); }; CdkPortalOutlet.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: CdkPortalOutlet, selectors: [["", "cdkPortalOutlet", ""]], inputs: { portal: ["cdkPortalOutlet", "portal"] }, outputs: { attached: "attached" }, exportAs: ["cdkPortalOutlet"], features: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵInheritDefinitionFeature"]] }); CdkPortalOutlet.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ComponentFactoryResolver"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_1__["DOCUMENT"],] }] } ]; CdkPortalOutlet.propDecorators = { attached: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Output"] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](CdkPortalOutlet, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Directive"], args: [{ selector: '[cdkPortalOutlet]', exportAs: 'cdkPortalOutlet', inputs: ['portal: cdkPortalOutlet'] }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ComponentFactoryResolver"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_1__["DOCUMENT"]] }] }]; }, { attached: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Output"] }] }); })(); /** * @deprecated Use `CdkPortalOutlet` instead. * @breaking-change 9.0.0 */ class PortalHostDirective extends CdkPortalOutlet { } PortalHostDirective.ɵfac = function PortalHostDirective_Factory(t) { return ɵPortalHostDirective_BaseFactory(t || PortalHostDirective); }; PortalHostDirective.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: PortalHostDirective, selectors: [["", "cdkPortalHost", ""], ["", "portalHost", ""]], inputs: { portal: ["cdkPortalHost", "portal"] }, exportAs: ["cdkPortalHost"], features: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵProvidersFeature"]([{ provide: CdkPortalOutlet, useExisting: PortalHostDirective }]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵInheritDefinitionFeature"]] }); const ɵPortalHostDirective_BaseFactory = /*@__PURE__*/ _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵgetInheritedFactory"](PortalHostDirective); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](PortalHostDirective, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Directive"], args: [{ selector: '[cdkPortalHost], [portalHost]', exportAs: 'cdkPortalHost', inputs: ['portal: cdkPortalHost'], providers: [{ provide: CdkPortalOutlet, useExisting: PortalHostDirective }] }] }], null, null); })(); class PortalModule { } PortalModule.ɵmod = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineNgModule"]({ type: PortalModule }); PortalModule.ɵinj = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjector"]({ factory: function PortalModule_Factory(t) { return new (t || PortalModule)(); } }); (function () { (typeof ngJitMode === "undefined" || ngJitMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵsetNgModuleScope"](PortalModule, { declarations: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective], exports: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective] }); })(); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](PortalModule, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["NgModule"], args: [{ exports: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective], declarations: [CdkPortal, CdkPortalOutlet, TemplatePortalDirective, PortalHostDirective] }] }], null, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Custom injector to be used when providing custom * injection tokens to components inside a portal. * @docs-private * @deprecated Use `Injector.create` instead. * @breaking-change 11.0.0 */ class PortalInjector { constructor(_parentInjector, _customTokens) { this._parentInjector = _parentInjector; this._customTokens = _customTokens; } get(token, notFoundValue) { const value = this._customTokens.get(token); if (typeof value !== 'undefined') { return value; } return this._parentInjector.get(token, notFoundValue); } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Generated bundle index. Do not edit. */ //# sourceMappingURL=portal.js.map /***/ }), /***/ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/scrolling.js": /*!**********************************************************************!*\ !*** ./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/scrolling.js ***! \**********************************************************************/ /*! exports provided: CdkFixedSizeVirtualScroll, CdkScrollable, CdkScrollableModule, CdkVirtualForOf, CdkVirtualScrollViewport, DEFAULT_RESIZE_TIME, DEFAULT_SCROLL_TIME, FixedSizeVirtualScrollStrategy, ScrollDispatcher, ScrollingModule, VIRTUAL_SCROLL_STRATEGY, ViewportRuler, _fixedSizeVirtualScrollStrategyFactory */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; __webpack_require__.r(__webpack_exports__); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkFixedSizeVirtualScroll", function() { return CdkFixedSizeVirtualScroll; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkScrollable", function() { return CdkScrollable; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkScrollableModule", function() { return CdkScrollableModule; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkVirtualForOf", function() { return CdkVirtualForOf; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkVirtualScrollViewport", function() { return CdkVirtualScrollViewport; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "DEFAULT_RESIZE_TIME", function() { return DEFAULT_RESIZE_TIME; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "DEFAULT_SCROLL_TIME", function() { return DEFAULT_SCROLL_TIME; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "FixedSizeVirtualScrollStrategy", function() { return FixedSizeVirtualScrollStrategy; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ScrollDispatcher", function() { return ScrollDispatcher; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ScrollingModule", function() { return ScrollingModule; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "VIRTUAL_SCROLL_STRATEGY", function() { return VIRTUAL_SCROLL_STRATEGY; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ViewportRuler", function() { return ViewportRuler; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "_fixedSizeVirtualScrollStrategyFactory", function() { return _fixedSizeVirtualScrollStrategyFactory; }); /* harmony import */ var _angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @angular/cdk/coercion */ "./node_modules/@angular/cdk/fesm2015/coercion.js"); /* harmony import */ var _angular_core__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! @angular/core */ "./node_modules/@angular/core/__ivy_ngcc__/fesm2015/core.js"); /* harmony import */ var rxjs__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(/*! rxjs */ "./node_modules/rxjs/_esm2015/index.js"); /* harmony import */ var rxjs_operators__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(/*! rxjs/operators */ "./node_modules/rxjs/_esm2015/operators/index.js"); /* harmony import */ var _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__ = __webpack_require__(/*! @angular/cdk/platform */ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/platform.js"); /* harmony import */ var _angular_common__WEBPACK_IMPORTED_MODULE_5__ = __webpack_require__(/*! @angular/common */ "./node_modules/@angular/common/__ivy_ngcc__/fesm2015/common.js"); /* harmony import */ var _angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_6__ = __webpack_require__(/*! @angular/cdk/bidi */ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/bidi.js"); /* harmony import */ var _angular_cdk_collections__WEBPACK_IMPORTED_MODULE_7__ = __webpack_require__(/*! @angular/cdk/collections */ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/collections.js"); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** The injection token used to specify the virtual scrolling strategy. */ const _c0 = ["contentWrapper"]; const _c1 = ["*"]; const VIRTUAL_SCROLL_STRATEGY = new _angular_core__WEBPACK_IMPORTED_MODULE_1__["InjectionToken"]('VIRTUAL_SCROLL_STRATEGY'); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** Virtual scrolling strategy for lists with items of known fixed size. */ class FixedSizeVirtualScrollStrategy { /** * @param itemSize The size of the items in the virtually scrolling list. * @param minBufferPx The minimum amount of buffer (in pixels) before needing to render more * @param maxBufferPx The amount of buffer (in pixels) to render when rendering more. */ constructor(itemSize, minBufferPx, maxBufferPx) { this._scrolledIndexChange = new rxjs__WEBPACK_IMPORTED_MODULE_2__["Subject"](); /** @docs-private Implemented as part of VirtualScrollStrategy. */ this.scrolledIndexChange = this._scrolledIndexChange.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["distinctUntilChanged"])()); /** The attached viewport. */ this._viewport = null; this._itemSize = itemSize; this._minBufferPx = minBufferPx; this._maxBufferPx = maxBufferPx; } /** * Attaches this scroll strategy to a viewport. * @param viewport The viewport to attach this strategy to. */ attach(viewport) { this._viewport = viewport; this._updateTotalContentSize(); this._updateRenderedRange(); } /** Detaches this scroll strategy from the currently attached viewport. */ detach() { this._scrolledIndexChange.complete(); this._viewport = null; } /** * Update the item size and buffer size. * @param itemSize The size of the items in the virtually scrolling list. * @param minBufferPx The minimum amount of buffer (in pixels) before needing to render more * @param maxBufferPx The amount of buffer (in pixels) to render when rendering more. */ updateItemAndBufferSize(itemSize, minBufferPx, maxBufferPx) { if (maxBufferPx < minBufferPx && (typeof ngDevMode === 'undefined' || ngDevMode)) { throw Error('CDK virtual scroll: maxBufferPx must be greater than or equal to minBufferPx'); } this._itemSize = itemSize; this._minBufferPx = minBufferPx; this._maxBufferPx = maxBufferPx; this._updateTotalContentSize(); this._updateRenderedRange(); } /** @docs-private Implemented as part of VirtualScrollStrategy. */ onContentScrolled() { this._updateRenderedRange(); } /** @docs-private Implemented as part of VirtualScrollStrategy. */ onDataLengthChanged() { this._updateTotalContentSize(); this._updateRenderedRange(); } /** @docs-private Implemented as part of VirtualScrollStrategy. */ onContentRendered() { } /** @docs-private Implemented as part of VirtualScrollStrategy. */ onRenderedOffsetChanged() { } /** * Scroll to the offset for the given index. * @param index The index of the element to scroll to. * @param behavior The ScrollBehavior to use when scrolling. */ scrollToIndex(index, behavior) { if (this._viewport) { this._viewport.scrollToOffset(index * this._itemSize, behavior); } } /** Update the viewport's total content size. */ _updateTotalContentSize() { if (!this._viewport) { return; } this._viewport.setTotalContentSize(this._viewport.getDataLength() * this._itemSize); } /** Update the viewport's rendered range. */ _updateRenderedRange() { if (!this._viewport) { return; } const renderedRange = this._viewport.getRenderedRange(); const newRange = { start: renderedRange.start, end: renderedRange.end }; const viewportSize = this._viewport.getViewportSize(); const dataLength = this._viewport.getDataLength(); let scrollOffset = this._viewport.measureScrollOffset(); let firstVisibleIndex = scrollOffset / this._itemSize; // If user scrolls to the bottom of the list and data changes to a smaller list if (newRange.end > dataLength) { // We have to recalculate the first visible index based on new data length and viewport size. const maxVisibleItems = Math.ceil(viewportSize / this._itemSize); const newVisibleIndex = Math.max(0, Math.min(firstVisibleIndex, dataLength - maxVisibleItems)); // If first visible index changed we must update scroll offset to handle start/end buffers // Current range must also be adjusted to cover the new position (bottom of new list). if (firstVisibleIndex != newVisibleIndex) { firstVisibleIndex = newVisibleIndex; scrollOffset = newVisibleIndex * this._itemSize; newRange.start = Math.floor(firstVisibleIndex); } newRange.end = Math.max(0, Math.min(dataLength, newRange.start + maxVisibleItems)); } const startBuffer = scrollOffset - newRange.start * this._itemSize; if (startBuffer < this._minBufferPx && newRange.start != 0) { const expandStart = Math.ceil((this._maxBufferPx - startBuffer) / this._itemSize); newRange.start = Math.max(0, newRange.start - expandStart); newRange.end = Math.min(dataLength, Math.ceil(firstVisibleIndex + (viewportSize + this._minBufferPx) / this._itemSize)); } else { const endBuffer = newRange.end * this._itemSize - (scrollOffset + viewportSize); if (endBuffer < this._minBufferPx && newRange.end != dataLength) { const expandEnd = Math.ceil((this._maxBufferPx - endBuffer) / this._itemSize); if (expandEnd > 0) { newRange.end = Math.min(dataLength, newRange.end + expandEnd); newRange.start = Math.max(0, Math.floor(firstVisibleIndex - this._minBufferPx / this._itemSize)); } } } this._viewport.setRenderedRange(newRange); this._viewport.setRenderedContentOffset(this._itemSize * newRange.start); this._scrolledIndexChange.next(Math.floor(firstVisibleIndex)); } } /** * Provider factory for `FixedSizeVirtualScrollStrategy` that simply extracts the already created * `FixedSizeVirtualScrollStrategy` from the given directive. * @param fixedSizeDir The instance of `CdkFixedSizeVirtualScroll` to extract the * `FixedSizeVirtualScrollStrategy` from. */ function _fixedSizeVirtualScrollStrategyFactory(fixedSizeDir) { return fixedSizeDir._scrollStrategy; } /** A virtual scroll strategy that supports fixed-size items. */ class CdkFixedSizeVirtualScroll { constructor() { this._itemSize = 20; this._minBufferPx = 100; this._maxBufferPx = 200; /** The scroll strategy used by this directive. */ this._scrollStrategy = new FixedSizeVirtualScrollStrategy(this.itemSize, this.minBufferPx, this.maxBufferPx); } /** The size of the items in the list (in pixels). */ get itemSize() { return this._itemSize; } set itemSize(value) { this._itemSize = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_0__["coerceNumberProperty"])(value); } /** * The minimum amount of buffer rendered beyond the viewport (in pixels). * If the amount of buffer dips below this number, more items will be rendered. Defaults to 100px. */ get minBufferPx() { return this._minBufferPx; } set minBufferPx(value) { this._minBufferPx = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_0__["coerceNumberProperty"])(value); } /** * The number of pixels worth of buffer to render for when rendering new items. Defaults to 200px. */ get maxBufferPx() { return this._maxBufferPx; } set maxBufferPx(value) { this._maxBufferPx = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_0__["coerceNumberProperty"])(value); } ngOnChanges() { this._scrollStrategy.updateItemAndBufferSize(this.itemSize, this.minBufferPx, this.maxBufferPx); } } CdkFixedSizeVirtualScroll.ɵfac = function CdkFixedSizeVirtualScroll_Factory(t) { return new (t || CdkFixedSizeVirtualScroll)(); }; CdkFixedSizeVirtualScroll.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineDirective"]({ type: CdkFixedSizeVirtualScroll, selectors: [["cdk-virtual-scroll-viewport", "itemSize", ""]], inputs: { itemSize: "itemSize", minBufferPx: "minBufferPx", maxBufferPx: "maxBufferPx" }, features: [_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵProvidersFeature"]([{ provide: VIRTUAL_SCROLL_STRATEGY, useFactory: _fixedSizeVirtualScrollStrategyFactory, deps: [Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["forwardRef"])(() => CdkFixedSizeVirtualScroll)] }]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵNgOnChangesFeature"]] }); CdkFixedSizeVirtualScroll.propDecorators = { itemSize: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"] }], minBufferPx: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"] }], maxBufferPx: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](CdkFixedSizeVirtualScroll, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Directive"], args: [{ selector: 'cdk-virtual-scroll-viewport[itemSize]', providers: [{ provide: VIRTUAL_SCROLL_STRATEGY, useFactory: _fixedSizeVirtualScrollStrategyFactory, deps: [Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["forwardRef"])(() => CdkFixedSizeVirtualScroll)] }] }] }], function () { return []; }, { itemSize: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"] }], minBufferPx: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"] }], maxBufferPx: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"] }] }); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** Time in ms to throttle the scrolling events by default. */ const DEFAULT_SCROLL_TIME = 20; /** * Service contained all registered Scrollable references and emits an event when any one of the * Scrollable references emit a scrolled event. */ class ScrollDispatcher { constructor(_ngZone, _platform, /** @breaking-change 11.0.0 make document required */ document) { this._ngZone = _ngZone; this._platform = _platform; /** Subject for notifying that a registered scrollable reference element has been scrolled. */ this._scrolled = new rxjs__WEBPACK_IMPORTED_MODULE_2__["Subject"](); /** Keeps track of the global `scroll` and `resize` subscriptions. */ this._globalSubscription = null; /** Keeps track of the amount of subscriptions to `scrolled`. Used for cleaning up afterwards. */ this._scrolledCount = 0; /** * Map of all the scrollable references that are registered with the service and their * scroll event subscriptions. */ this.scrollContainers = new Map(); this._document = document; } /** * Registers a scrollable instance with the service and listens for its scrolled events. When the * scrollable is scrolled, the service emits the event to its scrolled observable. * @param scrollable Scrollable instance to be registered. */ register(scrollable) { if (!this.scrollContainers.has(scrollable)) { this.scrollContainers.set(scrollable, scrollable.elementScrolled() .subscribe(() => this._scrolled.next(scrollable))); } } /** * Deregisters a Scrollable reference and unsubscribes from its scroll event observable. * @param scrollable Scrollable instance to be deregistered. */ deregister(scrollable) { const scrollableReference = this.scrollContainers.get(scrollable); if (scrollableReference) { scrollableReference.unsubscribe(); this.scrollContainers.delete(scrollable); } } /** * Returns an observable that emits an event whenever any of the registered Scrollable * references (or window, document, or body) fire a scrolled event. Can provide a time in ms * to override the default "throttle" time. * * **Note:** in order to avoid hitting change detection for every scroll event, * all of the events emitted from this stream will be run outside the Angular zone. * If you need to update any data bindings as a result of a scroll event, you have * to run the callback using `NgZone.run`. */ scrolled(auditTimeInMs = DEFAULT_SCROLL_TIME) { if (!this._platform.isBrowser) { return Object(rxjs__WEBPACK_IMPORTED_MODULE_2__["of"])(); } return new rxjs__WEBPACK_IMPORTED_MODULE_2__["Observable"]((observer) => { if (!this._globalSubscription) { this._addGlobalListener(); } // In the case of a 0ms delay, use an observable without auditTime // since it does add a perceptible delay in processing overhead. const subscription = auditTimeInMs > 0 ? this._scrolled.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["auditTime"])(auditTimeInMs)).subscribe(observer) : this._scrolled.subscribe(observer); this._scrolledCount++; return () => { subscription.unsubscribe(); this._scrolledCount--; if (!this._scrolledCount) { this._removeGlobalListener(); } }; }); } ngOnDestroy() { this._removeGlobalListener(); this.scrollContainers.forEach((_, container) => this.deregister(container)); this._scrolled.complete(); } /** * Returns an observable that emits whenever any of the * scrollable ancestors of an element are scrolled. * @param elementRef Element whose ancestors to listen for. * @param auditTimeInMs Time to throttle the scroll events. */ ancestorScrolled(elementRef, auditTimeInMs) { const ancestors = this.getAncestorScrollContainers(elementRef); return this.scrolled(auditTimeInMs).pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["filter"])(target => { return !target || ancestors.indexOf(target) > -1; })); } /** Returns all registered Scrollables that contain the provided element. */ getAncestorScrollContainers(elementRef) { const scrollingContainers = []; this.scrollContainers.forEach((_subscription, scrollable) => { if (this._scrollableContainsElement(scrollable, elementRef)) { scrollingContainers.push(scrollable); } }); return scrollingContainers; } /** Access injected document if available or fallback to global document reference */ _getDocument() { return this._document || document; } /** Use defaultView of injected document if available or fallback to global window reference */ _getWindow() { const doc = this._getDocument(); return doc.defaultView || window; } /** Returns true if the element is contained within the provided Scrollable. */ _scrollableContainsElement(scrollable, elementRef) { let element = elementRef.nativeElement; let scrollableElement = scrollable.getElementRef().nativeElement; // Traverse through the element parents until we reach null, checking if any of the elements // are the scrollable's element. do { if (element == scrollableElement) { return true; } } while (element = element.parentElement); return false; } /** Sets up the global scroll listeners. */ _addGlobalListener() { this._globalSubscription = this._ngZone.runOutsideAngular(() => { const window = this._getWindow(); return Object(rxjs__WEBPACK_IMPORTED_MODULE_2__["fromEvent"])(window.document, 'scroll').subscribe(() => this._scrolled.next()); }); } /** Cleans up the global scroll listener. */ _removeGlobalListener() { if (this._globalSubscription) { this._globalSubscription.unsubscribe(); this._globalSubscription = null; } } } ScrollDispatcher.ɵfac = function ScrollDispatcher_Factory(t) { return new (t || ScrollDispatcher)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["Platform"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_common__WEBPACK_IMPORTED_MODULE_5__["DOCUMENT"], 8)); }; ScrollDispatcher.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjectable"])({ factory: function ScrollDispatcher_Factory() { return new ScrollDispatcher(Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"]), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["Platform"]), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_common__WEBPACK_IMPORTED_MODULE_5__["DOCUMENT"], 8)); }, token: ScrollDispatcher, providedIn: "root" }); ScrollDispatcher.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }, { type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["Platform"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_5__["DOCUMENT"],] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](ScrollDispatcher, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Injectable"], args: [{ providedIn: 'root' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }, { type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["Platform"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_5__["DOCUMENT"]] }] }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Sends an event when the directive's element is scrolled. Registers itself with the * ScrollDispatcher service to include itself as part of its collection of scrolling events that it * can be listened to through the service. */ class CdkScrollable { constructor(elementRef, scrollDispatcher, ngZone, dir) { this.elementRef = elementRef; this.scrollDispatcher = scrollDispatcher; this.ngZone = ngZone; this.dir = dir; this._destroyed = new rxjs__WEBPACK_IMPORTED_MODULE_2__["Subject"](); this._elementScrolled = new rxjs__WEBPACK_IMPORTED_MODULE_2__["Observable"]((observer) => this.ngZone.runOutsideAngular(() => Object(rxjs__WEBPACK_IMPORTED_MODULE_2__["fromEvent"])(this.elementRef.nativeElement, 'scroll').pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["takeUntil"])(this._destroyed)) .subscribe(observer))); } ngOnInit() { this.scrollDispatcher.register(this); } ngOnDestroy() { this.scrollDispatcher.deregister(this); this._destroyed.next(); this._destroyed.complete(); } /** Returns observable that emits when a scroll event is fired on the host element. */ elementScrolled() { return this._elementScrolled; } /** Gets the ElementRef for the viewport. */ getElementRef() { return this.elementRef; } /** * Scrolls to the specified offsets. This is a normalized version of the browser's native scrollTo * method, since browsers are not consistent about what scrollLeft means in RTL. For this method * left and right always refer to the left and right side of the scrolling container irrespective * of the layout direction. start and end refer to left and right in an LTR context and vice-versa * in an RTL context. * @param options specified the offsets to scroll to. */ scrollTo(options) { const el = this.elementRef.nativeElement; const isRtl = this.dir && this.dir.value == 'rtl'; // Rewrite start & end offsets as right or left offsets. if (options.left == null) { options.left = isRtl ? options.end : options.start; } if (options.right == null) { options.right = isRtl ? options.start : options.end; } // Rewrite the bottom offset as a top offset. if (options.bottom != null) { options.top = el.scrollHeight - el.clientHeight - options.bottom; } // Rewrite the right offset as a left offset. if (isRtl && Object(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["getRtlScrollAxisType"])() != 0 /* NORMAL */) { if (options.left != null) { options.right = el.scrollWidth - el.clientWidth - options.left; } if (Object(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["getRtlScrollAxisType"])() == 2 /* INVERTED */) { options.left = options.right; } else if (Object(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["getRtlScrollAxisType"])() == 1 /* NEGATED */) { options.left = options.right ? -options.right : options.right; } } else { if (options.right != null) { options.left = el.scrollWidth - el.clientWidth - options.right; } } this._applyScrollToOptions(options); } _applyScrollToOptions(options) { const el = this.elementRef.nativeElement; if (Object(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["supportsScrollBehavior"])()) { el.scrollTo(options); } else { if (options.top != null) { el.scrollTop = options.top; } if (options.left != null) { el.scrollLeft = options.left; } } } /** * Measures the scroll offset relative to the specified edge of the viewport. This method can be * used instead of directly checking scrollLeft or scrollTop, since browsers are not consistent * about what scrollLeft means in RTL. The values returned by this method are normalized such that * left and right always refer to the left and right side of the scrolling container irrespective * of the layout direction. start and end refer to left and right in an LTR context and vice-versa * in an RTL context. * @param from The edge to measure from. */ measureScrollOffset(from) { const LEFT = 'left'; const RIGHT = 'right'; const el = this.elementRef.nativeElement; if (from == 'top') { return el.scrollTop; } if (from == 'bottom') { return el.scrollHeight - el.clientHeight - el.scrollTop; } // Rewrite start & end as left or right offsets. const isRtl = this.dir && this.dir.value == 'rtl'; if (from == 'start') { from = isRtl ? RIGHT : LEFT; } else if (from == 'end') { from = isRtl ? LEFT : RIGHT; } if (isRtl && Object(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["getRtlScrollAxisType"])() == 2 /* INVERTED */) { // For INVERTED, scrollLeft is (scrollWidth - clientWidth) when scrolled all the way left and // 0 when scrolled all the way right. if (from == LEFT) { return el.scrollWidth - el.clientWidth - el.scrollLeft; } else { return el.scrollLeft; } } else if (isRtl && Object(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["getRtlScrollAxisType"])() == 1 /* NEGATED */) { // For NEGATED, scrollLeft is -(scrollWidth - clientWidth) when scrolled all the way left and // 0 when scrolled all the way right. if (from == LEFT) { return el.scrollLeft + el.scrollWidth - el.clientWidth; } else { return -el.scrollLeft; } } else { // For NORMAL, as well as non-RTL contexts, scrollLeft is 0 when scrolled all the way left and // (scrollWidth - clientWidth) when scrolled all the way right. if (from == LEFT) { return el.scrollLeft; } else { return el.scrollWidth - el.clientWidth - el.scrollLeft; } } } } CdkScrollable.ɵfac = function CdkScrollable_Factory(t) { return new (t || CdkScrollable)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](ScrollDispatcher), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_6__["Directionality"], 8)); }; CdkScrollable.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineDirective"]({ type: CdkScrollable, selectors: [["", "cdk-scrollable", ""], ["", "cdkScrollable", ""]] }); CdkScrollable.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"] }, { type: ScrollDispatcher }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }, { type: _angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_6__["Directionality"], decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](CdkScrollable, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Directive"], args: [{ selector: '[cdk-scrollable], [cdkScrollable]' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"] }, { type: ScrollDispatcher }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }, { type: _angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_6__["Directionality"], decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"] }] }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** Time in ms to throttle the resize events by default. */ const DEFAULT_RESIZE_TIME = 20; /** * Simple utility for getting the bounds of the browser viewport. * @docs-private */ class ViewportRuler { constructor(_platform, ngZone, /** @breaking-change 11.0.0 make document required */ document) { this._platform = _platform; /** Stream of viewport change events. */ this._change = new rxjs__WEBPACK_IMPORTED_MODULE_2__["Subject"](); /** Event listener that will be used to handle the viewport change events. */ this._changeListener = (event) => { this._change.next(event); }; this._document = document; ngZone.runOutsideAngular(() => { if (_platform.isBrowser) { const window = this._getWindow(); // Note that bind the events ourselves, rather than going through something like RxJS's // `fromEvent` so that we can ensure that they're bound outside of the NgZone. window.addEventListener('resize', this._changeListener); window.addEventListener('orientationchange', this._changeListener); } // We don't need to keep track of the subscription, // because we complete the `change` stream on destroy. this.change().subscribe(() => this._updateViewportSize()); }); } ngOnDestroy() { if (this._platform.isBrowser) { const window = this._getWindow(); window.removeEventListener('resize', this._changeListener); window.removeEventListener('orientationchange', this._changeListener); } this._change.complete(); } /** Returns the viewport's width and height. */ getViewportSize() { if (!this._viewportSize) { this._updateViewportSize(); } const output = { width: this._viewportSize.width, height: this._viewportSize.height }; // If we're not on a browser, don't cache the size since it'll be mocked out anyway. if (!this._platform.isBrowser) { this._viewportSize = null; } return output; } /** Gets a ClientRect for the viewport's bounds. */ getViewportRect() { // Use the document element's bounding rect rather than the window scroll properties // (e.g. pageYOffset, scrollY) due to in issue in Chrome and IE where window scroll // properties and client coordinates (boundingClientRect, clientX/Y, etc.) are in different // conceptual viewports. Under most circumstances these viewports are equivalent, but they // can disagree when the page is pinch-zoomed (on devices that support touch). // See https://bugs.chromium.org/p/chromium/issues/detail?id=489206#c4 // We use the documentElement instead of the body because, by default (without a css reset) // browsers typically give the document body an 8px margin, which is not included in // getBoundingClientRect(). const scrollPosition = this.getViewportScrollPosition(); const { width, height } = this.getViewportSize(); return { top: scrollPosition.top, left: scrollPosition.left, bottom: scrollPosition.top + height, right: scrollPosition.left + width, height, width, }; } /** Gets the (top, left) scroll position of the viewport. */ getViewportScrollPosition() { // While we can get a reference to the fake document // during SSR, it doesn't have getBoundingClientRect. if (!this._platform.isBrowser) { return { top: 0, left: 0 }; } // The top-left-corner of the viewport is determined by the scroll position of the document // body, normally just (scrollLeft, scrollTop). However, Chrome and Firefox disagree about // whether `document.body` or `document.documentElement` is the scrolled element, so reading // `scrollTop` and `scrollLeft` is inconsistent. However, using the bounding rect of // `document.documentElement` works consistently, where the `top` and `left` values will // equal negative the scroll position. const document = this._getDocument(); const window = this._getWindow(); const documentElement = document.documentElement; const documentRect = documentElement.getBoundingClientRect(); const top = -documentRect.top || document.body.scrollTop || window.scrollY || documentElement.scrollTop || 0; const left = -documentRect.left || document.body.scrollLeft || window.scrollX || documentElement.scrollLeft || 0; return { top, left }; } /** * Returns a stream that emits whenever the size of the viewport changes. * @param throttleTime Time in milliseconds to throttle the stream. */ change(throttleTime = DEFAULT_RESIZE_TIME) { return throttleTime > 0 ? this._change.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["auditTime"])(throttleTime)) : this._change; } /** Access injected document if available or fallback to global document reference */ _getDocument() { return this._document || document; } /** Use defaultView of injected document if available or fallback to global window reference */ _getWindow() { const doc = this._getDocument(); return doc.defaultView || window; } /** Updates the cached viewport size. */ _updateViewportSize() { const window = this._getWindow(); this._viewportSize = this._platform.isBrowser ? { width: window.innerWidth, height: window.innerHeight } : { width: 0, height: 0 }; } } ViewportRuler.ɵfac = function ViewportRuler_Factory(t) { return new (t || ViewportRuler)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["Platform"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_common__WEBPACK_IMPORTED_MODULE_5__["DOCUMENT"], 8)); }; ViewportRuler.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjectable"])({ factory: function ViewportRuler_Factory() { return new ViewportRuler(Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["Platform"]), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"]), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_common__WEBPACK_IMPORTED_MODULE_5__["DOCUMENT"], 8)); }, token: ViewportRuler, providedIn: "root" }); ViewportRuler.ctorParameters = () => [ { type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["Platform"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_5__["DOCUMENT"],] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](ViewportRuler, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Injectable"], args: [{ providedIn: 'root' }] }], function () { return [{ type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["Platform"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_5__["DOCUMENT"]] }] }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** Checks if the given ranges are equal. */ function rangesEqual(r1, r2) { return r1.start == r2.start && r1.end == r2.end; } /** * Scheduler to be used for scroll events. Needs to fall back to * something that doesn't rely on requestAnimationFrame on environments * that don't support it (e.g. server-side rendering). */ const SCROLL_SCHEDULER = typeof requestAnimationFrame !== 'undefined' ? rxjs__WEBPACK_IMPORTED_MODULE_2__["animationFrameScheduler"] : rxjs__WEBPACK_IMPORTED_MODULE_2__["asapScheduler"]; /** A viewport that virtualizes its scrolling with the help of `CdkVirtualForOf`. */ class CdkVirtualScrollViewport extends CdkScrollable { constructor(elementRef, _changeDetectorRef, ngZone, _scrollStrategy, dir, scrollDispatcher, /** * @deprecated `viewportRuler` parameter to become required. * @breaking-change 11.0.0 */ viewportRuler) { super(elementRef, scrollDispatcher, ngZone, dir); this.elementRef = elementRef; this._changeDetectorRef = _changeDetectorRef; this._scrollStrategy = _scrollStrategy; /** Emits when the viewport is detached from a CdkVirtualForOf. */ this._detachedSubject = new rxjs__WEBPACK_IMPORTED_MODULE_2__["Subject"](); /** Emits when the rendered range changes. */ this._renderedRangeSubject = new rxjs__WEBPACK_IMPORTED_MODULE_2__["Subject"](); this._orientation = 'vertical'; // Note: we don't use the typical EventEmitter here because we need to subscribe to the scroll // strategy lazily (i.e. only if the user is actually listening to the events). We do this because // depending on how the strategy calculates the scrolled index, it may come at a cost to // performance. /** Emits when the index of the first element visible in the viewport changes. */ this.scrolledIndexChange = new rxjs__WEBPACK_IMPORTED_MODULE_2__["Observable"]((observer) => this._scrollStrategy.scrolledIndexChange.subscribe(index => Promise.resolve().then(() => this.ngZone.run(() => observer.next(index))))); /** A stream that emits whenever the rendered range changes. */ this.renderedRangeStream = this._renderedRangeSubject; /** * The total size of all content (in pixels), including content that is not currently rendered. */ this._totalContentSize = 0; /** A string representing the `style.width` property value to be used for the spacer element. */ this._totalContentWidth = ''; /** A string representing the `style.height` property value to be used for the spacer element. */ this._totalContentHeight = ''; /** The currently rendered range of indices. */ this._renderedRange = { start: 0, end: 0 }; /** The length of the data bound to this viewport (in number of items). */ this._dataLength = 0; /** The size of the viewport (in pixels). */ this._viewportSize = 0; /** The last rendered content offset that was set. */ this._renderedContentOffset = 0; /** * Whether the last rendered content offset was to the end of the content (and therefore needs to * be rewritten as an offset to the start of the content). */ this._renderedContentOffsetNeedsRewrite = false; /** Whether there is a pending change detection cycle. */ this._isChangeDetectionPending = false; /** A list of functions to run after the next change detection cycle. */ this._runAfterChangeDetection = []; /** Subscription to changes in the viewport size. */ this._viewportChanges = rxjs__WEBPACK_IMPORTED_MODULE_2__["Subscription"].EMPTY; if (!_scrollStrategy && (typeof ngDevMode === 'undefined' || ngDevMode)) { throw Error('Error: cdk-virtual-scroll-viewport requires the "itemSize" property to be set.'); } // @breaking-change 11.0.0 Remove null check for `viewportRuler`. if (viewportRuler) { this._viewportChanges = viewportRuler.change().subscribe(() => { this.checkViewportSize(); }); } } /** The direction the viewport scrolls. */ get orientation() { return this._orientation; } set orientation(orientation) { if (this._orientation !== orientation) { this._orientation = orientation; this._calculateSpacerSize(); } } ngOnInit() { super.ngOnInit(); // It's still too early to measure the viewport at this point. Deferring with a promise allows // the Viewport to be rendered with the correct size before we measure. We run this outside the // zone to avoid causing more change detection cycles. We handle the change detection loop // ourselves instead. this.ngZone.runOutsideAngular(() => Promise.resolve().then(() => { this._measureViewportSize(); this._scrollStrategy.attach(this); this.elementScrolled() .pipe( // Start off with a fake scroll event so we properly detect our initial position. Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["startWith"])(null), // Collect multiple events into one until the next animation frame. This way if // there are multiple scroll events in the same frame we only need to recheck // our layout once. Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["auditTime"])(0, SCROLL_SCHEDULER)) .subscribe(() => this._scrollStrategy.onContentScrolled()); this._markChangeDetectionNeeded(); })); } ngOnDestroy() { this.detach(); this._scrollStrategy.detach(); // Complete all subjects this._renderedRangeSubject.complete(); this._detachedSubject.complete(); this._viewportChanges.unsubscribe(); super.ngOnDestroy(); } /** Attaches a `CdkVirtualScrollRepeater` to this viewport. */ attach(forOf) { if (this._forOf && (typeof ngDevMode === 'undefined' || ngDevMode)) { throw Error('CdkVirtualScrollViewport is already attached.'); } // Subscribe to the data stream of the CdkVirtualForOf to keep track of when the data length // changes. Run outside the zone to avoid triggering change detection, since we're managing the // change detection loop ourselves. this.ngZone.runOutsideAngular(() => { this._forOf = forOf; this._forOf.dataStream.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["takeUntil"])(this._detachedSubject)).subscribe(data => { const newLength = data.length; if (newLength !== this._dataLength) { this._dataLength = newLength; this._scrollStrategy.onDataLengthChanged(); } this._doChangeDetection(); }); }); } /** Detaches the current `CdkVirtualForOf`. */ detach() { this._forOf = null; this._detachedSubject.next(); } /** Gets the length of the data bound to this viewport (in number of items). */ getDataLength() { return this._dataLength; } /** Gets the size of the viewport (in pixels). */ getViewportSize() { return this._viewportSize; } // TODO(mmalerba): This is technically out of sync with what's really rendered until a render // cycle happens. I'm being careful to only call it after the render cycle is complete and before // setting it to something else, but its error prone and should probably be split into // `pendingRange` and `renderedRange`, the latter reflecting whats actually in the DOM. /** Get the current rendered range of items. */ getRenderedRange() { return this._renderedRange; } /** * Sets the total size of all content (in pixels), including content that is not currently * rendered. */ setTotalContentSize(size) { if (this._totalContentSize !== size) { this._totalContentSize = size; this._calculateSpacerSize(); this._markChangeDetectionNeeded(); } } /** Sets the currently rendered range of indices. */ setRenderedRange(range) { if (!rangesEqual(this._renderedRange, range)) { this._renderedRangeSubject.next(this._renderedRange = range); this._markChangeDetectionNeeded(() => this._scrollStrategy.onContentRendered()); } } /** * Gets the offset from the start of the viewport to the start of the rendered data (in pixels). */ getOffsetToRenderedContentStart() { return this._renderedContentOffsetNeedsRewrite ? null : this._renderedContentOffset; } /** * Sets the offset from the start of the viewport to either the start or end of the rendered data * (in pixels). */ setRenderedContentOffset(offset, to = 'to-start') { // For a horizontal viewport in a right-to-left language we need to translate along the x-axis // in the negative direction. const isRtl = this.dir && this.dir.value == 'rtl'; const isHorizontal = this.orientation == 'horizontal'; const axis = isHorizontal ? 'X' : 'Y'; const axisDirection = isHorizontal && isRtl ? -1 : 1; let transform = `translate${axis}(${Number(axisDirection * offset)}px)`; this._renderedContentOffset = offset; if (to === 'to-end') { transform += ` translate${axis}(-100%)`; // The viewport should rewrite this as a `to-start` offset on the next render cycle. Otherwise // elements will appear to expand in the wrong direction (e.g. `mat-expansion-panel` would // expand upward). this._renderedContentOffsetNeedsRewrite = true; } if (this._renderedContentTransform != transform) { // We know this value is safe because we parse `offset` with `Number()` before passing it // into the string. this._renderedContentTransform = transform; this._markChangeDetectionNeeded(() => { if (this._renderedContentOffsetNeedsRewrite) { this._renderedContentOffset -= this.measureRenderedContentSize(); this._renderedContentOffsetNeedsRewrite = false; this.setRenderedContentOffset(this._renderedContentOffset); } else { this._scrollStrategy.onRenderedOffsetChanged(); } }); } } /** * Scrolls to the given offset from the start of the viewport. Please note that this is not always * the same as setting `scrollTop` or `scrollLeft`. In a horizontal viewport with right-to-left * direction, this would be the equivalent of setting a fictional `scrollRight` property. * @param offset The offset to scroll to. * @param behavior The ScrollBehavior to use when scrolling. Default is behavior is `auto`. */ scrollToOffset(offset, behavior = 'auto') { const options = { behavior }; if (this.orientation === 'horizontal') { options.start = offset; } else { options.top = offset; } this.scrollTo(options); } /** * Scrolls to the offset for the given index. * @param index The index of the element to scroll to. * @param behavior The ScrollBehavior to use when scrolling. Default is behavior is `auto`. */ scrollToIndex(index, behavior = 'auto') { this._scrollStrategy.scrollToIndex(index, behavior); } /** * Gets the current scroll offset from the start of the viewport (in pixels). * @param from The edge to measure the offset from. Defaults to 'top' in vertical mode and 'start' * in horizontal mode. */ measureScrollOffset(from) { return from ? super.measureScrollOffset(from) : super.measureScrollOffset(this.orientation === 'horizontal' ? 'start' : 'top'); } /** Measure the combined size of all of the rendered items. */ measureRenderedContentSize() { const contentEl = this._contentWrapper.nativeElement; return this.orientation === 'horizontal' ? contentEl.offsetWidth : contentEl.offsetHeight; } /** * Measure the total combined size of the given range. Throws if the range includes items that are * not rendered. */ measureRangeSize(range) { if (!this._forOf) { return 0; } return this._forOf.measureRangeSize(range, this.orientation); } /** Update the viewport dimensions and re-render. */ checkViewportSize() { // TODO: Cleanup later when add logic for handling content resize this._measureViewportSize(); this._scrollStrategy.onDataLengthChanged(); } /** Measure the viewport size. */ _measureViewportSize() { const viewportEl = this.elementRef.nativeElement; this._viewportSize = this.orientation === 'horizontal' ? viewportEl.clientWidth : viewportEl.clientHeight; } /** Queue up change detection to run. */ _markChangeDetectionNeeded(runAfter) { if (runAfter) { this._runAfterChangeDetection.push(runAfter); } // Use a Promise to batch together calls to `_doChangeDetection`. This way if we set a bunch of // properties sequentially we only have to run `_doChangeDetection` once at the end. if (!this._isChangeDetectionPending) { this._isChangeDetectionPending = true; this.ngZone.runOutsideAngular(() => Promise.resolve().then(() => { this._doChangeDetection(); })); } } /** Run change detection. */ _doChangeDetection() { this._isChangeDetectionPending = false; // Apply the content transform. The transform can't be set via an Angular binding because // bypassSecurityTrustStyle is banned in Google. However the value is safe, it's composed of // string literals, a variable that can only be 'X' or 'Y', and user input that is run through // the `Number` function first to coerce it to a numeric value. this._contentWrapper.nativeElement.style.transform = this._renderedContentTransform; // Apply changes to Angular bindings. Note: We must call `markForCheck` to run change detection // from the root, since the repeated items are content projected in. Calling `detectChanges` // instead does not properly check the projected content. this.ngZone.run(() => this._changeDetectorRef.markForCheck()); const runAfterChangeDetection = this._runAfterChangeDetection; this._runAfterChangeDetection = []; for (const fn of runAfterChangeDetection) { fn(); } } /** Calculates the `style.width` and `style.height` for the spacer element. */ _calculateSpacerSize() { this._totalContentHeight = this.orientation === 'horizontal' ? '' : `${this._totalContentSize}px`; this._totalContentWidth = this.orientation === 'horizontal' ? `${this._totalContentSize}px` : ''; } } CdkVirtualScrollViewport.ɵfac = function CdkVirtualScrollViewport_Factory(t) { return new (t || CdkVirtualScrollViewport)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["ChangeDetectorRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](VIRTUAL_SCROLL_STRATEGY, 8), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_6__["Directionality"], 8), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](ScrollDispatcher), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](ViewportRuler)); }; CdkVirtualScrollViewport.ɵcmp = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineComponent"]({ type: CdkVirtualScrollViewport, selectors: [["cdk-virtual-scroll-viewport"]], viewQuery: function CdkVirtualScrollViewport_Query(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵstaticViewQuery"](_c0, true); } if (rf & 2) { var _t; _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵqueryRefresh"](_t = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵloadQuery"]()) && (ctx._contentWrapper = _t.first); } }, hostAttrs: [1, "cdk-virtual-scroll-viewport"], hostVars: 4, hostBindings: function CdkVirtualScrollViewport_HostBindings(rf, ctx) { if (rf & 2) { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵclassProp"]("cdk-virtual-scroll-orientation-horizontal", ctx.orientation === "horizontal")("cdk-virtual-scroll-orientation-vertical", ctx.orientation !== "horizontal"); } }, inputs: { orientation: "orientation" }, outputs: { scrolledIndexChange: "scrolledIndexChange" }, features: [_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵProvidersFeature"]([{ provide: CdkScrollable, useExisting: CdkVirtualScrollViewport }]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵInheritDefinitionFeature"]], ngContentSelectors: _c1, decls: 4, vars: 4, consts: [[1, "cdk-virtual-scroll-content-wrapper"], ["contentWrapper", ""], [1, "cdk-virtual-scroll-spacer"]], template: function CdkVirtualScrollViewport_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵprojectionDef"](); _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵelementStart"](0, "div", 0, 1); _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵprojection"](2); _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵelementEnd"](); _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵelement"](3, "div", 2); } if (rf & 2) { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵadvance"](3); _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵstyleProp"]("width", ctx._totalContentWidth)("height", ctx._totalContentHeight); } }, styles: ["cdk-virtual-scroll-viewport{display:block;position:relative;overflow:auto;contain:strict;transform:translateZ(0);will-change:scroll-position;-webkit-overflow-scrolling:touch}.cdk-virtual-scroll-content-wrapper{position:absolute;top:0;left:0;contain:content}[dir=rtl] .cdk-virtual-scroll-content-wrapper{right:0;left:auto}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper{min-height:100%}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-left:0;padding-right:0;margin-left:0;margin-right:0;border-left-width:0;border-right-width:0;outline:none}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper{min-width:100%}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-top:0;padding-bottom:0;margin-top:0;margin-bottom:0;border-top-width:0;border-bottom-width:0;outline:none}.cdk-virtual-scroll-spacer{position:absolute;top:0;left:0;height:1px;width:1px;transform-origin:0 0}[dir=rtl] .cdk-virtual-scroll-spacer{right:0;left:auto;transform-origin:100% 0}\n"], encapsulation: 2, changeDetection: 0 }); CdkVirtualScrollViewport.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ChangeDetectorRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [VIRTUAL_SCROLL_STRATEGY,] }] }, { type: _angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_6__["Directionality"], decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"] }] }, { type: ScrollDispatcher }, { type: ViewportRuler } ]; CdkVirtualScrollViewport.propDecorators = { orientation: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"] }], scrolledIndexChange: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Output"] }], _contentWrapper: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ViewChild"], args: ['contentWrapper', { static: true },] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](CdkVirtualScrollViewport, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Component"], args: [{ selector: 'cdk-virtual-scroll-viewport', template: "\n
\n \n
\n\n
\n", host: { 'class': 'cdk-virtual-scroll-viewport', '[class.cdk-virtual-scroll-orientation-horizontal]': 'orientation === "horizontal"', '[class.cdk-virtual-scroll-orientation-vertical]': 'orientation !== "horizontal"' }, encapsulation: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ViewEncapsulation"].None, changeDetection: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ChangeDetectionStrategy"].OnPush, providers: [{ provide: CdkScrollable, useExisting: CdkVirtualScrollViewport }], styles: ["cdk-virtual-scroll-viewport{display:block;position:relative;overflow:auto;contain:strict;transform:translateZ(0);will-change:scroll-position;-webkit-overflow-scrolling:touch}.cdk-virtual-scroll-content-wrapper{position:absolute;top:0;left:0;contain:content}[dir=rtl] .cdk-virtual-scroll-content-wrapper{right:0;left:auto}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper{min-height:100%}.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-horizontal .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-left:0;padding-right:0;margin-left:0;margin-right:0;border-left-width:0;border-right-width:0;outline:none}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper{min-width:100%}.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>dl:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ol:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>table:not([cdkVirtualFor]),.cdk-virtual-scroll-orientation-vertical .cdk-virtual-scroll-content-wrapper>ul:not([cdkVirtualFor]){padding-top:0;padding-bottom:0;margin-top:0;margin-bottom:0;border-top-width:0;border-bottom-width:0;outline:none}.cdk-virtual-scroll-spacer{position:absolute;top:0;left:0;height:1px;width:1px;transform-origin:0 0}[dir=rtl] .cdk-virtual-scroll-spacer{right:0;left:auto;transform-origin:100% 0}\n"] }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ChangeDetectorRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [VIRTUAL_SCROLL_STRATEGY] }] }, { type: _angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_6__["Directionality"], decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"] }] }, { type: ScrollDispatcher }, { type: ViewportRuler }]; }, { scrolledIndexChange: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Output"] }], orientation: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"] }], _contentWrapper: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ViewChild"], args: ['contentWrapper', { static: true }] }] }); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** Helper to extract the offset of a DOM Node in a certain direction. */ function getOffset(orientation, direction, node) { const el = node; if (!el.getBoundingClientRect) { return 0; } const rect = el.getBoundingClientRect(); if (orientation === 'horizontal') { return direction === 'start' ? rect.left : rect.right; } return direction === 'start' ? rect.top : rect.bottom; } /** * A directive similar to `ngForOf` to be used for rendering data inside a virtual scrolling * container. */ class CdkVirtualForOf { constructor( /** The view container to add items to. */ _viewContainerRef, /** The template to use when stamping out new items. */ _template, /** The set of available differs. */ _differs, /** The strategy used to render items in the virtual scroll viewport. */ _viewRepeater, /** The virtual scrolling viewport that these items are being rendered in. */ _viewport, ngZone) { this._viewContainerRef = _viewContainerRef; this._template = _template; this._differs = _differs; this._viewRepeater = _viewRepeater; this._viewport = _viewport; /** Emits when the rendered view of the data changes. */ this.viewChange = new rxjs__WEBPACK_IMPORTED_MODULE_2__["Subject"](); /** Subject that emits when a new DataSource instance is given. */ this._dataSourceChanges = new rxjs__WEBPACK_IMPORTED_MODULE_2__["Subject"](); /** Emits whenever the data in the current DataSource changes. */ this.dataStream = this._dataSourceChanges .pipe( // Start off with null `DataSource`. Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["startWith"])(null), // Bundle up the previous and current data sources so we can work with both. Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["pairwise"])(), // Use `_changeDataSource` to disconnect from the previous data source and connect to the // new one, passing back a stream of data changes which we run through `switchMap` to give // us a data stream that emits the latest data from whatever the current `DataSource` is. Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["switchMap"])(([prev, cur]) => this._changeDataSource(prev, cur)), // Replay the last emitted data when someone subscribes. Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["shareReplay"])(1)); /** The differ used to calculate changes to the data. */ this._differ = null; /** Whether the rendered data should be updated during the next ngDoCheck cycle. */ this._needsUpdate = false; this._destroyed = new rxjs__WEBPACK_IMPORTED_MODULE_2__["Subject"](); this.dataStream.subscribe(data => { this._data = data; this._onRenderedDataChange(); }); this._viewport.renderedRangeStream.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_3__["takeUntil"])(this._destroyed)).subscribe(range => { this._renderedRange = range; ngZone.run(() => this.viewChange.next(this._renderedRange)); this._onRenderedDataChange(); }); this._viewport.attach(this); } /** The DataSource to display. */ get cdkVirtualForOf() { return this._cdkVirtualForOf; } set cdkVirtualForOf(value) { this._cdkVirtualForOf = value; if (Object(_angular_cdk_collections__WEBPACK_IMPORTED_MODULE_7__["isDataSource"])(value)) { this._dataSourceChanges.next(value); } else { // If value is an an NgIterable, convert it to an array. this._dataSourceChanges.next(new _angular_cdk_collections__WEBPACK_IMPORTED_MODULE_7__["ArrayDataSource"](Object(rxjs__WEBPACK_IMPORTED_MODULE_2__["isObservable"])(value) ? value : Array.from(value || []))); } } /** * The `TrackByFunction` to use for tracking changes. The `TrackByFunction` takes the index and * the item and produces a value to be used as the item's identity when tracking changes. */ get cdkVirtualForTrackBy() { return this._cdkVirtualForTrackBy; } set cdkVirtualForTrackBy(fn) { this._needsUpdate = true; this._cdkVirtualForTrackBy = fn ? (index, item) => fn(index + (this._renderedRange ? this._renderedRange.start : 0), item) : undefined; } /** The template used to stamp out new elements. */ set cdkVirtualForTemplate(value) { if (value) { this._needsUpdate = true; this._template = value; } } /** * The size of the cache used to store templates that are not being used for re-use later. * Setting the cache size to `0` will disable caching. Defaults to 20 templates. */ get cdkVirtualForTemplateCacheSize() { return this._viewRepeater.viewCacheSize; } set cdkVirtualForTemplateCacheSize(size) { this._viewRepeater.viewCacheSize = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_0__["coerceNumberProperty"])(size); } /** * Measures the combined size (width for horizontal orientation, height for vertical) of all items * in the specified range. Throws an error if the range includes items that are not currently * rendered. */ measureRangeSize(range, orientation) { if (range.start >= range.end) { return 0; } if ((range.start < this._renderedRange.start || range.end > this._renderedRange.end) && (typeof ngDevMode === 'undefined' || ngDevMode)) { throw Error(`Error: attempted to measure an item that isn't rendered.`); } // The index into the list of rendered views for the first item in the range. const renderedStartIndex = range.start - this._renderedRange.start; // The length of the range we're measuring. const rangeLen = range.end - range.start; // Loop over all the views, find the first and land node and compute the size by subtracting // the top of the first node from the bottom of the last one. let firstNode; let lastNode; // Find the first node by starting from the beginning and going forwards. for (let i = 0; i < rangeLen; i++) { const view = this._viewContainerRef.get(i + renderedStartIndex); if (view && view.rootNodes.length) { firstNode = lastNode = view.rootNodes[0]; break; } } // Find the last node by starting from the end and going backwards. for (let i = rangeLen - 1; i > -1; i--) { const view = this._viewContainerRef.get(i + renderedStartIndex); if (view && view.rootNodes.length) { lastNode = view.rootNodes[view.rootNodes.length - 1]; break; } } return firstNode && lastNode ? getOffset(orientation, 'end', lastNode) - getOffset(orientation, 'start', firstNode) : 0; } ngDoCheck() { if (this._differ && this._needsUpdate) { // TODO(mmalerba): We should differentiate needs update due to scrolling and a new portion of // this list being rendered (can use simpler algorithm) vs needs update due to data actually // changing (need to do this diff). const changes = this._differ.diff(this._renderedItems); if (!changes) { this._updateContext(); } else { this._applyChanges(changes); } this._needsUpdate = false; } } ngOnDestroy() { this._viewport.detach(); this._dataSourceChanges.next(undefined); this._dataSourceChanges.complete(); this.viewChange.complete(); this._destroyed.next(); this._destroyed.complete(); this._viewRepeater.detach(); } /** React to scroll state changes in the viewport. */ _onRenderedDataChange() { if (!this._renderedRange) { return; } this._renderedItems = this._data.slice(this._renderedRange.start, this._renderedRange.end); if (!this._differ) { this._differ = this._differs.find(this._renderedItems).create(this.cdkVirtualForTrackBy); } this._needsUpdate = true; } /** Swap out one `DataSource` for another. */ _changeDataSource(oldDs, newDs) { if (oldDs) { oldDs.disconnect(this); } this._needsUpdate = true; return newDs ? newDs.connect(this) : Object(rxjs__WEBPACK_IMPORTED_MODULE_2__["of"])(); } /** Update the `CdkVirtualForOfContext` for all views. */ _updateContext() { const count = this._data.length; let i = this._viewContainerRef.length; while (i--) { let view = this._viewContainerRef.get(i); view.context.index = this._renderedRange.start + i; view.context.count = count; this._updateComputedContextProperties(view.context); view.detectChanges(); } } /** Apply changes to the DOM. */ _applyChanges(changes) { this._viewRepeater.applyChanges(changes, this._viewContainerRef, (record, adjustedPreviousIndex, currentIndex) => this._getEmbeddedViewArgs(record, currentIndex), (record) => record.item); // Update $implicit for any items that had an identity change. changes.forEachIdentityChange((record) => { const view = this._viewContainerRef.get(record.currentIndex); view.context.$implicit = record.item; }); // Update the context variables on all items. const count = this._data.length; let i = this._viewContainerRef.length; while (i--) { const view = this._viewContainerRef.get(i); view.context.index = this._renderedRange.start + i; view.context.count = count; this._updateComputedContextProperties(view.context); } } /** Update the computed properties on the `CdkVirtualForOfContext`. */ _updateComputedContextProperties(context) { context.first = context.index === 0; context.last = context.index === context.count - 1; context.even = context.index % 2 === 0; context.odd = !context.even; } _getEmbeddedViewArgs(record, index) { // Note that it's important that we insert the item directly at the proper index, // rather than inserting it and the moving it in place, because if there's a directive // on the same node that injects the `ViewContainerRef`, Angular will insert another // comment node which can throw off the move when it's being repeated for all items. return { templateRef: this._template, context: { $implicit: record.item, // It's guaranteed that the iterable is not "undefined" or "null" because we only // generate views for elements if the "cdkVirtualForOf" iterable has elements. cdkVirtualForOf: this._cdkVirtualForOf, index: -1, count: -1, first: false, last: false, odd: false, even: false }, index, }; } } CdkVirtualForOf.ɵfac = function CdkVirtualForOf_Factory(t) { return new (t || CdkVirtualForOf)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["ViewContainerRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["TemplateRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["IterableDiffers"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_cdk_collections__WEBPACK_IMPORTED_MODULE_7__["_VIEW_REPEATER_STRATEGY"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](CdkVirtualScrollViewport, 4), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"])); }; CdkVirtualForOf.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineDirective"]({ type: CdkVirtualForOf, selectors: [["", "cdkVirtualFor", "", "cdkVirtualForOf", ""]], inputs: { cdkVirtualForOf: "cdkVirtualForOf", cdkVirtualForTrackBy: "cdkVirtualForTrackBy", cdkVirtualForTemplate: "cdkVirtualForTemplate", cdkVirtualForTemplateCacheSize: "cdkVirtualForTemplateCacheSize" }, features: [_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵProvidersFeature"]([ { provide: _angular_cdk_collections__WEBPACK_IMPORTED_MODULE_7__["_VIEW_REPEATER_STRATEGY"], useClass: _angular_cdk_collections__WEBPACK_IMPORTED_MODULE_7__["_RecycleViewRepeaterStrategy"] }, ])] }); CdkVirtualForOf.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ViewContainerRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["TemplateRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["IterableDiffers"] }, { type: _angular_cdk_collections__WEBPACK_IMPORTED_MODULE_7__["_RecycleViewRepeaterStrategy"], decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_cdk_collections__WEBPACK_IMPORTED_MODULE_7__["_VIEW_REPEATER_STRATEGY"],] }] }, { type: CdkVirtualScrollViewport, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["SkipSelf"] }] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] } ]; CdkVirtualForOf.propDecorators = { cdkVirtualForOf: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"] }], cdkVirtualForTrackBy: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"] }], cdkVirtualForTemplate: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"] }], cdkVirtualForTemplateCacheSize: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](CdkVirtualForOf, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Directive"], args: [{ selector: '[cdkVirtualFor][cdkVirtualForOf]', providers: [ { provide: _angular_cdk_collections__WEBPACK_IMPORTED_MODULE_7__["_VIEW_REPEATER_STRATEGY"], useClass: _angular_cdk_collections__WEBPACK_IMPORTED_MODULE_7__["_RecycleViewRepeaterStrategy"] }, ] }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ViewContainerRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["TemplateRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["IterableDiffers"] }, { type: _angular_cdk_collections__WEBPACK_IMPORTED_MODULE_7__["_RecycleViewRepeaterStrategy"], decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_cdk_collections__WEBPACK_IMPORTED_MODULE_7__["_VIEW_REPEATER_STRATEGY"]] }] }, { type: CdkVirtualScrollViewport, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["SkipSelf"] }] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }]; }, { cdkVirtualForOf: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"] }], cdkVirtualForTrackBy: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"] }], cdkVirtualForTemplate: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"] }], cdkVirtualForTemplateCacheSize: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"] }] }); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ class CdkScrollableModule { } CdkScrollableModule.ɵmod = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineNgModule"]({ type: CdkScrollableModule }); CdkScrollableModule.ɵinj = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjector"]({ factory: function CdkScrollableModule_Factory(t) { return new (t || CdkScrollableModule)(); } }); (function () { (typeof ngJitMode === "undefined" || ngJitMode) && _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵsetNgModuleScope"](CdkScrollableModule, { declarations: [CdkScrollable], exports: [CdkScrollable] }); })(); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](CdkScrollableModule, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgModule"], args: [{ exports: [CdkScrollable], declarations: [CdkScrollable] }] }], null, null); })(); /** * @docs-primary-export */ class ScrollingModule { } ScrollingModule.ɵmod = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineNgModule"]({ type: ScrollingModule }); ScrollingModule.ɵinj = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjector"]({ factory: function ScrollingModule_Factory(t) { return new (t || ScrollingModule)(); }, imports: [[ _angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_6__["BidiModule"], _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["PlatformModule"], CdkScrollableModule ], _angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_6__["BidiModule"], CdkScrollableModule] }); (function () { (typeof ngJitMode === "undefined" || ngJitMode) && _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵsetNgModuleScope"](ScrollingModule, { declarations: function () { return [CdkFixedSizeVirtualScroll, CdkVirtualForOf, CdkVirtualScrollViewport]; }, imports: function () { return [_angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_6__["BidiModule"], _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["PlatformModule"], CdkScrollableModule]; }, exports: function () { return [_angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_6__["BidiModule"], CdkScrollableModule, CdkFixedSizeVirtualScroll, CdkVirtualForOf, CdkVirtualScrollViewport]; } }); })(); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](ScrollingModule, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgModule"], args: [{ imports: [ _angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_6__["BidiModule"], _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["PlatformModule"], CdkScrollableModule ], exports: [ _angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_6__["BidiModule"], CdkScrollableModule, CdkFixedSizeVirtualScroll, CdkVirtualForOf, CdkVirtualScrollViewport, ], declarations: [ CdkFixedSizeVirtualScroll, CdkVirtualForOf, CdkVirtualScrollViewport, ] }] }], null, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Generated bundle index. Do not edit. */ //# sourceMappingURL=scrolling.js.map /***/ }), /***/ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/table.js": /*!******************************************************************!*\ !*** ./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/table.js ***! \******************************************************************/ /*! exports provided: DataSource, BaseCdkCell, BaseRowDef, CDK_ROW_TEMPLATE, CDK_TABLE, CDK_TABLE_TEMPLATE, CdkCell, CdkCellDef, CdkCellOutlet, CdkColumnDef, CdkFooterCell, CdkFooterCellDef, CdkFooterRow, CdkFooterRowDef, CdkHeaderCell, CdkHeaderCellDef, CdkHeaderRow, CdkHeaderRowDef, CdkNoDataRow, CdkRow, CdkRowDef, CdkTable, CdkTableModule, CdkTextColumn, DataRowOutlet, FooterRowOutlet, HeaderRowOutlet, NoDataRowOutlet, STICKY_DIRECTIONS, StickyStyler, TEXT_COLUMN_OPTIONS, _COALESCED_STYLE_SCHEDULER, _CoalescedStyleScheduler, _Schedule, mixinHasStickyInput */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; __webpack_require__.r(__webpack_exports__); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "BaseCdkCell", function() { return BaseCdkCell; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "BaseRowDef", function() { return BaseRowDef; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CDK_ROW_TEMPLATE", function() { return CDK_ROW_TEMPLATE; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CDK_TABLE", function() { return CDK_TABLE; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CDK_TABLE_TEMPLATE", function() { return CDK_TABLE_TEMPLATE; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkCell", function() { return CdkCell; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkCellDef", function() { return CdkCellDef; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkCellOutlet", function() { return CdkCellOutlet; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkColumnDef", function() { return CdkColumnDef; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkFooterCell", function() { return CdkFooterCell; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkFooterCellDef", function() { return CdkFooterCellDef; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkFooterRow", function() { return CdkFooterRow; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkFooterRowDef", function() { return CdkFooterRowDef; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkHeaderCell", function() { return CdkHeaderCell; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkHeaderCellDef", function() { return CdkHeaderCellDef; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkHeaderRow", function() { return CdkHeaderRow; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkHeaderRowDef", function() { return CdkHeaderRowDef; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkNoDataRow", function() { return CdkNoDataRow; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkRow", function() { return CdkRow; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkRowDef", function() { return CdkRowDef; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkTable", function() { return CdkTable; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkTableModule", function() { return CdkTableModule; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkTextColumn", function() { return CdkTextColumn; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "DataRowOutlet", function() { return DataRowOutlet; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "FooterRowOutlet", function() { return FooterRowOutlet; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HeaderRowOutlet", function() { return HeaderRowOutlet; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NoDataRowOutlet", function() { return NoDataRowOutlet; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "STICKY_DIRECTIONS", function() { return STICKY_DIRECTIONS; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "StickyStyler", function() { return StickyStyler; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "TEXT_COLUMN_OPTIONS", function() { return TEXT_COLUMN_OPTIONS; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "_COALESCED_STYLE_SCHEDULER", function() { return _COALESCED_STYLE_SCHEDULER; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "_CoalescedStyleScheduler", function() { return _CoalescedStyleScheduler; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "_Schedule", function() { return _Schedule; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "mixinHasStickyInput", function() { return mixinHasStickyInput; }); /* harmony import */ var _angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @angular/cdk/bidi */ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/bidi.js"); /* harmony import */ var _angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! @angular/cdk/coercion */ "./node_modules/@angular/cdk/fesm2015/coercion.js"); /* harmony import */ var _angular_cdk_collections__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(/*! @angular/cdk/collections */ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/collections.js"); /* harmony import */ var _angular_core__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(/*! @angular/core */ "./node_modules/@angular/core/__ivy_ngcc__/fesm2015/core.js"); /* harmony import */ var _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__ = __webpack_require__(/*! @angular/cdk/platform */ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/platform.js"); /* harmony reexport (safe) */ __webpack_require__.d(__webpack_exports__, "DataSource", function() { return _angular_cdk_collections__WEBPACK_IMPORTED_MODULE_2__["DataSource"]; }); /* harmony import */ var _angular_common__WEBPACK_IMPORTED_MODULE_5__ = __webpack_require__(/*! @angular/common */ "./node_modules/@angular/common/__ivy_ngcc__/fesm2015/common.js"); /* harmony import */ var rxjs__WEBPACK_IMPORTED_MODULE_6__ = __webpack_require__(/*! rxjs */ "./node_modules/rxjs/_esm2015/index.js"); /* harmony import */ var rxjs_operators__WEBPACK_IMPORTED_MODULE_7__ = __webpack_require__(/*! rxjs/operators */ "./node_modules/rxjs/_esm2015/operators/index.js"); /* harmony import */ var _angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_8__ = __webpack_require__(/*! @angular/cdk/scrolling */ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/scrolling.js"); const _c0 = [[["caption"]], [["colgroup"], ["col"]]]; const _c1 = ["caption", "colgroup, col"]; function CdkTextColumn_th_1_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵelementStart"](0, "th", 3); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵtext"](1); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵelementEnd"](); } if (rf & 2) { const ctx_r0 = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵnextContext"](); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵstyleProp"]("text-align", ctx_r0.justify); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵtextInterpolate1"](" ", ctx_r0.headerText, " "); } } function CdkTextColumn_td_2_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵelementStart"](0, "td", 4); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵtext"](1); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵelementEnd"](); } if (rf & 2) { const data_r2 = ctx.$implicit; const ctx_r1 = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵnextContext"](); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵstyleProp"]("text-align", ctx_r1.justify); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵadvance"](1); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵtextInterpolate1"](" ", ctx_r1.dataAccessor(data_r2, ctx_r1.name), " "); } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Mixin to provide a directive with a function that checks if the sticky input has been * changed since the last time the function was called. Essentially adds a dirty-check to the * sticky value. * @docs-private */ function mixinHasStickyInput(base) { return class extends base { constructor(...args) { super(...args); this._sticky = false; /** Whether the sticky input has changed since it was last checked. */ this._hasStickyChanged = false; } /** Whether sticky positioning should be applied. */ get sticky() { return this._sticky; } set sticky(v) { const prevValue = this._sticky; this._sticky = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_1__["coerceBooleanProperty"])(v); this._hasStickyChanged = prevValue !== this._sticky; } /** Whether the sticky value has changed since this was last called. */ hasStickyChanged() { const hasStickyChanged = this._hasStickyChanged; this._hasStickyChanged = false; return hasStickyChanged; } /** Resets the dirty check for cases where the sticky state has been used without checking. */ resetStickyChanged() { this._hasStickyChanged = false; } }; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Used to provide a table to some of the sub-components without causing a circular dependency. * @docs-private */ const CDK_TABLE = new _angular_core__WEBPACK_IMPORTED_MODULE_3__["InjectionToken"]('CDK_TABLE'); /** Injection token that can be used to specify the text column options. */ const TEXT_COLUMN_OPTIONS = new _angular_core__WEBPACK_IMPORTED_MODULE_3__["InjectionToken"]('text-column-options'); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Cell definition for a CDK table. * Captures the template of a column's data row cell as well as cell-specific properties. */ class CdkCellDef { constructor(/** @docs-private */ template) { this.template = template; } } CdkCellDef.ɵfac = function CdkCellDef_Factory(t) { return new (t || CdkCellDef)(_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["TemplateRef"])); }; CdkCellDef.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdefineDirective"]({ type: CdkCellDef, selectors: [["", "cdkCellDef", ""]] }); CdkCellDef.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["TemplateRef"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵsetClassMetadata"](CdkCellDef, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Directive"], args: [{ selector: '[cdkCellDef]' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["TemplateRef"] }]; }, null); })(); /** * Header cell definition for a CDK table. * Captures the template of a column's header cell and as well as cell-specific properties. */ class CdkHeaderCellDef { constructor(/** @docs-private */ template) { this.template = template; } } CdkHeaderCellDef.ɵfac = function CdkHeaderCellDef_Factory(t) { return new (t || CdkHeaderCellDef)(_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["TemplateRef"])); }; CdkHeaderCellDef.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdefineDirective"]({ type: CdkHeaderCellDef, selectors: [["", "cdkHeaderCellDef", ""]] }); CdkHeaderCellDef.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["TemplateRef"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵsetClassMetadata"](CdkHeaderCellDef, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Directive"], args: [{ selector: '[cdkHeaderCellDef]' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["TemplateRef"] }]; }, null); })(); /** * Footer cell definition for a CDK table. * Captures the template of a column's footer cell and as well as cell-specific properties. */ class CdkFooterCellDef { constructor(/** @docs-private */ template) { this.template = template; } } CdkFooterCellDef.ɵfac = function CdkFooterCellDef_Factory(t) { return new (t || CdkFooterCellDef)(_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["TemplateRef"])); }; CdkFooterCellDef.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdefineDirective"]({ type: CdkFooterCellDef, selectors: [["", "cdkFooterCellDef", ""]] }); CdkFooterCellDef.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["TemplateRef"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵsetClassMetadata"](CdkFooterCellDef, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Directive"], args: [{ selector: '[cdkFooterCellDef]' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["TemplateRef"] }]; }, null); })(); // Boilerplate for applying mixins to CdkColumnDef. /** @docs-private */ class CdkColumnDefBase { } const _CdkColumnDefBase = mixinHasStickyInput(CdkColumnDefBase); /** * Column definition for the CDK table. * Defines a set of cells available for a table column. */ class CdkColumnDef extends _CdkColumnDefBase { constructor(_table) { super(); this._table = _table; this._stickyEnd = false; } /** Unique name for this column. */ get name() { return this._name; } set name(name) { this._setNameInput(name); } /** * Whether this column should be sticky positioned on the end of the row. Should make sure * that it mimics the `CanStick` mixin such that `_hasStickyChanged` is set to true if the value * has been changed. */ get stickyEnd() { return this._stickyEnd; } set stickyEnd(v) { const prevValue = this._stickyEnd; this._stickyEnd = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_1__["coerceBooleanProperty"])(v); this._hasStickyChanged = prevValue !== this._stickyEnd; } /** * Overridable method that sets the css classes that will be added to every cell in this * column. * In the future, columnCssClassName will change from type string[] to string and this * will set a single string value. * @docs-private */ _updateColumnCssClassName() { this._columnCssClassName = [`cdk-column-${this.cssClassFriendlyName}`]; } /** * This has been extracted to a util because of TS 4 and VE. * View Engine doesn't support property rename inheritance. * TS 4.0 doesn't allow properties to override accessors or vice-versa. * @docs-private */ _setNameInput(value) { // If the directive is set without a name (updated programatically), then this setter will // trigger with an empty string and should not overwrite the programatically set value. if (value) { this._name = value; this.cssClassFriendlyName = value.replace(/[^a-z0-9_-]/ig, '-'); this._updateColumnCssClassName(); } } } CdkColumnDef.ɵfac = function CdkColumnDef_Factory(t) { return new (t || CdkColumnDef)(_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](CDK_TABLE, 8)); }; CdkColumnDef.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdefineDirective"]({ type: CdkColumnDef, selectors: [["", "cdkColumnDef", ""]], contentQueries: function CdkColumnDef_ContentQueries(rf, ctx, dirIndex) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵcontentQuery"](dirIndex, CdkCellDef, true); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵcontentQuery"](dirIndex, CdkHeaderCellDef, true); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵcontentQuery"](dirIndex, CdkFooterCellDef, true); } if (rf & 2) { var _t; _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵqueryRefresh"](_t = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵloadQuery"]()) && (ctx.cell = _t.first); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵqueryRefresh"](_t = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵloadQuery"]()) && (ctx.headerCell = _t.first); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵqueryRefresh"](_t = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵloadQuery"]()) && (ctx.footerCell = _t.first); } }, inputs: { sticky: "sticky", name: ["cdkColumnDef", "name"], stickyEnd: "stickyEnd" }, features: [_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵProvidersFeature"]([{ provide: 'MAT_SORT_HEADER_COLUMN_DEF', useExisting: CdkColumnDef }]), _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵInheritDefinitionFeature"]] }); CdkColumnDef.ctorParameters = () => [ { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Inject"], args: [CDK_TABLE,] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Optional"] }] } ]; CdkColumnDef.propDecorators = { name: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Input"], args: ['cdkColumnDef',] }], stickyEnd: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Input"], args: ['stickyEnd',] }], cell: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ContentChild"], args: [CdkCellDef,] }], headerCell: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ContentChild"], args: [CdkHeaderCellDef,] }], footerCell: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ContentChild"], args: [CdkFooterCellDef,] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵsetClassMetadata"](CdkColumnDef, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Directive"], args: [{ selector: '[cdkColumnDef]', inputs: ['sticky'], providers: [{ provide: 'MAT_SORT_HEADER_COLUMN_DEF', useExisting: CdkColumnDef }] }] }], function () { return [{ type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Inject"], args: [CDK_TABLE] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Optional"] }] }]; }, { name: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Input"], args: ['cdkColumnDef'] }], stickyEnd: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Input"], args: ['stickyEnd'] }], cell: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ContentChild"], args: [CdkCellDef] }], headerCell: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ContentChild"], args: [CdkHeaderCellDef] }], footerCell: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ContentChild"], args: [CdkFooterCellDef] }] }); })(); /** Base class for the cells. Adds a CSS classname that identifies the column it renders in. */ class BaseCdkCell { constructor(columnDef, elementRef) { // If IE 11 is dropped before we switch to setting a single class name, change to multi param // with destructuring. const classList = elementRef.nativeElement.classList; for (const className of columnDef._columnCssClassName) { classList.add(className); } } } /** Header cell template container that adds the right classes and role. */ class CdkHeaderCell extends BaseCdkCell { constructor(columnDef, elementRef) { super(columnDef, elementRef); } } CdkHeaderCell.ɵfac = function CdkHeaderCell_Factory(t) { return new (t || CdkHeaderCell)(_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](CdkColumnDef), _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["ElementRef"])); }; CdkHeaderCell.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdefineDirective"]({ type: CdkHeaderCell, selectors: [["cdk-header-cell"], ["th", "cdk-header-cell", ""]], hostAttrs: ["role", "columnheader", 1, "cdk-header-cell"], features: [_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵInheritDefinitionFeature"]] }); CdkHeaderCell.ctorParameters = () => [ { type: CdkColumnDef }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ElementRef"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵsetClassMetadata"](CdkHeaderCell, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Directive"], args: [{ selector: 'cdk-header-cell, th[cdk-header-cell]', host: { 'class': 'cdk-header-cell', 'role': 'columnheader' } }] }], function () { return [{ type: CdkColumnDef }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ElementRef"] }]; }, null); })(); /** Footer cell template container that adds the right classes and role. */ class CdkFooterCell extends BaseCdkCell { constructor(columnDef, elementRef) { super(columnDef, elementRef); } } CdkFooterCell.ɵfac = function CdkFooterCell_Factory(t) { return new (t || CdkFooterCell)(_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](CdkColumnDef), _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["ElementRef"])); }; CdkFooterCell.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdefineDirective"]({ type: CdkFooterCell, selectors: [["cdk-footer-cell"], ["td", "cdk-footer-cell", ""]], hostAttrs: ["role", "gridcell", 1, "cdk-footer-cell"], features: [_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵInheritDefinitionFeature"]] }); CdkFooterCell.ctorParameters = () => [ { type: CdkColumnDef }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ElementRef"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵsetClassMetadata"](CdkFooterCell, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Directive"], args: [{ selector: 'cdk-footer-cell, td[cdk-footer-cell]', host: { 'class': 'cdk-footer-cell', 'role': 'gridcell' } }] }], function () { return [{ type: CdkColumnDef }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ElementRef"] }]; }, null); })(); /** Cell template container that adds the right classes and role. */ class CdkCell extends BaseCdkCell { constructor(columnDef, elementRef) { super(columnDef, elementRef); } } CdkCell.ɵfac = function CdkCell_Factory(t) { return new (t || CdkCell)(_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](CdkColumnDef), _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["ElementRef"])); }; CdkCell.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdefineDirective"]({ type: CdkCell, selectors: [["cdk-cell"], ["td", "cdk-cell", ""]], hostAttrs: ["role", "gridcell", 1, "cdk-cell"], features: [_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵInheritDefinitionFeature"]] }); CdkCell.ctorParameters = () => [ { type: CdkColumnDef }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ElementRef"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵsetClassMetadata"](CdkCell, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Directive"], args: [{ selector: 'cdk-cell, td[cdk-cell]', host: { 'class': 'cdk-cell', 'role': 'gridcell' } }] }], function () { return [{ type: CdkColumnDef }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ElementRef"] }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @docs-private */ class _Schedule { constructor() { this.tasks = []; this.endTasks = []; } } /** Injection token used to provide a coalesced style scheduler. */ const _COALESCED_STYLE_SCHEDULER = new _angular_core__WEBPACK_IMPORTED_MODULE_3__["InjectionToken"]('_COALESCED_STYLE_SCHEDULER'); /** * Allows grouping up CSSDom mutations after the current execution context. * This can significantly improve performance when separate consecutive functions are * reading from the CSSDom and then mutating it. * * @docs-private */ class _CoalescedStyleScheduler { constructor(_ngZone) { this._ngZone = _ngZone; this._currentSchedule = null; this._destroyed = new rxjs__WEBPACK_IMPORTED_MODULE_6__["Subject"](); } /** * Schedules the specified task to run at the end of the current VM turn. */ schedule(task) { this._createScheduleIfNeeded(); this._currentSchedule.tasks.push(task); } /** * Schedules the specified task to run after other scheduled tasks at the end of the current * VM turn. */ scheduleEnd(task) { this._createScheduleIfNeeded(); this._currentSchedule.endTasks.push(task); } /** Prevent any further tasks from running. */ ngOnDestroy() { this._destroyed.next(); this._destroyed.complete(); } _createScheduleIfNeeded() { if (this._currentSchedule) { return; } this._currentSchedule = new _Schedule(); this._getScheduleObservable().pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_7__["takeUntil"])(this._destroyed)).subscribe(() => { while (this._currentSchedule.tasks.length || this._currentSchedule.endTasks.length) { const schedule = this._currentSchedule; // Capture new tasks scheduled by the current set of tasks. this._currentSchedule = new _Schedule(); for (const task of schedule.tasks) { task(); } for (const task of schedule.endTasks) { task(); } } this._currentSchedule = null; }); } _getScheduleObservable() { // Use onStable when in the context of an ongoing change detection cycle so that we // do not accidentally trigger additional cycles. return this._ngZone.isStable ? Object(rxjs__WEBPACK_IMPORTED_MODULE_6__["from"])(Promise.resolve(undefined)) : this._ngZone.onStable.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_7__["take"])(1)); } } _CoalescedStyleScheduler.ɵfac = function _CoalescedStyleScheduler_Factory(t) { return new (t || _CoalescedStyleScheduler)(_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵinject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["NgZone"])); }; _CoalescedStyleScheduler.ɵprov = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdefineInjectable"]({ token: _CoalescedStyleScheduler, factory: _CoalescedStyleScheduler.ɵfac }); _CoalescedStyleScheduler.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["NgZone"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵsetClassMetadata"](_CoalescedStyleScheduler, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Injectable"] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["NgZone"] }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * The row template that can be used by the mat-table. Should not be used outside of the * material library. */ const CDK_ROW_TEMPLATE = ``; /** * Base class for the CdkHeaderRowDef and CdkRowDef that handles checking their columns inputs * for changes and notifying the table. */ class BaseRowDef { constructor( /** @docs-private */ template, _differs) { this.template = template; this._differs = _differs; } ngOnChanges(changes) { // Create a new columns differ if one does not yet exist. Initialize it based on initial value // of the columns property or an empty array if none is provided. if (!this._columnsDiffer) { const columns = (changes['columns'] && changes['columns'].currentValue) || []; this._columnsDiffer = this._differs.find(columns).create(); this._columnsDiffer.diff(columns); } } /** * Returns the difference between the current columns and the columns from the last diff, or null * if there is no difference. */ getColumnsDiff() { return this._columnsDiffer.diff(this.columns); } /** Gets this row def's relevant cell template from the provided column def. */ extractCellTemplate(column) { if (this instanceof CdkHeaderRowDef) { return column.headerCell.template; } if (this instanceof CdkFooterRowDef) { return column.footerCell.template; } else { return column.cell.template; } } } BaseRowDef.ɵfac = function BaseRowDef_Factory(t) { return new (t || BaseRowDef)(_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["TemplateRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["IterableDiffers"])); }; BaseRowDef.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdefineDirective"]({ type: BaseRowDef, features: [_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵNgOnChangesFeature"]] }); BaseRowDef.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["TemplateRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["IterableDiffers"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵsetClassMetadata"](BaseRowDef, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Directive"] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["TemplateRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["IterableDiffers"] }]; }, null); })(); // Boilerplate for applying mixins to CdkHeaderRowDef. /** @docs-private */ class CdkHeaderRowDefBase extends BaseRowDef { } const _CdkHeaderRowDefBase = mixinHasStickyInput(CdkHeaderRowDefBase); /** * Header row definition for the CDK table. * Captures the header row's template and other header properties such as the columns to display. */ class CdkHeaderRowDef extends _CdkHeaderRowDefBase { constructor(template, _differs, _table) { super(template, _differs); this._table = _table; } // Prerender fails to recognize that ngOnChanges in a part of this class through inheritance. // Explicitly define it so that the method is called as part of the Angular lifecycle. ngOnChanges(changes) { super.ngOnChanges(changes); } } CdkHeaderRowDef.ɵfac = function CdkHeaderRowDef_Factory(t) { return new (t || CdkHeaderRowDef)(_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["TemplateRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["IterableDiffers"]), _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](CDK_TABLE, 8)); }; CdkHeaderRowDef.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdefineDirective"]({ type: CdkHeaderRowDef, selectors: [["", "cdkHeaderRowDef", ""]], inputs: { columns: ["cdkHeaderRowDef", "columns"], sticky: ["cdkHeaderRowDefSticky", "sticky"] }, features: [_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵInheritDefinitionFeature"], _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵNgOnChangesFeature"]] }); CdkHeaderRowDef.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["TemplateRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["IterableDiffers"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Inject"], args: [CDK_TABLE,] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Optional"] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵsetClassMetadata"](CdkHeaderRowDef, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Directive"], args: [{ selector: '[cdkHeaderRowDef]', inputs: ['columns: cdkHeaderRowDef', 'sticky: cdkHeaderRowDefSticky'] }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["TemplateRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["IterableDiffers"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Inject"], args: [CDK_TABLE] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Optional"] }] }]; }, null); })(); // Boilerplate for applying mixins to CdkFooterRowDef. /** @docs-private */ class CdkFooterRowDefBase extends BaseRowDef { } const _CdkFooterRowDefBase = mixinHasStickyInput(CdkFooterRowDefBase); /** * Footer row definition for the CDK table. * Captures the footer row's template and other footer properties such as the columns to display. */ class CdkFooterRowDef extends _CdkFooterRowDefBase { constructor(template, _differs, _table) { super(template, _differs); this._table = _table; } // Prerender fails to recognize that ngOnChanges in a part of this class through inheritance. // Explicitly define it so that the method is called as part of the Angular lifecycle. ngOnChanges(changes) { super.ngOnChanges(changes); } } CdkFooterRowDef.ɵfac = function CdkFooterRowDef_Factory(t) { return new (t || CdkFooterRowDef)(_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["TemplateRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["IterableDiffers"]), _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](CDK_TABLE, 8)); }; CdkFooterRowDef.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdefineDirective"]({ type: CdkFooterRowDef, selectors: [["", "cdkFooterRowDef", ""]], inputs: { columns: ["cdkFooterRowDef", "columns"], sticky: ["cdkFooterRowDefSticky", "sticky"] }, features: [_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵInheritDefinitionFeature"], _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵNgOnChangesFeature"]] }); CdkFooterRowDef.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["TemplateRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["IterableDiffers"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Inject"], args: [CDK_TABLE,] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Optional"] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵsetClassMetadata"](CdkFooterRowDef, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Directive"], args: [{ selector: '[cdkFooterRowDef]', inputs: ['columns: cdkFooterRowDef', 'sticky: cdkFooterRowDefSticky'] }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["TemplateRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["IterableDiffers"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Inject"], args: [CDK_TABLE] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Optional"] }] }]; }, null); })(); /** * Data row definition for the CDK table. * Captures the header row's template and other row properties such as the columns to display and * a when predicate that describes when this row should be used. */ class CdkRowDef extends BaseRowDef { // TODO(andrewseguin): Add an input for providing a switch function to determine // if this template should be used. constructor(template, _differs, _table) { super(template, _differs); this._table = _table; } } CdkRowDef.ɵfac = function CdkRowDef_Factory(t) { return new (t || CdkRowDef)(_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["TemplateRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["IterableDiffers"]), _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](CDK_TABLE, 8)); }; CdkRowDef.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdefineDirective"]({ type: CdkRowDef, selectors: [["", "cdkRowDef", ""]], inputs: { columns: ["cdkRowDefColumns", "columns"], when: ["cdkRowDefWhen", "when"] }, features: [_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵInheritDefinitionFeature"]] }); CdkRowDef.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["TemplateRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["IterableDiffers"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Inject"], args: [CDK_TABLE,] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Optional"] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵsetClassMetadata"](CdkRowDef, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Directive"], args: [{ selector: '[cdkRowDef]', inputs: ['columns: cdkRowDefColumns', 'when: cdkRowDefWhen'] }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["TemplateRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["IterableDiffers"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Inject"], args: [CDK_TABLE] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Optional"] }] }]; }, null); })(); /** * Outlet for rendering cells inside of a row or header row. * @docs-private */ class CdkCellOutlet { constructor(_viewContainer) { this._viewContainer = _viewContainer; CdkCellOutlet.mostRecentCellOutlet = this; } ngOnDestroy() { // If this was the last outlet being rendered in the view, remove the reference // from the static property after it has been destroyed to avoid leaking memory. if (CdkCellOutlet.mostRecentCellOutlet === this) { CdkCellOutlet.mostRecentCellOutlet = null; } } } CdkCellOutlet.ɵfac = function CdkCellOutlet_Factory(t) { return new (t || CdkCellOutlet)(_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewContainerRef"])); }; CdkCellOutlet.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdefineDirective"]({ type: CdkCellOutlet, selectors: [["", "cdkCellOutlet", ""]] }); /** * Static property containing the latest constructed instance of this class. * Used by the CDK table when each CdkHeaderRow and CdkRow component is created using * createEmbeddedView. After one of these components are created, this property will provide * a handle to provide that component's cells and context. After init, the CdkCellOutlet will * construct the cells with the provided context. */ CdkCellOutlet.mostRecentCellOutlet = null; CdkCellOutlet.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewContainerRef"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵsetClassMetadata"](CdkCellOutlet, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Directive"], args: [{ selector: '[cdkCellOutlet]' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewContainerRef"] }]; }, null); })(); /** Header template container that contains the cell outlet. Adds the right class and role. */ class CdkHeaderRow { } CdkHeaderRow.ɵfac = function CdkHeaderRow_Factory(t) { return new (t || CdkHeaderRow)(); }; CdkHeaderRow.ɵcmp = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdefineComponent"]({ type: CdkHeaderRow, selectors: [["cdk-header-row"], ["tr", "cdk-header-row", ""]], hostAttrs: ["role", "row", 1, "cdk-header-row"], decls: 1, vars: 0, consts: [["cdkCellOutlet", ""]], template: function CdkHeaderRow_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵelementContainer"](0, 0); } }, directives: [CdkCellOutlet], encapsulation: 2 }); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵsetClassMetadata"](CdkHeaderRow, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Component"], args: [{ selector: 'cdk-header-row, tr[cdk-header-row]', template: CDK_ROW_TEMPLATE, host: { 'class': 'cdk-header-row', 'role': 'row' }, // See note on CdkTable for explanation on why this uses the default change detection strategy. // tslint:disable-next-line:validate-decorators changeDetection: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ChangeDetectionStrategy"].Default, encapsulation: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewEncapsulation"].None }] }], null, null); })(); /** Footer template container that contains the cell outlet. Adds the right class and role. */ class CdkFooterRow { } CdkFooterRow.ɵfac = function CdkFooterRow_Factory(t) { return new (t || CdkFooterRow)(); }; CdkFooterRow.ɵcmp = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdefineComponent"]({ type: CdkFooterRow, selectors: [["cdk-footer-row"], ["tr", "cdk-footer-row", ""]], hostAttrs: ["role", "row", 1, "cdk-footer-row"], decls: 1, vars: 0, consts: [["cdkCellOutlet", ""]], template: function CdkFooterRow_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵelementContainer"](0, 0); } }, directives: [CdkCellOutlet], encapsulation: 2 }); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵsetClassMetadata"](CdkFooterRow, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Component"], args: [{ selector: 'cdk-footer-row, tr[cdk-footer-row]', template: CDK_ROW_TEMPLATE, host: { 'class': 'cdk-footer-row', 'role': 'row' }, // See note on CdkTable for explanation on why this uses the default change detection strategy. // tslint:disable-next-line:validate-decorators changeDetection: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ChangeDetectionStrategy"].Default, encapsulation: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewEncapsulation"].None }] }], null, null); })(); /** Data row template container that contains the cell outlet. Adds the right class and role. */ class CdkRow { } CdkRow.ɵfac = function CdkRow_Factory(t) { return new (t || CdkRow)(); }; CdkRow.ɵcmp = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdefineComponent"]({ type: CdkRow, selectors: [["cdk-row"], ["tr", "cdk-row", ""]], hostAttrs: ["role", "row", 1, "cdk-row"], decls: 1, vars: 0, consts: [["cdkCellOutlet", ""]], template: function CdkRow_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵelementContainer"](0, 0); } }, directives: [CdkCellOutlet], encapsulation: 2 }); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵsetClassMetadata"](CdkRow, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Component"], args: [{ selector: 'cdk-row, tr[cdk-row]', template: CDK_ROW_TEMPLATE, host: { 'class': 'cdk-row', 'role': 'row' }, // See note on CdkTable for explanation on why this uses the default change detection strategy. // tslint:disable-next-line:validate-decorators changeDetection: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ChangeDetectionStrategy"].Default, encapsulation: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewEncapsulation"].None }] }], null, null); })(); /** Row that can be used to display a message when no data is shown in the table. */ class CdkNoDataRow { constructor(templateRef) { this.templateRef = templateRef; } } CdkNoDataRow.ɵfac = function CdkNoDataRow_Factory(t) { return new (t || CdkNoDataRow)(_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["TemplateRef"])); }; CdkNoDataRow.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdefineDirective"]({ type: CdkNoDataRow, selectors: [["ng-template", "cdkNoDataRow", ""]] }); CdkNoDataRow.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["TemplateRef"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵsetClassMetadata"](CdkNoDataRow, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Directive"], args: [{ selector: 'ng-template[cdkNoDataRow]' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["TemplateRef"] }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * List of all possible directions that can be used for sticky positioning. * @docs-private */ const STICKY_DIRECTIONS = ['top', 'bottom', 'left', 'right']; /** * Applies and removes sticky positioning styles to the `CdkTable` rows and columns cells. * @docs-private */ class StickyStyler { /** * @param _isNativeHtmlTable Whether the sticky logic should be based on a table * that uses the native `` element. * @param _stickCellCss The CSS class that will be applied to every row/cell that has * sticky positioning applied. * @param direction The directionality context of the table (ltr/rtl); affects column positioning * by reversing left/right positions. * @param _isBrowser Whether the table is currently being rendered on the server or the client. * @param _needsPositionStickyOnElement Whether we need to specify position: sticky on cells * using inline styles. If false, it is assumed that position: sticky is included in * the component stylesheet for _stickCellCss. */ constructor(_isNativeHtmlTable, _stickCellCss, direction, /** * @deprecated `_coalescedStyleScheduler` parameter to become required. * @breaking-change 11.0.0 */ _coalescedStyleScheduler, _isBrowser = true, _needsPositionStickyOnElement = true) { this._isNativeHtmlTable = _isNativeHtmlTable; this._stickCellCss = _stickCellCss; this.direction = direction; this._coalescedStyleScheduler = _coalescedStyleScheduler; this._isBrowser = _isBrowser; this._needsPositionStickyOnElement = _needsPositionStickyOnElement; } /** * Clears the sticky positioning styles from the row and its cells by resetting the `position` * style, setting the zIndex to 0, and unsetting each provided sticky direction. * @param rows The list of rows that should be cleared from sticking in the provided directions * @param stickyDirections The directions that should no longer be set as sticky on the rows. */ clearStickyPositioning(rows, stickyDirections) { const elementsToClear = []; for (const row of rows) { // If the row isn't an element (e.g. if it's an `ng-container`), // it won't have inline styles or `children` so we skip it. if (row.nodeType !== row.ELEMENT_NODE) { continue; } elementsToClear.push(row); for (let i = 0; i < row.children.length; i++) { elementsToClear.push(row.children[i]); } } // Coalesce with sticky row/column updates (and potentially other changes like column resize). this._scheduleStyleChanges(() => { for (const element of elementsToClear) { this._removeStickyStyle(element, stickyDirections); } }); } /** * Applies sticky left and right positions to the cells of each row according to the sticky * states of the rendered column definitions. * @param rows The rows that should have its set of cells stuck according to the sticky states. * @param stickyStartStates A list of boolean states where each state represents whether the cell * in this index position should be stuck to the start of the row. * @param stickyEndStates A list of boolean states where each state represents whether the cell * in this index position should be stuck to the end of the row. */ updateStickyColumns(rows, stickyStartStates, stickyEndStates) { if (!rows.length || !this._isBrowser || !(stickyStartStates.some(state => state) || stickyEndStates.some(state => state))) { return; } const firstRow = rows[0]; const numCells = firstRow.children.length; const cellWidths = this._getCellWidths(firstRow); const startPositions = this._getStickyStartColumnPositions(cellWidths, stickyStartStates); const endPositions = this._getStickyEndColumnPositions(cellWidths, stickyEndStates); // Coalesce with sticky row updates (and potentially other changes like column resize). this._scheduleStyleChanges(() => { const isRtl = this.direction === 'rtl'; const start = isRtl ? 'right' : 'left'; const end = isRtl ? 'left' : 'right'; for (const row of rows) { for (let i = 0; i < numCells; i++) { const cell = row.children[i]; if (stickyStartStates[i]) { this._addStickyStyle(cell, start, startPositions[i]); } if (stickyEndStates[i]) { this._addStickyStyle(cell, end, endPositions[i]); } } } }); } /** * Applies sticky positioning to the row's cells if using the native table layout, and to the * row itself otherwise. * @param rowsToStick The list of rows that should be stuck according to their corresponding * sticky state and to the provided top or bottom position. * @param stickyStates A list of boolean states where each state represents whether the row * should be stuck in the particular top or bottom position. * @param position The position direction in which the row should be stuck if that row should be * sticky. * */ stickRows(rowsToStick, stickyStates, position) { // Since we can't measure the rows on the server, we can't stick the rows properly. if (!this._isBrowser) { return; } // If positioning the rows to the bottom, reverse their order when evaluating the sticky // position such that the last row stuck will be "bottom: 0px" and so on. Note that the // sticky states need to be reversed as well. const rows = position === 'bottom' ? rowsToStick.slice().reverse() : rowsToStick; const states = position === 'bottom' ? stickyStates.slice().reverse() : stickyStates; // Measure row heights all at once before adding sticky styles to reduce layout thrashing. const stickyHeights = []; const elementsToStick = []; for (let rowIndex = 0, stickyHeight = 0; rowIndex < rows.length; rowIndex++) { stickyHeights[rowIndex] = stickyHeight; if (!states[rowIndex]) { continue; } const row = rows[rowIndex]; elementsToStick[rowIndex] = this._isNativeHtmlTable ? Array.from(row.children) : [row]; if (rowIndex !== rows.length - 1) { stickyHeight += row.getBoundingClientRect().height; } } // Coalesce with other sticky row updates (top/bottom), sticky columns updates // (and potentially other changes like column resize). this._scheduleStyleChanges(() => { for (let rowIndex = 0; rowIndex < rows.length; rowIndex++) { if (!states[rowIndex]) { continue; } const height = stickyHeights[rowIndex]; for (const element of elementsToStick[rowIndex]) { this._addStickyStyle(element, position, height); } } }); } /** * When using the native table in Safari, sticky footer cells do not stick. The only way to stick * footer rows is to apply sticky styling to the tfoot container. This should only be done if * all footer rows are sticky. If not all footer rows are sticky, remove sticky positioning from * the tfoot element. */ updateStickyFooterContainer(tableElement, stickyStates) { if (!this._isNativeHtmlTable) { return; } const tfoot = tableElement.querySelector('tfoot'); // Coalesce with other sticky updates (and potentially other changes like column resize). this._scheduleStyleChanges(() => { if (stickyStates.some(state => !state)) { this._removeStickyStyle(tfoot, ['bottom']); } else { this._addStickyStyle(tfoot, 'bottom', 0); } }); } /** * Removes the sticky style on the element by removing the sticky cell CSS class, re-evaluating * the zIndex, removing each of the provided sticky directions, and removing the * sticky position if there are no more directions. */ _removeStickyStyle(element, stickyDirections) { for (const dir of stickyDirections) { element.style[dir] = ''; } // If the element no longer has any more sticky directions, remove sticky positioning and // the sticky CSS class. // Short-circuit checking element.style[dir] for stickyDirections as they // were already removed above. const hasDirection = STICKY_DIRECTIONS.some(dir => stickyDirections.indexOf(dir) === -1 && element.style[dir]); if (hasDirection) { element.style.zIndex = this._getCalculatedZIndex(element); } else { // When not hasDirection, _getCalculatedZIndex will always return ''. element.style.zIndex = ''; if (this._needsPositionStickyOnElement) { element.style.position = ''; } element.classList.remove(this._stickCellCss); } } /** * Adds the sticky styling to the element by adding the sticky style class, changing position * to be sticky (and -webkit-sticky), setting the appropriate zIndex, and adding a sticky * direction and value. */ _addStickyStyle(element, dir, dirValue) { element.classList.add(this._stickCellCss); element.style[dir] = `${dirValue}px`; element.style.zIndex = this._getCalculatedZIndex(element); if (this._needsPositionStickyOnElement) { element.style.cssText += 'position: -webkit-sticky; position: sticky; '; } } /** * Calculate what the z-index should be for the element, depending on what directions (top, * bottom, left, right) have been set. It should be true that elements with a top direction * should have the highest index since these are elements like a table header. If any of those * elements are also sticky in another direction, then they should appear above other elements * that are only sticky top (e.g. a sticky column on a sticky header). Bottom-sticky elements * (e.g. footer rows) should then be next in the ordering such that they are below the header * but above any non-sticky elements. Finally, left/right sticky elements (e.g. sticky columns) * should minimally increment so that they are above non-sticky elements but below top and bottom * elements. */ _getCalculatedZIndex(element) { const zIndexIncrements = { top: 100, bottom: 10, left: 1, right: 1, }; let zIndex = 0; // Use `Iterable` instead of `Array` because TypeScript, as of 3.6.3, // loses the array generic type in the `for of`. But we *also* have to use `Array` because // typescript won't iterate over an `Iterable` unless you compile with `--downlevelIteration` for (const dir of STICKY_DIRECTIONS) { if (element.style[dir]) { zIndex += zIndexIncrements[dir]; } } return zIndex ? `${zIndex}` : ''; } /** Gets the widths for each cell in the provided row. */ _getCellWidths(row) { const cellWidths = []; const firstRowCells = row.children; for (let i = 0; i < firstRowCells.length; i++) { let cell = firstRowCells[i]; cellWidths.push(cell.getBoundingClientRect().width); } return cellWidths; } /** * Determines the left and right positions of each sticky column cell, which will be the * accumulation of all sticky column cell widths to the left and right, respectively. * Non-sticky cells do not need to have a value set since their positions will not be applied. */ _getStickyStartColumnPositions(widths, stickyStates) { const positions = []; let nextPosition = 0; for (let i = 0; i < widths.length; i++) { if (stickyStates[i]) { positions[i] = nextPosition; nextPosition += widths[i]; } } return positions; } /** * Determines the left and right positions of each sticky column cell, which will be the * accumulation of all sticky column cell widths to the left and right, respectively. * Non-sticky cells do not need to have a value set since their positions will not be applied. */ _getStickyEndColumnPositions(widths, stickyStates) { const positions = []; let nextPosition = 0; for (let i = widths.length; i > 0; i--) { if (stickyStates[i]) { positions[i] = nextPosition; nextPosition += widths[i]; } } return positions; } /** * Schedules styles to be applied when the style scheduler deems appropriate. * @breaking-change 11.0.0 This method can be removed in favor of calling * `CoalescedStyleScheduler.schedule` directly once the scheduler is a required parameter. */ _scheduleStyleChanges(changes) { if (this._coalescedStyleScheduler) { this._coalescedStyleScheduler.schedule(changes); } else { changes(); } } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Returns an error to be thrown when attempting to find an unexisting column. * @param id Id whose lookup failed. * @docs-private */ function getTableUnknownColumnError(id) { return Error(`Could not find column with id "${id}".`); } /** * Returns an error to be thrown when two column definitions have the same name. * @docs-private */ function getTableDuplicateColumnNameError(name) { return Error(`Duplicate column definition name provided: "${name}".`); } /** * Returns an error to be thrown when there are multiple rows that are missing a when function. * @docs-private */ function getTableMultipleDefaultRowDefsError() { return Error(`There can only be one default row without a when predicate function.`); } /** * Returns an error to be thrown when there are no matching row defs for a particular set of data. * @docs-private */ function getTableMissingMatchingRowDefError(data) { return Error(`Could not find a matching row definition for the` + `provided row data: ${JSON.stringify(data)}`); } /** * Returns an error to be thrown when there is no row definitions present in the content. * @docs-private */ function getTableMissingRowDefsError() { return Error('Missing definitions for header, footer, and row; ' + 'cannot determine which columns should be rendered.'); } /** * Returns an error to be thrown when the data source does not match the compatible types. * @docs-private */ function getTableUnknownDataSourceError() { return Error(`Provided data source did not match an array, Observable, or DataSource`); } /** * Returns an error to be thrown when the text column cannot find a parent table to inject. * @docs-private */ function getTableTextColumnMissingParentTableError() { return Error(`Text column could not find a parent table for registration.`); } /** * Returns an error to be thrown when a table text column doesn't have a name. * @docs-private */ function getTableTextColumnMissingNameError() { return Error(`Table text column must have a name.`); } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Provides a handle for the table to grab the view container's ng-container to insert data rows. * @docs-private */ class DataRowOutlet { constructor(viewContainer, elementRef) { this.viewContainer = viewContainer; this.elementRef = elementRef; } } DataRowOutlet.ɵfac = function DataRowOutlet_Factory(t) { return new (t || DataRowOutlet)(_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewContainerRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["ElementRef"])); }; DataRowOutlet.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdefineDirective"]({ type: DataRowOutlet, selectors: [["", "rowOutlet", ""]] }); DataRowOutlet.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewContainerRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ElementRef"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵsetClassMetadata"](DataRowOutlet, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Directive"], args: [{ selector: '[rowOutlet]' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewContainerRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ElementRef"] }]; }, null); })(); /** * Provides a handle for the table to grab the view container's ng-container to insert the header. * @docs-private */ class HeaderRowOutlet { constructor(viewContainer, elementRef) { this.viewContainer = viewContainer; this.elementRef = elementRef; } } HeaderRowOutlet.ɵfac = function HeaderRowOutlet_Factory(t) { return new (t || HeaderRowOutlet)(_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewContainerRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["ElementRef"])); }; HeaderRowOutlet.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdefineDirective"]({ type: HeaderRowOutlet, selectors: [["", "headerRowOutlet", ""]] }); HeaderRowOutlet.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewContainerRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ElementRef"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵsetClassMetadata"](HeaderRowOutlet, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Directive"], args: [{ selector: '[headerRowOutlet]' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewContainerRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ElementRef"] }]; }, null); })(); /** * Provides a handle for the table to grab the view container's ng-container to insert the footer. * @docs-private */ class FooterRowOutlet { constructor(viewContainer, elementRef) { this.viewContainer = viewContainer; this.elementRef = elementRef; } } FooterRowOutlet.ɵfac = function FooterRowOutlet_Factory(t) { return new (t || FooterRowOutlet)(_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewContainerRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["ElementRef"])); }; FooterRowOutlet.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdefineDirective"]({ type: FooterRowOutlet, selectors: [["", "footerRowOutlet", ""]] }); FooterRowOutlet.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewContainerRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ElementRef"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵsetClassMetadata"](FooterRowOutlet, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Directive"], args: [{ selector: '[footerRowOutlet]' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewContainerRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ElementRef"] }]; }, null); })(); /** * Provides a handle for the table to grab the view * container's ng-container to insert the no data row. * @docs-private */ class NoDataRowOutlet { constructor(viewContainer, elementRef) { this.viewContainer = viewContainer; this.elementRef = elementRef; } } NoDataRowOutlet.ɵfac = function NoDataRowOutlet_Factory(t) { return new (t || NoDataRowOutlet)(_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewContainerRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["ElementRef"])); }; NoDataRowOutlet.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdefineDirective"]({ type: NoDataRowOutlet, selectors: [["", "noDataRowOutlet", ""]] }); NoDataRowOutlet.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewContainerRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ElementRef"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵsetClassMetadata"](NoDataRowOutlet, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Directive"], args: [{ selector: '[noDataRowOutlet]' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewContainerRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ElementRef"] }]; }, null); })(); /** * The table template that can be used by the mat-table. Should not be used outside of the * material library. * @docs-private */ const CDK_TABLE_TEMPLATE = // Note that according to MDN, the `caption` element has to be projected as the **first** // element in the table. See https://developer.mozilla.org/en-US/docs/Web/HTML/Element/caption ` `; /** * Class used to conveniently type the embedded view ref for rows with a context. * @docs-private */ class RowViewRef extends _angular_core__WEBPACK_IMPORTED_MODULE_3__["EmbeddedViewRef"] { } /** * A data table that can render a header row, data rows, and a footer row. * Uses the dataSource input to determine the data to be rendered. The data can be provided either * as a data array, an Observable stream that emits the data array to render, or a DataSource with a * connect function that will return an Observable stream that emits the data array to render. */ class CdkTable { constructor(_differs, _changeDetectorRef, _elementRef, role, _dir, _document, _platform, /** * @deprecated `_coalescedStyleScheduler`, `_viewRepeater` and `_viewportRuler` * parameters to become required. * @breaking-change 11.0.0 */ _viewRepeater, _coalescedStyleScheduler) { this._differs = _differs; this._changeDetectorRef = _changeDetectorRef; this._elementRef = _elementRef; this._dir = _dir; this._platform = _platform; this._viewRepeater = _viewRepeater; this._coalescedStyleScheduler = _coalescedStyleScheduler; /** Subject that emits when the component has been destroyed. */ this._onDestroy = new rxjs__WEBPACK_IMPORTED_MODULE_6__["Subject"](); /** * Map of all the user's defined columns (header, data, and footer cell template) identified by * name. Collection populated by the column definitions gathered by `ContentChildren` as well as * any custom column definitions added to `_customColumnDefs`. */ this._columnDefsByName = new Map(); /** * Column definitions that were defined outside of the direct content children of the table. * These will be defined when, e.g., creating a wrapper around the cdkTable that has * column definitions as *its* content child. */ this._customColumnDefs = new Set(); /** * Data row definitions that were defined outside of the direct content children of the table. * These will be defined when, e.g., creating a wrapper around the cdkTable that has * built-in data rows as *its* content child. */ this._customRowDefs = new Set(); /** * Header row definitions that were defined outside of the direct content children of the table. * These will be defined when, e.g., creating a wrapper around the cdkTable that has * built-in header rows as *its* content child. */ this._customHeaderRowDefs = new Set(); /** * Footer row definitions that were defined outside of the direct content children of the table. * These will be defined when, e.g., creating a wrapper around the cdkTable that has a * built-in footer row as *its* content child. */ this._customFooterRowDefs = new Set(); /** * Whether the header row definition has been changed. Triggers an update to the header row after * content is checked. Initialized as true so that the table renders the initial set of rows. */ this._headerRowDefChanged = true; /** * Whether the footer row definition has been changed. Triggers an update to the footer row after * content is checked. Initialized as true so that the table renders the initial set of rows. */ this._footerRowDefChanged = true; /** * Cache of the latest rendered `RenderRow` objects as a map for easy retrieval when constructing * a new list of `RenderRow` objects for rendering rows. Since the new list is constructed with * the cached `RenderRow` objects when possible, the row identity is preserved when the data * and row template matches, which allows the `IterableDiffer` to check rows by reference * and understand which rows are added/moved/removed. * * Implemented as a map of maps where the first key is the `data: T` object and the second is the * `CdkRowDef` object. With the two keys, the cache points to a `RenderRow` object that * contains an array of created pairs. The array is necessary to handle cases where the data * array contains multiple duplicate data objects and each instantiated `RenderRow` must be * stored. */ this._cachedRenderRowsMap = new Map(); /** * CSS class added to any row or cell that has sticky positioning applied. May be overriden by * table subclasses. */ this.stickyCssClass = 'cdk-table-sticky'; /** * Whether to manually add positon: sticky to all sticky cell elements. Not needed if * the position is set in a selector associated with the value of stickyCssClass. May be * overridden by table subclasses */ this.needsPositionStickyOnElement = true; /** Whether the no data row is currently showing anything. */ this._isShowingNoDataRow = false; this._multiTemplateDataRows = false; // TODO(andrewseguin): Remove max value as the end index // and instead calculate the view on init and scroll. /** * Stream containing the latest information on what rows are being displayed on screen. * Can be used by the data source to as a heuristic of what data should be provided. * * @docs-private */ this.viewChange = new rxjs__WEBPACK_IMPORTED_MODULE_6__["BehaviorSubject"]({ start: 0, end: Number.MAX_VALUE }); if (!role) { this._elementRef.nativeElement.setAttribute('role', 'grid'); } this._document = _document; this._isNativeHtmlTable = this._elementRef.nativeElement.nodeName === 'TABLE'; } /** * Tracking function that will be used to check the differences in data changes. Used similarly * to `ngFor` `trackBy` function. Optimize row operations by identifying a row based on its data * relative to the function to know if a row should be added/removed/moved. * Accepts a function that takes two parameters, `index` and `item`. */ get trackBy() { return this._trackByFn; } set trackBy(fn) { if ((typeof ngDevMode === 'undefined' || ngDevMode) && fn != null && typeof fn !== 'function') { console.warn(`trackBy must be a function, but received ${JSON.stringify(fn)}.`); } this._trackByFn = fn; } /** * The table's source of data, which can be provided in three ways (in order of complexity): * - Simple data array (each object represents one table row) * - Stream that emits a data array each time the array changes * - `DataSource` object that implements the connect/disconnect interface. * * If a data array is provided, the table must be notified when the array's objects are * added, removed, or moved. This can be done by calling the `renderRows()` function which will * render the diff since the last table render. If the data array reference is changed, the table * will automatically trigger an update to the rows. * * When providing an Observable stream, the table will trigger an update automatically when the * stream emits a new array of data. * * Finally, when providing a `DataSource` object, the table will use the Observable stream * provided by the connect function and trigger updates when that stream emits new data array * values. During the table's ngOnDestroy or when the data source is removed from the table, the * table will call the DataSource's `disconnect` function (may be useful for cleaning up any * subscriptions registered during the connect process). */ get dataSource() { return this._dataSource; } set dataSource(dataSource) { if (this._dataSource !== dataSource) { this._switchDataSource(dataSource); } } /** * Whether to allow multiple rows per data object by evaluating which rows evaluate their 'when' * predicate to true. If `multiTemplateDataRows` is false, which is the default value, then each * dataobject will render the first row that evaluates its when predicate to true, in the order * defined in the table, or otherwise the default row which does not have a when predicate. */ get multiTemplateDataRows() { return this._multiTemplateDataRows; } set multiTemplateDataRows(v) { this._multiTemplateDataRows = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_1__["coerceBooleanProperty"])(v); // In Ivy if this value is set via a static attribute (e.g.
), // this setter will be invoked before the row outlet has been defined hence the null check. if (this._rowOutlet && this._rowOutlet.viewContainer.length) { this._forceRenderDataRows(); this.updateStickyColumnStyles(); } } ngOnInit() { this._setupStickyStyler(); if (this._isNativeHtmlTable) { this._applyNativeTableSections(); } // Set up the trackBy function so that it uses the `RenderRow` as its identity by default. If // the user has provided a custom trackBy, return the result of that function as evaluated // with the values of the `RenderRow`'s data and index. this._dataDiffer = this._differs.find([]).create((_i, dataRow) => { return this.trackBy ? this.trackBy(dataRow.dataIndex, dataRow.data) : dataRow; }); } ngAfterContentChecked() { // Cache the row and column definitions gathered by ContentChildren and programmatic injection. this._cacheRowDefs(); this._cacheColumnDefs(); // Make sure that the user has at least added header, footer, or data row def. if (!this._headerRowDefs.length && !this._footerRowDefs.length && !this._rowDefs.length && (typeof ngDevMode === 'undefined' || ngDevMode)) { throw getTableMissingRowDefsError(); } // Render updates if the list of columns have been changed for the header, row, or footer defs. const columnsChanged = this._renderUpdatedColumns(); const stickyColumnStyleUpdateNeeded = columnsChanged || this._headerRowDefChanged || this._footerRowDefChanged; // If the header row definition has been changed, trigger a render to the header row. if (this._headerRowDefChanged) { this._forceRenderHeaderRows(); this._headerRowDefChanged = false; } // If the footer row definition has been changed, trigger a render to the footer row. if (this._footerRowDefChanged) { this._forceRenderFooterRows(); this._footerRowDefChanged = false; } // If there is a data source and row definitions, connect to the data source unless a // connection has already been made. if (this.dataSource && this._rowDefs.length > 0 && !this._renderChangeSubscription) { this._observeRenderChanges(); } else if (stickyColumnStyleUpdateNeeded) { // In the above case, _observeRenderChanges will result in updateStickyColumnStyles being // called when it row data arrives. Otherwise, we need to call it proactively. this.updateStickyColumnStyles(); } this._checkStickyStates(); } ngOnDestroy() { this._rowOutlet.viewContainer.clear(); this._noDataRowOutlet.viewContainer.clear(); this._headerRowOutlet.viewContainer.clear(); this._footerRowOutlet.viewContainer.clear(); this._cachedRenderRowsMap.clear(); this._onDestroy.next(); this._onDestroy.complete(); if (Object(_angular_cdk_collections__WEBPACK_IMPORTED_MODULE_2__["isDataSource"])(this.dataSource)) { this.dataSource.disconnect(this); } } /** * Renders rows based on the table's latest set of data, which was either provided directly as an * input or retrieved through an Observable stream (directly or from a DataSource). * Checks for differences in the data since the last diff to perform only the necessary * changes (add/remove/move rows). * * If the table's data source is a DataSource or Observable, this will be invoked automatically * each time the provided Observable stream emits a new data array. Otherwise if your data is * an array, this function will need to be called to render any changes. */ renderRows() { this._renderRows = this._getAllRenderRows(); const changes = this._dataDiffer.diff(this._renderRows); if (!changes) { this._updateNoDataRow(); return; } const viewContainer = this._rowOutlet.viewContainer; // @breaking-change 11.0.0 Remove null check for `_viewRepeater` and the // `else` clause once `_viewRepeater` is turned into a required parameter. if (this._viewRepeater) { this._viewRepeater.applyChanges(changes, viewContainer, (record, _adjustedPreviousIndex, currentIndex) => this._getEmbeddedViewArgs(record.item, currentIndex), (record) => record.item.data, (change) => { if (change.operation === 1 /* INSERTED */ && change.context) { this._renderCellTemplateForItem(change.record.item.rowDef, change.context); } }); } else { changes.forEachOperation((record, prevIndex, currentIndex) => { if (record.previousIndex == null) { const renderRow = record.item; const rowDef = renderRow.rowDef; const context = { $implicit: renderRow.data }; this._renderRow(this._rowOutlet, rowDef, currentIndex, context); } else if (currentIndex == null) { viewContainer.remove(prevIndex); } else { const view = viewContainer.get(prevIndex); viewContainer.move(view, currentIndex); } }); } // Update the meta context of a row's context data (index, count, first, last, ...) this._updateRowIndexContext(); // Update rows that did not get added/removed/moved but may have had their identity changed, // e.g. if trackBy matched data on some property but the actual data reference changed. changes.forEachIdentityChange((record) => { const rowView = viewContainer.get(record.currentIndex); rowView.context.$implicit = record.item.data; }); this._updateNoDataRow(); this.updateStickyColumnStyles(); } /** Adds a column definition that was not included as part of the content children. */ addColumnDef(columnDef) { this._customColumnDefs.add(columnDef); } /** Removes a column definition that was not included as part of the content children. */ removeColumnDef(columnDef) { this._customColumnDefs.delete(columnDef); } /** Adds a row definition that was not included as part of the content children. */ addRowDef(rowDef) { this._customRowDefs.add(rowDef); } /** Removes a row definition that was not included as part of the content children. */ removeRowDef(rowDef) { this._customRowDefs.delete(rowDef); } /** Adds a header row definition that was not included as part of the content children. */ addHeaderRowDef(headerRowDef) { this._customHeaderRowDefs.add(headerRowDef); this._headerRowDefChanged = true; } /** Removes a header row definition that was not included as part of the content children. */ removeHeaderRowDef(headerRowDef) { this._customHeaderRowDefs.delete(headerRowDef); this._headerRowDefChanged = true; } /** Adds a footer row definition that was not included as part of the content children. */ addFooterRowDef(footerRowDef) { this._customFooterRowDefs.add(footerRowDef); this._footerRowDefChanged = true; } /** Removes a footer row definition that was not included as part of the content children. */ removeFooterRowDef(footerRowDef) { this._customFooterRowDefs.delete(footerRowDef); this._footerRowDefChanged = true; } /** * Updates the header sticky styles. First resets all applied styles with respect to the cells * sticking to the top. Then, evaluating which cells need to be stuck to the top. This is * automatically called when the header row changes its displayed set of columns, or if its * sticky input changes. May be called manually for cases where the cell content changes outside * of these events. */ updateStickyHeaderRowStyles() { const headerRows = this._getRenderedRows(this._headerRowOutlet); const tableElement = this._elementRef.nativeElement; // Hide the thead element if there are no header rows. This is necessary to satisfy // overzealous a11y checkers that fail because the `rowgroup` element does not contain // required child `row`. const thead = tableElement.querySelector('thead'); if (thead) { thead.style.display = headerRows.length ? '' : 'none'; } const stickyStates = this._headerRowDefs.map(def => def.sticky); this._stickyStyler.clearStickyPositioning(headerRows, ['top']); this._stickyStyler.stickRows(headerRows, stickyStates, 'top'); // Reset the dirty state of the sticky input change since it has been used. this._headerRowDefs.forEach(def => def.resetStickyChanged()); } /** * Updates the footer sticky styles. First resets all applied styles with respect to the cells * sticking to the bottom. Then, evaluating which cells need to be stuck to the bottom. This is * automatically called when the footer row changes its displayed set of columns, or if its * sticky input changes. May be called manually for cases where the cell content changes outside * of these events. */ updateStickyFooterRowStyles() { const footerRows = this._getRenderedRows(this._footerRowOutlet); const tableElement = this._elementRef.nativeElement; // Hide the tfoot element if there are no footer rows. This is necessary to satisfy // overzealous a11y checkers that fail because the `rowgroup` element does not contain // required child `row`. const tfoot = tableElement.querySelector('tfoot'); if (tfoot) { tfoot.style.display = footerRows.length ? '' : 'none'; } const stickyStates = this._footerRowDefs.map(def => def.sticky); this._stickyStyler.clearStickyPositioning(footerRows, ['bottom']); this._stickyStyler.stickRows(footerRows, stickyStates, 'bottom'); this._stickyStyler.updateStickyFooterContainer(this._elementRef.nativeElement, stickyStates); // Reset the dirty state of the sticky input change since it has been used. this._footerRowDefs.forEach(def => def.resetStickyChanged()); } /** * Updates the column sticky styles. First resets all applied styles with respect to the cells * sticking to the left and right. Then sticky styles are added for the left and right according * to the column definitions for each cell in each row. This is automatically called when * the data source provides a new set of data or when a column definition changes its sticky * input. May be called manually for cases where the cell content changes outside of these events. */ updateStickyColumnStyles() { const headerRows = this._getRenderedRows(this._headerRowOutlet); const dataRows = this._getRenderedRows(this._rowOutlet); const footerRows = this._getRenderedRows(this._footerRowOutlet); // Clear the left and right positioning from all columns in the table across all rows since // sticky columns span across all table sections (header, data, footer) this._stickyStyler.clearStickyPositioning([...headerRows, ...dataRows, ...footerRows], ['left', 'right']); // Update the sticky styles for each header row depending on the def's sticky state headerRows.forEach((headerRow, i) => { this._addStickyColumnStyles([headerRow], this._headerRowDefs[i]); }); // Update the sticky styles for each data row depending on its def's sticky state this._rowDefs.forEach(rowDef => { // Collect all the rows rendered with this row definition. const rows = []; for (let i = 0; i < dataRows.length; i++) { if (this._renderRows[i].rowDef === rowDef) { rows.push(dataRows[i]); } } this._addStickyColumnStyles(rows, rowDef); }); // Update the sticky styles for each footer row depending on the def's sticky state footerRows.forEach((footerRow, i) => { this._addStickyColumnStyles([footerRow], this._footerRowDefs[i]); }); // Reset the dirty state of the sticky input change since it has been used. Array.from(this._columnDefsByName.values()).forEach(def => def.resetStickyChanged()); } /** * Get the list of RenderRow objects to render according to the current list of data and defined * row definitions. If the previous list already contained a particular pair, it should be reused * so that the differ equates their references. */ _getAllRenderRows() { const renderRows = []; // Store the cache and create a new one. Any re-used RenderRow objects will be moved into the // new cache while unused ones can be picked up by garbage collection. const prevCachedRenderRows = this._cachedRenderRowsMap; this._cachedRenderRowsMap = new Map(); // For each data object, get the list of rows that should be rendered, represented by the // respective `RenderRow` object which is the pair of `data` and `CdkRowDef`. for (let i = 0; i < this._data.length; i++) { let data = this._data[i]; const renderRowsForData = this._getRenderRowsForData(data, i, prevCachedRenderRows.get(data)); if (!this._cachedRenderRowsMap.has(data)) { this._cachedRenderRowsMap.set(data, new WeakMap()); } for (let j = 0; j < renderRowsForData.length; j++) { let renderRow = renderRowsForData[j]; const cache = this._cachedRenderRowsMap.get(renderRow.data); if (cache.has(renderRow.rowDef)) { cache.get(renderRow.rowDef).push(renderRow); } else { cache.set(renderRow.rowDef, [renderRow]); } renderRows.push(renderRow); } } return renderRows; } /** * Gets a list of `RenderRow` for the provided data object and any `CdkRowDef` objects that * should be rendered for this data. Reuses the cached RenderRow objects if they match the same * `(T, CdkRowDef)` pair. */ _getRenderRowsForData(data, dataIndex, cache) { const rowDefs = this._getRowDefs(data, dataIndex); return rowDefs.map(rowDef => { const cachedRenderRows = (cache && cache.has(rowDef)) ? cache.get(rowDef) : []; if (cachedRenderRows.length) { const dataRow = cachedRenderRows.shift(); dataRow.dataIndex = dataIndex; return dataRow; } else { return { data, rowDef, dataIndex }; } }); } /** Update the map containing the content's column definitions. */ _cacheColumnDefs() { this._columnDefsByName.clear(); const columnDefs = mergeArrayAndSet(this._getOwnDefs(this._contentColumnDefs), this._customColumnDefs); columnDefs.forEach(columnDef => { if (this._columnDefsByName.has(columnDef.name) && (typeof ngDevMode === 'undefined' || ngDevMode)) { throw getTableDuplicateColumnNameError(columnDef.name); } this._columnDefsByName.set(columnDef.name, columnDef); }); } /** Update the list of all available row definitions that can be used. */ _cacheRowDefs() { this._headerRowDefs = mergeArrayAndSet(this._getOwnDefs(this._contentHeaderRowDefs), this._customHeaderRowDefs); this._footerRowDefs = mergeArrayAndSet(this._getOwnDefs(this._contentFooterRowDefs), this._customFooterRowDefs); this._rowDefs = mergeArrayAndSet(this._getOwnDefs(this._contentRowDefs), this._customRowDefs); // After all row definitions are determined, find the row definition to be considered default. const defaultRowDefs = this._rowDefs.filter(def => !def.when); if (!this.multiTemplateDataRows && defaultRowDefs.length > 1 && (typeof ngDevMode === 'undefined' || ngDevMode)) { throw getTableMultipleDefaultRowDefsError(); } this._defaultRowDef = defaultRowDefs[0]; } /** * Check if the header, data, or footer rows have changed what columns they want to display or * whether the sticky states have changed for the header or footer. If there is a diff, then * re-render that section. */ _renderUpdatedColumns() { const columnsDiffReducer = (acc, def) => acc || !!def.getColumnsDiff(); // Force re-render data rows if the list of column definitions have changed. const dataColumnsChanged = this._rowDefs.reduce(columnsDiffReducer, false); if (dataColumnsChanged) { this._forceRenderDataRows(); } // Force re-render header/footer rows if the list of column definitions have changed. const headerColumnsChanged = this._headerRowDefs.reduce(columnsDiffReducer, false); if (headerColumnsChanged) { this._forceRenderHeaderRows(); } const footerColumnsChanged = this._footerRowDefs.reduce(columnsDiffReducer, false); if (footerColumnsChanged) { this._forceRenderFooterRows(); } return dataColumnsChanged || headerColumnsChanged || footerColumnsChanged; } /** * Switch to the provided data source by resetting the data and unsubscribing from the current * render change subscription if one exists. If the data source is null, interpret this by * clearing the row outlet. Otherwise start listening for new data. */ _switchDataSource(dataSource) { this._data = []; if (Object(_angular_cdk_collections__WEBPACK_IMPORTED_MODULE_2__["isDataSource"])(this.dataSource)) { this.dataSource.disconnect(this); } // Stop listening for data from the previous data source. if (this._renderChangeSubscription) { this._renderChangeSubscription.unsubscribe(); this._renderChangeSubscription = null; } if (!dataSource) { if (this._dataDiffer) { this._dataDiffer.diff([]); } this._rowOutlet.viewContainer.clear(); } this._dataSource = dataSource; } /** Set up a subscription for the data provided by the data source. */ _observeRenderChanges() { // If no data source has been set, there is nothing to observe for changes. if (!this.dataSource) { return; } let dataStream; if (Object(_angular_cdk_collections__WEBPACK_IMPORTED_MODULE_2__["isDataSource"])(this.dataSource)) { dataStream = this.dataSource.connect(this); } else if (Object(rxjs__WEBPACK_IMPORTED_MODULE_6__["isObservable"])(this.dataSource)) { dataStream = this.dataSource; } else if (Array.isArray(this.dataSource)) { dataStream = Object(rxjs__WEBPACK_IMPORTED_MODULE_6__["of"])(this.dataSource); } if (dataStream === undefined && (typeof ngDevMode === 'undefined' || ngDevMode)) { throw getTableUnknownDataSourceError(); } this._renderChangeSubscription = dataStream.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_7__["takeUntil"])(this._onDestroy)) .subscribe(data => { this._data = data || []; this.renderRows(); }); } /** * Clears any existing content in the header row outlet and creates a new embedded view * in the outlet using the header row definition. */ _forceRenderHeaderRows() { // Clear the header row outlet if any content exists. if (this._headerRowOutlet.viewContainer.length > 0) { this._headerRowOutlet.viewContainer.clear(); } this._headerRowDefs.forEach((def, i) => this._renderRow(this._headerRowOutlet, def, i)); this.updateStickyHeaderRowStyles(); } /** * Clears any existing content in the footer row outlet and creates a new embedded view * in the outlet using the footer row definition. */ _forceRenderFooterRows() { // Clear the footer row outlet if any content exists. if (this._footerRowOutlet.viewContainer.length > 0) { this._footerRowOutlet.viewContainer.clear(); } this._footerRowDefs.forEach((def, i) => this._renderRow(this._footerRowOutlet, def, i)); this.updateStickyFooterRowStyles(); } /** Adds the sticky column styles for the rows according to the columns' stick states. */ _addStickyColumnStyles(rows, rowDef) { const columnDefs = Array.from(rowDef.columns || []).map(columnName => { const columnDef = this._columnDefsByName.get(columnName); if (!columnDef && (typeof ngDevMode === 'undefined' || ngDevMode)) { throw getTableUnknownColumnError(columnName); } return columnDef; }); const stickyStartStates = columnDefs.map(columnDef => columnDef.sticky); const stickyEndStates = columnDefs.map(columnDef => columnDef.stickyEnd); this._stickyStyler.updateStickyColumns(rows, stickyStartStates, stickyEndStates); } /** Gets the list of rows that have been rendered in the row outlet. */ _getRenderedRows(rowOutlet) { const renderedRows = []; for (let i = 0; i < rowOutlet.viewContainer.length; i++) { const viewRef = rowOutlet.viewContainer.get(i); renderedRows.push(viewRef.rootNodes[0]); } return renderedRows; } /** * Get the matching row definitions that should be used for this row data. If there is only * one row definition, it is returned. Otherwise, find the row definitions that has a when * predicate that returns true with the data. If none return true, return the default row * definition. */ _getRowDefs(data, dataIndex) { if (this._rowDefs.length == 1) { return [this._rowDefs[0]]; } let rowDefs = []; if (this.multiTemplateDataRows) { rowDefs = this._rowDefs.filter(def => !def.when || def.when(dataIndex, data)); } else { let rowDef = this._rowDefs.find(def => def.when && def.when(dataIndex, data)) || this._defaultRowDef; if (rowDef) { rowDefs.push(rowDef); } } if (!rowDefs.length && (typeof ngDevMode === 'undefined' || ngDevMode)) { throw getTableMissingMatchingRowDefError(data); } return rowDefs; } _getEmbeddedViewArgs(renderRow, index) { const rowDef = renderRow.rowDef; const context = { $implicit: renderRow.data }; return { templateRef: rowDef.template, context, index, }; } /** * Creates a new row template in the outlet and fills it with the set of cell templates. * Optionally takes a context to provide to the row and cells, as well as an optional index * of where to place the new row template in the outlet. */ _renderRow(outlet, rowDef, index, context = {}) { // TODO(andrewseguin): enforce that one outlet was instantiated from createEmbeddedView const view = outlet.viewContainer.createEmbeddedView(rowDef.template, context, index); this._renderCellTemplateForItem(rowDef, context); return view; } _renderCellTemplateForItem(rowDef, context) { for (let cellTemplate of this._getCellTemplates(rowDef)) { if (CdkCellOutlet.mostRecentCellOutlet) { CdkCellOutlet.mostRecentCellOutlet._viewContainer.createEmbeddedView(cellTemplate, context); } } this._changeDetectorRef.markForCheck(); } /** * Updates the index-related context for each row to reflect any changes in the index of the rows, * e.g. first/last/even/odd. */ _updateRowIndexContext() { const viewContainer = this._rowOutlet.viewContainer; for (let renderIndex = 0, count = viewContainer.length; renderIndex < count; renderIndex++) { const viewRef = viewContainer.get(renderIndex); const context = viewRef.context; context.count = count; context.first = renderIndex === 0; context.last = renderIndex === count - 1; context.even = renderIndex % 2 === 0; context.odd = !context.even; if (this.multiTemplateDataRows) { context.dataIndex = this._renderRows[renderIndex].dataIndex; context.renderIndex = renderIndex; } else { context.index = this._renderRows[renderIndex].dataIndex; } } } /** Gets the column definitions for the provided row def. */ _getCellTemplates(rowDef) { if (!rowDef || !rowDef.columns) { return []; } return Array.from(rowDef.columns, columnId => { const column = this._columnDefsByName.get(columnId); if (!column && (typeof ngDevMode === 'undefined' || ngDevMode)) { throw getTableUnknownColumnError(columnId); } return rowDef.extractCellTemplate(column); }); } /** Adds native table sections (e.g. tbody) and moves the row outlets into them. */ _applyNativeTableSections() { const documentFragment = this._document.createDocumentFragment(); const sections = [ { tag: 'thead', outlets: [this._headerRowOutlet] }, { tag: 'tbody', outlets: [this._rowOutlet, this._noDataRowOutlet] }, { tag: 'tfoot', outlets: [this._footerRowOutlet] }, ]; for (const section of sections) { const element = this._document.createElement(section.tag); element.setAttribute('role', 'rowgroup'); for (const outlet of section.outlets) { element.appendChild(outlet.elementRef.nativeElement); } documentFragment.appendChild(element); } // Use a DocumentFragment so we don't hit the DOM on each iteration. this._elementRef.nativeElement.appendChild(documentFragment); } /** * Forces a re-render of the data rows. Should be called in cases where there has been an input * change that affects the evaluation of which rows should be rendered, e.g. toggling * `multiTemplateDataRows` or adding/removing row definitions. */ _forceRenderDataRows() { this._dataDiffer.diff([]); this._rowOutlet.viewContainer.clear(); this.renderRows(); } /** * Checks if there has been a change in sticky states since last check and applies the correct * sticky styles. Since checking resets the "dirty" state, this should only be performed once * during a change detection and after the inputs are settled (after content check). */ _checkStickyStates() { const stickyCheckReducer = (acc, d) => { return acc || d.hasStickyChanged(); }; // Note that the check needs to occur for every definition since it notifies the definition // that it can reset its dirty state. Using another operator like `some` may short-circuit // remaining definitions and leave them in an unchecked state. if (this._headerRowDefs.reduce(stickyCheckReducer, false)) { this.updateStickyHeaderRowStyles(); } if (this._footerRowDefs.reduce(stickyCheckReducer, false)) { this.updateStickyFooterRowStyles(); } if (Array.from(this._columnDefsByName.values()).reduce(stickyCheckReducer, false)) { this.updateStickyColumnStyles(); } } /** * Creates the sticky styler that will be used for sticky rows and columns. Listens * for directionality changes and provides the latest direction to the styler. Re-applies column * stickiness when directionality changes. */ _setupStickyStyler() { const direction = this._dir ? this._dir.value : 'ltr'; this._stickyStyler = new StickyStyler(this._isNativeHtmlTable, this.stickyCssClass, direction, this._coalescedStyleScheduler, this._platform.isBrowser, this.needsPositionStickyOnElement); (this._dir ? this._dir.change : Object(rxjs__WEBPACK_IMPORTED_MODULE_6__["of"])()) .pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_7__["takeUntil"])(this._onDestroy)) .subscribe(value => { this._stickyStyler.direction = value; this.updateStickyColumnStyles(); }); } /** Filters definitions that belong to this table from a QueryList. */ _getOwnDefs(items) { return items.filter(item => !item._table || item._table === this); } /** Creates or removes the no data row, depending on whether any data is being shown. */ _updateNoDataRow() { if (this._noDataRow) { const shouldShow = this._rowOutlet.viewContainer.length === 0; if (shouldShow !== this._isShowingNoDataRow) { const container = this._noDataRowOutlet.viewContainer; shouldShow ? container.createEmbeddedView(this._noDataRow.templateRef) : container.clear(); this._isShowingNoDataRow = shouldShow; } } } } CdkTable.ɵfac = function CdkTable_Factory(t) { return new (t || CdkTable)(_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["IterableDiffers"]), _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["ChangeDetectorRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_3__["ElementRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵinjectAttribute"]('role'), _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_0__["Directionality"], 8), _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_common__WEBPACK_IMPORTED_MODULE_5__["DOCUMENT"]), _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["Platform"]), _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_angular_cdk_collections__WEBPACK_IMPORTED_MODULE_2__["_VIEW_REPEATER_STRATEGY"], 8), _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](_COALESCED_STYLE_SCHEDULER, 8)); }; CdkTable.ɵcmp = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdefineComponent"]({ type: CdkTable, selectors: [["cdk-table"], ["table", "cdk-table", ""]], contentQueries: function CdkTable_ContentQueries(rf, ctx, dirIndex) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵcontentQuery"](dirIndex, CdkNoDataRow, true); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵcontentQuery"](dirIndex, CdkColumnDef, true); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵcontentQuery"](dirIndex, CdkRowDef, true); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵcontentQuery"](dirIndex, CdkHeaderRowDef, true); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵcontentQuery"](dirIndex, CdkFooterRowDef, true); } if (rf & 2) { var _t; _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵqueryRefresh"](_t = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵloadQuery"]()) && (ctx._noDataRow = _t.first); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵqueryRefresh"](_t = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵloadQuery"]()) && (ctx._contentColumnDefs = _t); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵqueryRefresh"](_t = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵloadQuery"]()) && (ctx._contentRowDefs = _t); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵqueryRefresh"](_t = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵloadQuery"]()) && (ctx._contentHeaderRowDefs = _t); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵqueryRefresh"](_t = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵloadQuery"]()) && (ctx._contentFooterRowDefs = _t); } }, viewQuery: function CdkTable_Query(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵstaticViewQuery"](DataRowOutlet, true); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵstaticViewQuery"](HeaderRowOutlet, true); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵstaticViewQuery"](FooterRowOutlet, true); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵstaticViewQuery"](NoDataRowOutlet, true); } if (rf & 2) { var _t; _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵqueryRefresh"](_t = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵloadQuery"]()) && (ctx._rowOutlet = _t.first); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵqueryRefresh"](_t = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵloadQuery"]()) && (ctx._headerRowOutlet = _t.first); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵqueryRefresh"](_t = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵloadQuery"]()) && (ctx._footerRowOutlet = _t.first); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵqueryRefresh"](_t = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵloadQuery"]()) && (ctx._noDataRowOutlet = _t.first); } }, hostAttrs: [1, "cdk-table"], inputs: { trackBy: "trackBy", dataSource: "dataSource", multiTemplateDataRows: "multiTemplateDataRows" }, exportAs: ["cdkTable"], features: [_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵProvidersFeature"]([ { provide: CDK_TABLE, useExisting: CdkTable }, { provide: _angular_cdk_collections__WEBPACK_IMPORTED_MODULE_2__["_VIEW_REPEATER_STRATEGY"], useClass: _angular_cdk_collections__WEBPACK_IMPORTED_MODULE_2__["_DisposeViewRepeaterStrategy"] }, { provide: _COALESCED_STYLE_SCHEDULER, useClass: _CoalescedStyleScheduler }, ])], ngContentSelectors: _c1, decls: 6, vars: 0, consts: [["headerRowOutlet", ""], ["rowOutlet", ""], ["noDataRowOutlet", ""], ["footerRowOutlet", ""]], template: function CdkTable_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵprojectionDef"](_c0); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵprojection"](0); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵprojection"](1, 1); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵelementContainer"](2, 0); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵelementContainer"](3, 1); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵelementContainer"](4, 2); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵelementContainer"](5, 3); } }, directives: [HeaderRowOutlet, DataRowOutlet, NoDataRowOutlet, FooterRowOutlet], encapsulation: 2 }); CdkTable.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["IterableDiffers"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ChangeDetectorRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ElementRef"] }, { type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Attribute"], args: ['role',] }] }, { type: _angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_0__["Directionality"], decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Optional"] }] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_5__["DOCUMENT"],] }] }, { type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["Platform"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Inject"], args: [_angular_cdk_collections__WEBPACK_IMPORTED_MODULE_2__["_VIEW_REPEATER_STRATEGY"],] }] }, { type: _CoalescedStyleScheduler, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Inject"], args: [_COALESCED_STYLE_SCHEDULER,] }] } ]; CdkTable.propDecorators = { trackBy: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Input"] }], dataSource: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Input"] }], multiTemplateDataRows: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Input"] }], _rowOutlet: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewChild"], args: [DataRowOutlet, { static: true },] }], _headerRowOutlet: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewChild"], args: [HeaderRowOutlet, { static: true },] }], _footerRowOutlet: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewChild"], args: [FooterRowOutlet, { static: true },] }], _noDataRowOutlet: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewChild"], args: [NoDataRowOutlet, { static: true },] }], _contentColumnDefs: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ContentChildren"], args: [CdkColumnDef, { descendants: true },] }], _contentRowDefs: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ContentChildren"], args: [CdkRowDef, { descendants: true },] }], _contentHeaderRowDefs: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ContentChildren"], args: [CdkHeaderRowDef, { descendants: true },] }], _contentFooterRowDefs: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ContentChildren"], args: [CdkFooterRowDef, { descendants: true },] }], _noDataRow: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ContentChild"], args: [CdkNoDataRow,] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵsetClassMetadata"](CdkTable, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Component"], args: [{ selector: 'cdk-table, table[cdk-table]', exportAs: 'cdkTable', template: CDK_TABLE_TEMPLATE, host: { 'class': 'cdk-table' }, encapsulation: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewEncapsulation"].None, // The "OnPush" status for the `MatTable` component is effectively a noop, so we are removing it. // The view for `MatTable` consists entirely of templates declared in other views. As they are // declared elsewhere, they are checked when their declaration points are checked. // tslint:disable-next-line:validate-decorators changeDetection: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ChangeDetectionStrategy"].Default, providers: [ { provide: CDK_TABLE, useExisting: CdkTable }, { provide: _angular_cdk_collections__WEBPACK_IMPORTED_MODULE_2__["_VIEW_REPEATER_STRATEGY"], useClass: _angular_cdk_collections__WEBPACK_IMPORTED_MODULE_2__["_DisposeViewRepeaterStrategy"] }, { provide: _COALESCED_STYLE_SCHEDULER, useClass: _CoalescedStyleScheduler }, ] }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["IterableDiffers"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ChangeDetectorRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ElementRef"] }, { type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Attribute"], args: ['role'] }] }, { type: _angular_cdk_bidi__WEBPACK_IMPORTED_MODULE_0__["Directionality"], decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Optional"] }] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_5__["DOCUMENT"]] }] }, { type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_4__["Platform"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Inject"], args: [_angular_cdk_collections__WEBPACK_IMPORTED_MODULE_2__["_VIEW_REPEATER_STRATEGY"]] }] }, { type: _CoalescedStyleScheduler, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Inject"], args: [_COALESCED_STYLE_SCHEDULER] }] }]; }, { trackBy: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Input"] }], dataSource: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Input"] }], multiTemplateDataRows: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Input"] }], _rowOutlet: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewChild"], args: [DataRowOutlet, { static: true }] }], _headerRowOutlet: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewChild"], args: [HeaderRowOutlet, { static: true }] }], _footerRowOutlet: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewChild"], args: [FooterRowOutlet, { static: true }] }], _noDataRowOutlet: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewChild"], args: [NoDataRowOutlet, { static: true }] }], _contentColumnDefs: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ContentChildren"], args: [CdkColumnDef, { descendants: true }] }], _contentRowDefs: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ContentChildren"], args: [CdkRowDef, { descendants: true }] }], _contentHeaderRowDefs: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ContentChildren"], args: [CdkHeaderRowDef, { descendants: true }] }], _contentFooterRowDefs: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ContentChildren"], args: [CdkFooterRowDef, { descendants: true }] }], _noDataRow: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ContentChild"], args: [CdkNoDataRow] }] }); })(); /** Utility function that gets a merged list of the entries in an array and values of a Set. */ function mergeArrayAndSet(array, set) { return array.concat(Array.from(set)); } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Column that simply shows text content for the header and row cells. Assumes that the table * is using the native table implementation (`
`). * * By default, the name of this column will be the header text and data property accessor. * The header text can be overridden with the `headerText` input. Cell values can be overridden with * the `dataAccessor` input. Change the text justification to the start or end using the `justify` * input. */ class CdkTextColumn { constructor( // `CdkTextColumn` is always requiring a table, but we just assert it manually // for better error reporting. // tslint:disable-next-line: lightweight-tokens _table, _options) { this._table = _table; this._options = _options; /** Alignment of the cell values. */ this.justify = 'start'; this._options = _options || {}; } /** Column name that should be used to reference this column. */ get name() { return this._name; } set name(name) { this._name = name; // With Ivy, inputs can be initialized before static query results are // available. In that case, we defer the synchronization until "ngOnInit" fires. this._syncColumnDefName(); } ngOnInit() { this._syncColumnDefName(); if (this.headerText === undefined) { this.headerText = this._createDefaultHeaderText(); } if (!this.dataAccessor) { this.dataAccessor = this._options.defaultDataAccessor || ((data, name) => data[name]); } if (this._table) { // Provide the cell and headerCell directly to the table with the static `ViewChild` query, // since the columnDef will not pick up its content by the time the table finishes checking // its content and initializing the rows. this.columnDef.cell = this.cell; this.columnDef.headerCell = this.headerCell; this._table.addColumnDef(this.columnDef); } else if (typeof ngDevMode === 'undefined' || ngDevMode) { throw getTableTextColumnMissingParentTableError(); } } ngOnDestroy() { if (this._table) { this._table.removeColumnDef(this.columnDef); } } /** * Creates a default header text. Use the options' header text transformation function if one * has been provided. Otherwise simply capitalize the column name. */ _createDefaultHeaderText() { const name = this.name; if (!name && (typeof ngDevMode === 'undefined' || ngDevMode)) { throw getTableTextColumnMissingNameError(); } if (this._options && this._options.defaultHeaderTextTransform) { return this._options.defaultHeaderTextTransform(name); } return name[0].toUpperCase() + name.slice(1); } /** Synchronizes the column definition name with the text column name. */ _syncColumnDefName() { if (this.columnDef) { this.columnDef.name = this.name; } } } CdkTextColumn.ɵfac = function CdkTextColumn_Factory(t) { return new (t || CdkTextColumn)(_angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](CdkTable, 8), _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdirectiveInject"](TEXT_COLUMN_OPTIONS, 8)); }; CdkTextColumn.ɵcmp = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdefineComponent"]({ type: CdkTextColumn, selectors: [["cdk-text-column"]], viewQuery: function CdkTextColumn_Query(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵstaticViewQuery"](CdkColumnDef, true); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵstaticViewQuery"](CdkCellDef, true); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵstaticViewQuery"](CdkHeaderCellDef, true); } if (rf & 2) { var _t; _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵqueryRefresh"](_t = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵloadQuery"]()) && (ctx.columnDef = _t.first); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵqueryRefresh"](_t = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵloadQuery"]()) && (ctx.cell = _t.first); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵqueryRefresh"](_t = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵloadQuery"]()) && (ctx.headerCell = _t.first); } }, inputs: { justify: "justify", name: "name", headerText: "headerText", dataAccessor: "dataAccessor" }, decls: 3, vars: 0, consts: [["cdkColumnDef", ""], ["cdk-header-cell", "", 3, "text-align", 4, "cdkHeaderCellDef"], ["cdk-cell", "", 3, "text-align", 4, "cdkCellDef"], ["cdk-header-cell", ""], ["cdk-cell", ""]], template: function CdkTextColumn_Template(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵelementContainerStart"](0, 0); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵtemplate"](1, CdkTextColumn_th_1_Template, 2, 3, "th", 1); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵtemplate"](2, CdkTextColumn_td_2_Template, 2, 3, "td", 2); _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵelementContainerEnd"](); } }, directives: [CdkColumnDef, CdkHeaderCellDef, CdkCellDef, CdkHeaderCell, CdkCell], encapsulation: 2 }); CdkTextColumn.ctorParameters = () => [ { type: CdkTable, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Optional"] }] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Inject"], args: [TEXT_COLUMN_OPTIONS,] }] } ]; CdkTextColumn.propDecorators = { name: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Input"] }], headerText: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Input"] }], dataAccessor: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Input"] }], justify: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Input"] }], columnDef: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewChild"], args: [CdkColumnDef, { static: true },] }], cell: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewChild"], args: [CdkCellDef, { static: true },] }], headerCell: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewChild"], args: [CdkHeaderCellDef, { static: true },] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵsetClassMetadata"](CdkTextColumn, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Component"], args: [{ selector: 'cdk-text-column', template: ` `, encapsulation: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewEncapsulation"].None, // Change detection is intentionally not set to OnPush. This component's template will be provided // to the table to be inserted into its view. This is problematic when change detection runs since // the bindings in this template will be evaluated _after_ the table's view is evaluated, which // mean's the template in the table's view will not have the updated value (and in fact will cause // an ExpressionChangedAfterItHasBeenCheckedError). // tslint:disable-next-line:validate-decorators changeDetection: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ChangeDetectionStrategy"].Default }] }], function () { return [{ type: CdkTable, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Optional"] }] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Inject"], args: [TEXT_COLUMN_OPTIONS] }] }]; }, { justify: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Input"] }], name: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Input"] }], headerText: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Input"] }], dataAccessor: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["Input"] }], columnDef: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewChild"], args: [CdkColumnDef, { static: true }] }], cell: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewChild"], args: [CdkCellDef, { static: true }] }], headerCell: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["ViewChild"], args: [CdkHeaderCellDef, { static: true }] }] }); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ const EXPORTED_DECLARATIONS = [ CdkTable, CdkRowDef, CdkCellDef, CdkCellOutlet, CdkHeaderCellDef, CdkFooterCellDef, CdkColumnDef, CdkCell, CdkRow, CdkHeaderCell, CdkFooterCell, CdkHeaderRow, CdkHeaderRowDef, CdkFooterRow, CdkFooterRowDef, DataRowOutlet, HeaderRowOutlet, FooterRowOutlet, CdkTextColumn, CdkNoDataRow, NoDataRowOutlet, ]; class CdkTableModule { } CdkTableModule.ɵmod = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdefineNgModule"]({ type: CdkTableModule }); CdkTableModule.ɵinj = _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵdefineInjector"]({ factory: function CdkTableModule_Factory(t) { return new (t || CdkTableModule)(); }, imports: [[_angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_8__["ScrollingModule"]]] }); (function () { (typeof ngJitMode === "undefined" || ngJitMode) && _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵɵsetNgModuleScope"](CdkTableModule, { declarations: function () { return [CdkTable, CdkRowDef, CdkCellDef, CdkCellOutlet, CdkHeaderCellDef, CdkFooterCellDef, CdkColumnDef, CdkCell, CdkRow, CdkHeaderCell, CdkFooterCell, CdkHeaderRow, CdkHeaderRowDef, CdkFooterRow, CdkFooterRowDef, DataRowOutlet, HeaderRowOutlet, FooterRowOutlet, CdkTextColumn, CdkNoDataRow, NoDataRowOutlet]; }, imports: function () { return [_angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_8__["ScrollingModule"]]; }, exports: function () { return [CdkTable, CdkRowDef, CdkCellDef, CdkCellOutlet, CdkHeaderCellDef, CdkFooterCellDef, CdkColumnDef, CdkCell, CdkRow, CdkHeaderCell, CdkFooterCell, CdkHeaderRow, CdkHeaderRowDef, CdkFooterRow, CdkFooterRowDef, DataRowOutlet, HeaderRowOutlet, FooterRowOutlet, CdkTextColumn, CdkNoDataRow, NoDataRowOutlet]; } }); })(); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_3__["ɵsetClassMetadata"](CdkTableModule, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_3__["NgModule"], args: [{ exports: EXPORTED_DECLARATIONS, declarations: EXPORTED_DECLARATIONS, imports: [_angular_cdk_scrolling__WEBPACK_IMPORTED_MODULE_8__["ScrollingModule"]] }] }], null, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Generated bundle index. Do not edit. */ //# sourceMappingURL=table.js.map /***/ }), /***/ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/text-field.js": /*!***********************************************************************!*\ !*** ./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/text-field.js ***! \***********************************************************************/ /*! exports provided: AutofillMonitor, CdkAutofill, CdkTextareaAutosize, TextFieldModule */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; __webpack_require__.r(__webpack_exports__); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "AutofillMonitor", function() { return AutofillMonitor; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkAutofill", function() { return CdkAutofill; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CdkTextareaAutosize", function() { return CdkTextareaAutosize; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "TextFieldModule", function() { return TextFieldModule; }); /* harmony import */ var _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @angular/cdk/platform */ "./node_modules/@angular/cdk/__ivy_ngcc__/fesm2015/platform.js"); /* harmony import */ var _angular_core__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! @angular/core */ "./node_modules/@angular/core/__ivy_ngcc__/fesm2015/core.js"); /* harmony import */ var _angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(/*! @angular/cdk/coercion */ "./node_modules/@angular/cdk/fesm2015/coercion.js"); /* harmony import */ var rxjs__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(/*! rxjs */ "./node_modules/rxjs/_esm2015/index.js"); /* harmony import */ var rxjs_operators__WEBPACK_IMPORTED_MODULE_4__ = __webpack_require__(/*! rxjs/operators */ "./node_modules/rxjs/_esm2015/operators/index.js"); /* harmony import */ var _angular_common__WEBPACK_IMPORTED_MODULE_5__ = __webpack_require__(/*! @angular/common */ "./node_modules/@angular/common/__ivy_ngcc__/fesm2015/common.js"); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** Options to pass to the animationstart listener. */ const listenerOptions = Object(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_0__["normalizePassiveListenerOptions"])({ passive: true }); /** * An injectable service that can be used to monitor the autofill state of an input. * Based on the following blog post: * https://medium.com/@brunn/detecting-autofilled-fields-in-javascript-aed598d25da7 */ class AutofillMonitor { constructor(_platform, _ngZone) { this._platform = _platform; this._ngZone = _ngZone; this._monitoredElements = new Map(); } monitor(elementOrRef) { if (!this._platform.isBrowser) { return rxjs__WEBPACK_IMPORTED_MODULE_3__["EMPTY"]; } const element = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_2__["coerceElement"])(elementOrRef); const info = this._monitoredElements.get(element); if (info) { return info.subject; } const result = new rxjs__WEBPACK_IMPORTED_MODULE_3__["Subject"](); const cssClass = 'cdk-text-field-autofilled'; const listener = ((event) => { // Animation events fire on initial element render, we check for the presence of the autofill // CSS class to make sure this is a real change in state, not just the initial render before // we fire off events. if (event.animationName === 'cdk-text-field-autofill-start' && !element.classList.contains(cssClass)) { element.classList.add(cssClass); this._ngZone.run(() => result.next({ target: event.target, isAutofilled: true })); } else if (event.animationName === 'cdk-text-field-autofill-end' && element.classList.contains(cssClass)) { element.classList.remove(cssClass); this._ngZone.run(() => result.next({ target: event.target, isAutofilled: false })); } }); this._ngZone.runOutsideAngular(() => { element.addEventListener('animationstart', listener, listenerOptions); element.classList.add('cdk-text-field-autofill-monitored'); }); this._monitoredElements.set(element, { subject: result, unlisten: () => { element.removeEventListener('animationstart', listener, listenerOptions); } }); return result; } stopMonitoring(elementOrRef) { const element = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_2__["coerceElement"])(elementOrRef); const info = this._monitoredElements.get(element); if (info) { info.unlisten(); info.subject.complete(); element.classList.remove('cdk-text-field-autofill-monitored'); element.classList.remove('cdk-text-field-autofilled'); this._monitoredElements.delete(element); } } ngOnDestroy() { this._monitoredElements.forEach((_info, element) => this.stopMonitoring(element)); } } AutofillMonitor.ɵfac = function AutofillMonitor_Factory(t) { return new (t || AutofillMonitor)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_0__["Platform"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"])); }; AutofillMonitor.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjectable"])({ factory: function AutofillMonitor_Factory() { return new AutofillMonitor(Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_0__["Platform"]), Object(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵinject"])(_angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"])); }, token: AutofillMonitor, providedIn: "root" }); AutofillMonitor.ctorParameters = () => [ { type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_0__["Platform"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](AutofillMonitor, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Injectable"], args: [{ providedIn: 'root' }] }], function () { return [{ type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_0__["Platform"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }]; }, null); })(); /** A directive that can be used to monitor the autofill state of an input. */ class CdkAutofill { constructor(_elementRef, _autofillMonitor) { this._elementRef = _elementRef; this._autofillMonitor = _autofillMonitor; /** Emits when the autofill state of the element changes. */ this.cdkAutofill = new _angular_core__WEBPACK_IMPORTED_MODULE_1__["EventEmitter"](); } ngOnInit() { this._autofillMonitor .monitor(this._elementRef) .subscribe(event => this.cdkAutofill.emit(event)); } ngOnDestroy() { this._autofillMonitor.stopMonitoring(this._elementRef); } } CdkAutofill.ɵfac = function CdkAutofill_Factory(t) { return new (t || CdkAutofill)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](AutofillMonitor)); }; CdkAutofill.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineDirective"]({ type: CdkAutofill, selectors: [["", "cdkAutofill", ""]], outputs: { cdkAutofill: "cdkAutofill" } }); CdkAutofill.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"] }, { type: AutofillMonitor } ]; CdkAutofill.propDecorators = { cdkAutofill: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Output"] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](CdkAutofill, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Directive"], args: [{ selector: '[cdkAutofill]' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"] }, { type: AutofillMonitor }]; }, { cdkAutofill: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Output"] }] }); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** Directive to automatically resize a textarea to fit its content. */ class CdkTextareaAutosize { constructor(_elementRef, _platform, _ngZone, /** @breaking-change 11.0.0 make document required */ document) { this._elementRef = _elementRef; this._platform = _platform; this._ngZone = _ngZone; this._destroyed = new rxjs__WEBPACK_IMPORTED_MODULE_3__["Subject"](); this._enabled = true; /** * Value of minRows as of last resize. If the minRows has decreased, the * height of the textarea needs to be recomputed to reflect the new minimum. The maxHeight * does not have the same problem because it does not affect the textarea's scrollHeight. */ this._previousMinRows = -1; this._document = document; this._textareaElement = this._elementRef.nativeElement; this._measuringClass = _platform.FIREFOX ? 'cdk-textarea-autosize-measuring-firefox' : 'cdk-textarea-autosize-measuring'; } /** Minimum amount of rows in the textarea. */ get minRows() { return this._minRows; } set minRows(value) { this._minRows = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_2__["coerceNumberProperty"])(value); this._setMinHeight(); } /** Maximum amount of rows in the textarea. */ get maxRows() { return this._maxRows; } set maxRows(value) { this._maxRows = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_2__["coerceNumberProperty"])(value); this._setMaxHeight(); } /** Whether autosizing is enabled or not */ get enabled() { return this._enabled; } set enabled(value) { value = Object(_angular_cdk_coercion__WEBPACK_IMPORTED_MODULE_2__["coerceBooleanProperty"])(value); // Only act if the actual value changed. This specifically helps to not run // resizeToFitContent too early (i.e. before ngAfterViewInit) if (this._enabled !== value) { (this._enabled = value) ? this.resizeToFitContent(true) : this.reset(); } } /** Sets the minimum height of the textarea as determined by minRows. */ _setMinHeight() { const minHeight = this.minRows && this._cachedLineHeight ? `${this.minRows * this._cachedLineHeight}px` : null; if (minHeight) { this._textareaElement.style.minHeight = minHeight; } } /** Sets the maximum height of the textarea as determined by maxRows. */ _setMaxHeight() { const maxHeight = this.maxRows && this._cachedLineHeight ? `${this.maxRows * this._cachedLineHeight}px` : null; if (maxHeight) { this._textareaElement.style.maxHeight = maxHeight; } } ngAfterViewInit() { if (this._platform.isBrowser) { // Remember the height which we started with in case autosizing is disabled this._initialHeight = this._textareaElement.style.height; this.resizeToFitContent(); this._ngZone.runOutsideAngular(() => { const window = this._getWindow(); Object(rxjs__WEBPACK_IMPORTED_MODULE_3__["fromEvent"])(window, 'resize') .pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_4__["auditTime"])(16), Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_4__["takeUntil"])(this._destroyed)) .subscribe(() => this.resizeToFitContent(true)); }); } } ngOnDestroy() { this._destroyed.next(); this._destroyed.complete(); } /** * Cache the height of a single-row textarea if it has not already been cached. * * We need to know how large a single "row" of a textarea is in order to apply minRows and * maxRows. For the initial version, we will assume that the height of a single line in the * textarea does not ever change. */ _cacheTextareaLineHeight() { if (this._cachedLineHeight) { return; } // Use a clone element because we have to override some styles. let textareaClone = this._textareaElement.cloneNode(false); textareaClone.rows = 1; // Use `position: absolute` so that this doesn't cause a browser layout and use // `visibility: hidden` so that nothing is rendered. Clear any other styles that // would affect the height. textareaClone.style.position = 'absolute'; textareaClone.style.visibility = 'hidden'; textareaClone.style.border = 'none'; textareaClone.style.padding = '0'; textareaClone.style.height = ''; textareaClone.style.minHeight = ''; textareaClone.style.maxHeight = ''; // In Firefox it happens that textarea elements are always bigger than the specified amount // of rows. This is because Firefox tries to add extra space for the horizontal scrollbar. // As a workaround that removes the extra space for the scrollbar, we can just set overflow // to hidden. This ensures that there is no invalid calculation of the line height. // See Firefox bug report: https://bugzilla.mozilla.org/show_bug.cgi?id=33654 textareaClone.style.overflow = 'hidden'; this._textareaElement.parentNode.appendChild(textareaClone); this._cachedLineHeight = textareaClone.clientHeight; this._textareaElement.parentNode.removeChild(textareaClone); // Min and max heights have to be re-calculated if the cached line height changes this._setMinHeight(); this._setMaxHeight(); } ngDoCheck() { if (this._platform.isBrowser) { this.resizeToFitContent(); } } /** * Resize the textarea to fit its content. * @param force Whether to force a height recalculation. By default the height will be * recalculated only if the value changed since the last call. */ resizeToFitContent(force = false) { // If autosizing is disabled, just skip everything else if (!this._enabled) { return; } this._cacheTextareaLineHeight(); // If we haven't determined the line-height yet, we know we're still hidden and there's no point // in checking the height of the textarea. if (!this._cachedLineHeight) { return; } const textarea = this._elementRef.nativeElement; const value = textarea.value; // Only resize if the value or minRows have changed since these calculations can be expensive. if (!force && this._minRows === this._previousMinRows && value === this._previousValue) { return; } const placeholderText = textarea.placeholder; // Reset the textarea height to auto in order to shrink back to its default size. // Also temporarily force overflow:hidden, so scroll bars do not interfere with calculations. // Long placeholders that are wider than the textarea width may lead to a bigger scrollHeight // value. To ensure that the scrollHeight is not bigger than the content, the placeholders // need to be removed temporarily. textarea.classList.add(this._measuringClass); textarea.placeholder = ''; // The measuring class includes a 2px padding to workaround an issue with Chrome, // so we account for that extra space here by subtracting 4 (2px top + 2px bottom). const height = textarea.scrollHeight - 4; // Use the scrollHeight to know how large the textarea *would* be if fit its entire value. textarea.style.height = `${height}px`; textarea.classList.remove(this._measuringClass); textarea.placeholder = placeholderText; this._ngZone.runOutsideAngular(() => { if (typeof requestAnimationFrame !== 'undefined') { requestAnimationFrame(() => this._scrollToCaretPosition(textarea)); } else { setTimeout(() => this._scrollToCaretPosition(textarea)); } }); this._previousValue = value; this._previousMinRows = this._minRows; } /** * Resets the textarea to its original size */ reset() { // Do not try to change the textarea, if the initialHeight has not been determined yet // This might potentially remove styles when reset() is called before ngAfterViewInit if (this._initialHeight !== undefined) { this._textareaElement.style.height = this._initialHeight; } } // In Ivy the `host` metadata will be merged, whereas in ViewEngine it is overridden. In order // to avoid double event listeners, we need to use `HostListener`. Once Ivy is the default, we // can move this back into `host`. // tslint:disable:no-host-decorator-in-concrete _noopInputHandler() { // no-op handler that ensures we're running change detection on input events. } /** Access injected document if available or fallback to global document reference */ _getDocument() { return this._document || document; } /** Use defaultView of injected document if available or fallback to global window reference */ _getWindow() { const doc = this._getDocument(); return doc.defaultView || window; } /** * Scrolls a textarea to the caret position. On Firefox resizing the textarea will * prevent it from scrolling to the caret position. We need to re-set the selection * in order for it to scroll to the proper position. */ _scrollToCaretPosition(textarea) { const { selectionStart, selectionEnd } = textarea; const document = this._getDocument(); // IE will throw an "Unspecified error" if we try to set the selection range after the // element has been removed from the DOM. Assert that the directive hasn't been destroyed // between the time we requested the animation frame and when it was executed. // Also note that we have to assert that the textarea is focused before we set the // selection range. Setting the selection range on a non-focused textarea will cause // it to receive focus on IE and Edge. if (!this._destroyed.isStopped && document.activeElement === textarea) { textarea.setSelectionRange(selectionStart, selectionEnd); } } } CdkTextareaAutosize.ɵfac = function CdkTextareaAutosize_Factory(t) { return new (t || CdkTextareaAutosize)(_angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_0__["Platform"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"]), _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdirectiveInject"](_angular_common__WEBPACK_IMPORTED_MODULE_5__["DOCUMENT"], 8)); }; CdkTextareaAutosize.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineDirective"]({ type: CdkTextareaAutosize, selectors: [["textarea", "cdkTextareaAutosize", ""]], hostAttrs: ["rows", "1", 1, "cdk-textarea-autosize"], hostBindings: function CdkTextareaAutosize_HostBindings(rf, ctx) { if (rf & 1) { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵlistener"]("input", function CdkTextareaAutosize_input_HostBindingHandler() { return ctx._noopInputHandler(); }); } }, inputs: { minRows: ["cdkAutosizeMinRows", "minRows"], maxRows: ["cdkAutosizeMaxRows", "maxRows"], enabled: ["cdkTextareaAutosize", "enabled"] }, exportAs: ["cdkTextareaAutosize"] }); CdkTextareaAutosize.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"] }, { type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_0__["Platform"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_5__["DOCUMENT"],] }] } ]; CdkTextareaAutosize.propDecorators = { minRows: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkAutosizeMinRows',] }], maxRows: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkAutosizeMaxRows',] }], enabled: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkTextareaAutosize',] }], _noopInputHandler: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["HostListener"], args: ['input',] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](CdkTextareaAutosize, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Directive"], args: [{ selector: 'textarea[cdkTextareaAutosize]', exportAs: 'cdkTextareaAutosize', host: { 'class': 'cdk-textarea-autosize', // Textarea elements that have the directive applied should have a single row by default. // Browsers normally show two rows by default and therefore this limits the minRows binding. 'rows': '1' } }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["ElementRef"] }, { type: _angular_cdk_platform__WEBPACK_IMPORTED_MODULE_0__["Platform"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgZone"] }, { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Inject"], args: [_angular_common__WEBPACK_IMPORTED_MODULE_5__["DOCUMENT"]] }] }]; }, { minRows: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkAutosizeMinRows'] }], maxRows: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkAutosizeMaxRows'] }], enabled: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["Input"], args: ['cdkTextareaAutosize'] }], // In Ivy the `host` metadata will be merged, whereas in ViewEngine it is overridden. In order // to avoid double event listeners, we need to use `HostListener`. Once Ivy is the default, we // can move this back into `host`. // tslint:disable:no-host-decorator-in-concrete _noopInputHandler: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["HostListener"], args: ['input'] }] }); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ class TextFieldModule { } TextFieldModule.ɵmod = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineNgModule"]({ type: TextFieldModule }); TextFieldModule.ɵinj = _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵdefineInjector"]({ factory: function TextFieldModule_Factory(t) { return new (t || TextFieldModule)(); }, imports: [[_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_0__["PlatformModule"]]] }); (function () { (typeof ngJitMode === "undefined" || ngJitMode) && _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵɵsetNgModuleScope"](TextFieldModule, { declarations: function () { return [CdkAutofill, CdkTextareaAutosize]; }, imports: function () { return [_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_0__["PlatformModule"]]; }, exports: function () { return [CdkAutofill, CdkTextareaAutosize]; } }); })(); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_1__["ɵsetClassMetadata"](TextFieldModule, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_1__["NgModule"], args: [{ declarations: [CdkAutofill, CdkTextareaAutosize], imports: [_angular_cdk_platform__WEBPACK_IMPORTED_MODULE_0__["PlatformModule"]], exports: [CdkAutofill, CdkTextareaAutosize] }] }], null, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Generated bundle index. Do not edit. */ //# sourceMappingURL=text-field.js.map /***/ }), /***/ "./node_modules/@angular/cdk/fesm2015/cdk.js": /*!***************************************************!*\ !*** ./node_modules/@angular/cdk/fesm2015/cdk.js ***! \***************************************************/ /*! exports provided: VERSION */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; __webpack_require__.r(__webpack_exports__); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "VERSION", function() { return VERSION; }); /* harmony import */ var _angular_core__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @angular/core */ "./node_modules/@angular/core/__ivy_ngcc__/fesm2015/core.js"); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** Current version of the Angular Component Development Kit. */ const VERSION = new _angular_core__WEBPACK_IMPORTED_MODULE_0__["Version"]('10.2.7'); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ //# sourceMappingURL=cdk.js.map /***/ }), /***/ "./node_modules/@angular/cdk/fesm2015/coercion.js": /*!********************************************************!*\ !*** ./node_modules/@angular/cdk/fesm2015/coercion.js ***! \********************************************************/ /*! exports provided: _isNumberValue, coerceArray, coerceBooleanProperty, coerceCssPixelValue, coerceElement, coerceNumberProperty */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; __webpack_require__.r(__webpack_exports__); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "_isNumberValue", function() { return _isNumberValue; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "coerceArray", function() { return coerceArray; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "coerceBooleanProperty", function() { return coerceBooleanProperty; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "coerceCssPixelValue", function() { return coerceCssPixelValue; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "coerceElement", function() { return coerceElement; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "coerceNumberProperty", function() { return coerceNumberProperty; }); /* harmony import */ var _angular_core__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @angular/core */ "./node_modules/@angular/core/__ivy_ngcc__/fesm2015/core.js"); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** Coerces a data-bound value (typically a string) to a boolean. */ function coerceBooleanProperty(value) { return value != null && `${value}` !== 'false'; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ function coerceNumberProperty(value, fallbackValue = 0) { return _isNumberValue(value) ? Number(value) : fallbackValue; } /** * Whether the provided value is considered a number. * @docs-private */ function _isNumberValue(value) { // parseFloat(value) handles most of the cases we're interested in (it treats null, empty string, // and other non-number values as NaN, where Number just uses 0) but it considers the string // '123hello' to be a valid number. Therefore we also check if Number(value) is NaN. return !isNaN(parseFloat(value)) && !isNaN(Number(value)); } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ function coerceArray(value) { return Array.isArray(value) ? value : [value]; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** Coerces a value to a CSS pixel value. */ function coerceCssPixelValue(value) { if (value == null) { return ''; } return typeof value === 'string' ? value : `${value}px`; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Coerces an ElementRef or an Element into an element. * Useful for APIs that can accept either a ref or the native element itself. */ function coerceElement(elementOrRef) { return elementOrRef instanceof _angular_core__WEBPACK_IMPORTED_MODULE_0__["ElementRef"] ? elementOrRef.nativeElement : elementOrRef; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ //# sourceMappingURL=coercion.js.map /***/ }), /***/ "./node_modules/@angular/common/__ivy_ngcc__/fesm2015/common.js": /*!**********************************************************************!*\ !*** ./node_modules/@angular/common/__ivy_ngcc__/fesm2015/common.js ***! \**********************************************************************/ /*! exports provided: APP_BASE_HREF, AsyncPipe, CommonModule, CurrencyPipe, DOCUMENT, DatePipe, DecimalPipe, FormStyle, FormatWidth, HashLocationStrategy, I18nPluralPipe, I18nSelectPipe, JsonPipe, KeyValuePipe, LOCATION_INITIALIZED, Location, LocationStrategy, LowerCasePipe, NgClass, NgComponentOutlet, NgForOf, NgForOfContext, NgIf, NgIfContext, NgLocaleLocalization, NgLocalization, NgPlural, NgPluralCase, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgTemplateOutlet, NumberFormatStyle, NumberSymbol, PathLocationStrategy, PercentPipe, PlatformLocation, Plural, SlicePipe, TitleCasePipe, TranslationWidth, UpperCasePipe, VERSION, ViewportScroller, WeekDay, formatCurrency, formatDate, formatNumber, formatPercent, getCurrencySymbol, getLocaleCurrencyCode, getLocaleCurrencyName, getLocaleCurrencySymbol, getLocaleDateFormat, getLocaleDateTimeFormat, getLocaleDayNames, getLocaleDayPeriods, getLocaleDirection, getLocaleEraNames, getLocaleExtraDayPeriodRules, getLocaleExtraDayPeriods, getLocaleFirstDayOfWeek, getLocaleId, getLocaleMonthNames, getLocaleNumberFormat, getLocaleNumberSymbol, getLocalePluralCase, getLocaleTimeFormat, getLocaleWeekEndRange, getNumberOfCurrencyDigits, isPlatformBrowser, isPlatformServer, isPlatformWorkerApp, isPlatformWorkerUi, registerLocaleData, ɵBrowserPlatformLocation, ɵDomAdapter, ɵNullViewportScroller, ɵPLATFORM_BROWSER_ID, ɵPLATFORM_SERVER_ID, ɵPLATFORM_WORKER_APP_ID, ɵPLATFORM_WORKER_UI_ID, ɵangular_packages_common_common_a, ɵangular_packages_common_common_b, ɵangular_packages_common_common_c, ɵangular_packages_common_common_d, ɵangular_packages_common_common_e, ɵangular_packages_common_common_f, ɵgetDOM, ɵparseCookieValue, ɵsetRootDomAdapter */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; __webpack_require__.r(__webpack_exports__); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "APP_BASE_HREF", function() { return APP_BASE_HREF; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "AsyncPipe", function() { return AsyncPipe; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CommonModule", function() { return CommonModule; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "CurrencyPipe", function() { return CurrencyPipe; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "DOCUMENT", function() { return DOCUMENT; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "DatePipe", function() { return DatePipe; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "DecimalPipe", function() { return DecimalPipe; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "FormStyle", function() { return FormStyle; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "FormatWidth", function() { return FormatWidth; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HashLocationStrategy", function() { return HashLocationStrategy; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "I18nPluralPipe", function() { return I18nPluralPipe; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "I18nSelectPipe", function() { return I18nSelectPipe; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "JsonPipe", function() { return JsonPipe; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "KeyValuePipe", function() { return KeyValuePipe; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "LOCATION_INITIALIZED", function() { return LOCATION_INITIALIZED; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "Location", function() { return Location; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "LocationStrategy", function() { return LocationStrategy; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "LowerCasePipe", function() { return LowerCasePipe; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgClass", function() { return NgClass; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgComponentOutlet", function() { return NgComponentOutlet; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgForOf", function() { return NgForOf; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgForOfContext", function() { return NgForOfContext; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgIf", function() { return NgIf; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgIfContext", function() { return NgIfContext; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgLocaleLocalization", function() { return NgLocaleLocalization; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgLocalization", function() { return NgLocalization; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgPlural", function() { return NgPlural; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgPluralCase", function() { return NgPluralCase; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgStyle", function() { return NgStyle; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgSwitch", function() { return NgSwitch; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgSwitchCase", function() { return NgSwitchCase; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgSwitchDefault", function() { return NgSwitchDefault; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NgTemplateOutlet", function() { return NgTemplateOutlet; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NumberFormatStyle", function() { return NumberFormatStyle; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "NumberSymbol", function() { return NumberSymbol; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "PathLocationStrategy", function() { return PathLocationStrategy; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "PercentPipe", function() { return PercentPipe; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "PlatformLocation", function() { return PlatformLocation; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "Plural", function() { return Plural; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "SlicePipe", function() { return SlicePipe; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "TitleCasePipe", function() { return TitleCasePipe; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "TranslationWidth", function() { return TranslationWidth; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "UpperCasePipe", function() { return UpperCasePipe; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "VERSION", function() { return VERSION; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ViewportScroller", function() { return ViewportScroller; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "WeekDay", function() { return WeekDay; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "formatCurrency", function() { return formatCurrency; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "formatDate", function() { return formatDate; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "formatNumber", function() { return formatNumber; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "formatPercent", function() { return formatPercent; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getCurrencySymbol", function() { return getCurrencySymbol; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleCurrencyCode", function() { return getLocaleCurrencyCode; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleCurrencyName", function() { return getLocaleCurrencyName; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleCurrencySymbol", function() { return getLocaleCurrencySymbol; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleDateFormat", function() { return getLocaleDateFormat; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleDateTimeFormat", function() { return getLocaleDateTimeFormat; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleDayNames", function() { return getLocaleDayNames; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleDayPeriods", function() { return getLocaleDayPeriods; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleDirection", function() { return getLocaleDirection; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleEraNames", function() { return getLocaleEraNames; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleExtraDayPeriodRules", function() { return getLocaleExtraDayPeriodRules; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleExtraDayPeriods", function() { return getLocaleExtraDayPeriods; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleFirstDayOfWeek", function() { return getLocaleFirstDayOfWeek; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleId", function() { return getLocaleId; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleMonthNames", function() { return getLocaleMonthNames; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleNumberFormat", function() { return getLocaleNumberFormat; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleNumberSymbol", function() { return getLocaleNumberSymbol; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocalePluralCase", function() { return getLocalePluralCase; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleTimeFormat", function() { return getLocaleTimeFormat; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getLocaleWeekEndRange", function() { return getLocaleWeekEndRange; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "getNumberOfCurrencyDigits", function() { return getNumberOfCurrencyDigits; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "isPlatformBrowser", function() { return isPlatformBrowser; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "isPlatformServer", function() { return isPlatformServer; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "isPlatformWorkerApp", function() { return isPlatformWorkerApp; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "isPlatformWorkerUi", function() { return isPlatformWorkerUi; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "registerLocaleData", function() { return registerLocaleData; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵBrowserPlatformLocation", function() { return BrowserPlatformLocation; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵDomAdapter", function() { return DomAdapter; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵNullViewportScroller", function() { return NullViewportScroller; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵPLATFORM_BROWSER_ID", function() { return PLATFORM_BROWSER_ID; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵPLATFORM_SERVER_ID", function() { return PLATFORM_SERVER_ID; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵPLATFORM_WORKER_APP_ID", function() { return PLATFORM_WORKER_APP_ID; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵPLATFORM_WORKER_UI_ID", function() { return PLATFORM_WORKER_UI_ID; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_common_a", function() { return useBrowserPlatformLocation; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_common_b", function() { return createBrowserPlatformLocation; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_common_c", function() { return createLocation; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_common_d", function() { return provideLocationStrategy; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_common_e", function() { return COMMON_DIRECTIVES; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_common_f", function() { return COMMON_PIPES; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵgetDOM", function() { return getDOM; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵparseCookieValue", function() { return parseCookieValue; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵsetRootDomAdapter", function() { return setRootDomAdapter; }); /* harmony import */ var _angular_core__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @angular/core */ "./node_modules/@angular/core/__ivy_ngcc__/fesm2015/core.js"); /** * @license Angular v10.2.4 * (c) 2010-2020 Google LLC. https://angular.io/ * License: MIT */ /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ let _DOM = null; function getDOM() { return _DOM; } function setDOM(adapter) { _DOM = adapter; } function setRootDomAdapter(adapter) { if (!_DOM) { _DOM = adapter; } } /* tslint:disable:requireParameterType */ /** * Provides DOM operations in an environment-agnostic way. * * @security Tread carefully! Interacting with the DOM directly is dangerous and * can introduce XSS risks. */ class DomAdapter { } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * A DI Token representing the main rendering context. In a browser this is the DOM Document. * * Note: Document might not be available in the Application Context when Application and Rendering * Contexts are not the same (e.g. when running the application in a Web Worker). * * @publicApi */ const DOCUMENT = new _angular_core__WEBPACK_IMPORTED_MODULE_0__["InjectionToken"]('DocumentToken'); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * This class should not be used directly by an application developer. Instead, use * {@link Location}. * * `PlatformLocation` encapsulates all calls to DOM APIs, which allows the Router to be * platform-agnostic. * This means that we can have different implementation of `PlatformLocation` for the different * platforms that Angular supports. For example, `@angular/platform-browser` provides an * implementation specific to the browser environment, while `@angular/platform-server` provides * one suitable for use with server-side rendering. * * The `PlatformLocation` class is used directly by all implementations of {@link LocationStrategy} * when they need to interact with the DOM APIs like pushState, popState, etc. * * {@link LocationStrategy} in turn is used by the {@link Location} service which is used directly * by the {@link Router} in order to navigate between routes. Since all interactions between {@link * Router} / * {@link Location} / {@link LocationStrategy} and DOM APIs flow through the `PlatformLocation` * class, they are all platform-agnostic. * * @publicApi */ class PlatformLocation { } PlatformLocation.ɵfac = function PlatformLocation_Factory(t) { return new (t || PlatformLocation)(); }; PlatformLocation.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"])({ factory: useBrowserPlatformLocation, token: PlatformLocation, providedIn: "platform" }); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](PlatformLocation, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Injectable"], args: [{ providedIn: 'platform', // See #23917 useFactory: useBrowserPlatformLocation }] }], null, null); })(); function useBrowserPlatformLocation() { return Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(BrowserPlatformLocation); } /** * @description * Indicates when a location is initialized. * * @publicApi */ const LOCATION_INITIALIZED = new _angular_core__WEBPACK_IMPORTED_MODULE_0__["InjectionToken"]('Location Initialized'); /** * `PlatformLocation` encapsulates all of the direct calls to platform APIs. * This class should not be used directly by an application developer. Instead, use * {@link Location}. */ class BrowserPlatformLocation extends PlatformLocation { constructor(_doc) { super(); this._doc = _doc; this._init(); } // This is moved to its own method so that `MockPlatformLocationStrategy` can overwrite it /** @internal */ _init() { this.location = getDOM().getLocation(); this._history = getDOM().getHistory(); } getBaseHrefFromDOM() { return getDOM().getBaseHref(this._doc); } onPopState(fn) { getDOM().getGlobalEventTarget(this._doc, 'window').addEventListener('popstate', fn, false); } onHashChange(fn) { getDOM().getGlobalEventTarget(this._doc, 'window').addEventListener('hashchange', fn, false); } get href() { return this.location.href; } get protocol() { return this.location.protocol; } get hostname() { return this.location.hostname; } get port() { return this.location.port; } get pathname() { return this.location.pathname; } get search() { return this.location.search; } get hash() { return this.location.hash; } set pathname(newPath) { this.location.pathname = newPath; } pushState(state, title, url) { if (supportsState()) { this._history.pushState(state, title, url); } else { this.location.hash = url; } } replaceState(state, title, url) { if (supportsState()) { this._history.replaceState(state, title, url); } else { this.location.hash = url; } } forward() { this._history.forward(); } back() { this._history.back(); } getState() { return this._history.state; } } BrowserPlatformLocation.ɵfac = function BrowserPlatformLocation_Factory(t) { return new (t || BrowserPlatformLocation)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](DOCUMENT)); }; BrowserPlatformLocation.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"])({ factory: createBrowserPlatformLocation, token: BrowserPlatformLocation, providedIn: "platform" }); BrowserPlatformLocation.ctorParameters = () => [ { type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Inject"], args: [DOCUMENT,] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](BrowserPlatformLocation, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Injectable"], args: [{ providedIn: 'platform', // See #23917 useFactory: createBrowserPlatformLocation }] }], function () { return [{ type: undefined, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Inject"], args: [DOCUMENT] }] }]; }, null); })(); function supportsState() { return !!window.history.pushState; } function createBrowserPlatformLocation() { return new BrowserPlatformLocation(Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(DOCUMENT)); } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Joins two parts of a URL with a slash if needed. * * @param start URL string * @param end URL string * * * @returns The joined URL string. */ function joinWithSlash(start, end) { if (start.length == 0) { return end; } if (end.length == 0) { return start; } let slashes = 0; if (start.endsWith('/')) { slashes++; } if (end.startsWith('/')) { slashes++; } if (slashes == 2) { return start + end.substring(1); } if (slashes == 1) { return start + end; } return start + '/' + end; } /** * Removes a trailing slash from a URL string if needed. * Looks for the first occurrence of either `#`, `?`, or the end of the * line as `/` characters and removes the trailing slash if one exists. * * @param url URL string. * * @returns The URL string, modified if needed. */ function stripTrailingSlash(url) { const match = url.match(/#|\?|$/); const pathEndIdx = match && match.index || url.length; const droppedSlashIdx = pathEndIdx - (url[pathEndIdx - 1] === '/' ? 1 : 0); return url.slice(0, droppedSlashIdx) + url.slice(pathEndIdx); } /** * Normalizes URL parameters by prepending with `?` if needed. * * @param params String of URL parameters. * * @returns The normalized URL parameters string. */ function normalizeQueryParams(params) { return params && params[0] !== '?' ? '?' + params : params; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Enables the `Location` service to read route state from the browser's URL. * Angular provides two strategies: * `HashLocationStrategy` and `PathLocationStrategy`. * * Applications should use the `Router` or `Location` services to * interact with application route state. * * For instance, `HashLocationStrategy` produces URLs like * http://example.com#/foo, * and `PathLocationStrategy` produces * http://example.com/foo as an equivalent URL. * * See these two classes for more. * * @publicApi */ class LocationStrategy { } LocationStrategy.ɵfac = function LocationStrategy_Factory(t) { return new (t || LocationStrategy)(); }; LocationStrategy.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"])({ factory: provideLocationStrategy, token: LocationStrategy, providedIn: "root" }); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](LocationStrategy, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Injectable"], args: [{ providedIn: 'root', useFactory: provideLocationStrategy }] }], null, null); })(); function provideLocationStrategy(platformLocation) { // See #23917 const location = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(DOCUMENT).location; return new PathLocationStrategy(Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(PlatformLocation), location && location.origin || ''); } /** * A predefined [DI token](guide/glossary#di-token) for the base href * to be used with the `PathLocationStrategy`. * The base href is the URL prefix that should be preserved when generating * and recognizing URLs. * * @usageNotes * * The following example shows how to use this token to configure the root app injector * with a base href value, so that the DI framework can supply the dependency anywhere in the app. * * ```typescript * import {Component, NgModule} from '@angular/core'; * import {APP_BASE_HREF} from '@angular/common'; * * @NgModule({ * providers: [{provide: APP_BASE_HREF, useValue: '/my/app'}] * }) * class AppModule {} * ``` * * @publicApi */ const APP_BASE_HREF = new _angular_core__WEBPACK_IMPORTED_MODULE_0__["InjectionToken"]('appBaseHref'); /** * @description * A {@link LocationStrategy} used to configure the {@link Location} service to * represent its state in the * [path](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax) of the * browser's URL. * * If you're using `PathLocationStrategy`, you must provide a {@link APP_BASE_HREF} * or add a `` element to the document. * * For instance, if you provide an `APP_BASE_HREF` of `'/my/app/'` and call * `location.go('/foo')`, the browser's URL will become * `example.com/my/app/foo`. To ensure all relative URIs resolve correctly, * the `` and/or `APP_BASE_HREF` should end with a `/`. * * Similarly, if you add `` to the document and call * `location.go('/foo')`, the browser's URL will become * `example.com/my/app/foo`. * * Note that when using `PathLocationStrategy`, neither the query nor * the fragment in the `` will be preserved, as outlined * by the [RFC](https://tools.ietf.org/html/rfc3986#section-5.2.2). * * @usageNotes * * ### Example * * {@example common/location/ts/path_location_component.ts region='LocationComponent'} * * @publicApi */ class PathLocationStrategy extends LocationStrategy { constructor(_platformLocation, href) { super(); this._platformLocation = _platformLocation; if (href == null) { href = this._platformLocation.getBaseHrefFromDOM(); } if (href == null) { throw new Error(`No base href set. Please provide a value for the APP_BASE_HREF token or add a base element to the document.`); } this._baseHref = href; } onPopState(fn) { this._platformLocation.onPopState(fn); this._platformLocation.onHashChange(fn); } getBaseHref() { return this._baseHref; } prepareExternalUrl(internal) { return joinWithSlash(this._baseHref, internal); } path(includeHash = false) { const pathname = this._platformLocation.pathname + normalizeQueryParams(this._platformLocation.search); const hash = this._platformLocation.hash; return hash && includeHash ? `${pathname}${hash}` : pathname; } pushState(state, title, url, queryParams) { const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams)); this._platformLocation.pushState(state, title, externalUrl); } replaceState(state, title, url, queryParams) { const externalUrl = this.prepareExternalUrl(url + normalizeQueryParams(queryParams)); this._platformLocation.replaceState(state, title, externalUrl); } forward() { this._platformLocation.forward(); } back() { this._platformLocation.back(); } } PathLocationStrategy.ɵfac = function PathLocationStrategy_Factory(t) { return new (t || PathLocationStrategy)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](PlatformLocation), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](APP_BASE_HREF, 8)); }; PathLocationStrategy.ɵprov = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"]({ token: PathLocationStrategy, factory: PathLocationStrategy.ɵfac }); PathLocationStrategy.ctorParameters = () => [ { type: PlatformLocation }, { type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Inject"], args: [APP_BASE_HREF,] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](PathLocationStrategy, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Injectable"] }], function () { return [{ type: PlatformLocation }, { type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Inject"], args: [APP_BASE_HREF] }] }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @description * A {@link LocationStrategy} used to configure the {@link Location} service to * represent its state in the * [hash fragment](https://en.wikipedia.org/wiki/Uniform_Resource_Locator#Syntax) * of the browser's URL. * * For instance, if you call `location.go('/foo')`, the browser's URL will become * `example.com#/foo`. * * @usageNotes * * ### Example * * {@example common/location/ts/hash_location_component.ts region='LocationComponent'} * * @publicApi */ class HashLocationStrategy extends LocationStrategy { constructor(_platformLocation, _baseHref) { super(); this._platformLocation = _platformLocation; this._baseHref = ''; if (_baseHref != null) { this._baseHref = _baseHref; } } onPopState(fn) { this._platformLocation.onPopState(fn); this._platformLocation.onHashChange(fn); } getBaseHref() { return this._baseHref; } path(includeHash = false) { // the hash value is always prefixed with a `#` // and if it is empty then it will stay empty let path = this._platformLocation.hash; if (path == null) path = '#'; return path.length > 0 ? path.substring(1) : path; } prepareExternalUrl(internal) { const url = joinWithSlash(this._baseHref, internal); return url.length > 0 ? ('#' + url) : url; } pushState(state, title, path, queryParams) { let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams)); if (url.length == 0) { url = this._platformLocation.pathname; } this._platformLocation.pushState(state, title, url); } replaceState(state, title, path, queryParams) { let url = this.prepareExternalUrl(path + normalizeQueryParams(queryParams)); if (url.length == 0) { url = this._platformLocation.pathname; } this._platformLocation.replaceState(state, title, url); } forward() { this._platformLocation.forward(); } back() { this._platformLocation.back(); } } HashLocationStrategy.ɵfac = function HashLocationStrategy_Factory(t) { return new (t || HashLocationStrategy)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](PlatformLocation), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](APP_BASE_HREF, 8)); }; HashLocationStrategy.ɵprov = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"]({ token: HashLocationStrategy, factory: HashLocationStrategy.ɵfac }); HashLocationStrategy.ctorParameters = () => [ { type: PlatformLocation }, { type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Inject"], args: [APP_BASE_HREF,] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](HashLocationStrategy, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Injectable"] }], function () { return [{ type: PlatformLocation }, { type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Optional"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Inject"], args: [APP_BASE_HREF] }] }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @description * * A service that applications can use to interact with a browser's URL. * * Depending on the `LocationStrategy` used, `Location` persists * to the URL's path or the URL's hash segment. * * @usageNotes * * It's better to use the `Router#navigate` service to trigger route changes. Use * `Location` only if you need to interact with or create normalized URLs outside of * routing. * * `Location` is responsible for normalizing the URL against the application's base href. * A normalized URL is absolute from the URL host, includes the application's base href, and has no * trailing slash: * - `/my/app/user/123` is normalized * - `my/app/user/123` **is not** normalized * - `/my/app/user/123/` **is not** normalized * * ### Example * * * * @publicApi */ class Location { constructor(platformStrategy, platformLocation) { /** @internal */ this._subject = new _angular_core__WEBPACK_IMPORTED_MODULE_0__["EventEmitter"](); /** @internal */ this._urlChangeListeners = []; this._platformStrategy = platformStrategy; const browserBaseHref = this._platformStrategy.getBaseHref(); this._platformLocation = platformLocation; this._baseHref = stripTrailingSlash(_stripIndexHtml(browserBaseHref)); this._platformStrategy.onPopState((ev) => { this._subject.emit({ 'url': this.path(true), 'pop': true, 'state': ev.state, 'type': ev.type, }); }); } /** * Normalizes the URL path for this location. * * @param includeHash True to include an anchor fragment in the path. * * @returns The normalized URL path. */ // TODO: vsavkin. Remove the boolean flag and always include hash once the deprecated router is // removed. path(includeHash = false) { return this.normalize(this._platformStrategy.path(includeHash)); } /** * Reports the current state of the location history. * @returns The current value of the `history.state` object. */ getState() { return this._platformLocation.getState(); } /** * Normalizes the given path and compares to the current normalized path. * * @param path The given URL path. * @param query Query parameters. * * @returns True if the given URL path is equal to the current normalized path, false * otherwise. */ isCurrentPathEqualTo(path, query = '') { return this.path() == this.normalize(path + normalizeQueryParams(query)); } /** * Normalizes a URL path by stripping any trailing slashes. * * @param url String representing a URL. * * @returns The normalized URL string. */ normalize(url) { return Location.stripTrailingSlash(_stripBaseHref(this._baseHref, _stripIndexHtml(url))); } /** * Normalizes an external URL path. * If the given URL doesn't begin with a leading slash (`'/'`), adds one * before normalizing. Adds a hash if `HashLocationStrategy` is * in use, or the `APP_BASE_HREF` if the `PathLocationStrategy` is in use. * * @param url String representing a URL. * * @returns A normalized platform-specific URL. */ prepareExternalUrl(url) { if (url && url[0] !== '/') { url = '/' + url; } return this._platformStrategy.prepareExternalUrl(url); } // TODO: rename this method to pushState /** * Changes the browser's URL to a normalized version of a given URL, and pushes a * new item onto the platform's history. * * @param path URL path to normalize. * @param query Query parameters. * @param state Location history state. * */ go(path, query = '', state = null) { this._platformStrategy.pushState(state, '', path, query); this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state); } /** * Changes the browser's URL to a normalized version of the given URL, and replaces * the top item on the platform's history stack. * * @param path URL path to normalize. * @param query Query parameters. * @param state Location history state. */ replaceState(path, query = '', state = null) { this._platformStrategy.replaceState(state, '', path, query); this._notifyUrlChangeListeners(this.prepareExternalUrl(path + normalizeQueryParams(query)), state); } /** * Navigates forward in the platform's history. */ forward() { this._platformStrategy.forward(); } /** * Navigates back in the platform's history. */ back() { this._platformStrategy.back(); } /** * Registers a URL change listener. Use to catch updates performed by the Angular * framework that are not detectible through "popstate" or "hashchange" events. * * @param fn The change handler function, which take a URL and a location history state. */ onUrlChange(fn) { this._urlChangeListeners.push(fn); if (!this._urlChangeSubscription) { this._urlChangeSubscription = this.subscribe(v => { this._notifyUrlChangeListeners(v.url, v.state); }); } } /** @internal */ _notifyUrlChangeListeners(url = '', state) { this._urlChangeListeners.forEach(fn => fn(url, state)); } /** * Subscribes to the platform's `popState` events. * * @param value Event that is triggered when the state history changes. * @param exception The exception to throw. * * @returns Subscribed events. */ subscribe(onNext, onThrow, onReturn) { return this._subject.subscribe({ next: onNext, error: onThrow, complete: onReturn }); } } Location.ɵfac = function Location_Factory(t) { return new (t || Location)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](LocationStrategy), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](PlatformLocation)); }; /** * Normalizes URL parameters by prepending with `?` if needed. * * @param params String of URL parameters. * * @returns The normalized URL parameters string. */ Location.normalizeQueryParams = normalizeQueryParams; /** * Joins two parts of a URL with a slash if needed. * * @param start URL string * @param end URL string * * * @returns The joined URL string. */ Location.joinWithSlash = joinWithSlash; /** * Removes a trailing slash from a URL string if needed. * Looks for the first occurrence of either `#`, `?`, or the end of the * line as `/` characters and removes the trailing slash if one exists. * * @param url URL string. * * @returns The URL string, modified if needed. */ Location.stripTrailingSlash = stripTrailingSlash; Location.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"])({ factory: createLocation, token: Location, providedIn: "root" }); Location.ctorParameters = () => [ { type: LocationStrategy }, { type: PlatformLocation } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](Location, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Injectable"], args: [{ providedIn: 'root', // See #23917 useFactory: createLocation }] }], function () { return [{ type: LocationStrategy }, { type: PlatformLocation }]; }, null); })(); function createLocation() { return new Location(Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(LocationStrategy), Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(PlatformLocation)); } function _stripBaseHref(baseHref, url) { return baseHref && url.startsWith(baseHref) ? url.substring(baseHref.length) : url; } function _stripIndexHtml(url) { return url.replace(/\/index.html$/, ''); } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** @internal */ const CURRENCIES_EN = { 'ADP': [undefined, undefined, 0], 'AFN': [undefined, undefined, 0], 'ALL': [undefined, undefined, 0], 'AMD': [undefined, undefined, 2], 'AOA': [undefined, 'Kz'], 'ARS': [undefined, '$'], 'AUD': ['A$', '$'], 'BAM': [undefined, 'KM'], 'BBD': [undefined, '$'], 'BDT': [undefined, '৳'], 'BHD': [undefined, undefined, 3], 'BIF': [undefined, undefined, 0], 'BMD': [undefined, '$'], 'BND': [undefined, '$'], 'BOB': [undefined, 'Bs'], 'BRL': ['R$'], 'BSD': [undefined, '$'], 'BWP': [undefined, 'P'], 'BYN': [undefined, 'р.', 2], 'BYR': [undefined, undefined, 0], 'BZD': [undefined, '$'], 'CAD': ['CA$', '$', 2], 'CHF': [undefined, undefined, 2], 'CLF': [undefined, undefined, 4], 'CLP': [undefined, '$', 0], 'CNY': ['CN¥', '¥'], 'COP': [undefined, '$', 2], 'CRC': [undefined, '₡', 2], 'CUC': [undefined, '$'], 'CUP': [undefined, '$'], 'CZK': [undefined, 'Kč', 2], 'DJF': [undefined, undefined, 0], 'DKK': [undefined, 'kr', 2], 'DOP': [undefined, '$'], 'EGP': [undefined, 'E£'], 'ESP': [undefined, '₧', 0], 'EUR': ['€'], 'FJD': [undefined, '$'], 'FKP': [undefined, '£'], 'GBP': ['£'], 'GEL': [undefined, '₾'], 'GIP': [undefined, '£'], 'GNF': [undefined, 'FG', 0], 'GTQ': [undefined, 'Q'], 'GYD': [undefined, '$', 2], 'HKD': ['HK$', '$'], 'HNL': [undefined, 'L'], 'HRK': [undefined, 'kn'], 'HUF': [undefined, 'Ft', 2], 'IDR': [undefined, 'Rp', 2], 'ILS': ['₪'], 'INR': ['₹'], 'IQD': [undefined, undefined, 0], 'IRR': [undefined, undefined, 0], 'ISK': [undefined, 'kr', 0], 'ITL': [undefined, undefined, 0], 'JMD': [undefined, '$'], 'JOD': [undefined, undefined, 3], 'JPY': ['¥', undefined, 0], 'KHR': [undefined, '៛'], 'KMF': [undefined, 'CF', 0], 'KPW': [undefined, '₩', 0], 'KRW': ['₩', undefined, 0], 'KWD': [undefined, undefined, 3], 'KYD': [undefined, '$'], 'KZT': [undefined, '₸'], 'LAK': [undefined, '₭', 0], 'LBP': [undefined, 'L£', 0], 'LKR': [undefined, 'Rs'], 'LRD': [undefined, '$'], 'LTL': [undefined, 'Lt'], 'LUF': [undefined, undefined, 0], 'LVL': [undefined, 'Ls'], 'LYD': [undefined, undefined, 3], 'MGA': [undefined, 'Ar', 0], 'MGF': [undefined, undefined, 0], 'MMK': [undefined, 'K', 0], 'MNT': [undefined, '₮', 2], 'MRO': [undefined, undefined, 0], 'MUR': [undefined, 'Rs', 2], 'MXN': ['MX$', '$'], 'MYR': [undefined, 'RM'], 'NAD': [undefined, '$'], 'NGN': [undefined, '₦'], 'NIO': [undefined, 'C$'], 'NOK': [undefined, 'kr', 2], 'NPR': [undefined, 'Rs'], 'NZD': ['NZ$', '$'], 'OMR': [undefined, undefined, 3], 'PHP': [undefined, '₱'], 'PKR': [undefined, 'Rs', 2], 'PLN': [undefined, 'zł'], 'PYG': [undefined, '₲', 0], 'RON': [undefined, 'lei'], 'RSD': [undefined, undefined, 0], 'RUB': [undefined, '₽'], 'RUR': [undefined, 'р.'], 'RWF': [undefined, 'RF', 0], 'SBD': [undefined, '$'], 'SEK': [undefined, 'kr', 2], 'SGD': [undefined, '$'], 'SHP': [undefined, '£'], 'SLL': [undefined, undefined, 0], 'SOS': [undefined, undefined, 0], 'SRD': [undefined, '$'], 'SSP': [undefined, '£'], 'STD': [undefined, undefined, 0], 'STN': [undefined, 'Db'], 'SYP': [undefined, '£', 0], 'THB': [undefined, '฿'], 'TMM': [undefined, undefined, 0], 'TND': [undefined, undefined, 3], 'TOP': [undefined, 'T$'], 'TRL': [undefined, undefined, 0], 'TRY': [undefined, '₺'], 'TTD': [undefined, '$'], 'TWD': ['NT$', '$', 2], 'TZS': [undefined, undefined, 2], 'UAH': [undefined, '₴'], 'UGX': [undefined, undefined, 0], 'USD': ['$'], 'UYI': [undefined, undefined, 0], 'UYU': [undefined, '$'], 'UYW': [undefined, undefined, 4], 'UZS': [undefined, undefined, 2], 'VEF': [undefined, 'Bs', 2], 'VND': ['₫', undefined, 0], 'VUV': [undefined, undefined, 0], 'XAF': ['FCFA', undefined, 0], 'XCD': ['EC$', '$'], 'XOF': ['CFA', undefined, 0], 'XPF': ['CFPF', undefined, 0], 'XXX': ['¤'], 'YER': [undefined, undefined, 0], 'ZAR': [undefined, 'R'], 'ZMK': [undefined, undefined, 0], 'ZMW': [undefined, 'ZK'], 'ZWD': [undefined, undefined, 0] }; /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Format styles that can be used to represent numbers. * @see `getLocaleNumberFormat()`. * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * * @publicApi */ var NumberFormatStyle; (function (NumberFormatStyle) { NumberFormatStyle[NumberFormatStyle["Decimal"] = 0] = "Decimal"; NumberFormatStyle[NumberFormatStyle["Percent"] = 1] = "Percent"; NumberFormatStyle[NumberFormatStyle["Currency"] = 2] = "Currency"; NumberFormatStyle[NumberFormatStyle["Scientific"] = 3] = "Scientific"; })(NumberFormatStyle || (NumberFormatStyle = {})); /** * Plurality cases used for translating plurals to different languages. * * @see `NgPlural` * @see `NgPluralCase` * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * * @publicApi */ var Plural; (function (Plural) { Plural[Plural["Zero"] = 0] = "Zero"; Plural[Plural["One"] = 1] = "One"; Plural[Plural["Two"] = 2] = "Two"; Plural[Plural["Few"] = 3] = "Few"; Plural[Plural["Many"] = 4] = "Many"; Plural[Plural["Other"] = 5] = "Other"; })(Plural || (Plural = {})); /** * Context-dependant translation forms for strings. * Typically the standalone version is for the nominative form of the word, * and the format version is used for the genitive case. * @see [CLDR website](http://cldr.unicode.org/translation/date-time-1/date-time#TOC-Standalone-vs.-Format-Styles) * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * * @publicApi */ var FormStyle; (function (FormStyle) { FormStyle[FormStyle["Format"] = 0] = "Format"; FormStyle[FormStyle["Standalone"] = 1] = "Standalone"; })(FormStyle || (FormStyle = {})); /** * String widths available for translations. * The specific character widths are locale-specific. * Examples are given for the word "Sunday" in English. * * @publicApi */ var TranslationWidth; (function (TranslationWidth) { /** 1 character for `en-US`. For example: 'S' */ TranslationWidth[TranslationWidth["Narrow"] = 0] = "Narrow"; /** 3 characters for `en-US`. For example: 'Sun' */ TranslationWidth[TranslationWidth["Abbreviated"] = 1] = "Abbreviated"; /** Full length for `en-US`. For example: "Sunday" */ TranslationWidth[TranslationWidth["Wide"] = 2] = "Wide"; /** 2 characters for `en-US`, For example: "Su" */ TranslationWidth[TranslationWidth["Short"] = 3] = "Short"; })(TranslationWidth || (TranslationWidth = {})); /** * String widths available for date-time formats. * The specific character widths are locale-specific. * Examples are given for `en-US`. * * @see `getLocaleDateFormat()` * @see `getLocaleTimeFormat()`` * @see `getLocaleDateTimeFormat()` * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * @publicApi */ var FormatWidth; (function (FormatWidth) { /** * For `en-US`, 'M/d/yy, h:mm a'` * (Example: `6/15/15, 9:03 AM`) */ FormatWidth[FormatWidth["Short"] = 0] = "Short"; /** * For `en-US`, `'MMM d, y, h:mm:ss a'` * (Example: `Jun 15, 2015, 9:03:01 AM`) */ FormatWidth[FormatWidth["Medium"] = 1] = "Medium"; /** * For `en-US`, `'MMMM d, y, h:mm:ss a z'` * (Example: `June 15, 2015 at 9:03:01 AM GMT+1`) */ FormatWidth[FormatWidth["Long"] = 2] = "Long"; /** * For `en-US`, `'EEEE, MMMM d, y, h:mm:ss a zzzz'` * (Example: `Monday, June 15, 2015 at 9:03:01 AM GMT+01:00`) */ FormatWidth[FormatWidth["Full"] = 3] = "Full"; })(FormatWidth || (FormatWidth = {})); /** * Symbols that can be used to replace placeholders in number patterns. * Examples are based on `en-US` values. * * @see `getLocaleNumberSymbol()` * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * * @publicApi */ var NumberSymbol; (function (NumberSymbol) { /** * Decimal separator. * For `en-US`, the dot character. * Example : 2,345`.`67 */ NumberSymbol[NumberSymbol["Decimal"] = 0] = "Decimal"; /** * Grouping separator, typically for thousands. * For `en-US`, the comma character. * Example: 2`,`345.67 */ NumberSymbol[NumberSymbol["Group"] = 1] = "Group"; /** * List-item separator. * Example: "one, two, and three" */ NumberSymbol[NumberSymbol["List"] = 2] = "List"; /** * Sign for percentage (out of 100). * Example: 23.4% */ NumberSymbol[NumberSymbol["PercentSign"] = 3] = "PercentSign"; /** * Sign for positive numbers. * Example: +23 */ NumberSymbol[NumberSymbol["PlusSign"] = 4] = "PlusSign"; /** * Sign for negative numbers. * Example: -23 */ NumberSymbol[NumberSymbol["MinusSign"] = 5] = "MinusSign"; /** * Computer notation for exponential value (n times a power of 10). * Example: 1.2E3 */ NumberSymbol[NumberSymbol["Exponential"] = 6] = "Exponential"; /** * Human-readable format of exponential. * Example: 1.2x103 */ NumberSymbol[NumberSymbol["SuperscriptingExponent"] = 7] = "SuperscriptingExponent"; /** * Sign for permille (out of 1000). * Example: 23.4‰ */ NumberSymbol[NumberSymbol["PerMille"] = 8] = "PerMille"; /** * Infinity, can be used with plus and minus. * Example: ∞, +∞, -∞ */ NumberSymbol[NumberSymbol["Infinity"] = 9] = "Infinity"; /** * Not a number. * Example: NaN */ NumberSymbol[NumberSymbol["NaN"] = 10] = "NaN"; /** * Symbol used between time units. * Example: 10:52 */ NumberSymbol[NumberSymbol["TimeSeparator"] = 11] = "TimeSeparator"; /** * Decimal separator for currency values (fallback to `Decimal`). * Example: $2,345.67 */ NumberSymbol[NumberSymbol["CurrencyDecimal"] = 12] = "CurrencyDecimal"; /** * Group separator for currency values (fallback to `Group`). * Example: $2,345.67 */ NumberSymbol[NumberSymbol["CurrencyGroup"] = 13] = "CurrencyGroup"; })(NumberSymbol || (NumberSymbol = {})); /** * The value for each day of the week, based on the `en-US` locale * * @publicApi */ var WeekDay; (function (WeekDay) { WeekDay[WeekDay["Sunday"] = 0] = "Sunday"; WeekDay[WeekDay["Monday"] = 1] = "Monday"; WeekDay[WeekDay["Tuesday"] = 2] = "Tuesday"; WeekDay[WeekDay["Wednesday"] = 3] = "Wednesday"; WeekDay[WeekDay["Thursday"] = 4] = "Thursday"; WeekDay[WeekDay["Friday"] = 5] = "Friday"; WeekDay[WeekDay["Saturday"] = 6] = "Saturday"; })(WeekDay || (WeekDay = {})); /** * Retrieves the locale ID from the currently loaded locale. * The loaded locale could be, for example, a global one rather than a regional one. * @param locale A locale code, such as `fr-FR`. * @returns The locale code. For example, `fr`. * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * * @publicApi */ function getLocaleId(locale) { return Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale)[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].LocaleId]; } /** * Retrieves day period strings for the given locale. * * @param locale A locale code for the locale format rules to use. * @param formStyle The required grammatical form. * @param width The required character width. * @returns An array of localized period strings. For example, `[AM, PM]` for `en-US`. * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * * @publicApi */ function getLocaleDayPeriods(locale, formStyle, width) { const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale); const amPmData = [ data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].DayPeriodsFormat], data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].DayPeriodsStandalone] ]; const amPm = getLastDefinedValue(amPmData, formStyle); return getLastDefinedValue(amPm, width); } /** * Retrieves days of the week for the given locale, using the Gregorian calendar. * * @param locale A locale code for the locale format rules to use. * @param formStyle The required grammatical form. * @param width The required character width. * @returns An array of localized name strings. * For example,`[Sunday, Monday, ... Saturday]` for `en-US`. * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * * @publicApi */ function getLocaleDayNames(locale, formStyle, width) { const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale); const daysData = [data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].DaysFormat], data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].DaysStandalone]]; const days = getLastDefinedValue(daysData, formStyle); return getLastDefinedValue(days, width); } /** * Retrieves months of the year for the given locale, using the Gregorian calendar. * * @param locale A locale code for the locale format rules to use. * @param formStyle The required grammatical form. * @param width The required character width. * @returns An array of localized name strings. * For example, `[January, February, ...]` for `en-US`. * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * * @publicApi */ function getLocaleMonthNames(locale, formStyle, width) { const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale); const monthsData = [data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].MonthsFormat], data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].MonthsStandalone]]; const months = getLastDefinedValue(monthsData, formStyle); return getLastDefinedValue(months, width); } /** * Retrieves Gregorian-calendar eras for the given locale. * @param locale A locale code for the locale format rules to use. * @param formStyle The required grammatical form. * @param width The required character width. * @returns An array of localized era strings. * For example, `[AD, BC]` for `en-US`. * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * * @publicApi */ function getLocaleEraNames(locale, width) { const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale); const erasData = data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].Eras]; return getLastDefinedValue(erasData, width); } /** * Retrieves the first day of the week for the given locale. * * @param locale A locale code for the locale format rules to use. * @returns A day index number, using the 0-based week-day index for `en-US` * (Sunday = 0, Monday = 1, ...). * For example, for `fr-FR`, returns 1 to indicate that the first day is Monday. * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * * @publicApi */ function getLocaleFirstDayOfWeek(locale) { const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale); return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].FirstDayOfWeek]; } /** * Range of week days that are considered the week-end for the given locale. * * @param locale A locale code for the locale format rules to use. * @returns The range of day values, `[startDay, endDay]`. * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * * @publicApi */ function getLocaleWeekEndRange(locale) { const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale); return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].WeekendRange]; } /** * Retrieves a localized date-value formating string. * * @param locale A locale code for the locale format rules to use. * @param width The format type. * @returns The localized formating string. * @see `FormatWidth` * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * * @publicApi */ function getLocaleDateFormat(locale, width) { const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale); return getLastDefinedValue(data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].DateFormat], width); } /** * Retrieves a localized time-value formatting string. * * @param locale A locale code for the locale format rules to use. * @param width The format type. * @returns The localized formatting string. * @see `FormatWidth` * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * @publicApi */ function getLocaleTimeFormat(locale, width) { const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale); return getLastDefinedValue(data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].TimeFormat], width); } /** * Retrieves a localized date-time formatting string. * * @param locale A locale code for the locale format rules to use. * @param width The format type. * @returns The localized formatting string. * @see `FormatWidth` * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * * @publicApi */ function getLocaleDateTimeFormat(locale, width) { const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale); const dateTimeFormatData = data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].DateTimeFormat]; return getLastDefinedValue(dateTimeFormatData, width); } /** * Retrieves a localized number symbol that can be used to replace placeholders in number formats. * @param locale The locale code. * @param symbol The symbol to localize. * @returns The character for the localized symbol. * @see `NumberSymbol` * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * * @publicApi */ function getLocaleNumberSymbol(locale, symbol) { const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale); const res = data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].NumberSymbols][symbol]; if (typeof res === 'undefined') { if (symbol === NumberSymbol.CurrencyDecimal) { return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].NumberSymbols][NumberSymbol.Decimal]; } else if (symbol === NumberSymbol.CurrencyGroup) { return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].NumberSymbols][NumberSymbol.Group]; } } return res; } /** * Retrieves a number format for a given locale. * * Numbers are formatted using patterns, like `#,###.00`. For example, the pattern `#,###.00` * when used to format the number 12345.678 could result in "12'345,678". That would happen if the * grouping separator for your language is an apostrophe, and the decimal separator is a comma. * * Important: The characters `.` `,` `0` `#` (and others below) are special placeholders * that stand for the decimal separator, and so on, and are NOT real characters. * You must NOT "translate" the placeholders. For example, don't change `.` to `,` even though in * your language the decimal point is written with a comma. The symbols should be replaced by the * local equivalents, using the appropriate `NumberSymbol` for your language. * * Here are the special characters used in number patterns: * * | Symbol | Meaning | * |--------|---------| * | . | Replaced automatically by the character used for the decimal point. | * | , | Replaced by the "grouping" (thousands) separator. | * | 0 | Replaced by a digit (or zero if there aren't enough digits). | * | # | Replaced by a digit (or nothing if there aren't enough). | * | ¤ | Replaced by a currency symbol, such as $ or USD. | * | % | Marks a percent format. The % symbol may change position, but must be retained. | * | E | Marks a scientific format. The E symbol may change position, but must be retained. | * | ' | Special characters used as literal characters are quoted with ASCII single quotes. | * * @param locale A locale code for the locale format rules to use. * @param type The type of numeric value to be formatted (such as `Decimal` or `Currency`.) * @returns The localized format string. * @see `NumberFormatStyle` * @see [CLDR website](http://cldr.unicode.org/translation/number-patterns) * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * * @publicApi */ function getLocaleNumberFormat(locale, type) { const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale); return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].NumberFormats][type]; } /** * Retrieves the symbol used to represent the currency for the main country * corresponding to a given locale. For example, '$' for `en-US`. * * @param locale A locale code for the locale format rules to use. * @returns The localized symbol character, * or `null` if the main country cannot be determined. * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * * @publicApi */ function getLocaleCurrencySymbol(locale) { const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale); return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].CurrencySymbol] || null; } /** * Retrieves the name of the currency for the main country corresponding * to a given locale. For example, 'US Dollar' for `en-US`. * @param locale A locale code for the locale format rules to use. * @returns The currency name, * or `null` if the main country cannot be determined. * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * * @publicApi */ function getLocaleCurrencyName(locale) { const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale); return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].CurrencyName] || null; } /** * Retrieves the default currency code for the given locale. * * The default is defined as the first currency which is still in use. * * @param locale The code of the locale whose currency code we want. * @returns The code of the default currency for the given locale. * * @publicApi */ function getLocaleCurrencyCode(locale) { return Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵgetLocaleCurrencyCode"])(locale); } /** * Retrieves the currency values for a given locale. * @param locale A locale code for the locale format rules to use. * @returns The currency values. * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) */ function getLocaleCurrencies(locale) { const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale); return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].Currencies]; } /** * @alias core/ɵgetLocalePluralCase * @publicApi */ const getLocalePluralCase = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵgetLocalePluralCase"]; function checkFullData(data) { if (!data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].ExtraData]) { throw new Error(`Missing extra locale data for the locale "${data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"] .LocaleId]}". Use "registerLocaleData" to load new data. See the "I18n guide" on angular.io to know more.`); } } /** * Retrieves locale-specific rules used to determine which day period to use * when more than one period is defined for a locale. * * There is a rule for each defined day period. The * first rule is applied to the first day period and so on. * Fall back to AM/PM when no rules are available. * * A rule can specify a period as time range, or as a single time value. * * This functionality is only available when you have loaded the full locale data. * See the ["I18n guide"](guide/i18n#i18n-pipes). * * @param locale A locale code for the locale format rules to use. * @returns The rules for the locale, a single time value or array of *from-time, to-time*, * or null if no periods are available. * * @see `getLocaleExtraDayPeriods()` * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * * @publicApi */ function getLocaleExtraDayPeriodRules(locale) { const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale); checkFullData(data); const rules = data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].ExtraData][2 /* ExtraDayPeriodsRules */] || []; return rules.map((rule) => { if (typeof rule === 'string') { return extractTime(rule); } return [extractTime(rule[0]), extractTime(rule[1])]; }); } /** * Retrieves locale-specific day periods, which indicate roughly how a day is broken up * in different languages. * For example, for `en-US`, periods are morning, noon, afternoon, evening, and midnight. * * This functionality is only available when you have loaded the full locale data. * See the ["I18n guide"](guide/i18n#i18n-pipes). * * @param locale A locale code for the locale format rules to use. * @param formStyle The required grammatical form. * @param width The required character width. * @returns The translated day-period strings. * @see `getLocaleExtraDayPeriodRules()` * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * * @publicApi */ function getLocaleExtraDayPeriods(locale, formStyle, width) { const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale); checkFullData(data); const dayPeriodsData = [ data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].ExtraData][0 /* ExtraDayPeriodFormats */], data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].ExtraData][1 /* ExtraDayPeriodStandalone */] ]; const dayPeriods = getLastDefinedValue(dayPeriodsData, formStyle) || []; return getLastDefinedValue(dayPeriods, width) || []; } /** * Retrieves the writing direction of a specified locale * @param locale A locale code for the locale format rules to use. * @publicApi * @returns 'rtl' or 'ltr' * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) */ function getLocaleDirection(locale) { const data = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵfindLocaleData"])(locale); return data[_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵLocaleDataIndex"].Directionality]; } /** * Retrieves the first value that is defined in an array, going backwards from an index position. * * To avoid repeating the same data (as when the "format" and "standalone" forms are the same) * add the first value to the locale data arrays, and add other values only if they are different. * * @param data The data array to retrieve from. * @param index A 0-based index into the array to start from. * @returns The value immediately before the given index position. * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * * @publicApi */ function getLastDefinedValue(data, index) { for (let i = index; i > -1; i--) { if (typeof data[i] !== 'undefined') { return data[i]; } } throw new Error('Locale data API: locale data undefined'); } /** * Extracts the hours and minutes from a string like "15:45" */ function extractTime(time) { const [h, m] = time.split(':'); return { hours: +h, minutes: +m }; } /** * Retrieves the currency symbol for a given currency code. * * For example, for the default `en-US` locale, the code `USD` can * be represented by the narrow symbol `$` or the wide symbol `US$`. * * @param code The currency code. * @param format The format, `wide` or `narrow`. * @param locale A locale code for the locale format rules to use. * * @returns The symbol, or the currency code if no symbol is available. * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * * @publicApi */ function getCurrencySymbol(code, format, locale = 'en') { const currency = getLocaleCurrencies(locale)[code] || CURRENCIES_EN[code] || []; const symbolNarrow = currency[1 /* SymbolNarrow */]; if (format === 'narrow' && typeof symbolNarrow === 'string') { return symbolNarrow; } return currency[0 /* Symbol */] || code; } // Most currencies have cents, that's why the default is 2 const DEFAULT_NB_OF_CURRENCY_DIGITS = 2; /** * Reports the number of decimal digits for a given currency. * The value depends upon the presence of cents in that particular currency. * * @param code The currency code. * @returns The number of decimal digits, typically 0 or 2. * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * * @publicApi */ function getNumberOfCurrencyDigits(code) { let digits; const currency = CURRENCIES_EN[code]; if (currency) { digits = currency[2 /* NbOfDigits */]; } return typeof digits === 'number' ? digits : DEFAULT_NB_OF_CURRENCY_DIGITS; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ const ISO8601_DATE_REGEX = /^(\d{4})-?(\d\d)-?(\d\d)(?:T(\d\d)(?::?(\d\d)(?::?(\d\d)(?:\.(\d+))?)?)?(Z|([+-])(\d\d):?(\d\d))?)?$/; // 1 2 3 4 5 6 7 8 9 10 11 const NAMED_FORMATS = {}; const DATE_FORMATS_SPLIT = /((?:[^GyMLwWdEabBhHmsSzZO']+)|(?:'(?:[^']|'')*')|(?:G{1,5}|y{1,4}|M{1,5}|L{1,5}|w{1,2}|W{1}|d{1,2}|E{1,6}|a{1,5}|b{1,5}|B{1,5}|h{1,2}|H{1,2}|m{1,2}|s{1,2}|S{1,3}|z{1,4}|Z{1,5}|O{1,4}))([\s\S]*)/; var ZoneWidth; (function (ZoneWidth) { ZoneWidth[ZoneWidth["Short"] = 0] = "Short"; ZoneWidth[ZoneWidth["ShortGMT"] = 1] = "ShortGMT"; ZoneWidth[ZoneWidth["Long"] = 2] = "Long"; ZoneWidth[ZoneWidth["Extended"] = 3] = "Extended"; })(ZoneWidth || (ZoneWidth = {})); var DateType; (function (DateType) { DateType[DateType["FullYear"] = 0] = "FullYear"; DateType[DateType["Month"] = 1] = "Month"; DateType[DateType["Date"] = 2] = "Date"; DateType[DateType["Hours"] = 3] = "Hours"; DateType[DateType["Minutes"] = 4] = "Minutes"; DateType[DateType["Seconds"] = 5] = "Seconds"; DateType[DateType["FractionalSeconds"] = 6] = "FractionalSeconds"; DateType[DateType["Day"] = 7] = "Day"; })(DateType || (DateType = {})); var TranslationType; (function (TranslationType) { TranslationType[TranslationType["DayPeriods"] = 0] = "DayPeriods"; TranslationType[TranslationType["Days"] = 1] = "Days"; TranslationType[TranslationType["Months"] = 2] = "Months"; TranslationType[TranslationType["Eras"] = 3] = "Eras"; })(TranslationType || (TranslationType = {})); /** * @ngModule CommonModule * @description * * Formats a date according to locale rules. * * @param value The date to format, as a Date, or a number (milliseconds since UTC epoch) * or an [ISO date-time string](https://www.w3.org/TR/NOTE-datetime). * @param format The date-time components to include. See `DatePipe` for details. * @param locale A locale code for the locale format rules to use. * @param timezone The time zone. A time zone offset from GMT (such as `'+0430'`), * or a standard UTC/GMT or continental US time zone abbreviation. * If not specified, uses host system settings. * * @returns The formatted date string. * * @see `DatePipe` * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * * @publicApi */ function formatDate(value, format, locale, timezone) { let date = toDate(value); const namedFormat = getNamedFormat(locale, format); format = namedFormat || format; let parts = []; let match; while (format) { match = DATE_FORMATS_SPLIT.exec(format); if (match) { parts = parts.concat(match.slice(1)); const part = parts.pop(); if (!part) { break; } format = part; } else { parts.push(format); break; } } let dateTimezoneOffset = date.getTimezoneOffset(); if (timezone) { dateTimezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset); date = convertTimezoneToLocal(date, timezone, true); } let text = ''; parts.forEach(value => { const dateFormatter = getDateFormatter(value); text += dateFormatter ? dateFormatter(date, locale, dateTimezoneOffset) : value === '\'\'' ? '\'' : value.replace(/(^'|'$)/g, '').replace(/''/g, '\''); }); return text; } function getNamedFormat(locale, format) { const localeId = getLocaleId(locale); NAMED_FORMATS[localeId] = NAMED_FORMATS[localeId] || {}; if (NAMED_FORMATS[localeId][format]) { return NAMED_FORMATS[localeId][format]; } let formatValue = ''; switch (format) { case 'shortDate': formatValue = getLocaleDateFormat(locale, FormatWidth.Short); break; case 'mediumDate': formatValue = getLocaleDateFormat(locale, FormatWidth.Medium); break; case 'longDate': formatValue = getLocaleDateFormat(locale, FormatWidth.Long); break; case 'fullDate': formatValue = getLocaleDateFormat(locale, FormatWidth.Full); break; case 'shortTime': formatValue = getLocaleTimeFormat(locale, FormatWidth.Short); break; case 'mediumTime': formatValue = getLocaleTimeFormat(locale, FormatWidth.Medium); break; case 'longTime': formatValue = getLocaleTimeFormat(locale, FormatWidth.Long); break; case 'fullTime': formatValue = getLocaleTimeFormat(locale, FormatWidth.Full); break; case 'short': const shortTime = getNamedFormat(locale, 'shortTime'); const shortDate = getNamedFormat(locale, 'shortDate'); formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Short), [shortTime, shortDate]); break; case 'medium': const mediumTime = getNamedFormat(locale, 'mediumTime'); const mediumDate = getNamedFormat(locale, 'mediumDate'); formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Medium), [mediumTime, mediumDate]); break; case 'long': const longTime = getNamedFormat(locale, 'longTime'); const longDate = getNamedFormat(locale, 'longDate'); formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Long), [longTime, longDate]); break; case 'full': const fullTime = getNamedFormat(locale, 'fullTime'); const fullDate = getNamedFormat(locale, 'fullDate'); formatValue = formatDateTime(getLocaleDateTimeFormat(locale, FormatWidth.Full), [fullTime, fullDate]); break; } if (formatValue) { NAMED_FORMATS[localeId][format] = formatValue; } return formatValue; } function formatDateTime(str, opt_values) { if (opt_values) { str = str.replace(/\{([^}]+)}/g, function (match, key) { return (opt_values != null && key in opt_values) ? opt_values[key] : match; }); } return str; } function padNumber(num, digits, minusSign = '-', trim, negWrap) { let neg = ''; if (num < 0 || (negWrap && num <= 0)) { if (negWrap) { num = -num + 1; } else { num = -num; neg = minusSign; } } let strNum = String(num); while (strNum.length < digits) { strNum = '0' + strNum; } if (trim) { strNum = strNum.substr(strNum.length - digits); } return neg + strNum; } function formatFractionalSeconds(milliseconds, digits) { const strMs = padNumber(milliseconds, 3); return strMs.substr(0, digits); } /** * Returns a date formatter that transforms a date into its locale digit representation */ function dateGetter(name, size, offset = 0, trim = false, negWrap = false) { return function (date, locale) { let part = getDatePart(name, date); if (offset > 0 || part > -offset) { part += offset; } if (name === DateType.Hours) { if (part === 0 && offset === -12) { part = 12; } } else if (name === DateType.FractionalSeconds) { return formatFractionalSeconds(part, size); } const localeMinus = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign); return padNumber(part, size, localeMinus, trim, negWrap); }; } function getDatePart(part, date) { switch (part) { case DateType.FullYear: return date.getFullYear(); case DateType.Month: return date.getMonth(); case DateType.Date: return date.getDate(); case DateType.Hours: return date.getHours(); case DateType.Minutes: return date.getMinutes(); case DateType.Seconds: return date.getSeconds(); case DateType.FractionalSeconds: return date.getMilliseconds(); case DateType.Day: return date.getDay(); default: throw new Error(`Unknown DateType value "${part}".`); } } /** * Returns a date formatter that transforms a date into its locale string representation */ function dateStrGetter(name, width, form = FormStyle.Format, extended = false) { return function (date, locale) { return getDateTranslation(date, locale, name, width, form, extended); }; } /** * Returns the locale translation of a date for a given form, type and width */ function getDateTranslation(date, locale, name, width, form, extended) { switch (name) { case TranslationType.Months: return getLocaleMonthNames(locale, form, width)[date.getMonth()]; case TranslationType.Days: return getLocaleDayNames(locale, form, width)[date.getDay()]; case TranslationType.DayPeriods: const currentHours = date.getHours(); const currentMinutes = date.getMinutes(); if (extended) { const rules = getLocaleExtraDayPeriodRules(locale); const dayPeriods = getLocaleExtraDayPeriods(locale, form, width); const index = rules.findIndex(rule => { if (Array.isArray(rule)) { // morning, afternoon, evening, night const [from, to] = rule; const afterFrom = currentHours >= from.hours && currentMinutes >= from.minutes; const beforeTo = (currentHours < to.hours || (currentHours === to.hours && currentMinutes < to.minutes)); // We must account for normal rules that span a period during the day (e.g. 6am-9am) // where `from` is less (earlier) than `to`. But also rules that span midnight (e.g. // 10pm - 5am) where `from` is greater (later!) than `to`. // // In the first case the current time must be BOTH after `from` AND before `to` // (e.g. 8am is after 6am AND before 10am). // // In the second case the current time must be EITHER after `from` OR before `to` // (e.g. 4am is before 5am but not after 10pm; and 11pm is not before 5am but it is // after 10pm). if (from.hours < to.hours) { if (afterFrom && beforeTo) { return true; } } else if (afterFrom || beforeTo) { return true; } } else { // noon or midnight if (rule.hours === currentHours && rule.minutes === currentMinutes) { return true; } } return false; }); if (index !== -1) { return dayPeriods[index]; } } // if no rules for the day periods, we use am/pm by default return getLocaleDayPeriods(locale, form, width)[currentHours < 12 ? 0 : 1]; case TranslationType.Eras: return getLocaleEraNames(locale, width)[date.getFullYear() <= 0 ? 0 : 1]; default: // This default case is not needed by TypeScript compiler, as the switch is exhaustive. // However Closure Compiler does not understand that and reports an error in typed mode. // The `throw new Error` below works around the problem, and the unexpected: never variable // makes sure tsc still checks this code is unreachable. const unexpected = name; throw new Error(`unexpected translation type ${unexpected}`); } } /** * Returns a date formatter that transforms a date and an offset into a timezone with ISO8601 or * GMT format depending on the width (eg: short = +0430, short:GMT = GMT+4, long = GMT+04:30, * extended = +04:30) */ function timeZoneGetter(width) { return function (date, locale, offset) { const zone = -1 * offset; const minusSign = getLocaleNumberSymbol(locale, NumberSymbol.MinusSign); const hours = zone > 0 ? Math.floor(zone / 60) : Math.ceil(zone / 60); switch (width) { case ZoneWidth.Short: return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + padNumber(Math.abs(zone % 60), 2, minusSign); case ZoneWidth.ShortGMT: return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 1, minusSign); case ZoneWidth.Long: return 'GMT' + ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' + padNumber(Math.abs(zone % 60), 2, minusSign); case ZoneWidth.Extended: if (offset === 0) { return 'Z'; } else { return ((zone >= 0) ? '+' : '') + padNumber(hours, 2, minusSign) + ':' + padNumber(Math.abs(zone % 60), 2, minusSign); } default: throw new Error(`Unknown zone width "${width}"`); } }; } const JANUARY = 0; const THURSDAY = 4; function getFirstThursdayOfYear(year) { const firstDayOfYear = (new Date(year, JANUARY, 1)).getDay(); return new Date(year, 0, 1 + ((firstDayOfYear <= THURSDAY) ? THURSDAY : THURSDAY + 7) - firstDayOfYear); } function getThursdayThisWeek(datetime) { return new Date(datetime.getFullYear(), datetime.getMonth(), datetime.getDate() + (THURSDAY - datetime.getDay())); } function weekGetter(size, monthBased = false) { return function (date, locale) { let result; if (monthBased) { const nbDaysBefore1stDayOfMonth = new Date(date.getFullYear(), date.getMonth(), 1).getDay() - 1; const today = date.getDate(); result = 1 + Math.floor((today + nbDaysBefore1stDayOfMonth) / 7); } else { const thisThurs = getThursdayThisWeek(date); // Some days of a year are part of next year according to ISO 8601. // Compute the firstThurs from the year of this week's Thursday const firstThurs = getFirstThursdayOfYear(thisThurs.getFullYear()); const diff = thisThurs.getTime() - firstThurs.getTime(); result = 1 + Math.round(diff / 6.048e8); // 6.048e8 ms per week } return padNumber(result, size, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign)); }; } const DATE_FORMATS = {}; // Based on CLDR formats: // See complete list: http://www.unicode.org/reports/tr35/tr35-dates.html#Date_Field_Symbol_Table // See also explanations: http://cldr.unicode.org/translation/date-time // TODO(ocombe): support all missing cldr formats: Y, U, Q, D, F, e, c, j, J, C, A, v, V, X, x function getDateFormatter(format) { if (DATE_FORMATS[format]) { return DATE_FORMATS[format]; } let formatter; switch (format) { // Era name (AD/BC) case 'G': case 'GG': case 'GGG': formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Abbreviated); break; case 'GGGG': formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Wide); break; case 'GGGGG': formatter = dateStrGetter(TranslationType.Eras, TranslationWidth.Narrow); break; // 1 digit representation of the year, e.g. (AD 1 => 1, AD 199 => 199) case 'y': formatter = dateGetter(DateType.FullYear, 1, 0, false, true); break; // 2 digit representation of the year, padded (00-99). (e.g. AD 2001 => 01, AD 2010 => 10) case 'yy': formatter = dateGetter(DateType.FullYear, 2, 0, true, true); break; // 3 digit representation of the year, padded (000-999). (e.g. AD 2001 => 01, AD 2010 => 10) case 'yyy': formatter = dateGetter(DateType.FullYear, 3, 0, false, true); break; // 4 digit representation of the year (e.g. AD 1 => 0001, AD 2010 => 2010) case 'yyyy': formatter = dateGetter(DateType.FullYear, 4, 0, false, true); break; // Month of the year (1-12), numeric case 'M': case 'L': formatter = dateGetter(DateType.Month, 1, 1); break; case 'MM': case 'LL': formatter = dateGetter(DateType.Month, 2, 1); break; // Month of the year (January, ...), string, format case 'MMM': formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated); break; case 'MMMM': formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Wide); break; case 'MMMMM': formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Narrow); break; // Month of the year (January, ...), string, standalone case 'LLL': formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Abbreviated, FormStyle.Standalone); break; case 'LLLL': formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Wide, FormStyle.Standalone); break; case 'LLLLL': formatter = dateStrGetter(TranslationType.Months, TranslationWidth.Narrow, FormStyle.Standalone); break; // Week of the year (1, ... 52) case 'w': formatter = weekGetter(1); break; case 'ww': formatter = weekGetter(2); break; // Week of the month (1, ...) case 'W': formatter = weekGetter(1, true); break; // Day of the month (1-31) case 'd': formatter = dateGetter(DateType.Date, 1); break; case 'dd': formatter = dateGetter(DateType.Date, 2); break; // Day of the Week case 'E': case 'EE': case 'EEE': formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Abbreviated); break; case 'EEEE': formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Wide); break; case 'EEEEE': formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Narrow); break; case 'EEEEEE': formatter = dateStrGetter(TranslationType.Days, TranslationWidth.Short); break; // Generic period of the day (am-pm) case 'a': case 'aa': case 'aaa': formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated); break; case 'aaaa': formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide); break; case 'aaaaa': formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow); break; // Extended period of the day (midnight, at night, ...), standalone case 'b': case 'bb': case 'bbb': formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Standalone, true); break; case 'bbbb': formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Standalone, true); break; case 'bbbbb': formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Standalone, true); break; // Extended period of the day (midnight, night, ...), standalone case 'B': case 'BB': case 'BBB': formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Abbreviated, FormStyle.Format, true); break; case 'BBBB': formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Wide, FormStyle.Format, true); break; case 'BBBBB': formatter = dateStrGetter(TranslationType.DayPeriods, TranslationWidth.Narrow, FormStyle.Format, true); break; // Hour in AM/PM, (1-12) case 'h': formatter = dateGetter(DateType.Hours, 1, -12); break; case 'hh': formatter = dateGetter(DateType.Hours, 2, -12); break; // Hour of the day (0-23) case 'H': formatter = dateGetter(DateType.Hours, 1); break; // Hour in day, padded (00-23) case 'HH': formatter = dateGetter(DateType.Hours, 2); break; // Minute of the hour (0-59) case 'm': formatter = dateGetter(DateType.Minutes, 1); break; case 'mm': formatter = dateGetter(DateType.Minutes, 2); break; // Second of the minute (0-59) case 's': formatter = dateGetter(DateType.Seconds, 1); break; case 'ss': formatter = dateGetter(DateType.Seconds, 2); break; // Fractional second case 'S': formatter = dateGetter(DateType.FractionalSeconds, 1); break; case 'SS': formatter = dateGetter(DateType.FractionalSeconds, 2); break; case 'SSS': formatter = dateGetter(DateType.FractionalSeconds, 3); break; // Timezone ISO8601 short format (-0430) case 'Z': case 'ZZ': case 'ZZZ': formatter = timeZoneGetter(ZoneWidth.Short); break; // Timezone ISO8601 extended format (-04:30) case 'ZZZZZ': formatter = timeZoneGetter(ZoneWidth.Extended); break; // Timezone GMT short format (GMT+4) case 'O': case 'OO': case 'OOO': // Should be location, but fallback to format O instead because we don't have the data yet case 'z': case 'zz': case 'zzz': formatter = timeZoneGetter(ZoneWidth.ShortGMT); break; // Timezone GMT long format (GMT+0430) case 'OOOO': case 'ZZZZ': // Should be location, but fallback to format O instead because we don't have the data yet case 'zzzz': formatter = timeZoneGetter(ZoneWidth.Long); break; default: return null; } DATE_FORMATS[format] = formatter; return formatter; } function timezoneToOffset(timezone, fallback) { // Support: IE 9-11 only, Edge 13-15+ // IE/Edge do not "understand" colon (`:`) in timezone timezone = timezone.replace(/:/g, ''); const requestedTimezoneOffset = Date.parse('Jan 01, 1970 00:00:00 ' + timezone) / 60000; return isNaN(requestedTimezoneOffset) ? fallback : requestedTimezoneOffset; } function addDateMinutes(date, minutes) { date = new Date(date.getTime()); date.setMinutes(date.getMinutes() + minutes); return date; } function convertTimezoneToLocal(date, timezone, reverse) { const reverseValue = reverse ? -1 : 1; const dateTimezoneOffset = date.getTimezoneOffset(); const timezoneOffset = timezoneToOffset(timezone, dateTimezoneOffset); return addDateMinutes(date, reverseValue * (timezoneOffset - dateTimezoneOffset)); } /** * Converts a value to date. * * Supported input formats: * - `Date` * - number: timestamp * - string: numeric (e.g. "1234"), ISO and date strings in a format supported by * [Date.parse()](https://developer.mozilla.org/en-US/docs/Web/JavaScript/Reference/Global_Objects/Date/parse). * Note: ISO strings without time return a date without timeoffset. * * Throws if unable to convert to a date. */ function toDate(value) { if (isDate(value)) { return value; } if (typeof value === 'number' && !isNaN(value)) { return new Date(value); } if (typeof value === 'string') { value = value.trim(); const parsedNb = parseFloat(value); // any string that only contains numbers, like "1234" but not like "1234hello" if (!isNaN(value - parsedNb)) { return new Date(parsedNb); } if (/^(\d{4}-\d{1,2}-\d{1,2})$/.test(value)) { /* For ISO Strings without time the day, month and year must be extracted from the ISO String before Date creation to avoid time offset and errors in the new Date. If we only replace '-' with ',' in the ISO String ("2015,01,01"), and try to create a new date, some browsers (e.g. IE 9) will throw an invalid Date error. If we leave the '-' ("2015-01-01") and try to create a new Date("2015-01-01") the timeoffset is applied. Note: ISO months are 0 for January, 1 for February, ... */ const [y, m, d] = value.split('-').map((val) => +val); return new Date(y, m - 1, d); } let match; if (match = value.match(ISO8601_DATE_REGEX)) { return isoStringToDate(match); } } const date = new Date(value); if (!isDate(date)) { throw new Error(`Unable to convert "${value}" into a date`); } return date; } /** * Converts a date in ISO8601 to a Date. * Used instead of `Date.parse` because of browser discrepancies. */ function isoStringToDate(match) { const date = new Date(0); let tzHour = 0; let tzMin = 0; // match[8] means that the string contains "Z" (UTC) or a timezone like "+01:00" or "+0100" const dateSetter = match[8] ? date.setUTCFullYear : date.setFullYear; const timeSetter = match[8] ? date.setUTCHours : date.setHours; // if there is a timezone defined like "+01:00" or "+0100" if (match[9]) { tzHour = Number(match[9] + match[10]); tzMin = Number(match[9] + match[11]); } dateSetter.call(date, Number(match[1]), Number(match[2]) - 1, Number(match[3])); const h = Number(match[4] || 0) - tzHour; const m = Number(match[5] || 0) - tzMin; const s = Number(match[6] || 0); const ms = Math.round(parseFloat('0.' + (match[7] || 0)) * 1000); timeSetter.call(date, h, m, s, ms); return date; } function isDate(value) { return value instanceof Date && !isNaN(value.valueOf()); } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ const NUMBER_FORMAT_REGEXP = /^(\d+)?\.((\d+)(-(\d+))?)?$/; const MAX_DIGITS = 22; const DECIMAL_SEP = '.'; const ZERO_CHAR = '0'; const PATTERN_SEP = ';'; const GROUP_SEP = ','; const DIGIT_CHAR = '#'; const CURRENCY_CHAR = '¤'; const PERCENT_CHAR = '%'; /** * Transforms a number to a locale string based on a style and a format. */ function formatNumberToLocaleString(value, pattern, locale, groupSymbol, decimalSymbol, digitsInfo, isPercent = false) { let formattedText = ''; let isZero = false; if (!isFinite(value)) { formattedText = getLocaleNumberSymbol(locale, NumberSymbol.Infinity); } else { let parsedNumber = parseNumber(value); if (isPercent) { parsedNumber = toPercent(parsedNumber); } let minInt = pattern.minInt; let minFraction = pattern.minFrac; let maxFraction = pattern.maxFrac; if (digitsInfo) { const parts = digitsInfo.match(NUMBER_FORMAT_REGEXP); if (parts === null) { throw new Error(`${digitsInfo} is not a valid digit info`); } const minIntPart = parts[1]; const minFractionPart = parts[3]; const maxFractionPart = parts[5]; if (minIntPart != null) { minInt = parseIntAutoRadix(minIntPart); } if (minFractionPart != null) { minFraction = parseIntAutoRadix(minFractionPart); } if (maxFractionPart != null) { maxFraction = parseIntAutoRadix(maxFractionPart); } else if (minFractionPart != null && minFraction > maxFraction) { maxFraction = minFraction; } } roundNumber(parsedNumber, minFraction, maxFraction); let digits = parsedNumber.digits; let integerLen = parsedNumber.integerLen; const exponent = parsedNumber.exponent; let decimals = []; isZero = digits.every(d => !d); // pad zeros for small numbers for (; integerLen < minInt; integerLen++) { digits.unshift(0); } // pad zeros for small numbers for (; integerLen < 0; integerLen++) { digits.unshift(0); } // extract decimals digits if (integerLen > 0) { decimals = digits.splice(integerLen, digits.length); } else { decimals = digits; digits = [0]; } // format the integer digits with grouping separators const groups = []; if (digits.length >= pattern.lgSize) { groups.unshift(digits.splice(-pattern.lgSize, digits.length).join('')); } while (digits.length > pattern.gSize) { groups.unshift(digits.splice(-pattern.gSize, digits.length).join('')); } if (digits.length) { groups.unshift(digits.join('')); } formattedText = groups.join(getLocaleNumberSymbol(locale, groupSymbol)); // append the decimal digits if (decimals.length) { formattedText += getLocaleNumberSymbol(locale, decimalSymbol) + decimals.join(''); } if (exponent) { formattedText += getLocaleNumberSymbol(locale, NumberSymbol.Exponential) + '+' + exponent; } } if (value < 0 && !isZero) { formattedText = pattern.negPre + formattedText + pattern.negSuf; } else { formattedText = pattern.posPre + formattedText + pattern.posSuf; } return formattedText; } /** * @ngModule CommonModule * @description * * Formats a number as currency using locale rules. * * @param value The number to format. * @param locale A locale code for the locale format rules to use. * @param currency A string containing the currency symbol or its name, * such as "$" or "Canadian Dollar". Used in output string, but does not affect the operation * of the function. * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) * currency code, such as `USD` for the US dollar and `EUR` for the euro. * Used to determine the number of digits in the decimal part. * @param digitInfo Decimal representation options, specified by a string in the following format: * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details. * * @returns The formatted currency value. * * @see `formatNumber()` * @see `DecimalPipe` * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * * @publicApi */ function formatCurrency(value, locale, currency, currencyCode, digitsInfo) { const format = getLocaleNumberFormat(locale, NumberFormatStyle.Currency); const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign)); pattern.minFrac = getNumberOfCurrencyDigits(currencyCode); pattern.maxFrac = pattern.minFrac; const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.CurrencyGroup, NumberSymbol.CurrencyDecimal, digitsInfo); return res .replace(CURRENCY_CHAR, currency) // if we have 2 time the currency character, the second one is ignored .replace(CURRENCY_CHAR, '') // If there is a spacing between currency character and the value and // the currency character is supressed by passing an empty string, the // spacing character would remain as part of the string. Then we // should remove it. .trim(); } /** * @ngModule CommonModule * @description * * Formats a number as a percentage according to locale rules. * * @param value The number to format. * @param locale A locale code for the locale format rules to use. * @param digitInfo Decimal representation options, specified by a string in the following format: * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details. * * @returns The formatted percentage value. * * @see `formatNumber()` * @see `DecimalPipe` * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * @publicApi * */ function formatPercent(value, locale, digitsInfo) { const format = getLocaleNumberFormat(locale, NumberFormatStyle.Percent); const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign)); const res = formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo, true); return res.replace(new RegExp(PERCENT_CHAR, 'g'), getLocaleNumberSymbol(locale, NumberSymbol.PercentSign)); } /** * @ngModule CommonModule * @description * * Formats a number as text, with group sizing, separator, and other * parameters based on the locale. * * @param value The number to format. * @param locale A locale code for the locale format rules to use. * @param digitInfo Decimal representation options, specified by a string in the following format: * `{minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}`. See `DecimalPipe` for more details. * * @returns The formatted text string. * @see [Internationalization (i18n) Guide](https://angular.io/guide/i18n) * * @publicApi */ function formatNumber(value, locale, digitsInfo) { const format = getLocaleNumberFormat(locale, NumberFormatStyle.Decimal); const pattern = parseNumberFormat(format, getLocaleNumberSymbol(locale, NumberSymbol.MinusSign)); return formatNumberToLocaleString(value, pattern, locale, NumberSymbol.Group, NumberSymbol.Decimal, digitsInfo); } function parseNumberFormat(format, minusSign = '-') { const p = { minInt: 1, minFrac: 0, maxFrac: 0, posPre: '', posSuf: '', negPre: '', negSuf: '', gSize: 0, lgSize: 0 }; const patternParts = format.split(PATTERN_SEP); const positive = patternParts[0]; const negative = patternParts[1]; const positiveParts = positive.indexOf(DECIMAL_SEP) !== -1 ? positive.split(DECIMAL_SEP) : [ positive.substring(0, positive.lastIndexOf(ZERO_CHAR) + 1), positive.substring(positive.lastIndexOf(ZERO_CHAR) + 1) ], integer = positiveParts[0], fraction = positiveParts[1] || ''; p.posPre = integer.substr(0, integer.indexOf(DIGIT_CHAR)); for (let i = 0; i < fraction.length; i++) { const ch = fraction.charAt(i); if (ch === ZERO_CHAR) { p.minFrac = p.maxFrac = i + 1; } else if (ch === DIGIT_CHAR) { p.maxFrac = i + 1; } else { p.posSuf += ch; } } const groups = integer.split(GROUP_SEP); p.gSize = groups[1] ? groups[1].length : 0; p.lgSize = (groups[2] || groups[1]) ? (groups[2] || groups[1]).length : 0; if (negative) { const trunkLen = positive.length - p.posPre.length - p.posSuf.length, pos = negative.indexOf(DIGIT_CHAR); p.negPre = negative.substr(0, pos).replace(/'/g, ''); p.negSuf = negative.substr(pos + trunkLen).replace(/'/g, ''); } else { p.negPre = minusSign + p.posPre; p.negSuf = p.posSuf; } return p; } // Transforms a parsed number into a percentage by multiplying it by 100 function toPercent(parsedNumber) { // if the number is 0, don't do anything if (parsedNumber.digits[0] === 0) { return parsedNumber; } // Getting the current number of decimals const fractionLen = parsedNumber.digits.length - parsedNumber.integerLen; if (parsedNumber.exponent) { parsedNumber.exponent += 2; } else { if (fractionLen === 0) { parsedNumber.digits.push(0, 0); } else if (fractionLen === 1) { parsedNumber.digits.push(0); } parsedNumber.integerLen += 2; } return parsedNumber; } /** * Parses a number. * Significant bits of this parse algorithm came from https://github.com/MikeMcl/big.js/ */ function parseNumber(num) { let numStr = Math.abs(num) + ''; let exponent = 0, digits, integerLen; let i, j, zeros; // Decimal point? if ((integerLen = numStr.indexOf(DECIMAL_SEP)) > -1) { numStr = numStr.replace(DECIMAL_SEP, ''); } // Exponential form? if ((i = numStr.search(/e/i)) > 0) { // Work out the exponent. if (integerLen < 0) integerLen = i; integerLen += +numStr.slice(i + 1); numStr = numStr.substring(0, i); } else if (integerLen < 0) { // There was no decimal point or exponent so it is an integer. integerLen = numStr.length; } // Count the number of leading zeros. for (i = 0; numStr.charAt(i) === ZERO_CHAR; i++) { /* empty */ } if (i === (zeros = numStr.length)) { // The digits are all zero. digits = [0]; integerLen = 1; } else { // Count the number of trailing zeros zeros--; while (numStr.charAt(zeros) === ZERO_CHAR) zeros--; // Trailing zeros are insignificant so ignore them integerLen -= i; digits = []; // Convert string to array of digits without leading/trailing zeros. for (j = 0; i <= zeros; i++, j++) { digits[j] = Number(numStr.charAt(i)); } } // If the number overflows the maximum allowed digits then use an exponent. if (integerLen > MAX_DIGITS) { digits = digits.splice(0, MAX_DIGITS - 1); exponent = integerLen - 1; integerLen = 1; } return { digits, exponent, integerLen }; } /** * Round the parsed number to the specified number of decimal places * This function changes the parsedNumber in-place */ function roundNumber(parsedNumber, minFrac, maxFrac) { if (minFrac > maxFrac) { throw new Error(`The minimum number of digits after fraction (${minFrac}) is higher than the maximum (${maxFrac}).`); } let digits = parsedNumber.digits; let fractionLen = digits.length - parsedNumber.integerLen; const fractionSize = Math.min(Math.max(minFrac, fractionLen), maxFrac); // The index of the digit to where rounding is to occur let roundAt = fractionSize + parsedNumber.integerLen; let digit = digits[roundAt]; if (roundAt > 0) { // Drop fractional digits beyond `roundAt` digits.splice(Math.max(parsedNumber.integerLen, roundAt)); // Set non-fractional digits beyond `roundAt` to 0 for (let j = roundAt; j < digits.length; j++) { digits[j] = 0; } } else { // We rounded to zero so reset the parsedNumber fractionLen = Math.max(0, fractionLen); parsedNumber.integerLen = 1; digits.length = Math.max(1, roundAt = fractionSize + 1); digits[0] = 0; for (let i = 1; i < roundAt; i++) digits[i] = 0; } if (digit >= 5) { if (roundAt - 1 < 0) { for (let k = 0; k > roundAt; k--) { digits.unshift(0); parsedNumber.integerLen++; } digits.unshift(1); parsedNumber.integerLen++; } else { digits[roundAt - 1]++; } } // Pad out with zeros to get the required fraction length for (; fractionLen < Math.max(0, fractionSize); fractionLen++) digits.push(0); let dropTrailingZeros = fractionSize !== 0; // Minimal length = nb of decimals required + current nb of integers // Any number besides that is optional and can be removed if it's a trailing 0 const minLen = minFrac + parsedNumber.integerLen; // Do any carrying, e.g. a digit was rounded up to 10 const carry = digits.reduceRight(function (carry, d, i, digits) { d = d + carry; digits[i] = d < 10 ? d : d - 10; // d % 10 if (dropTrailingZeros) { // Do not keep meaningless fractional trailing zeros (e.g. 15.52000 --> 15.52) if (digits[i] === 0 && i >= minLen) { digits.pop(); } else { dropTrailingZeros = false; } } return d >= 10 ? 1 : 0; // Math.floor(d / 10); }, 0); if (carry) { digits.unshift(carry); parsedNumber.integerLen++; } } function parseIntAutoRadix(text) { const result = parseInt(text); if (isNaN(result)) { throw new Error('Invalid integer literal when parsing ' + text); } return result; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @publicApi */ class NgLocalization { } /** * Returns the plural category for a given value. * - "=value" when the case exists, * - the plural category otherwise */ function getPluralCategory(value, cases, ngLocalization, locale) { let key = `=${value}`; if (cases.indexOf(key) > -1) { return key; } key = ngLocalization.getPluralCategory(value, locale); if (cases.indexOf(key) > -1) { return key; } if (cases.indexOf('other') > -1) { return 'other'; } throw new Error(`No plural message found for value "${value}"`); } /** * Returns the plural case based on the locale * * @publicApi */ class NgLocaleLocalization extends NgLocalization { constructor(locale) { super(); this.locale = locale; } getPluralCategory(value, locale) { const plural = getLocalePluralCase(locale || this.locale)(value); switch (plural) { case Plural.Zero: return 'zero'; case Plural.One: return 'one'; case Plural.Two: return 'two'; case Plural.Few: return 'few'; case Plural.Many: return 'many'; default: return 'other'; } } } NgLocaleLocalization.ɵfac = function NgLocaleLocalization_Factory(t) { return new (t || NgLocaleLocalization)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["LOCALE_ID"])); }; NgLocaleLocalization.ɵprov = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"]({ token: NgLocaleLocalization, factory: NgLocaleLocalization.ɵfac }); NgLocaleLocalization.ctorParameters = () => [ { type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Inject"], args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["LOCALE_ID"],] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](NgLocaleLocalization, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Injectable"] }], function () { return [{ type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Inject"], args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["LOCALE_ID"]] }] }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Register global data to be used internally by Angular. See the * ["I18n guide"](guide/i18n#i18n-pipes) to know how to import additional locale data. * * The signature registerLocaleData(data: any, extraData?: any) is deprecated since v5.1 * * @publicApi */ function registerLocaleData(data, localeId, extraData) { return Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵregisterLocaleData"])(data, localeId, extraData); } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ function parseCookieValue(cookieStr, name) { name = encodeURIComponent(name); for (const cookie of cookieStr.split(';')) { const eqIndex = cookie.indexOf('='); const [cookieName, cookieValue] = eqIndex == -1 ? [cookie, ''] : [cookie.slice(0, eqIndex), cookie.slice(eqIndex + 1)]; if (cookieName.trim() === name) { return decodeURIComponent(cookieValue); } } return null; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @ngModule CommonModule * * @usageNotes * ``` * ... * * ... * * ... * * ... * * ... * ``` * * @description * * Adds and removes CSS classes on an HTML element. * * The CSS classes are updated as follows, depending on the type of the expression evaluation: * - `string` - the CSS classes listed in the string (space delimited) are added, * - `Array` - the CSS classes declared as Array elements are added, * - `Object` - keys are CSS classes that get added when the expression given in the value * evaluates to a truthy value, otherwise they are removed. * * @publicApi */ class NgClass { constructor(_iterableDiffers, _keyValueDiffers, _ngEl, _renderer) { this._iterableDiffers = _iterableDiffers; this._keyValueDiffers = _keyValueDiffers; this._ngEl = _ngEl; this._renderer = _renderer; this._iterableDiffer = null; this._keyValueDiffer = null; this._initialClasses = []; this._rawClass = null; } set klass(value) { this._removeClasses(this._initialClasses); this._initialClasses = typeof value === 'string' ? value.split(/\s+/) : []; this._applyClasses(this._initialClasses); this._applyClasses(this._rawClass); } set ngClass(value) { this._removeClasses(this._rawClass); this._applyClasses(this._initialClasses); this._iterableDiffer = null; this._keyValueDiffer = null; this._rawClass = typeof value === 'string' ? value.split(/\s+/) : value; if (this._rawClass) { if (Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵisListLikeIterable"])(this._rawClass)) { this._iterableDiffer = this._iterableDiffers.find(this._rawClass).create(); } else { this._keyValueDiffer = this._keyValueDiffers.find(this._rawClass).create(); } } } ngDoCheck() { if (this._iterableDiffer) { const iterableChanges = this._iterableDiffer.diff(this._rawClass); if (iterableChanges) { this._applyIterableChanges(iterableChanges); } } else if (this._keyValueDiffer) { const keyValueChanges = this._keyValueDiffer.diff(this._rawClass); if (keyValueChanges) { this._applyKeyValueChanges(keyValueChanges); } } } _applyKeyValueChanges(changes) { changes.forEachAddedItem((record) => this._toggleClass(record.key, record.currentValue)); changes.forEachChangedItem((record) => this._toggleClass(record.key, record.currentValue)); changes.forEachRemovedItem((record) => { if (record.previousValue) { this._toggleClass(record.key, false); } }); } _applyIterableChanges(changes) { changes.forEachAddedItem((record) => { if (typeof record.item === 'string') { this._toggleClass(record.item, true); } else { throw new Error(`NgClass can only toggle CSS classes expressed as strings, got ${Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵstringify"])(record.item)}`); } }); changes.forEachRemovedItem((record) => this._toggleClass(record.item, false)); } /** * Applies a collection of CSS classes to the DOM element. * * For argument of type Set and Array CSS class names contained in those collections are always * added. * For argument of type Map CSS class name in the map's key is toggled based on the value (added * for truthy and removed for falsy). */ _applyClasses(rawClassVal) { if (rawClassVal) { if (Array.isArray(rawClassVal) || rawClassVal instanceof Set) { rawClassVal.forEach((klass) => this._toggleClass(klass, true)); } else { Object.keys(rawClassVal).forEach(klass => this._toggleClass(klass, !!rawClassVal[klass])); } } } /** * Removes a collection of CSS classes from the DOM element. This is mostly useful for cleanup * purposes. */ _removeClasses(rawClassVal) { if (rawClassVal) { if (Array.isArray(rawClassVal) || rawClassVal instanceof Set) { rawClassVal.forEach((klass) => this._toggleClass(klass, false)); } else { Object.keys(rawClassVal).forEach(klass => this._toggleClass(klass, false)); } } } _toggleClass(klass, enabled) { klass = klass.trim(); if (klass) { klass.split(/\s+/g).forEach(klass => { if (enabled) { this._renderer.addClass(this._ngEl.nativeElement, klass); } else { this._renderer.removeClass(this._ngEl.nativeElement, klass); } }); } } } NgClass.ɵfac = function NgClass_Factory(t) { return new (t || NgClass)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["IterableDiffers"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["KeyValueDiffers"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ElementRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["Renderer2"])); }; NgClass.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgClass, selectors: [["", "ngClass", ""]], inputs: { klass: ["class", "klass"], ngClass: "ngClass" } }); NgClass.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["IterableDiffers"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["KeyValueDiffers"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ElementRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Renderer2"] } ]; NgClass.propDecorators = { klass: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"], args: ['class',] }], ngClass: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"], args: ['ngClass',] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](NgClass, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Directive"], args: [{ selector: '[ngClass]' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["IterableDiffers"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["KeyValueDiffers"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ElementRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Renderer2"] }]; }, { klass: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"], args: ['class'] }], ngClass: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"], args: ['ngClass'] }] }); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Instantiates a single {@link Component} type and inserts its Host View into current View. * `NgComponentOutlet` provides a declarative approach for dynamic component creation. * * `NgComponentOutlet` requires a component type, if a falsy value is set the view will clear and * any existing component will get destroyed. * * @usageNotes * * ### Fine tune control * * You can control the component creation process by using the following optional attributes: * * * `ngComponentOutletInjector`: Optional custom {@link Injector} that will be used as parent for * the Component. Defaults to the injector of the current view container. * * * `ngComponentOutletContent`: Optional list of projectable nodes to insert into the content * section of the component, if exists. * * * `ngComponentOutletNgModuleFactory`: Optional module factory to allow dynamically loading other * module, then load a component from that module. * * ### Syntax * * Simple * ``` * * ``` * * Customized injector/content * ``` * * * ``` * * Customized ngModuleFactory * ``` * * * ``` * * ### A simple example * * {@example common/ngComponentOutlet/ts/module.ts region='SimpleExample'} * * A more complete example with additional options: * * {@example common/ngComponentOutlet/ts/module.ts region='CompleteExample'} * * @publicApi * @ngModule CommonModule */ class NgComponentOutlet { constructor(_viewContainerRef) { this._viewContainerRef = _viewContainerRef; this._componentRef = null; this._moduleRef = null; } ngOnChanges(changes) { this._viewContainerRef.clear(); this._componentRef = null; if (this.ngComponentOutlet) { const elInjector = this.ngComponentOutletInjector || this._viewContainerRef.parentInjector; if (changes['ngComponentOutletNgModuleFactory']) { if (this._moduleRef) this._moduleRef.destroy(); if (this.ngComponentOutletNgModuleFactory) { const parentModule = elInjector.get(_angular_core__WEBPACK_IMPORTED_MODULE_0__["NgModuleRef"]); this._moduleRef = this.ngComponentOutletNgModuleFactory.create(parentModule.injector); } else { this._moduleRef = null; } } const componentFactoryResolver = this._moduleRef ? this._moduleRef.componentFactoryResolver : elInjector.get(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ComponentFactoryResolver"]); const componentFactory = componentFactoryResolver.resolveComponentFactory(this.ngComponentOutlet); this._componentRef = this._viewContainerRef.createComponent(componentFactory, this._viewContainerRef.length, elInjector, this.ngComponentOutletContent); } } ngOnDestroy() { if (this._moduleRef) this._moduleRef.destroy(); } } NgComponentOutlet.ɵfac = function NgComponentOutlet_Factory(t) { return new (t || NgComponentOutlet)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"])); }; NgComponentOutlet.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgComponentOutlet, selectors: [["", "ngComponentOutlet", ""]], inputs: { ngComponentOutlet: "ngComponentOutlet", ngComponentOutletInjector: "ngComponentOutletInjector", ngComponentOutletContent: "ngComponentOutletContent", ngComponentOutletNgModuleFactory: "ngComponentOutletNgModuleFactory" }, features: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵNgOnChangesFeature"]] }); NgComponentOutlet.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"] } ]; NgComponentOutlet.propDecorators = { ngComponentOutlet: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], ngComponentOutletInjector: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], ngComponentOutletContent: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], ngComponentOutletNgModuleFactory: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](NgComponentOutlet, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Directive"], args: [{ selector: '[ngComponentOutlet]' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"] }]; }, { ngComponentOutlet: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], ngComponentOutletInjector: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], ngComponentOutletContent: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], ngComponentOutletNgModuleFactory: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }] }); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @publicApi */ class NgForOfContext { constructor($implicit, ngForOf, index, count) { this.$implicit = $implicit; this.ngForOf = ngForOf; this.index = index; this.count = count; } get first() { return this.index === 0; } get last() { return this.index === this.count - 1; } get even() { return this.index % 2 === 0; } get odd() { return !this.even; } } /** * A [structural directive](guide/structural-directives) that renders * a template for each item in a collection. * The directive is placed on an element, which becomes the parent * of the cloned templates. * * The `ngForOf` directive is generally used in the * [shorthand form](guide/structural-directives#the-asterisk--prefix) `*ngFor`. * In this form, the template to be rendered for each iteration is the content * of an anchor element containing the directive. * * The following example shows the shorthand syntax with some options, * contained in an `
  • ` element. * * ``` *
  • ...
    • * ``` * * The shorthand form expands into a long form that uses the `ngForOf` selector * on an `` element. * The content of the `` element is the `
  • ` element that held the * short-form directive. * * Here is the expanded version of the short-form example. * * ``` * *
  • ...
    • *     * ``` * * Angular automatically expands the shorthand syntax as it compiles the template. * The context for each embedded view is logically merged to the current component * context according to its lexical position. * * When using the shorthand syntax, Angular allows only [one structural directive * on an element](guide/structural-directives#one-structural-directive-per-host-element). * If you want to iterate conditionally, for example, * put the `*ngIf` on a container element that wraps the `*ngFor` element. * For futher discussion, see * [Structural Directives](guide/structural-directives#one-per-element). * * @usageNotes * * ### Local variables * * `NgForOf` provides exported values that can be aliased to local variables. * For example: * * ``` *
  • * {{i}}/{{users.length}}. {{user}} default *
    • * ``` * * The following exported values can be aliased to local variables: * * - `$implicit: T`: The value of the individual items in the iterable (`ngForOf`). * - `ngForOf: NgIterable`: The value of the iterable expression. Useful when the expression is * more complex then a property access, for example when using the async pipe (`userStreams | * async`). * - `index: number`: The index of the current item in the iterable. * - `count: number`: The length of the iterable. * - `first: boolean`: True when the item is the first item in the iterable. * - `last: boolean`: True when the item is the last item in the iterable. * - `even: boolean`: True when the item has an even index in the iterable. * - `odd: boolean`: True when the item has an odd index in the iterable. * * ### Change propagation * * When the contents of the iterator changes, `NgForOf` makes the corresponding changes to the DOM: * * * When an item is added, a new instance of the template is added to the DOM. * * When an item is removed, its template instance is removed from the DOM. * * When items are reordered, their respective templates are reordered in the DOM. * * Angular uses object identity to track insertions and deletions within the iterator and reproduce * those changes in the DOM. This has important implications for animations and any stateful * controls that are present, such as `` elements that accept user input. Inserted rows can * be animated in, deleted rows can be animated out, and unchanged rows retain any unsaved state * such as user input. * For more on animations, see [Transitions and Triggers](guide/transition-and-triggers). * * The identities of elements in the iterator can change while the data does not. * This can happen, for example, if the iterator is produced from an RPC to the server, and that * RPC is re-run. Even if the data hasn't changed, the second response produces objects with * different identities, and Angular must tear down the entire DOM and rebuild it (as if all old * elements were deleted and all new elements inserted). * * To avoid this expensive operation, you can customize the default tracking algorithm. * by supplying the `trackBy` option to `NgForOf`. * `trackBy` takes a function that has two arguments: `index` and `item`. * If `trackBy` is given, Angular tracks changes by the return value of the function. * * @see [Structural Directives](guide/structural-directives) * @ngModule CommonModule * @publicApi */ class NgForOf { constructor(_viewContainer, _template, _differs) { this._viewContainer = _viewContainer; this._template = _template; this._differs = _differs; this._ngForOf = null; this._ngForOfDirty = true; this._differ = null; } /** * The value of the iterable expression, which can be used as a * [template input variable](guide/structural-directives#template-input-variable). */ set ngForOf(ngForOf) { this._ngForOf = ngForOf; this._ngForOfDirty = true; } /** * A function that defines how to track changes for items in the iterable. * * When items are added, moved, or removed in the iterable, * the directive must re-render the appropriate DOM nodes. * To minimize churn in the DOM, only nodes that have changed * are re-rendered. * * By default, the change detector assumes that * the object instance identifies the node in the iterable. * When this function is supplied, the directive uses * the result of calling this function to identify the item node, * rather than the identity of the object itself. * * The function receives two inputs, * the iteration index and the associated node data. */ set ngForTrackBy(fn) { if (Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["isDevMode"])() && fn != null && typeof fn !== 'function') { // TODO(vicb): use a log service once there is a public one available if (console && console.warn) { console.warn(`trackBy must be a function, but received ${JSON.stringify(fn)}. ` + `See https://angular.io/api/common/NgForOf#change-propagation for more information.`); } } this._trackByFn = fn; } get ngForTrackBy() { return this._trackByFn; } /** * A reference to the template that is stamped out for each item in the iterable. * @see [template reference variable](guide/template-reference-variables) */ set ngForTemplate(value) { // TODO(TS2.1): make TemplateRef>> once we move to TS v2.1 // The current type is too restrictive; a template that just uses index, for example, // should be acceptable. if (value) { this._template = value; } } /** * Applies the changes when needed. */ ngDoCheck() { if (this._ngForOfDirty) { this._ngForOfDirty = false; // React on ngForOf changes only once all inputs have been initialized const value = this._ngForOf; if (!this._differ && value) { try { this._differ = this._differs.find(value).create(this.ngForTrackBy); } catch (_a) { throw new Error(`Cannot find a differ supporting object '${value}' of type '${getTypeName(value)}'. NgFor only supports binding to Iterables such as Arrays.`); } } } if (this._differ) { const changes = this._differ.diff(this._ngForOf); if (changes) this._applyChanges(changes); } } _applyChanges(changes) { const insertTuples = []; changes.forEachOperation((item, adjustedPreviousIndex, currentIndex) => { if (item.previousIndex == null) { // NgForOf is never "null" or "undefined" here because the differ detected // that a new item needs to be inserted from the iterable. This implies that // there is an iterable value for "_ngForOf". const view = this._viewContainer.createEmbeddedView(this._template, new NgForOfContext(null, this._ngForOf, -1, -1), currentIndex === null ? undefined : currentIndex); const tuple = new RecordViewTuple(item, view); insertTuples.push(tuple); } else if (currentIndex == null) { this._viewContainer.remove(adjustedPreviousIndex === null ? undefined : adjustedPreviousIndex); } else if (adjustedPreviousIndex !== null) { const view = this._viewContainer.get(adjustedPreviousIndex); this._viewContainer.move(view, currentIndex); const tuple = new RecordViewTuple(item, view); insertTuples.push(tuple); } }); for (let i = 0; i < insertTuples.length; i++) { this._perViewChange(insertTuples[i].view, insertTuples[i].record); } for (let i = 0, ilen = this._viewContainer.length; i < ilen; i++) { const viewRef = this._viewContainer.get(i); viewRef.context.index = i; viewRef.context.count = ilen; viewRef.context.ngForOf = this._ngForOf; } changes.forEachIdentityChange((record) => { const viewRef = this._viewContainer.get(record.currentIndex); viewRef.context.$implicit = record.item; }); } _perViewChange(view, record) { view.context.$implicit = record.item; } /** * Asserts the correct type of the context for the template that `NgForOf` will render. * * The presence of this method is a signal to the Ivy template type-check compiler that the * `NgForOf` structural directive renders its template with a specific context type. */ static ngTemplateContextGuard(dir, ctx) { return true; } } NgForOf.ɵfac = function NgForOf_Factory(t) { return new (t || NgForOf)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["TemplateRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["IterableDiffers"])); }; NgForOf.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgForOf, selectors: [["", "ngFor", "", "ngForOf", ""]], inputs: { ngForOf: "ngForOf", ngForTrackBy: "ngForTrackBy", ngForTemplate: "ngForTemplate" } }); NgForOf.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["TemplateRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["IterableDiffers"] } ]; NgForOf.propDecorators = { ngForOf: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], ngForTrackBy: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], ngForTemplate: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](NgForOf, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Directive"], args: [{ selector: '[ngFor][ngForOf]' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["TemplateRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["IterableDiffers"] }]; }, { ngForOf: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], ngForTrackBy: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], ngForTemplate: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }] }); })(); class RecordViewTuple { constructor(record, view) { this.record = record; this.view = view; } } function getTypeName(type) { return type['name'] || typeof type; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * A structural directive that conditionally includes a template based on the value of * an expression coerced to Boolean. * When the expression evaluates to true, Angular renders the template * provided in a `then` clause, and when false or null, * Angular renders the template provided in an optional `else` clause. The default * template for the `else` clause is blank. * * A [shorthand form](guide/structural-directives#the-asterisk--prefix) of the directive, * `*ngIf="condition"`, is generally used, provided * as an attribute of the anchor element for the inserted template. * Angular expands this into a more explicit version, in which the anchor element * is contained in an `` element. * * Simple form with shorthand syntax: * * ``` *
    Content to render when condition is true.
    * ``` * * Simple form with expanded syntax: * * ``` *
    Content to render when condition is * true.
     * ``` * * Form with an "else" block: * * ``` *
    Content to render when condition is true.
    * Content to render when condition is false. * ``` * * Shorthand form with "then" and "else" blocks: * * ``` *
    * Content to render when condition is true. * Content to render when condition is false. * ``` * * Form with storing the value locally: * * ``` *
    {{value}}
    * Content to render when value is null. * ``` * * @usageNotes * * The `*ngIf` directive is most commonly used to conditionally show an inline template, * as seen in the following example. * The default `else` template is blank. * * {@example common/ngIf/ts/module.ts region='NgIfSimple'} * * ### Showing an alternative template using `else` * * To display a template when `expression` evaluates to false, use an `else` template * binding as shown in the following example. * The `else` binding points to an `` element labeled `#elseBlock`. * The template can be defined anywhere in the component view, but is typically placed right after * `ngIf` for readability. * * {@example common/ngIf/ts/module.ts region='NgIfElse'} * * ### Using an external `then` template * * In the previous example, the then-clause template is specified inline, as the content of the * tag that contains the `ngIf` directive. You can also specify a template that is defined * externally, by referencing a labeled `` element. When you do this, you can * change which template to use at runtime, as shown in the following example. * * {@example common/ngIf/ts/module.ts region='NgIfThenElse'} * * ### Storing a conditional result in a variable * * You might want to show a set of properties from the same object. If you are waiting * for asynchronous data, the object can be undefined. * In this case, you can use `ngIf` and store the result of the condition in a local * variable as shown in the the following example. * * {@example common/ngIf/ts/module.ts region='NgIfAs'} * * This code uses only one `AsyncPipe`, so only one subscription is created. * The conditional statement stores the result of `userStream|async` in the local variable `user`. * You can then bind the local `user` repeatedly. * * The conditional displays the data only if `userStream` returns a value, * so you don't need to use the * [safe-navigation-operator](guide/template-expression-operators#safe-navigation-operator) (`?.`) * to guard against null values when accessing properties. * You can display an alternative template while waiting for the data. * * ### Shorthand syntax * * The shorthand syntax `*ngIf` expands into two separate template specifications * for the "then" and "else" clauses. For example, consider the following shorthand statement, * that is meant to show a loading page while waiting for data to be loaded. * * ``` *
    * ... *
    * * *
    Loading...
    *     * ``` * * You can see that the "else" clause references the `` * with the `#loading` label, and the template for the "then" clause * is provided as the content of the anchor element. * * However, when Angular expands the shorthand syntax, it creates * another `` tag, with `ngIf` and `ngIfElse` directives. * The anchor element containing the template for the "then" clause becomes * the content of this unlabeled `` tag. * * ``` * *
    * ... *
    *     * * *
    Loading...
    *     * ``` * * The presence of the implicit template object has implications for the nesting of * structural directives. For more on this subject, see * [Structural Directives](https://angular.io/guide/structural-directives#one-per-element). * * @ngModule CommonModule * @publicApi */ class NgIf { constructor(_viewContainer, templateRef) { this._viewContainer = _viewContainer; this._context = new NgIfContext(); this._thenTemplateRef = null; this._elseTemplateRef = null; this._thenViewRef = null; this._elseViewRef = null; this._thenTemplateRef = templateRef; } /** * The Boolean expression to evaluate as the condition for showing a template. */ set ngIf(condition) { this._context.$implicit = this._context.ngIf = condition; this._updateView(); } /** * A template to show if the condition expression evaluates to true. */ set ngIfThen(templateRef) { assertTemplate('ngIfThen', templateRef); this._thenTemplateRef = templateRef; this._thenViewRef = null; // clear previous view if any. this._updateView(); } /** * A template to show if the condition expression evaluates to false. */ set ngIfElse(templateRef) { assertTemplate('ngIfElse', templateRef); this._elseTemplateRef = templateRef; this._elseViewRef = null; // clear previous view if any. this._updateView(); } _updateView() { if (this._context.$implicit) { if (!this._thenViewRef) { this._viewContainer.clear(); this._elseViewRef = null; if (this._thenTemplateRef) { this._thenViewRef = this._viewContainer.createEmbeddedView(this._thenTemplateRef, this._context); } } } else { if (!this._elseViewRef) { this._viewContainer.clear(); this._thenViewRef = null; if (this._elseTemplateRef) { this._elseViewRef = this._viewContainer.createEmbeddedView(this._elseTemplateRef, this._context); } } } } /** * Asserts the correct type of the context for the template that `NgIf` will render. * * The presence of this method is a signal to the Ivy template type-check compiler that the * `NgIf` structural directive renders its template with a specific context type. */ static ngTemplateContextGuard(dir, ctx) { return true; } } NgIf.ɵfac = function NgIf_Factory(t) { return new (t || NgIf)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["TemplateRef"])); }; NgIf.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgIf, selectors: [["", "ngIf", ""]], inputs: { ngIf: "ngIf", ngIfThen: "ngIfThen", ngIfElse: "ngIfElse" } }); NgIf.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["TemplateRef"] } ]; NgIf.propDecorators = { ngIf: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], ngIfThen: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], ngIfElse: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](NgIf, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Directive"], args: [{ selector: '[ngIf]' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["TemplateRef"] }]; }, { ngIf: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], ngIfThen: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], ngIfElse: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }] }); })(); /** * @publicApi */ class NgIfContext { constructor() { this.$implicit = null; this.ngIf = null; } } function assertTemplate(property, templateRef) { const isTemplateRefOrNull = !!(!templateRef || templateRef.createEmbeddedView); if (!isTemplateRefOrNull) { throw new Error(`${property} must be a TemplateRef, but received '${Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵstringify"])(templateRef)}'.`); } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ class SwitchView { constructor(_viewContainerRef, _templateRef) { this._viewContainerRef = _viewContainerRef; this._templateRef = _templateRef; this._created = false; } create() { this._created = true; this._viewContainerRef.createEmbeddedView(this._templateRef); } destroy() { this._created = false; this._viewContainerRef.clear(); } enforceState(created) { if (created && !this._created) { this.create(); } else if (!created && this._created) { this.destroy(); } } } /** * @ngModule CommonModule * * @description * The `[ngSwitch]` directive on a container specifies an expression to match against. * The expressions to match are provided by `ngSwitchCase` directives on views within the container. * - Every view that matches is rendered. * - If there are no matches, a view with the `ngSwitchDefault` directive is rendered. * - Elements within the `[NgSwitch]` statement but outside of any `NgSwitchCase` * or `ngSwitchDefault` directive are preserved at the location. * * @usageNotes * Define a container element for the directive, and specify the switch expression * to match against as an attribute: * * ``` * * ``` * * Within the container, `*ngSwitchCase` statements specify the match expressions * as attributes. Include `*ngSwitchDefault` as the final case. * * ``` * * ... * ... * ... * * ``` * * ### Usage Examples * * The following example shows how to use more than one case to display the same view: * * ``` * * * ... * ... * ... * * ... * * ``` * * The following example shows how cases can be nested: * ``` * * ... * ... * ... * * * * * * ... * * ``` * * @publicApi * @see `NgSwitchCase` * @see `NgSwitchDefault` * @see [Structural Directives](guide/structural-directives) * */ class NgSwitch { constructor() { this._defaultUsed = false; this._caseCount = 0; this._lastCaseCheckIndex = 0; this._lastCasesMatched = false; } set ngSwitch(newValue) { this._ngSwitch = newValue; if (this._caseCount === 0) { this._updateDefaultCases(true); } } /** @internal */ _addCase() { return this._caseCount++; } /** @internal */ _addDefault(view) { if (!this._defaultViews) { this._defaultViews = []; } this._defaultViews.push(view); } /** @internal */ _matchCase(value) { const matched = value == this._ngSwitch; this._lastCasesMatched = this._lastCasesMatched || matched; this._lastCaseCheckIndex++; if (this._lastCaseCheckIndex === this._caseCount) { this._updateDefaultCases(!this._lastCasesMatched); this._lastCaseCheckIndex = 0; this._lastCasesMatched = false; } return matched; } _updateDefaultCases(useDefault) { if (this._defaultViews && useDefault !== this._defaultUsed) { this._defaultUsed = useDefault; for (let i = 0; i < this._defaultViews.length; i++) { const defaultView = this._defaultViews[i]; defaultView.enforceState(useDefault); } } } } NgSwitch.ɵfac = function NgSwitch_Factory(t) { return new (t || NgSwitch)(); }; NgSwitch.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgSwitch, selectors: [["", "ngSwitch", ""]], inputs: { ngSwitch: "ngSwitch" } }); NgSwitch.propDecorators = { ngSwitch: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](NgSwitch, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Directive"], args: [{ selector: '[ngSwitch]' }] }], function () { return []; }, { ngSwitch: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }] }); })(); /** * @ngModule CommonModule * * @description * Provides a switch case expression to match against an enclosing `ngSwitch` expression. * When the expressions match, the given `NgSwitchCase` template is rendered. * If multiple match expressions match the switch expression value, all of them are displayed. * * @usageNotes * * Within a switch container, `*ngSwitchCase` statements specify the match expressions * as attributes. Include `*ngSwitchDefault` as the final case. * * ``` * * ... * ... * ... * * ``` * * Each switch-case statement contains an in-line HTML template or template reference * that defines the subtree to be selected if the value of the match expression * matches the value of the switch expression. * * Unlike JavaScript, which uses strict equality, Angular uses loose equality. * This means that the empty string, `""` matches 0. * * @publicApi * @see `NgSwitch` * @see `NgSwitchDefault` * */ class NgSwitchCase { constructor(viewContainer, templateRef, ngSwitch) { this.ngSwitch = ngSwitch; ngSwitch._addCase(); this._view = new SwitchView(viewContainer, templateRef); } /** * Performs case matching. For internal use only. */ ngDoCheck() { this._view.enforceState(this.ngSwitch._matchCase(this.ngSwitchCase)); } } NgSwitchCase.ɵfac = function NgSwitchCase_Factory(t) { return new (t || NgSwitchCase)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["TemplateRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](NgSwitch, 1)); }; NgSwitchCase.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgSwitchCase, selectors: [["", "ngSwitchCase", ""]], inputs: { ngSwitchCase: "ngSwitchCase" } }); NgSwitchCase.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["TemplateRef"] }, { type: NgSwitch, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Host"] }] } ]; NgSwitchCase.propDecorators = { ngSwitchCase: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](NgSwitchCase, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Directive"], args: [{ selector: '[ngSwitchCase]' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["TemplateRef"] }, { type: NgSwitch, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Host"] }] }]; }, { ngSwitchCase: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }] }); })(); /** * @ngModule CommonModule * * @description * * Creates a view that is rendered when no `NgSwitchCase` expressions * match the `NgSwitch` expression. * This statement should be the final case in an `NgSwitch`. * * @publicApi * @see `NgSwitch` * @see `NgSwitchCase` * */ class NgSwitchDefault { constructor(viewContainer, templateRef, ngSwitch) { ngSwitch._addDefault(new SwitchView(viewContainer, templateRef)); } } NgSwitchDefault.ɵfac = function NgSwitchDefault_Factory(t) { return new (t || NgSwitchDefault)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["TemplateRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](NgSwitch, 1)); }; NgSwitchDefault.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgSwitchDefault, selectors: [["", "ngSwitchDefault", ""]] }); NgSwitchDefault.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["TemplateRef"] }, { type: NgSwitch, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Host"] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](NgSwitchDefault, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Directive"], args: [{ selector: '[ngSwitchDefault]' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["TemplateRef"] }, { type: NgSwitch, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Host"] }] }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @ngModule CommonModule * * @usageNotes * ``` * * there is nothing * there is one * there are a few * * ``` * * @description * * Adds / removes DOM sub-trees based on a numeric value. Tailored for pluralization. * * Displays DOM sub-trees that match the switch expression value, or failing that, DOM sub-trees * that match the switch expression's pluralization category. * * To use this directive you must provide a container element that sets the `[ngPlural]` attribute * to a switch expression. Inner elements with a `[ngPluralCase]` will display based on their * expression: * - if `[ngPluralCase]` is set to a value starting with `=`, it will only display if the value * matches the switch expression exactly, * - otherwise, the view will be treated as a "category match", and will only display if exact * value matches aren't found and the value maps to its category for the defined locale. * * See http://cldr.unicode.org/index/cldr-spec/plural-rules * * @publicApi */ class NgPlural { constructor(_localization) { this._localization = _localization; this._caseViews = {}; } set ngPlural(value) { this._switchValue = value; this._updateView(); } addCase(value, switchView) { this._caseViews[value] = switchView; } _updateView() { this._clearViews(); const cases = Object.keys(this._caseViews); const key = getPluralCategory(this._switchValue, cases, this._localization); this._activateView(this._caseViews[key]); } _clearViews() { if (this._activeView) this._activeView.destroy(); } _activateView(view) { if (view) { this._activeView = view; this._activeView.create(); } } } NgPlural.ɵfac = function NgPlural_Factory(t) { return new (t || NgPlural)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](NgLocalization)); }; NgPlural.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgPlural, selectors: [["", "ngPlural", ""]], inputs: { ngPlural: "ngPlural" } }); NgPlural.ctorParameters = () => [ { type: NgLocalization } ]; NgPlural.propDecorators = { ngPlural: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](NgPlural, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Directive"], args: [{ selector: '[ngPlural]' }] }], function () { return [{ type: NgLocalization }]; }, { ngPlural: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }] }); })(); /** * @ngModule CommonModule * * @description * * Creates a view that will be added/removed from the parent {@link NgPlural} when the * given expression matches the plural expression according to CLDR rules. * * @usageNotes * ``` * * ... * ... * *``` * * See {@link NgPlural} for more details and example. * * @publicApi */ class NgPluralCase { constructor(value, template, viewContainer, ngPlural) { this.value = value; const isANumber = !isNaN(Number(value)); ngPlural.addCase(isANumber ? `=${value}` : value, new SwitchView(viewContainer, template)); } } NgPluralCase.ɵfac = function NgPluralCase_Factory(t) { return new (t || NgPluralCase)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinjectAttribute"]('ngPluralCase'), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["TemplateRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](NgPlural, 1)); }; NgPluralCase.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgPluralCase, selectors: [["", "ngPluralCase", ""]] }); NgPluralCase.ctorParameters = () => [ { type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Attribute"], args: ['ngPluralCase',] }] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["TemplateRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"] }, { type: NgPlural, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Host"] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](NgPluralCase, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Directive"], args: [{ selector: '[ngPluralCase]' }] }], function () { return [{ type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Attribute"], args: ['ngPluralCase'] }] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["TemplateRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"] }, { type: NgPlural, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Host"] }] }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @ngModule CommonModule * * @usageNotes * * Set the font of the containing element to the result of an expression. * * ``` * ... * ``` * * Set the width of the containing element to a pixel value returned by an expression. * * ``` * ... * ``` * * Set a collection of style values using an expression that returns key-value pairs. * * ``` * ... * ``` * * @description * * An attribute directive that updates styles for the containing HTML element. * Sets one or more style properties, specified as colon-separated key-value pairs. * The key is a style name, with an optional `.` suffix * (such as 'top.px', 'font-style.em'). * The value is an expression to be evaluated. * The resulting non-null value, expressed in the given unit, * is assigned to the given style property. * If the result of evaluation is null, the corresponding style is removed. * * @publicApi */ class NgStyle { constructor(_ngEl, _differs, _renderer) { this._ngEl = _ngEl; this._differs = _differs; this._renderer = _renderer; this._ngStyle = null; this._differ = null; } set ngStyle(values) { this._ngStyle = values; if (!this._differ && values) { this._differ = this._differs.find(values).create(); } } ngDoCheck() { if (this._differ) { const changes = this._differ.diff(this._ngStyle); if (changes) { this._applyChanges(changes); } } } _setStyle(nameAndUnit, value) { const [name, unit] = nameAndUnit.split('.'); value = value != null && unit ? `${value}${unit}` : value; if (value != null) { this._renderer.setStyle(this._ngEl.nativeElement, name, value); } else { this._renderer.removeStyle(this._ngEl.nativeElement, name); } } _applyChanges(changes) { changes.forEachRemovedItem((record) => this._setStyle(record.key, null)); changes.forEachAddedItem((record) => this._setStyle(record.key, record.currentValue)); changes.forEachChangedItem((record) => this._setStyle(record.key, record.currentValue)); } } NgStyle.ɵfac = function NgStyle_Factory(t) { return new (t || NgStyle)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ElementRef"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["KeyValueDiffers"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["Renderer2"])); }; NgStyle.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgStyle, selectors: [["", "ngStyle", ""]], inputs: { ngStyle: "ngStyle" } }); NgStyle.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ElementRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["KeyValueDiffers"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Renderer2"] } ]; NgStyle.propDecorators = { ngStyle: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"], args: ['ngStyle',] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](NgStyle, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Directive"], args: [{ selector: '[ngStyle]' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ElementRef"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["KeyValueDiffers"] }, { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Renderer2"] }]; }, { ngStyle: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"], args: ['ngStyle'] }] }); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @ngModule CommonModule * * @description * * Inserts an embedded view from a prepared `TemplateRef`. * * You can attach a context object to the `EmbeddedViewRef` by setting `[ngTemplateOutletContext]`. * `[ngTemplateOutletContext]` should be an object, the object's keys will be available for binding * by the local template `let` declarations. * * @usageNotes * ``` * * ``` * * Using the key `$implicit` in the context object will set its value as default. * * ### Example * * {@example common/ngTemplateOutlet/ts/module.ts region='NgTemplateOutlet'} * * @publicApi */ class NgTemplateOutlet { constructor(_viewContainerRef) { this._viewContainerRef = _viewContainerRef; this._viewRef = null; /** * A context object to attach to the {@link EmbeddedViewRef}. This should be an * object, the object's keys will be available for binding by the local template `let` * declarations. * Using the key `$implicit` in the context object will set its value as default. */ this.ngTemplateOutletContext = null; /** * A string defining the template reference and optionally the context object for the template. */ this.ngTemplateOutlet = null; } ngOnChanges(changes) { const recreateView = this._shouldRecreateView(changes); if (recreateView) { const viewContainerRef = this._viewContainerRef; if (this._viewRef) { viewContainerRef.remove(viewContainerRef.indexOf(this._viewRef)); } this._viewRef = this.ngTemplateOutlet ? viewContainerRef.createEmbeddedView(this.ngTemplateOutlet, this.ngTemplateOutletContext) : null; } else if (this._viewRef && this.ngTemplateOutletContext) { this._updateExistingContext(this.ngTemplateOutletContext); } } /** * We need to re-create existing embedded view if: * - templateRef has changed * - context has changes * * We mark context object as changed when the corresponding object * shape changes (new properties are added or existing properties are removed). * In other words we consider context with the same properties as "the same" even * if object reference changes (see https://github.com/angular/angular/issues/13407). */ _shouldRecreateView(changes) { const ctxChange = changes['ngTemplateOutletContext']; return !!changes['ngTemplateOutlet'] || (ctxChange && this._hasContextShapeChanged(ctxChange)); } _hasContextShapeChanged(ctxChange) { const prevCtxKeys = Object.keys(ctxChange.previousValue || {}); const currCtxKeys = Object.keys(ctxChange.currentValue || {}); if (prevCtxKeys.length === currCtxKeys.length) { for (let propName of currCtxKeys) { if (prevCtxKeys.indexOf(propName) === -1) { return true; } } return false; } return true; } _updateExistingContext(ctx) { for (let propName of Object.keys(ctx)) { this._viewRef.context[propName] = this.ngTemplateOutletContext[propName]; } } } NgTemplateOutlet.ɵfac = function NgTemplateOutlet_Factory(t) { return new (t || NgTemplateOutlet)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"])); }; NgTemplateOutlet.ɵdir = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineDirective"]({ type: NgTemplateOutlet, selectors: [["", "ngTemplateOutlet", ""]], inputs: { ngTemplateOutletContext: "ngTemplateOutletContext", ngTemplateOutlet: "ngTemplateOutlet" }, features: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵNgOnChangesFeature"]] }); NgTemplateOutlet.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"] } ]; NgTemplateOutlet.propDecorators = { ngTemplateOutletContext: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], ngTemplateOutlet: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }] }; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](NgTemplateOutlet, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Directive"], args: [{ selector: '[ngTemplateOutlet]' }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ViewContainerRef"] }]; }, { ngTemplateOutletContext: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }], ngTemplateOutlet: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Input"] }] }); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * A collection of Angular directives that are likely to be used in each and every Angular * application. */ const COMMON_DIRECTIVES = [ NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, ]; /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ function invalidPipeArgumentError(type, value) { return Error(`InvalidPipeArgument: '${value}' for pipe '${Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵstringify"])(type)}'`); } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ class ObservableStrategy { createSubscription(async, updateLatestValue) { return async.subscribe({ next: updateLatestValue, error: (e) => { throw e; } }); } dispose(subscription) { subscription.unsubscribe(); } onDestroy(subscription) { subscription.unsubscribe(); } } class PromiseStrategy { createSubscription(async, updateLatestValue) { return async.then(updateLatestValue, e => { throw e; }); } dispose(subscription) { } onDestroy(subscription) { } } const _promiseStrategy = new PromiseStrategy(); const _observableStrategy = new ObservableStrategy(); /** * @ngModule CommonModule * @description * * Unwraps a value from an asynchronous primitive. * * The `async` pipe subscribes to an `Observable` or `Promise` and returns the latest value it has * emitted. When a new value is emitted, the `async` pipe marks the component to be checked for * changes. When the component gets destroyed, the `async` pipe unsubscribes automatically to avoid * potential memory leaks. * * @usageNotes * * ### Examples * * This example binds a `Promise` to the view. Clicking the `Resolve` button resolves the * promise. * * {@example common/pipes/ts/async_pipe.ts region='AsyncPipePromise'} * * It's also possible to use `async` with Observables. The example below binds the `time` Observable * to the view. The Observable continuously updates the view with the current time. * * {@example common/pipes/ts/async_pipe.ts region='AsyncPipeObservable'} * * @publicApi */ class AsyncPipe { constructor(_ref) { this._ref = _ref; this._latestValue = null; this._subscription = null; this._obj = null; this._strategy = null; } ngOnDestroy() { if (this._subscription) { this._dispose(); } } transform(obj) { if (!this._obj) { if (obj) { this._subscribe(obj); } return this._latestValue; } if (obj !== this._obj) { this._dispose(); return this.transform(obj); } return this._latestValue; } _subscribe(obj) { this._obj = obj; this._strategy = this._selectStrategy(obj); this._subscription = this._strategy.createSubscription(obj, (value) => this._updateLatestValue(obj, value)); } _selectStrategy(obj) { if (Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵisPromise"])(obj)) { return _promiseStrategy; } if (Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵisObservable"])(obj)) { return _observableStrategy; } throw invalidPipeArgumentError(AsyncPipe, obj); } _dispose() { this._strategy.dispose(this._subscription); this._latestValue = null; this._subscription = null; this._obj = null; } _updateLatestValue(async, value) { if (async === this._obj) { this._latestValue = value; this._ref.markForCheck(); } } } AsyncPipe.ɵfac = function AsyncPipe_Factory(t) { return new (t || AsyncPipe)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinjectPipeChangeDetectorRef"]()); }; AsyncPipe.ɵpipe = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "async", type: AsyncPipe, pure: false }); AsyncPipe.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ChangeDetectorRef"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](AsyncPipe, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Pipe"], args: [{ name: 'async', pure: false }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["ChangeDetectorRef"] }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Transforms text to all lower case. * * @see `UpperCasePipe` * @see `TitleCasePipe` * @usageNotes * * The following example defines a view that allows the user to enter * text, and then uses the pipe to convert the input text to all lower case. * * * * @ngModule CommonModule * @publicApi */ class LowerCasePipe { /** * @param value The string to transform to lower case. */ transform(value) { if (!value) return value; if (typeof value !== 'string') { throw invalidPipeArgumentError(LowerCasePipe, value); } return value.toLowerCase(); } } LowerCasePipe.ɵfac = function LowerCasePipe_Factory(t) { return new (t || LowerCasePipe)(); }; LowerCasePipe.ɵpipe = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "lowercase", type: LowerCasePipe, pure: true }); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](LowerCasePipe, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Pipe"], args: [{ name: 'lowercase' }] }], null, null); })(); // // Regex below matches any Unicode word and compatible with ES5. In ES2018 the same result // can be achieved by using /\p{L}\S*/gu and also known as Unicode Property Escapes // (http://2ality.com/2017/07/regexp-unicode-property-escapes.html). Since there is no // transpilation of this functionality down to ES5 without external tool, the only solution is // to use already transpiled form. Example can be found here - // https://mothereff.in/regexpu#input=var+regex+%3D+/%5Cp%7BL%7D/u%3B&unicodePropertyEscape=1 // const unicodeWordMatch = /(?:[A-Za-z\xAA\xB5\xBA\xC0-\xD6\xD8-\xF6\xF8-\u02C1\u02C6-\u02D1\u02E0-\u02E4\u02EC\u02EE\u0370-\u0374\u0376\u0377\u037A-\u037D\u037F\u0386\u0388-\u038A\u038C\u038E-\u03A1\u03A3-\u03F5\u03F7-\u0481\u048A-\u052F\u0531-\u0556\u0559\u0561-\u0587\u05D0-\u05EA\u05F0-\u05F2\u0620-\u064A\u066E\u066F\u0671-\u06D3\u06D5\u06E5\u06E6\u06EE\u06EF\u06FA-\u06FC\u06FF\u0710\u0712-\u072F\u074D-\u07A5\u07B1\u07CA-\u07EA\u07F4\u07F5\u07FA\u0800-\u0815\u081A\u0824\u0828\u0840-\u0858\u0860-\u086A\u08A0-\u08B4\u08B6-\u08BD\u0904-\u0939\u093D\u0950\u0958-\u0961\u0971-\u0980\u0985-\u098C\u098F\u0990\u0993-\u09A8\u09AA-\u09B0\u09B2\u09B6-\u09B9\u09BD\u09CE\u09DC\u09DD\u09DF-\u09E1\u09F0\u09F1\u09FC\u0A05-\u0A0A\u0A0F\u0A10\u0A13-\u0A28\u0A2A-\u0A30\u0A32\u0A33\u0A35\u0A36\u0A38\u0A39\u0A59-\u0A5C\u0A5E\u0A72-\u0A74\u0A85-\u0A8D\u0A8F-\u0A91\u0A93-\u0AA8\u0AAA-\u0AB0\u0AB2\u0AB3\u0AB5-\u0AB9\u0ABD\u0AD0\u0AE0\u0AE1\u0AF9\u0B05-\u0B0C\u0B0F\u0B10\u0B13-\u0B28\u0B2A-\u0B30\u0B32\u0B33\u0B35-\u0B39\u0B3D\u0B5C\u0B5D\u0B5F-\u0B61\u0B71\u0B83\u0B85-\u0B8A\u0B8E-\u0B90\u0B92-\u0B95\u0B99\u0B9A\u0B9C\u0B9E\u0B9F\u0BA3\u0BA4\u0BA8-\u0BAA\u0BAE-\u0BB9\u0BD0\u0C05-\u0C0C\u0C0E-\u0C10\u0C12-\u0C28\u0C2A-\u0C39\u0C3D\u0C58-\u0C5A\u0C60\u0C61\u0C80\u0C85-\u0C8C\u0C8E-\u0C90\u0C92-\u0CA8\u0CAA-\u0CB3\u0CB5-\u0CB9\u0CBD\u0CDE\u0CE0\u0CE1\u0CF1\u0CF2\u0D05-\u0D0C\u0D0E-\u0D10\u0D12-\u0D3A\u0D3D\u0D4E\u0D54-\u0D56\u0D5F-\u0D61\u0D7A-\u0D7F\u0D85-\u0D96\u0D9A-\u0DB1\u0DB3-\u0DBB\u0DBD\u0DC0-\u0DC6\u0E01-\u0E30\u0E32\u0E33\u0E40-\u0E46\u0E81\u0E82\u0E84\u0E87\u0E88\u0E8A\u0E8D\u0E94-\u0E97\u0E99-\u0E9F\u0EA1-\u0EA3\u0EA5\u0EA7\u0EAA\u0EAB\u0EAD-\u0EB0\u0EB2\u0EB3\u0EBD\u0EC0-\u0EC4\u0EC6\u0EDC-\u0EDF\u0F00\u0F40-\u0F47\u0F49-\u0F6C\u0F88-\u0F8C\u1000-\u102A\u103F\u1050-\u1055\u105A-\u105D\u1061\u1065\u1066\u106E-\u1070\u1075-\u1081\u108E\u10A0-\u10C5\u10C7\u10CD\u10D0-\u10FA\u10FC-\u1248\u124A-\u124D\u1250-\u1256\u1258\u125A-\u125D\u1260-\u1288\u128A-\u128D\u1290-\u12B0\u12B2-\u12B5\u12B8-\u12BE\u12C0\u12C2-\u12C5\u12C8-\u12D6\u12D8-\u1310\u1312-\u1315\u1318-\u135A\u1380-\u138F\u13A0-\u13F5\u13F8-\u13FD\u1401-\u166C\u166F-\u167F\u1681-\u169A\u16A0-\u16EA\u16F1-\u16F8\u1700-\u170C\u170E-\u1711\u1720-\u1731\u1740-\u1751\u1760-\u176C\u176E-\u1770\u1780-\u17B3\u17D7\u17DC\u1820-\u1877\u1880-\u1884\u1887-\u18A8\u18AA\u18B0-\u18F5\u1900-\u191E\u1950-\u196D\u1970-\u1974\u1980-\u19AB\u19B0-\u19C9\u1A00-\u1A16\u1A20-\u1A54\u1AA7\u1B05-\u1B33\u1B45-\u1B4B\u1B83-\u1BA0\u1BAE\u1BAF\u1BBA-\u1BE5\u1C00-\u1C23\u1C4D-\u1C4F\u1C5A-\u1C7D\u1C80-\u1C88\u1CE9-\u1CEC\u1CEE-\u1CF1\u1CF5\u1CF6\u1D00-\u1DBF\u1E00-\u1F15\u1F18-\u1F1D\u1F20-\u1F45\u1F48-\u1F4D\u1F50-\u1F57\u1F59\u1F5B\u1F5D\u1F5F-\u1F7D\u1F80-\u1FB4\u1FB6-\u1FBC\u1FBE\u1FC2-\u1FC4\u1FC6-\u1FCC\u1FD0-\u1FD3\u1FD6-\u1FDB\u1FE0-\u1FEC\u1FF2-\u1FF4\u1FF6-\u1FFC\u2071\u207F\u2090-\u209C\u2102\u2107\u210A-\u2113\u2115\u2119-\u211D\u2124\u2126\u2128\u212A-\u212D\u212F-\u2139\u213C-\u213F\u2145-\u2149\u214E\u2183\u2184\u2C00-\u2C2E\u2C30-\u2C5E\u2C60-\u2CE4\u2CEB-\u2CEE\u2CF2\u2CF3\u2D00-\u2D25\u2D27\u2D2D\u2D30-\u2D67\u2D6F\u2D80-\u2D96\u2DA0-\u2DA6\u2DA8-\u2DAE\u2DB0-\u2DB6\u2DB8-\u2DBE\u2DC0-\u2DC6\u2DC8-\u2DCE\u2DD0-\u2DD6\u2DD8-\u2DDE\u2E2F\u3005\u3006\u3031-\u3035\u303B\u303C\u3041-\u3096\u309D-\u309F\u30A1-\u30FA\u30FC-\u30FF\u3105-\u312E\u3131-\u318E\u31A0-\u31BA\u31F0-\u31FF\u3400-\u4DB5\u4E00-\u9FEA\uA000-\uA48C\uA4D0-\uA4FD\uA500-\uA60C\uA610-\uA61F\uA62A\uA62B\uA640-\uA66E\uA67F-\uA69D\uA6A0-\uA6E5\uA717-\uA71F\uA722-\uA788\uA78B-\uA7AE\uA7B0-\uA7B7\uA7F7-\uA801\uA803-\uA805\uA807-\uA80A\uA80C-\uA822\uA840-\uA873\uA882-\uA8B3\uA8F2-\uA8F7\uA8FB\uA8FD\uA90A-\uA925\uA930-\uA946\uA960-\uA97C\uA984-\uA9B2\uA9CF\uA9E0-\uA9E4\uA9E6-\uA9EF\uA9FA-\uA9FE\uAA00-\uAA28\uAA40-\uAA42\uAA44-\uAA4B\uAA60-\uAA76\uAA7A\uAA7E-\uAAAF\uAAB1\uAAB5\uAAB6\uAAB9-\uAABD\uAAC0\uAAC2\uAADB-\uAADD\uAAE0-\uAAEA\uAAF2-\uAAF4\uAB01-\uAB06\uAB09-\uAB0E\uAB11-\uAB16\uAB20-\uAB26\uAB28-\uAB2E\uAB30-\uAB5A\uAB5C-\uAB65\uAB70-\uABE2\uAC00-\uD7A3\uD7B0-\uD7C6\uD7CB-\uD7FB\uF900-\uFA6D\uFA70-\uFAD9\uFB00-\uFB06\uFB13-\uFB17\uFB1D\uFB1F-\uFB28\uFB2A-\uFB36\uFB38-\uFB3C\uFB3E\uFB40\uFB41\uFB43\uFB44\uFB46-\uFBB1\uFBD3-\uFD3D\uFD50-\uFD8F\uFD92-\uFDC7\uFDF0-\uFDFB\uFE70-\uFE74\uFE76-\uFEFC\uFF21-\uFF3A\uFF41-\uFF5A\uFF66-\uFFBE\uFFC2-\uFFC7\uFFCA-\uFFCF\uFFD2-\uFFD7\uFFDA-\uFFDC]|\uD800[\uDC00-\uDC0B\uDC0D-\uDC26\uDC28-\uDC3A\uDC3C\uDC3D\uDC3F-\uDC4D\uDC50-\uDC5D\uDC80-\uDCFA\uDE80-\uDE9C\uDEA0-\uDED0\uDF00-\uDF1F\uDF2D-\uDF40\uDF42-\uDF49\uDF50-\uDF75\uDF80-\uDF9D\uDFA0-\uDFC3\uDFC8-\uDFCF]|\uD801[\uDC00-\uDC9D\uDCB0-\uDCD3\uDCD8-\uDCFB\uDD00-\uDD27\uDD30-\uDD63\uDE00-\uDF36\uDF40-\uDF55\uDF60-\uDF67]|\uD802[\uDC00-\uDC05\uDC08\uDC0A-\uDC35\uDC37\uDC38\uDC3C\uDC3F-\uDC55\uDC60-\uDC76\uDC80-\uDC9E\uDCE0-\uDCF2\uDCF4\uDCF5\uDD00-\uDD15\uDD20-\uDD39\uDD80-\uDDB7\uDDBE\uDDBF\uDE00\uDE10-\uDE13\uDE15-\uDE17\uDE19-\uDE33\uDE60-\uDE7C\uDE80-\uDE9C\uDEC0-\uDEC7\uDEC9-\uDEE4\uDF00-\uDF35\uDF40-\uDF55\uDF60-\uDF72\uDF80-\uDF91]|\uD803[\uDC00-\uDC48\uDC80-\uDCB2\uDCC0-\uDCF2]|\uD804[\uDC03-\uDC37\uDC83-\uDCAF\uDCD0-\uDCE8\uDD03-\uDD26\uDD50-\uDD72\uDD76\uDD83-\uDDB2\uDDC1-\uDDC4\uDDDA\uDDDC\uDE00-\uDE11\uDE13-\uDE2B\uDE80-\uDE86\uDE88\uDE8A-\uDE8D\uDE8F-\uDE9D\uDE9F-\uDEA8\uDEB0-\uDEDE\uDF05-\uDF0C\uDF0F\uDF10\uDF13-\uDF28\uDF2A-\uDF30\uDF32\uDF33\uDF35-\uDF39\uDF3D\uDF50\uDF5D-\uDF61]|\uD805[\uDC00-\uDC34\uDC47-\uDC4A\uDC80-\uDCAF\uDCC4\uDCC5\uDCC7\uDD80-\uDDAE\uDDD8-\uDDDB\uDE00-\uDE2F\uDE44\uDE80-\uDEAA\uDF00-\uDF19]|\uD806[\uDCA0-\uDCDF\uDCFF\uDE00\uDE0B-\uDE32\uDE3A\uDE50\uDE5C-\uDE83\uDE86-\uDE89\uDEC0-\uDEF8]|\uD807[\uDC00-\uDC08\uDC0A-\uDC2E\uDC40\uDC72-\uDC8F\uDD00-\uDD06\uDD08\uDD09\uDD0B-\uDD30\uDD46]|\uD808[\uDC00-\uDF99]|\uD809[\uDC80-\uDD43]|[\uD80C\uD81C-\uD820\uD840-\uD868\uD86A-\uD86C\uD86F-\uD872\uD874-\uD879][\uDC00-\uDFFF]|\uD80D[\uDC00-\uDC2E]|\uD811[\uDC00-\uDE46]|\uD81A[\uDC00-\uDE38\uDE40-\uDE5E\uDED0-\uDEED\uDF00-\uDF2F\uDF40-\uDF43\uDF63-\uDF77\uDF7D-\uDF8F]|\uD81B[\uDF00-\uDF44\uDF50\uDF93-\uDF9F\uDFE0\uDFE1]|\uD821[\uDC00-\uDFEC]|\uD822[\uDC00-\uDEF2]|\uD82C[\uDC00-\uDD1E\uDD70-\uDEFB]|\uD82F[\uDC00-\uDC6A\uDC70-\uDC7C\uDC80-\uDC88\uDC90-\uDC99]|\uD835[\uDC00-\uDC54\uDC56-\uDC9C\uDC9E\uDC9F\uDCA2\uDCA5\uDCA6\uDCA9-\uDCAC\uDCAE-\uDCB9\uDCBB\uDCBD-\uDCC3\uDCC5-\uDD05\uDD07-\uDD0A\uDD0D-\uDD14\uDD16-\uDD1C\uDD1E-\uDD39\uDD3B-\uDD3E\uDD40-\uDD44\uDD46\uDD4A-\uDD50\uDD52-\uDEA5\uDEA8-\uDEC0\uDEC2-\uDEDA\uDEDC-\uDEFA\uDEFC-\uDF14\uDF16-\uDF34\uDF36-\uDF4E\uDF50-\uDF6E\uDF70-\uDF88\uDF8A-\uDFA8\uDFAA-\uDFC2\uDFC4-\uDFCB]|\uD83A[\uDC00-\uDCC4\uDD00-\uDD43]|\uD83B[\uDE00-\uDE03\uDE05-\uDE1F\uDE21\uDE22\uDE24\uDE27\uDE29-\uDE32\uDE34-\uDE37\uDE39\uDE3B\uDE42\uDE47\uDE49\uDE4B\uDE4D-\uDE4F\uDE51\uDE52\uDE54\uDE57\uDE59\uDE5B\uDE5D\uDE5F\uDE61\uDE62\uDE64\uDE67-\uDE6A\uDE6C-\uDE72\uDE74-\uDE77\uDE79-\uDE7C\uDE7E\uDE80-\uDE89\uDE8B-\uDE9B\uDEA1-\uDEA3\uDEA5-\uDEA9\uDEAB-\uDEBB]|\uD869[\uDC00-\uDED6\uDF00-\uDFFF]|\uD86D[\uDC00-\uDF34\uDF40-\uDFFF]|\uD86E[\uDC00-\uDC1D\uDC20-\uDFFF]|\uD873[\uDC00-\uDEA1\uDEB0-\uDFFF]|\uD87A[\uDC00-\uDFE0]|\uD87E[\uDC00-\uDE1D])\S*/g; /** * Transforms text to title case. * Capitalizes the first letter of each word and transforms the * rest of the word to lower case. * Words are delimited by any whitespace character, such as a space, tab, or line-feed character. * * @see `LowerCasePipe` * @see `UpperCasePipe` * * @usageNotes * The following example shows the result of transforming various strings into title case. * * * * @ngModule CommonModule * @publicApi */ class TitleCasePipe { /** * @param value The string to transform to title case. */ transform(value) { if (!value) return value; if (typeof value !== 'string') { throw invalidPipeArgumentError(TitleCasePipe, value); } return value.replace(unicodeWordMatch, (txt => txt[0].toUpperCase() + txt.substr(1).toLowerCase())); } } TitleCasePipe.ɵfac = function TitleCasePipe_Factory(t) { return new (t || TitleCasePipe)(); }; TitleCasePipe.ɵpipe = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "titlecase", type: TitleCasePipe, pure: true }); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](TitleCasePipe, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Pipe"], args: [{ name: 'titlecase' }] }], null, null); })(); /** * Transforms text to all upper case. * @see `LowerCasePipe` * @see `TitleCasePipe` * * @ngModule CommonModule * @publicApi */ class UpperCasePipe { /** * @param value The string to transform to upper case. */ transform(value) { if (!value) return value; if (typeof value !== 'string') { throw invalidPipeArgumentError(UpperCasePipe, value); } return value.toUpperCase(); } } UpperCasePipe.ɵfac = function UpperCasePipe_Factory(t) { return new (t || UpperCasePipe)(); }; UpperCasePipe.ɵpipe = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "uppercase", type: UpperCasePipe, pure: true }); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](UpperCasePipe, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Pipe"], args: [{ name: 'uppercase' }] }], null, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ // clang-format off /** * @ngModule CommonModule * @description * * Formats a date value according to locale rules. * * Only the `en-US` locale data comes with Angular. To localize dates * in another language, you must import the corresponding locale data. * See the [I18n guide](guide/i18n#i18n-pipes) for more information. * * @see `formatDate()` * * * @usageNotes * * The result of this pipe is not reevaluated when the input is mutated. To avoid the need to * reformat the date on every change-detection cycle, treat the date as an immutable object * and change the reference when the pipe needs to run again. * * ### Pre-defined format options * * Examples are given in `en-US` locale. * * - `'short'`: equivalent to `'M/d/yy, h:mm a'` (`6/15/15, 9:03 AM`). * - `'medium'`: equivalent to `'MMM d, y, h:mm:ss a'` (`Jun 15, 2015, 9:03:01 AM`). * - `'long'`: equivalent to `'MMMM d, y, h:mm:ss a z'` (`June 15, 2015 at 9:03:01 AM * GMT+1`). * - `'full'`: equivalent to `'EEEE, MMMM d, y, h:mm:ss a zzzz'` (`Monday, June 15, 2015 at * 9:03:01 AM GMT+01:00`). * - `'shortDate'`: equivalent to `'M/d/yy'` (`6/15/15`). * - `'mediumDate'`: equivalent to `'MMM d, y'` (`Jun 15, 2015`). * - `'longDate'`: equivalent to `'MMMM d, y'` (`June 15, 2015`). * - `'fullDate'`: equivalent to `'EEEE, MMMM d, y'` (`Monday, June 15, 2015`). * - `'shortTime'`: equivalent to `'h:mm a'` (`9:03 AM`). * - `'mediumTime'`: equivalent to `'h:mm:ss a'` (`9:03:01 AM`). * - `'longTime'`: equivalent to `'h:mm:ss a z'` (`9:03:01 AM GMT+1`). * - `'fullTime'`: equivalent to `'h:mm:ss a zzzz'` (`9:03:01 AM GMT+01:00`). * * ### Custom format options * * You can construct a format string using symbols to specify the components * of a date-time value, as described in the following table. * Format details depend on the locale. * Fields marked with (*) are only available in the extra data set for the given locale. * * | Field type | Format | Description | Example Value | * |--------------------|-------------|---------------------------------------------------------------|------------------------------------------------------------| * | Era | G, GG & GGG | Abbreviated | AD | * | | GGGG | Wide | Anno Domini | * | | GGGGG | Narrow | A | * | Year | y | Numeric: minimum digits | 2, 20, 201, 2017, 20173 | * | | yy | Numeric: 2 digits + zero padded | 02, 20, 01, 17, 73 | * | | yyy | Numeric: 3 digits + zero padded | 002, 020, 201, 2017, 20173 | * | | yyyy | Numeric: 4 digits or more + zero padded | 0002, 0020, 0201, 2017, 20173 | * | Month | M | Numeric: 1 digit | 9, 12 | * | | MM | Numeric: 2 digits + zero padded | 09, 12 | * | | MMM | Abbreviated | Sep | * | | MMMM | Wide | September | * | | MMMMM | Narrow | S | * | Month standalone | L | Numeric: 1 digit | 9, 12 | * | | LL | Numeric: 2 digits + zero padded | 09, 12 | * | | LLL | Abbreviated | Sep | * | | LLLL | Wide | September | * | | LLLLL | Narrow | S | * | Week of year | w | Numeric: minimum digits | 1... 53 | * | | ww | Numeric: 2 digits + zero padded | 01... 53 | * | Week of month | W | Numeric: 1 digit | 1... 5 | * | Day of month | d | Numeric: minimum digits | 1 | * | | dd | Numeric: 2 digits + zero padded | 01 | * | Week day | E, EE & EEE | Abbreviated | Tue | * | | EEEE | Wide | Tuesday | * | | EEEEE | Narrow | T | * | | EEEEEE | Short | Tu | * | Period | a, aa & aaa | Abbreviated | am/pm or AM/PM | * | | aaaa | Wide (fallback to `a` when missing) | ante meridiem/post meridiem | * | | aaaaa | Narrow | a/p | * | Period* | B, BB & BBB | Abbreviated | mid. | * | | BBBB | Wide | am, pm, midnight, noon, morning, afternoon, evening, night | * | | BBBBB | Narrow | md | * | Period standalone* | b, bb & bbb | Abbreviated | mid. | * | | bbbb | Wide | am, pm, midnight, noon, morning, afternoon, evening, night | * | | bbbbb | Narrow | md | * | Hour 1-12 | h | Numeric: minimum digits | 1, 12 | * | | hh | Numeric: 2 digits + zero padded | 01, 12 | * | Hour 0-23 | H | Numeric: minimum digits | 0, 23 | * | | HH | Numeric: 2 digits + zero padded | 00, 23 | * | Minute | m | Numeric: minimum digits | 8, 59 | * | | mm | Numeric: 2 digits + zero padded | 08, 59 | * | Second | s | Numeric: minimum digits | 0... 59 | * | | ss | Numeric: 2 digits + zero padded | 00... 59 | * | Fractional seconds | S | Numeric: 1 digit | 0... 9 | * | | SS | Numeric: 2 digits + zero padded | 00... 99 | * | | SSS | Numeric: 3 digits + zero padded (= milliseconds) | 000... 999 | * | Zone | z, zz & zzz | Short specific non location format (fallback to O) | GMT-8 | * | | zzzz | Long specific non location format (fallback to OOOO) | GMT-08:00 | * | | Z, ZZ & ZZZ | ISO8601 basic format | -0800 | * | | ZZZZ | Long localized GMT format | GMT-8:00 | * | | ZZZZZ | ISO8601 extended format + Z indicator for offset 0 (= XXXXX) | -08:00 | * | | O, OO & OOO | Short localized GMT format | GMT-8 | * | | OOOO | Long localized GMT format | GMT-08:00 | * * Note that timezone correction is not applied to an ISO string that has no time component, such as "2016-09-19" * * ### Format examples * * These examples transform a date into various formats, * assuming that `dateObj` is a JavaScript `Date` object for * year: 2015, month: 6, day: 15, hour: 21, minute: 43, second: 11, * given in the local time for the `en-US` locale. * * ``` * {{ dateObj | date }} // output is 'Jun 15, 2015' * {{ dateObj | date:'medium' }} // output is 'Jun 15, 2015, 9:43:11 PM' * {{ dateObj | date:'shortTime' }} // output is '9:43 PM' * {{ dateObj | date:'mm:ss' }} // output is '43:11' * ``` * * ### Usage example * * The following component uses a date pipe to display the current date in different formats. * * ``` * @Component({ * selector: 'date-pipe', * template: `
    *

    Today is {{today | date}}

    *

    Or if you prefer, {{today | date:'fullDate'}}

    *

    The time is {{today | date:'h:mm a z'}}

    *
    ` * }) * // Get the current date and time as a date-time value. * export class DatePipeComponent { * today: number = Date.now(); * } * ``` * * @publicApi */ // clang-format on class DatePipe { constructor(locale) { this.locale = locale; } /** * @param value The date expression: a `Date` object, a number * (milliseconds since UTC epoch), or an ISO string (https://www.w3.org/TR/NOTE-datetime). * @param format The date/time components to include, using predefined options or a * custom format string. * @param timezone A timezone offset (such as `'+0430'`), or a standard * UTC/GMT or continental US timezone abbreviation. * When not supplied, uses the end-user's local system timezone. * @param locale A locale code for the locale format rules to use. * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default. * See [Setting your app locale](guide/i18n#setting-up-the-locale-of-your-app). * @returns A date string in the desired format. */ transform(value, format = 'mediumDate', timezone, locale) { if (value == null || value === '' || value !== value) return null; try { return formatDate(value, format, locale || this.locale, timezone); } catch (error) { throw invalidPipeArgumentError(DatePipe, error.message); } } } DatePipe.ɵfac = function DatePipe_Factory(t) { return new (t || DatePipe)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["LOCALE_ID"])); }; DatePipe.ɵpipe = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "date", type: DatePipe, pure: true }); DatePipe.ctorParameters = () => [ { type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Inject"], args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["LOCALE_ID"],] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](DatePipe, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Pipe"], args: [{ name: 'date', pure: true }] }], function () { return [{ type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Inject"], args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["LOCALE_ID"]] }] }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ const _INTERPOLATION_REGEXP = /#/g; /** * @ngModule CommonModule * @description * * Maps a value to a string that pluralizes the value according to locale rules. * * @usageNotes * * ### Example * * {@example common/pipes/ts/i18n_pipe.ts region='I18nPluralPipeComponent'} * * @publicApi */ class I18nPluralPipe { constructor(_localization) { this._localization = _localization; } /** * @param value the number to be formatted * @param pluralMap an object that mimics the ICU format, see * http://userguide.icu-project.org/formatparse/messages. * @param locale a `string` defining the locale to use (uses the current {@link LOCALE_ID} by * default). */ transform(value, pluralMap, locale) { if (value == null) return ''; if (typeof pluralMap !== 'object' || pluralMap === null) { throw invalidPipeArgumentError(I18nPluralPipe, pluralMap); } const key = getPluralCategory(value, Object.keys(pluralMap), this._localization, locale); return pluralMap[key].replace(_INTERPOLATION_REGEXP, value.toString()); } } I18nPluralPipe.ɵfac = function I18nPluralPipe_Factory(t) { return new (t || I18nPluralPipe)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](NgLocalization)); }; I18nPluralPipe.ɵpipe = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "i18nPlural", type: I18nPluralPipe, pure: true }); I18nPluralPipe.ctorParameters = () => [ { type: NgLocalization } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](I18nPluralPipe, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Pipe"], args: [{ name: 'i18nPlural', pure: true }] }], function () { return [{ type: NgLocalization }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @ngModule CommonModule * @description * * Generic selector that displays the string that matches the current value. * * If none of the keys of the `mapping` match the `value`, then the content * of the `other` key is returned when present, otherwise an empty string is returned. * * @usageNotes * * ### Example * * {@example common/pipes/ts/i18n_pipe.ts region='I18nSelectPipeComponent'} * * @publicApi */ class I18nSelectPipe { /** * @param value a string to be internationalized. * @param mapping an object that indicates the text that should be displayed * for different values of the provided `value`. */ transform(value, mapping) { if (value == null) return ''; if (typeof mapping !== 'object' || typeof value !== 'string') { throw invalidPipeArgumentError(I18nSelectPipe, mapping); } if (mapping.hasOwnProperty(value)) { return mapping[value]; } if (mapping.hasOwnProperty('other')) { return mapping['other']; } return ''; } } I18nSelectPipe.ɵfac = function I18nSelectPipe_Factory(t) { return new (t || I18nSelectPipe)(); }; I18nSelectPipe.ɵpipe = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "i18nSelect", type: I18nSelectPipe, pure: true }); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](I18nSelectPipe, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Pipe"], args: [{ name: 'i18nSelect', pure: true }] }], null, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @ngModule CommonModule * @description * * Converts a value into its JSON-format representation. Useful for debugging. * * @usageNotes * * The following component uses a JSON pipe to convert an object * to JSON format, and displays the string in both formats for comparison. * * {@example common/pipes/ts/json_pipe.ts region='JsonPipe'} * * @publicApi */ class JsonPipe { /** * @param value A value of any type to convert into a JSON-format string. */ transform(value) { return JSON.stringify(value, null, 2); } } JsonPipe.ɵfac = function JsonPipe_Factory(t) { return new (t || JsonPipe)(); }; JsonPipe.ɵpipe = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "json", type: JsonPipe, pure: false }); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](JsonPipe, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Pipe"], args: [{ name: 'json', pure: false }] }], null, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ function makeKeyValuePair(key, value) { return { key: key, value: value }; } /** * @ngModule CommonModule * @description * * Transforms Object or Map into an array of key value pairs. * * The output array will be ordered by keys. * By default the comparator will be by Unicode point value. * You can optionally pass a compareFn if your keys are complex types. * * @usageNotes * ### Examples * * This examples show how an Object or a Map can be iterated by ngFor with the use of this * keyvalue pipe. * * {@example common/pipes/ts/keyvalue_pipe.ts region='KeyValuePipe'} * * @publicApi */ class KeyValuePipe { constructor(differs) { this.differs = differs; this.keyValues = []; } transform(input, compareFn = defaultComparator) { if (!input || (!(input instanceof Map) && typeof input !== 'object')) { return null; } if (!this.differ) { // make a differ for whatever type we've been passed in this.differ = this.differs.find(input).create(); } const differChanges = this.differ.diff(input); if (differChanges) { this.keyValues = []; differChanges.forEachItem((r) => { this.keyValues.push(makeKeyValuePair(r.key, r.currentValue)); }); this.keyValues.sort(compareFn); } return this.keyValues; } } KeyValuePipe.ɵfac = function KeyValuePipe_Factory(t) { return new (t || KeyValuePipe)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["KeyValueDiffers"])); }; KeyValuePipe.ɵpipe = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "keyvalue", type: KeyValuePipe, pure: false }); KeyValuePipe.ctorParameters = () => [ { type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["KeyValueDiffers"] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](KeyValuePipe, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Pipe"], args: [{ name: 'keyvalue', pure: false }] }], function () { return [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["KeyValueDiffers"] }]; }, null); })(); function defaultComparator(keyValueA, keyValueB) { const a = keyValueA.key; const b = keyValueB.key; // if same exit with 0; if (a === b) return 0; // make sure that undefined are at the end of the sort. if (a === undefined) return 1; if (b === undefined) return -1; // make sure that nulls are at the end of the sort. if (a === null) return 1; if (b === null) return -1; if (typeof a == 'string' && typeof b == 'string') { return a < b ? -1 : 1; } if (typeof a == 'number' && typeof b == 'number') { return a - b; } if (typeof a == 'boolean' && typeof b == 'boolean') { return a < b ? -1 : 1; } // `a` and `b` are of different types. Compare their string values. const aString = String(a); const bString = String(b); return aString == bString ? 0 : aString < bString ? -1 : 1; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @ngModule CommonModule * @description * * Transforms a number into a string, * formatted according to locale rules that determine group sizing and * separator, decimal-point character, and other locale-specific * configurations. * * If no parameters are specified, the function rounds off to the nearest value using this * [rounding method](https://en.wikibooks.org/wiki/Arithmetic/Rounding). * The behavior differs from that of the JavaScript ```Math.round()``` function. * In the following case for example, the pipe rounds down where * ```Math.round()``` rounds up: * * ```html * -2.5 | number:'1.0-0' * > -3 * Math.round(-2.5) * > -2 * ``` * * @see `formatNumber()` * * @usageNotes * The following code shows how the pipe transforms numbers * into text strings, according to various format specifications, * where the caller's default locale is `en-US`. * * ### Example * * * * @publicApi */ class DecimalPipe { constructor(_locale) { this._locale = _locale; } /** * @param value The number to be formatted. * @param digitsInfo Decimal representation options, specified by a string * in the following format:
    * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}. * - `minIntegerDigits`: The minimum number of integer digits before the decimal point. * Default is `1`. * - `minFractionDigits`: The minimum number of digits after the decimal point. * Default is `0`. * - `maxFractionDigits`: The maximum number of digits after the decimal point. * Default is `3`. * @param locale A locale code for the locale format rules to use. * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default. * See [Setting your app locale](guide/i18n#setting-up-the-locale-of-your-app). */ transform(value, digitsInfo, locale) { if (isEmpty(value)) return null; locale = locale || this._locale; try { const num = strToNumber(value); return formatNumber(num, locale, digitsInfo); } catch (error) { throw invalidPipeArgumentError(DecimalPipe, error.message); } } } DecimalPipe.ɵfac = function DecimalPipe_Factory(t) { return new (t || DecimalPipe)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["LOCALE_ID"])); }; DecimalPipe.ɵpipe = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "number", type: DecimalPipe, pure: true }); DecimalPipe.ctorParameters = () => [ { type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Inject"], args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["LOCALE_ID"],] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](DecimalPipe, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Pipe"], args: [{ name: 'number' }] }], function () { return [{ type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Inject"], args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["LOCALE_ID"]] }] }]; }, null); })(); /** * @ngModule CommonModule * @description * * Transforms a number to a percentage * string, formatted according to locale rules that determine group sizing and * separator, decimal-point character, and other locale-specific * configurations. * * @see `formatPercent()` * * @usageNotes * The following code shows how the pipe transforms numbers * into text strings, according to various format specifications, * where the caller's default locale is `en-US`. * * * * @publicApi */ class PercentPipe { constructor(_locale) { this._locale = _locale; } /** * * @param value The number to be formatted as a percentage. * @param digitsInfo Decimal representation options, specified by a string * in the following format:
    * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}. * - `minIntegerDigits`: The minimum number of integer digits before the decimal point. * Default is `1`. * - `minFractionDigits`: The minimum number of digits after the decimal point. * Default is `0`. * - `maxFractionDigits`: The maximum number of digits after the decimal point. * Default is `0`. * @param locale A locale code for the locale format rules to use. * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default. * See [Setting your app locale](guide/i18n#setting-up-the-locale-of-your-app). */ transform(value, digitsInfo, locale) { if (isEmpty(value)) return null; locale = locale || this._locale; try { const num = strToNumber(value); return formatPercent(num, locale, digitsInfo); } catch (error) { throw invalidPipeArgumentError(PercentPipe, error.message); } } } PercentPipe.ɵfac = function PercentPipe_Factory(t) { return new (t || PercentPipe)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["LOCALE_ID"])); }; PercentPipe.ɵpipe = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "percent", type: PercentPipe, pure: true }); PercentPipe.ctorParameters = () => [ { type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Inject"], args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["LOCALE_ID"],] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](PercentPipe, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Pipe"], args: [{ name: 'percent' }] }], function () { return [{ type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Inject"], args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["LOCALE_ID"]] }] }]; }, null); })(); /** * @ngModule CommonModule * @description * * Transforms a number to a currency string, formatted according to locale rules * that determine group sizing and separator, decimal-point character, * and other locale-specific configurations. * * {@a currency-code-deprecation} *
    * * **Deprecation notice:** * * The default currency code is currently always `USD` but this is deprecated from v9. * * **In v11 the default currency code will be taken from the current locale identified by * the `LOCAL_ID` token. See the [i18n guide](guide/i18n#setting-up-the-locale-of-your-app) for * more information.** * * If you need the previous behavior then set it by creating a `DEFAULT_CURRENCY_CODE` provider in * your application `NgModule`: * * ```ts * {provide: DEFAULT_CURRENCY_CODE, useValue: 'USD'} * ``` * *
    * * @see `getCurrencySymbol()` * @see `formatCurrency()` * * @usageNotes * The following code shows how the pipe transforms numbers * into text strings, according to various format specifications, * where the caller's default locale is `en-US`. * * * * @publicApi */ class CurrencyPipe { constructor(_locale, _defaultCurrencyCode = 'USD') { this._locale = _locale; this._defaultCurrencyCode = _defaultCurrencyCode; } /** * * @param value The number to be formatted as currency. * @param currencyCode The [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) currency code, * such as `USD` for the US dollar and `EUR` for the euro. The default currency code can be * configured using the `DEFAULT_CURRENCY_CODE` injection token. * @param display The format for the currency indicator. One of the following: * - `code`: Show the code (such as `USD`). * - `symbol`(default): Show the symbol (such as `$`). * - `symbol-narrow`: Use the narrow symbol for locales that have two symbols for their * currency. * For example, the Canadian dollar CAD has the symbol `CA$` and the symbol-narrow `$`. If the * locale has no narrow symbol, uses the standard symbol for the locale. * - String: Use the given string value instead of a code or a symbol. * For example, an empty string will suppress the currency & symbol. * - Boolean (marked deprecated in v5): `true` for symbol and false for `code`. * * @param digitsInfo Decimal representation options, specified by a string * in the following format:
    * {minIntegerDigits}.{minFractionDigits}-{maxFractionDigits}. * - `minIntegerDigits`: The minimum number of integer digits before the decimal point. * Default is `1`. * - `minFractionDigits`: The minimum number of digits after the decimal point. * Default is `2`. * - `maxFractionDigits`: The maximum number of digits after the decimal point. * Default is `2`. * If not provided, the number will be formatted with the proper amount of digits, * depending on what the [ISO 4217](https://en.wikipedia.org/wiki/ISO_4217) specifies. * For example, the Canadian dollar has 2 digits, whereas the Chilean peso has none. * @param locale A locale code for the locale format rules to use. * When not supplied, uses the value of `LOCALE_ID`, which is `en-US` by default. * See [Setting your app locale](guide/i18n#setting-up-the-locale-of-your-app). */ transform(value, currencyCode, display = 'symbol', digitsInfo, locale) { if (isEmpty(value)) return null; locale = locale || this._locale; if (typeof display === 'boolean') { if (console && console.warn) { console.warn(`Warning: the currency pipe has been changed in Angular v5. The symbolDisplay option (third parameter) is now a string instead of a boolean. The accepted values are "code", "symbol" or "symbol-narrow".`); } display = display ? 'symbol' : 'code'; } let currency = currencyCode || this._defaultCurrencyCode; if (display !== 'code') { if (display === 'symbol' || display === 'symbol-narrow') { currency = getCurrencySymbol(currency, display === 'symbol' ? 'wide' : 'narrow', locale); } else { currency = display; } } try { const num = strToNumber(value); return formatCurrency(num, locale, currency, currencyCode, digitsInfo); } catch (error) { throw invalidPipeArgumentError(CurrencyPipe, error.message); } } } CurrencyPipe.ɵfac = function CurrencyPipe_Factory(t) { return new (t || CurrencyPipe)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["LOCALE_ID"]), _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdirectiveInject"](_angular_core__WEBPACK_IMPORTED_MODULE_0__["DEFAULT_CURRENCY_CODE"])); }; CurrencyPipe.ɵpipe = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "currency", type: CurrencyPipe, pure: true }); CurrencyPipe.ctorParameters = () => [ { type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Inject"], args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["LOCALE_ID"],] }] }, { type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Inject"], args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["DEFAULT_CURRENCY_CODE"],] }] } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](CurrencyPipe, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Pipe"], args: [{ name: 'currency' }] }], function () { return [{ type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Inject"], args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["LOCALE_ID"]] }] }, { type: String, decorators: [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Inject"], args: [_angular_core__WEBPACK_IMPORTED_MODULE_0__["DEFAULT_CURRENCY_CODE"]] }] }]; }, null); })(); function isEmpty(value) { return value == null || value === '' || value !== value; } /** * Transforms a string into a number (if needed). */ function strToNumber(value) { // Convert strings to numbers if (typeof value === 'string' && !isNaN(Number(value) - parseFloat(value))) { return Number(value); } if (typeof value !== 'number') { throw new Error(`${value} is not a number`); } return value; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @ngModule CommonModule * @description * * Creates a new `Array` or `String` containing a subset (slice) of the elements. * * @usageNotes * * All behavior is based on the expected behavior of the JavaScript API `Array.prototype.slice()` * and `String.prototype.slice()`. * * When operating on an `Array`, the returned `Array` is always a copy even when all * the elements are being returned. * * When operating on a blank value, the pipe returns the blank value. * * ### List Example * * This `ngFor` example: * * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_list'} * * produces the following: * * ```html *
  • b
    • *
  • c
    • * ``` * * ### String Examples * * {@example common/pipes/ts/slice_pipe.ts region='SlicePipe_string'} * * @publicApi */ class SlicePipe { transform(value, start, end) { if (value == null) return value; if (!this.supports(value)) { throw invalidPipeArgumentError(SlicePipe, value); } return value.slice(start, end); } supports(obj) { return typeof obj === 'string' || Array.isArray(obj); } } SlicePipe.ɵfac = function SlicePipe_Factory(t) { return new (t || SlicePipe)(); }; SlicePipe.ɵpipe = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefinePipe"]({ name: "slice", type: SlicePipe, pure: false }); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](SlicePipe, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Pipe"], args: [{ name: 'slice', pure: false }] }], null, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * A collection of Angular pipes that are likely to be used in each and every application. */ const COMMON_PIPES = [ AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe, ]; /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ // Note: This does not contain the location providers, // as they need some platform specific implementations to work. /** * Exports all the basic Angular directives and pipes, * such as `NgIf`, `NgForOf`, `DecimalPipe`, and so on. * Re-exported by `BrowserModule`, which is included automatically in the root * `AppModule` when you create a new app with the CLI `new` command. * * * The `providers` options configure the NgModule's injector to provide * localization dependencies to members. * * The `exports` options make the declared directives and pipes available for import * by other NgModules. * * @publicApi */ class CommonModule { } CommonModule.ɵmod = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineNgModule"]({ type: CommonModule }); CommonModule.ɵinj = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjector"]({ factory: function CommonModule_Factory(t) { return new (t || CommonModule)(); }, providers: [ { provide: NgLocalization, useClass: NgLocaleLocalization }, ] }); (function () { (typeof ngJitMode === "undefined" || ngJitMode) && _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵsetNgModuleScope"](CommonModule, { declarations: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe], exports: [NgClass, NgComponentOutlet, NgForOf, NgIf, NgTemplateOutlet, NgStyle, NgSwitch, NgSwitchCase, NgSwitchDefault, NgPlural, NgPluralCase, AsyncPipe, UpperCasePipe, LowerCasePipe, JsonPipe, SlicePipe, DecimalPipe, PercentPipe, TitleCasePipe, CurrencyPipe, DatePipe, I18nPluralPipe, I18nSelectPipe, KeyValuePipe] }); })(); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](CommonModule, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["NgModule"], args: [{ declarations: [COMMON_DIRECTIVES, COMMON_PIPES], exports: [COMMON_DIRECTIVES, COMMON_PIPES], providers: [ { provide: NgLocalization, useClass: NgLocaleLocalization }, ] }] }], null, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ const PLATFORM_BROWSER_ID = 'browser'; const PLATFORM_SERVER_ID = 'server'; const PLATFORM_WORKER_APP_ID = 'browserWorkerApp'; const PLATFORM_WORKER_UI_ID = 'browserWorkerUi'; /** * Returns whether a platform id represents a browser platform. * @publicApi */ function isPlatformBrowser(platformId) { return platformId === PLATFORM_BROWSER_ID; } /** * Returns whether a platform id represents a server platform. * @publicApi */ function isPlatformServer(platformId) { return platformId === PLATFORM_SERVER_ID; } /** * Returns whether a platform id represents a web worker app platform. * @publicApi */ function isPlatformWorkerApp(platformId) { return platformId === PLATFORM_WORKER_APP_ID; } /** * Returns whether a platform id represents a web worker UI platform. * @publicApi */ function isPlatformWorkerUi(platformId) { return platformId === PLATFORM_WORKER_UI_ID; } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @publicApi */ const VERSION = new _angular_core__WEBPACK_IMPORTED_MODULE_0__["Version"]('10.2.4'); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Defines a scroll position manager. Implemented by `BrowserViewportScroller`. * * @publicApi */ class ViewportScroller { } // De-sugared tree-shakable injection // See #23917 /** @nocollapse */ ViewportScroller.ɵprov = Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"])({ token: ViewportScroller, providedIn: 'root', factory: () => new BrowserViewportScroller(Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(DOCUMENT), window, Object(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"])(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ErrorHandler"])) }); /** * Manages the scroll position for a browser window. */ class BrowserViewportScroller { constructor(document, window, errorHandler) { this.document = document; this.window = window; this.errorHandler = errorHandler; this.offset = () => [0, 0]; } /** * Configures the top offset used when scrolling to an anchor. * @param offset A position in screen coordinates (a tuple with x and y values) * or a function that returns the top offset position. * */ setOffset(offset) { if (Array.isArray(offset)) { this.offset = () => offset; } else { this.offset = offset; } } /** * Retrieves the current scroll position. * @returns The position in screen coordinates. */ getScrollPosition() { if (this.supportsScrolling()) { return [this.window.scrollX, this.window.scrollY]; } else { return [0, 0]; } } /** * Sets the scroll position. * @param position The new position in screen coordinates. */ scrollToPosition(position) { if (this.supportsScrolling()) { this.window.scrollTo(position[0], position[1]); } } /** * Scrolls to an anchor element. * @param anchor The ID of the anchor element. */ scrollToAnchor(anchor) { if (this.supportsScrolling()) { const elSelected = this.document.getElementById(anchor) || this.document.getElementsByName(anchor)[0]; if (elSelected) { this.scrollToElement(elSelected); } } } /** * Disables automatic scroll restoration provided by the browser. */ setHistoryScrollRestoration(scrollRestoration) { if (this.supportScrollRestoration()) { const history = this.window.history; if (history && history.scrollRestoration) { history.scrollRestoration = scrollRestoration; } } } scrollToElement(el) { const rect = el.getBoundingClientRect(); const left = rect.left + this.window.pageXOffset; const top = rect.top + this.window.pageYOffset; const offset = this.offset(); this.window.scrollTo(left - offset[0], top - offset[1]); } /** * We only support scroll restoration when we can get a hold of window. * This means that we do not support this behavior when running in a web worker. * * Lifting this restriction right now would require more changes in the dom adapter. * Since webworkers aren't widely used, we will lift it once RouterScroller is * battle-tested. */ supportScrollRestoration() { try { if (!this.window || !this.window.scrollTo) { return false; } // The `scrollRestoration` property could be on the `history` instance or its prototype. const scrollRestorationDescriptor = getScrollRestorationProperty(this.window.history) || getScrollRestorationProperty(Object.getPrototypeOf(this.window.history)); // We can write to the `scrollRestoration` property if it is a writable data field or it has a // setter function. return !!scrollRestorationDescriptor && !!(scrollRestorationDescriptor.writable || scrollRestorationDescriptor.set); } catch (_a) { return false; } } supportsScrolling() { try { return !!this.window.scrollTo; } catch (_a) { return false; } } } function getScrollRestorationProperty(obj) { return Object.getOwnPropertyDescriptor(obj, 'scrollRestoration'); } /** * Provides an empty implementation of the viewport scroller. This will * live in @angular/common as it will be used by both platform-server and platform-webworker. */ class NullViewportScroller { /** * Empty implementation */ setOffset(offset) { } /** * Empty implementation */ getScrollPosition() { return [0, 0]; } /** * Empty implementation */ scrollToPosition(position) { } /** * Empty implementation */ scrollToAnchor(anchor) { } /** * Empty implementation */ setHistoryScrollRestoration(scrollRestoration) { } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ // This file only reexports content of the `src` folder. Keep it that way. /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Generated bundle index. Do not edit. */ //# sourceMappingURL=common.js.map /***/ }), /***/ "./node_modules/@angular/common/__ivy_ngcc__/fesm2015/http.js": /*!********************************************************************!*\ !*** ./node_modules/@angular/common/__ivy_ngcc__/fesm2015/http.js ***! \********************************************************************/ /*! exports provided: HTTP_INTERCEPTORS, HttpBackend, HttpClient, HttpClientJsonpModule, HttpClientModule, HttpClientXsrfModule, HttpErrorResponse, HttpEventType, HttpHandler, HttpHeaderResponse, HttpHeaders, HttpParams, HttpRequest, HttpResponse, HttpResponseBase, HttpUrlEncodingCodec, HttpXhrBackend, HttpXsrfTokenExtractor, JsonpClientBackend, JsonpInterceptor, XhrFactory, ɵHttpInterceptingHandler, ɵangular_packages_common_http_http_a, ɵangular_packages_common_http_http_b, ɵangular_packages_common_http_http_c, ɵangular_packages_common_http_http_d, ɵangular_packages_common_http_http_e, ɵangular_packages_common_http_http_f, ɵangular_packages_common_http_http_g, ɵangular_packages_common_http_http_h */ /***/ (function(module, __webpack_exports__, __webpack_require__) { "use strict"; __webpack_require__.r(__webpack_exports__); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HTTP_INTERCEPTORS", function() { return HTTP_INTERCEPTORS; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpBackend", function() { return HttpBackend; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpClient", function() { return HttpClient; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpClientJsonpModule", function() { return HttpClientJsonpModule; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpClientModule", function() { return HttpClientModule; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpClientXsrfModule", function() { return HttpClientXsrfModule; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpErrorResponse", function() { return HttpErrorResponse; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpEventType", function() { return HttpEventType; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpHandler", function() { return HttpHandler; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpHeaderResponse", function() { return HttpHeaderResponse; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpHeaders", function() { return HttpHeaders; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpParams", function() { return HttpParams; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpRequest", function() { return HttpRequest; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpResponse", function() { return HttpResponse; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpResponseBase", function() { return HttpResponseBase; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpUrlEncodingCodec", function() { return HttpUrlEncodingCodec; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpXhrBackend", function() { return HttpXhrBackend; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "HttpXsrfTokenExtractor", function() { return HttpXsrfTokenExtractor; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "JsonpClientBackend", function() { return JsonpClientBackend; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "JsonpInterceptor", function() { return JsonpInterceptor; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "XhrFactory", function() { return XhrFactory; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵHttpInterceptingHandler", function() { return HttpInterceptingHandler; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_http_http_a", function() { return NoopInterceptor; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_http_http_b", function() { return JsonpCallbackContext; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_http_http_c", function() { return jsonpCallbackContext; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_http_http_d", function() { return BrowserXhr; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_http_http_e", function() { return XSRF_COOKIE_NAME; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_http_http_f", function() { return XSRF_HEADER_NAME; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_http_http_g", function() { return HttpXsrfCookieExtractor; }); /* harmony export (binding) */ __webpack_require__.d(__webpack_exports__, "ɵangular_packages_common_http_http_h", function() { return HttpXsrfInterceptor; }); /* harmony import */ var _angular_core__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__(/*! @angular/core */ "./node_modules/@angular/core/__ivy_ngcc__/fesm2015/core.js"); /* harmony import */ var rxjs__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__(/*! rxjs */ "./node_modules/rxjs/_esm2015/index.js"); /* harmony import */ var rxjs_operators__WEBPACK_IMPORTED_MODULE_2__ = __webpack_require__(/*! rxjs/operators */ "./node_modules/rxjs/_esm2015/operators/index.js"); /* harmony import */ var _angular_common__WEBPACK_IMPORTED_MODULE_3__ = __webpack_require__(/*! @angular/common */ "./node_modules/@angular/common/__ivy_ngcc__/fesm2015/common.js"); /** * @license Angular v10.2.4 * (c) 2010-2020 Google LLC. https://angular.io/ * License: MIT */ /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Transforms an `HttpRequest` into a stream of `HttpEvent`s, one of which will likely be a * `HttpResponse`. * * `HttpHandler` is injectable. When injected, the handler instance dispatches requests to the * first interceptor in the chain, which dispatches to the second, etc, eventually reaching the * `HttpBackend`. * * In an `HttpInterceptor`, the `HttpHandler` parameter is the next interceptor in the chain. * * @publicApi */ class HttpHandler { } /** * A final `HttpHandler` which will dispatch the request via browser HTTP APIs to a backend. * * Interceptors sit between the `HttpClient` interface and the `HttpBackend`. * * When injected, `HttpBackend` dispatches requests directly to the backend, without going * through the interceptor chain. * * @publicApi */ class HttpBackend { } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Represents the header configuration options for an HTTP request. * Instances are immutable. Modifying methods return a cloned * instance with the change. The original object is never changed. * * @publicApi */ class HttpHeaders { /** Constructs a new HTTP header object with the given values.*/ constructor(headers) { /** * Internal map of lowercased header names to the normalized * form of the name (the form seen first). */ this.normalizedNames = new Map(); /** * Queued updates to be materialized the next initialization. */ this.lazyUpdate = null; if (!headers) { this.headers = new Map(); } else if (typeof headers === 'string') { this.lazyInit = () => { this.headers = new Map(); headers.split('\n').forEach(line => { const index = line.indexOf(':'); if (index > 0) { const name = line.slice(0, index); const key = name.toLowerCase(); const value = line.slice(index + 1).trim(); this.maybeSetNormalizedName(name, key); if (this.headers.has(key)) { this.headers.get(key).push(value); } else { this.headers.set(key, [value]); } } }); }; } else { this.lazyInit = () => { this.headers = new Map(); Object.keys(headers).forEach(name => { let values = headers[name]; const key = name.toLowerCase(); if (typeof values === 'string') { values = [values]; } if (values.length > 0) { this.headers.set(key, values); this.maybeSetNormalizedName(name, key); } }); }; } } /** * Checks for existence of a given header. * * @param name The header name to check for existence. * * @returns True if the header exists, false otherwise. */ has(name) { this.init(); return this.headers.has(name.toLowerCase()); } /** * Retrieves the first value of a given header. * * @param name The header name. * * @returns The value string if the header exists, null otherwise */ get(name) { this.init(); const values = this.headers.get(name.toLowerCase()); return values && values.length > 0 ? values[0] : null; } /** * Retrieves the names of the headers. * * @returns A list of header names. */ keys() { this.init(); return Array.from(this.normalizedNames.values()); } /** * Retrieves a list of values for a given header. * * @param name The header name from which to retrieve values. * * @returns A string of values if the header exists, null otherwise. */ getAll(name) { this.init(); return this.headers.get(name.toLowerCase()) || null; } /** * Appends a new value to the existing set of values for a header * and returns them in a clone of the original instance. * * @param name The header name for which to append the values. * @param value The value to append. * * @returns A clone of the HTTP headers object with the value appended to the given header. */ append(name, value) { return this.clone({ name, value, op: 'a' }); } /** * Sets or modifies a value for a given header in a clone of the original instance. * If the header already exists, its value is replaced with the given value * in the returned object. * * @param name The header name. * @param value The value or values to set or overide for the given header. * * @returns A clone of the HTTP headers object with the newly set header value. */ set(name, value) { return this.clone({ name, value, op: 's' }); } /** * Deletes values for a given header in a clone of the original instance. * * @param name The header name. * @param value The value or values to delete for the given header. * * @returns A clone of the HTTP headers object with the given value deleted. */ delete(name, value) { return this.clone({ name, value, op: 'd' }); } maybeSetNormalizedName(name, lcName) { if (!this.normalizedNames.has(lcName)) { this.normalizedNames.set(lcName, name); } } init() { if (!!this.lazyInit) { if (this.lazyInit instanceof HttpHeaders) { this.copyFrom(this.lazyInit); } else { this.lazyInit(); } this.lazyInit = null; if (!!this.lazyUpdate) { this.lazyUpdate.forEach(update => this.applyUpdate(update)); this.lazyUpdate = null; } } } copyFrom(other) { other.init(); Array.from(other.headers.keys()).forEach(key => { this.headers.set(key, other.headers.get(key)); this.normalizedNames.set(key, other.normalizedNames.get(key)); }); } clone(update) { const clone = new HttpHeaders(); clone.lazyInit = (!!this.lazyInit && this.lazyInit instanceof HttpHeaders) ? this.lazyInit : this; clone.lazyUpdate = (this.lazyUpdate || []).concat([update]); return clone; } applyUpdate(update) { const key = update.name.toLowerCase(); switch (update.op) { case 'a': case 's': let value = update.value; if (typeof value === 'string') { value = [value]; } if (value.length === 0) { return; } this.maybeSetNormalizedName(update.name, key); const base = (update.op === 'a' ? this.headers.get(key) : undefined) || []; base.push(...value); this.headers.set(key, base); break; case 'd': const toDelete = update.value; if (!toDelete) { this.headers.delete(key); this.normalizedNames.delete(key); } else { let existing = this.headers.get(key); if (!existing) { return; } existing = existing.filter(value => toDelete.indexOf(value) === -1); if (existing.length === 0) { this.headers.delete(key); this.normalizedNames.delete(key); } else { this.headers.set(key, existing); } } break; } } /** * @internal */ forEach(fn) { this.init(); Array.from(this.normalizedNames.keys()) .forEach(key => fn(this.normalizedNames.get(key), this.headers.get(key))); } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Provides encoding and decoding of URL parameter and query-string values. * * Serializes and parses URL parameter keys and values to encode and decode them. * If you pass URL query parameters without encoding, * the query parameters can be misinterpreted at the receiving end. * * * @publicApi */ class HttpUrlEncodingCodec { /** * Encodes a key name for a URL parameter or query-string. * @param key The key name. * @returns The encoded key name. */ encodeKey(key) { return standardEncoding(key); } /** * Encodes the value of a URL parameter or query-string. * @param value The value. * @returns The encoded value. */ encodeValue(value) { return standardEncoding(value); } /** * Decodes an encoded URL parameter or query-string key. * @param key The encoded key name. * @returns The decoded key name. */ decodeKey(key) { return decodeURIComponent(key); } /** * Decodes an encoded URL parameter or query-string value. * @param value The encoded value. * @returns The decoded value. */ decodeValue(value) { return decodeURIComponent(value); } } function paramParser(rawParams, codec) { const map = new Map(); if (rawParams.length > 0) { const params = rawParams.split('&'); params.forEach((param) => { const eqIdx = param.indexOf('='); const [key, val] = eqIdx == -1 ? [codec.decodeKey(param), ''] : [codec.decodeKey(param.slice(0, eqIdx)), codec.decodeValue(param.slice(eqIdx + 1))]; const list = map.get(key) || []; list.push(val); map.set(key, list); }); } return map; } function standardEncoding(v) { return encodeURIComponent(v) .replace(/%40/gi, '@') .replace(/%3A/gi, ':') .replace(/%24/gi, '$') .replace(/%2C/gi, ',') .replace(/%3B/gi, ';') .replace(/%2B/gi, '+') .replace(/%3D/gi, '=') .replace(/%3F/gi, '?') .replace(/%2F/gi, '/'); } /** * An HTTP request/response body that represents serialized parameters, * per the MIME type `application/x-www-form-urlencoded`. * * This class is immutable; all mutation operations return a new instance. * * @publicApi */ class HttpParams { constructor(options = {}) { this.updates = null; this.cloneFrom = null; this.encoder = options.encoder || new HttpUrlEncodingCodec(); if (!!options.fromString) { if (!!options.fromObject) { throw new Error(`Cannot specify both fromString and fromObject.`); } this.map = paramParser(options.fromString, this.encoder); } else if (!!options.fromObject) { this.map = new Map(); Object.keys(options.fromObject).forEach(key => { const value = options.fromObject[key]; this.map.set(key, Array.isArray(value) ? value : [value]); }); } else { this.map = null; } } /** * Reports whether the body includes one or more values for a given parameter. * @param param The parameter name. * @returns True if the parameter has one or more values, * false if it has no value or is not present. */ has(param) { this.init(); return this.map.has(param); } /** * Retrieves the first value for a parameter. * @param param The parameter name. * @returns The first value of the given parameter, * or `null` if the parameter is not present. */ get(param) { this.init(); const res = this.map.get(param); return !!res ? res[0] : null; } /** * Retrieves all values for a parameter. * @param param The parameter name. * @returns All values in a string array, * or `null` if the parameter not present. */ getAll(param) { this.init(); return this.map.get(param) || null; } /** * Retrieves all the parameters for this body. * @returns The parameter names in a string array. */ keys() { this.init(); return Array.from(this.map.keys()); } /** * Appends a new value to existing values for a parameter. * @param param The parameter name. * @param value The new value to add. * @return A new body with the appended value. */ append(param, value) { return this.clone({ param, value, op: 'a' }); } /** * Replaces the value for a parameter. * @param param The parameter name. * @param value The new value. * @return A new body with the new value. */ set(param, value) { return this.clone({ param, value, op: 's' }); } /** * Removes a given value or all values from a parameter. * @param param The parameter name. * @param value The value to remove, if provided. * @return A new body with the given value removed, or with all values * removed if no value is specified. */ delete(param, value) { return this.clone({ param, value, op: 'd' }); } /** * Serializes the body to an encoded string, where key-value pairs (separated by `=`) are * separated by `&`s. */ toString() { this.init(); return this.keys() .map(key => { const eKey = this.encoder.encodeKey(key); // `a: ['1']` produces `'a=1'` // `b: []` produces `''` // `c: ['1', '2']` produces `'c=1&c=2'` return this.map.get(key).map(value => eKey + '=' + this.encoder.encodeValue(value)) .join('&'); }) // filter out empty values because `b: []` produces `''` // which results in `a=1&&c=1&c=2` instead of `a=1&c=1&c=2` if we don't .filter(param => param !== '') .join('&'); } clone(update) { const clone = new HttpParams({ encoder: this.encoder }); clone.cloneFrom = this.cloneFrom || this; clone.updates = (this.updates || []).concat([update]); return clone; } init() { if (this.map === null) { this.map = new Map(); } if (this.cloneFrom !== null) { this.cloneFrom.init(); this.cloneFrom.keys().forEach(key => this.map.set(key, this.cloneFrom.map.get(key))); this.updates.forEach(update => { switch (update.op) { case 'a': case 's': const base = (update.op === 'a' ? this.map.get(update.param) : undefined) || []; base.push(update.value); this.map.set(update.param, base); break; case 'd': if (update.value !== undefined) { let base = this.map.get(update.param) || []; const idx = base.indexOf(update.value); if (idx !== -1) { base.splice(idx, 1); } if (base.length > 0) { this.map.set(update.param, base); } else { this.map.delete(update.param); } } else { this.map.delete(update.param); break; } } }); this.cloneFrom = this.updates = null; } } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Determine whether the given HTTP method may include a body. */ function mightHaveBody(method) { switch (method) { case 'DELETE': case 'GET': case 'HEAD': case 'OPTIONS': case 'JSONP': return false; default: return true; } } /** * Safely assert whether the given value is an ArrayBuffer. * * In some execution environments ArrayBuffer is not defined. */ function isArrayBuffer(value) { return typeof ArrayBuffer !== 'undefined' && value instanceof ArrayBuffer; } /** * Safely assert whether the given value is a Blob. * * In some execution environments Blob is not defined. */ function isBlob(value) { return typeof Blob !== 'undefined' && value instanceof Blob; } /** * Safely assert whether the given value is a FormData instance. * * In some execution environments FormData is not defined. */ function isFormData(value) { return typeof FormData !== 'undefined' && value instanceof FormData; } /** * An outgoing HTTP request with an optional typed body. * * `HttpRequest` represents an outgoing request, including URL, method, * headers, body, and other request configuration options. Instances should be * assumed to be immutable. To modify a `HttpRequest`, the `clone` * method should be used. * * @publicApi */ class HttpRequest { constructor(method, url, third, fourth) { this.url = url; /** * The request body, or `null` if one isn't set. * * Bodies are not enforced to be immutable, as they can include a reference to any * user-defined data type. However, interceptors should take care to preserve * idempotence by treating them as such. */ this.body = null; /** * Whether this request should be made in a way that exposes progress events. * * Progress events are expensive (change detection runs on each event) and so * they should only be requested if the consumer intends to monitor them. */ this.reportProgress = false; /** * Whether this request should be sent with outgoing credentials (cookies). */ this.withCredentials = false; /** * The expected response type of the server. * * This is used to parse the response appropriately before returning it to * the requestee. */ this.responseType = 'json'; this.method = method.toUpperCase(); // Next, need to figure out which argument holds the HttpRequestInit // options, if any. let options; // Check whether a body argument is expected. The only valid way to omit // the body argument is to use a known no-body method like GET. if (mightHaveBody(this.method) || !!fourth) { // Body is the third argument, options are the fourth. this.body = (third !== undefined) ? third : null; options = fourth; } else { // No body required, options are the third argument. The body stays null. options = third; } // If options have been passed, interpret them. if (options) { // Normalize reportProgress and withCredentials. this.reportProgress = !!options.reportProgress; this.withCredentials = !!options.withCredentials; // Override default response type of 'json' if one is provided. if (!!options.responseType) { this.responseType = options.responseType; } // Override headers if they're provided. if (!!options.headers) { this.headers = options.headers; } if (!!options.params) { this.params = options.params; } } // If no headers have been passed in, construct a new HttpHeaders instance. if (!this.headers) { this.headers = new HttpHeaders(); } // If no parameters have been passed in, construct a new HttpUrlEncodedParams instance. if (!this.params) { this.params = new HttpParams(); this.urlWithParams = url; } else { // Encode the parameters to a string in preparation for inclusion in the URL. const params = this.params.toString(); if (params.length === 0) { // No parameters, the visible URL is just the URL given at creation time. this.urlWithParams = url; } else { // Does the URL already have query parameters? Look for '?'. const qIdx = url.indexOf('?'); // There are 3 cases to handle: // 1) No existing parameters -> append '?' followed by params. // 2) '?' exists and is followed by existing query string -> // append '&' followed by params. // 3) '?' exists at the end of the url -> append params directly. // This basically amounts to determining the character, if any, with // which to join the URL and parameters. const sep = qIdx === -1 ? '?' : (qIdx < url.length - 1 ? '&' : ''); this.urlWithParams = url + sep + params; } } } /** * Transform the free-form body into a serialized format suitable for * transmission to the server. */ serializeBody() { // If no body is present, no need to serialize it. if (this.body === null) { return null; } // Check whether the body is already in a serialized form. If so, // it can just be returned directly. if (isArrayBuffer(this.body) || isBlob(this.body) || isFormData(this.body) || typeof this.body === 'string') { return this.body; } // Check whether the body is an instance of HttpUrlEncodedParams. if (this.body instanceof HttpParams) { return this.body.toString(); } // Check whether the body is an object or array, and serialize with JSON if so. if (typeof this.body === 'object' || typeof this.body === 'boolean' || Array.isArray(this.body)) { return JSON.stringify(this.body); } // Fall back on toString() for everything else. return this.body.toString(); } /** * Examine the body and attempt to infer an appropriate MIME type * for it. * * If no such type can be inferred, this method will return `null`. */ detectContentTypeHeader() { // An empty body has no content type. if (this.body === null) { return null; } // FormData bodies rely on the browser's content type assignment. if (isFormData(this.body)) { return null; } // Blobs usually have their own content type. If it doesn't, then // no type can be inferred. if (isBlob(this.body)) { return this.body.type || null; } // Array buffers have unknown contents and thus no type can be inferred. if (isArrayBuffer(this.body)) { return null; } // Technically, strings could be a form of JSON data, but it's safe enough // to assume they're plain strings. if (typeof this.body === 'string') { return 'text/plain'; } // `HttpUrlEncodedParams` has its own content-type. if (this.body instanceof HttpParams) { return 'application/x-www-form-urlencoded;charset=UTF-8'; } // Arrays, objects, and numbers will be encoded as JSON. if (typeof this.body === 'object' || typeof this.body === 'number' || Array.isArray(this.body)) { return 'application/json'; } // No type could be inferred. return null; } clone(update = {}) { // For method, url, and responseType, take the current value unless // it is overridden in the update hash. const method = update.method || this.method; const url = update.url || this.url; const responseType = update.responseType || this.responseType; // The body is somewhat special - a `null` value in update.body means // whatever current body is present is being overridden with an empty // body, whereas an `undefined` value in update.body implies no // override. const body = (update.body !== undefined) ? update.body : this.body; // Carefully handle the boolean options to differentiate between // `false` and `undefined` in the update args. const withCredentials = (update.withCredentials !== undefined) ? update.withCredentials : this.withCredentials; const reportProgress = (update.reportProgress !== undefined) ? update.reportProgress : this.reportProgress; // Headers and params may be appended to if `setHeaders` or // `setParams` are used. let headers = update.headers || this.headers; let params = update.params || this.params; // Check whether the caller has asked to add headers. if (update.setHeaders !== undefined) { // Set every requested header. headers = Object.keys(update.setHeaders) .reduce((headers, name) => headers.set(name, update.setHeaders[name]), headers); } // Check whether the caller has asked to set params. if (update.setParams) { // Set every requested param. params = Object.keys(update.setParams) .reduce((params, param) => params.set(param, update.setParams[param]), params); } // Finally, construct the new HttpRequest using the pieces from above. return new HttpRequest(method, url, body, { params, headers, reportProgress, responseType, withCredentials, }); } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Type enumeration for the different kinds of `HttpEvent`. * * @publicApi */ var HttpEventType; (function (HttpEventType) { /** * The request was sent out over the wire. */ HttpEventType[HttpEventType["Sent"] = 0] = "Sent"; /** * An upload progress event was received. */ HttpEventType[HttpEventType["UploadProgress"] = 1] = "UploadProgress"; /** * The response status code and headers were received. */ HttpEventType[HttpEventType["ResponseHeader"] = 2] = "ResponseHeader"; /** * A download progress event was received. */ HttpEventType[HttpEventType["DownloadProgress"] = 3] = "DownloadProgress"; /** * The full response including the body was received. */ HttpEventType[HttpEventType["Response"] = 4] = "Response"; /** * A custom event from an interceptor or a backend. */ HttpEventType[HttpEventType["User"] = 5] = "User"; })(HttpEventType || (HttpEventType = {})); /** * Base class for both `HttpResponse` and `HttpHeaderResponse`. * * @publicApi */ class HttpResponseBase { /** * Super-constructor for all responses. * * The single parameter accepted is an initialization hash. Any properties * of the response passed there will override the default values. */ constructor(init, defaultStatus = 200, defaultStatusText = 'OK') { // If the hash has values passed, use them to initialize the response. // Otherwise use the default values. this.headers = init.headers || new HttpHeaders(); this.status = init.status !== undefined ? init.status : defaultStatus; this.statusText = init.statusText || defaultStatusText; this.url = init.url || null; // Cache the ok value to avoid defining a getter. this.ok = this.status >= 200 && this.status < 300; } } /** * A partial HTTP response which only includes the status and header data, * but no response body. * * `HttpHeaderResponse` is a `HttpEvent` available on the response * event stream, only when progress events are requested. * * @publicApi */ class HttpHeaderResponse extends HttpResponseBase { /** * Create a new `HttpHeaderResponse` with the given parameters. */ constructor(init = {}) { super(init); this.type = HttpEventType.ResponseHeader; } /** * Copy this `HttpHeaderResponse`, overriding its contents with the * given parameter hash. */ clone(update = {}) { // Perform a straightforward initialization of the new HttpHeaderResponse, // overriding the current parameters with new ones if given. return new HttpHeaderResponse({ headers: update.headers || this.headers, status: update.status !== undefined ? update.status : this.status, statusText: update.statusText || this.statusText, url: update.url || this.url || undefined, }); } } /** * A full HTTP response, including a typed response body (which may be `null` * if one was not returned). * * `HttpResponse` is a `HttpEvent` available on the response event * stream. * * @publicApi */ class HttpResponse extends HttpResponseBase { /** * Construct a new `HttpResponse`. */ constructor(init = {}) { super(init); this.type = HttpEventType.Response; this.body = init.body !== undefined ? init.body : null; } clone(update = {}) { return new HttpResponse({ body: (update.body !== undefined) ? update.body : this.body, headers: update.headers || this.headers, status: (update.status !== undefined) ? update.status : this.status, statusText: update.statusText || this.statusText, url: update.url || this.url || undefined, }); } } /** * A response that represents an error or failure, either from a * non-successful HTTP status, an error while executing the request, * or some other failure which occurred during the parsing of the response. * * Any error returned on the `Observable` response stream will be * wrapped in an `HttpErrorResponse` to provide additional context about * the state of the HTTP layer when the error occurred. The error property * will contain either a wrapped Error object or the error response returned * from the server. * * @publicApi */ class HttpErrorResponse extends HttpResponseBase { constructor(init) { // Initialize with a default status of 0 / Unknown Error. super(init, 0, 'Unknown Error'); this.name = 'HttpErrorResponse'; /** * Errors are never okay, even when the status code is in the 2xx success range. */ this.ok = false; // If the response was successful, then this was a parse error. Otherwise, it was // a protocol-level failure of some sort. Either the request failed in transit // or the server returned an unsuccessful status code. if (this.status >= 200 && this.status < 300) { this.message = `Http failure during parsing for ${init.url || '(unknown url)'}`; } else { this.message = `Http failure response for ${init.url || '(unknown url)'}: ${init.status} ${init.statusText}`; } this.error = init.error || null; } } /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * Constructs an instance of `HttpRequestOptions` from a source `HttpMethodOptions` and * the given `body`. This function clones the object and adds the body. * * Note that the `responseType` *options* value is a String that identifies the * single data type of the response. * A single overload version of the method handles each response type. * The value of `responseType` cannot be a union, as the combined signature could imply. * */ function addBody(options, body) { return { body, headers: options.headers, observe: options.observe, params: options.params, reportProgress: options.reportProgress, responseType: options.responseType, withCredentials: options.withCredentials, }; } /** * Performs HTTP requests. * This service is available as an injectable class, with methods to perform HTTP requests. * Each request method has multiple signatures, and the return type varies based on * the signature that is called (mainly the values of `observe` and `responseType`). * * Note that the `responseType` *options* value is a String that identifies the * single data type of the response. * A single overload version of the method handles each response type. * The value of `responseType` cannot be a union, as the combined signature could imply. * * @usageNotes * Sample HTTP requests for the [Tour of Heroes](/tutorial/toh-pt0) application. * * ### HTTP Request Example * * ``` * // GET heroes whose name contains search term * searchHeroes(term: string): observable{ * * const params = new HttpParams({fromString: 'name=term'}); * return this.httpClient.request('GET', this.heroesUrl, {responseType:'json', params}); * } * ``` * ### JSONP Example * ``` * requestJsonp(url, callback = 'callback') { * return this.httpClient.jsonp(this.heroesURL, callback); * } * ``` * * ### PATCH Example * ``` * // PATCH one of the heroes' name * patchHero (id: number, heroName: string): Observable<{}> { * const url = `${this.heroesUrl}/${id}`; // PATCH api/heroes/42 * return this.httpClient.patch(url, {name: heroName}, httpOptions) * .pipe(catchError(this.handleError('patchHero'))); * } * ``` * * @see [HTTP Guide](guide/http) * * @publicApi */ class HttpClient { constructor(handler) { this.handler = handler; } /** * Constructs an observable for a generic HTTP request that, when subscribed, * fires the request through the chain of registered interceptors and on to the * server. * * You can pass an `HttpRequest` directly as the only parameter. In this case, * the call returns an observable of the raw `HttpEvent` stream. * * Alternatively you can pass an HTTP method as the first parameter, * a URL string as the second, and an options hash containing the request body as the third. * See `addBody()`. In this case, the specified `responseType` and `observe` options determine the * type of returned observable. * * The `responseType` value determines how a successful response body is parsed. * * If `responseType` is the default `json`, you can pass a type interface for the resulting * object as a type parameter to the call. * * The `observe` value determines the return type, according to what you are interested in * observing. * * An `observe` value of events returns an observable of the raw `HttpEvent` stream, including * progress events by default. * * An `observe` value of response returns an observable of `HttpResponse`, * where the `T` parameter depends on the `responseType` and any optionally provided type * parameter. * * An `observe` value of body returns an observable of `` with the same `T` body type. * */ request(first, url, options = {}) { let req; // First, check whether the primary argument is an instance of `HttpRequest`. if (first instanceof HttpRequest) { // It is. The other arguments must be undefined (per the signatures) and can be // ignored. req = first; } else { // It's a string, so it represents a URL. Construct a request based on it, // and incorporate the remaining arguments (assuming `GET` unless a method is // provided. // Figure out the headers. let headers = undefined; if (options.headers instanceof HttpHeaders) { headers = options.headers; } else { headers = new HttpHeaders(options.headers); } // Sort out parameters. let params = undefined; if (!!options.params) { if (options.params instanceof HttpParams) { params = options.params; } else { params = new HttpParams({ fromObject: options.params }); } } // Construct the request. req = new HttpRequest(first, url, (options.body !== undefined ? options.body : null), { headers, params, reportProgress: options.reportProgress, // By default, JSON is assumed to be returned for all calls. responseType: options.responseType || 'json', withCredentials: options.withCredentials, }); } // Start with an Observable.of() the initial request, and run the handler (which // includes all interceptors) inside a concatMap(). This way, the handler runs // inside an Observable chain, which causes interceptors to be re-run on every // subscription (this also makes retries re-run the handler, including interceptors). const events$ = Object(rxjs__WEBPACK_IMPORTED_MODULE_1__["of"])(req).pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_2__["concatMap"])((req) => this.handler.handle(req))); // If coming via the API signature which accepts a previously constructed HttpRequest, // the only option is to get the event stream. Otherwise, return the event stream if // that is what was requested. if (first instanceof HttpRequest || options.observe === 'events') { return events$; } // The requested stream contains either the full response or the body. In either // case, the first step is to filter the event stream to extract a stream of // responses(s). const res$ = events$.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_2__["filter"])((event) => event instanceof HttpResponse)); // Decide which stream to return. switch (options.observe || 'body') { case 'body': // The requested stream is the body. Map the response stream to the response // body. This could be done more simply, but a misbehaving interceptor might // transform the response body into a different format and ignore the requested // responseType. Guard against this by validating that the response is of the // requested type. switch (req.responseType) { case 'arraybuffer': return res$.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_2__["map"])((res) => { // Validate that the body is an ArrayBuffer. if (res.body !== null && !(res.body instanceof ArrayBuffer)) { throw new Error('Response is not an ArrayBuffer.'); } return res.body; })); case 'blob': return res$.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_2__["map"])((res) => { // Validate that the body is a Blob. if (res.body !== null && !(res.body instanceof Blob)) { throw new Error('Response is not a Blob.'); } return res.body; })); case 'text': return res$.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_2__["map"])((res) => { // Validate that the body is a string. if (res.body !== null && typeof res.body !== 'string') { throw new Error('Response is not a string.'); } return res.body; })); case 'json': default: // No validation needed for JSON responses, as they can be of any type. return res$.pipe(Object(rxjs_operators__WEBPACK_IMPORTED_MODULE_2__["map"])((res) => res.body)); } case 'response': // The response stream was requested directly, so return it. return res$; default: // Guard against new future observe types being added. throw new Error(`Unreachable: unhandled observe type ${options.observe}}`); } } /** * Constructs an observable that, when subscribed, causes the configured * `DELETE` request to execute on the server. See the individual overloads for * details on the return type. * * @param url The endpoint URL. * @param options The HTTP options to send with the request. * */ delete(url, options = {}) { return this.request('DELETE', url, options); } /** * Constructs an observable that, when subscribed, causes the configured * `GET` request to execute on the server. See the individual overloads for * details on the return type. */ get(url, options = {}) { return this.request('GET', url, options); } /** * Constructs an observable that, when subscribed, causes the configured * `HEAD` request to execute on the server. The `HEAD` method returns * meta information about the resource without transferring the * resource itself. See the individual overloads for * details on the return type. */ head(url, options = {}) { return this.request('HEAD', url, options); } /** * Constructs an `Observable` that, when subscribed, causes a request with the special method * `JSONP` to be dispatched via the interceptor pipeline. * The [JSONP pattern](https://en.wikipedia.org/wiki/JSONP) works around limitations of certain * API endpoints that don't support newer, * and preferable [CORS](https://developer.mozilla.org/en-US/docs/Web/HTTP/CORS) protocol. * JSONP treats the endpoint API as a JavaScript file and tricks the browser to process the * requests even if the API endpoint is not located on the same domain (origin) as the client-side * application making the request. * The endpoint API must support JSONP callback for JSONP requests to work. * The resource API returns the JSON response wrapped in a callback function. * You can pass the callback function name as one of the query parameters. * Note that JSONP requests can only be used with `GET` requests. * * @param url The resource URL. * @param callbackParam The callback function name. * */ jsonp(url, callbackParam) { return this.request('JSONP', url, { params: new HttpParams().append(callbackParam, 'JSONP_CALLBACK'), observe: 'body', responseType: 'json', }); } /** * Constructs an `Observable` that, when subscribed, causes the configured * `OPTIONS` request to execute on the server. This method allows the client * to determine the supported HTTP methods and other capabilites of an endpoint, * without implying a resource action. See the individual overloads for * details on the return type. */ options(url, options = {}) { return this.request('OPTIONS', url, options); } /** * Constructs an observable that, when subscribed, causes the configured * `PATCH` request to execute on the server. See the individual overloads for * details on the return type. */ patch(url, body, options = {}) { return this.request('PATCH', url, addBody(options, body)); } /** * Constructs an observable that, when subscribed, causes the configured * `POST` request to execute on the server. The server responds with the location of * the replaced resource. See the individual overloads for * details on the return type. */ post(url, body, options = {}) { return this.request('POST', url, addBody(options, body)); } /** * Constructs an observable that, when subscribed, causes the configured * `PUT` request to execute on the server. The `PUT` method replaces an existing resource * with a new set of values. * See the individual overloads for details on the return type. */ put(url, body, options = {}) { return this.request('PUT', url, addBody(options, body)); } } HttpClient.ɵfac = function HttpClient_Factory(t) { return new (t || HttpClient)(_angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵinject"](HttpHandler)); }; HttpClient.ɵprov = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"]({ token: HttpClient, factory: HttpClient.ɵfac }); HttpClient.ctorParameters = () => [ { type: HttpHandler } ]; /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](HttpClient, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Injectable"] }], function () { return [{ type: HttpHandler }]; }, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ /** * `HttpHandler` which applies an `HttpInterceptor` to an `HttpRequest`. * * */ class HttpInterceptorHandler { constructor(next, interceptor) { this.next = next; this.interceptor = interceptor; } handle(req) { return this.interceptor.intercept(req, this.next); } } /** * A multi-provider token that represents the array of registered * `HttpInterceptor` objects. * * @publicApi */ const HTTP_INTERCEPTORS = new _angular_core__WEBPACK_IMPORTED_MODULE_0__["InjectionToken"]('HTTP_INTERCEPTORS'); class NoopInterceptor { intercept(req, next) { return next.handle(req); } } NoopInterceptor.ɵfac = function NoopInterceptor_Factory(t) { return new (t || NoopInterceptor)(); }; NoopInterceptor.ɵprov = _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵɵdefineInjectable"]({ token: NoopInterceptor, factory: NoopInterceptor.ɵfac }); /*@__PURE__*/ (function () { _angular_core__WEBPACK_IMPORTED_MODULE_0__["ɵsetClassMetadata"](NoopInterceptor, [{ type: _angular_core__WEBPACK_IMPORTED_MODULE_0__["Injectable"] }], null, null); })(); /** * @license * Copyright Google LLC All Rights Reserved. * * Use of this source code is governed by an MIT-style license that can be * found in the LICENSE file at https://angular.io/license */ // Every request made through JSONP needs a callback name that's unique across the // whole page. Each request is assigned an id and the callback name is constructed // from that. The next id to be assigned is tracked in a global variable here that // is shared among all applications on the page. let nextRequestId = 0; // Error text given when a JSONP script is injected, but doesn't invoke the callback // passed in its URL. const JSONP_ERR_NO_CALLBACK = 'JSONP injected script did not invoke callback.'; // Error text given when a request is passed to the JsonpClientBackend that doesn't // have a request method JSONP. const JSONP_ERR_WRONG_METHOD = 'JSONP requests must use JSONP request method.'; const JSONP_ERR_WRONG_RESPONSE_TYPE = 'JSONP requests must use Json response type.'; /** * DI token/abstract type representing a map of JSONP callbacks. * * In the browser, this should always be the `window` object. * * */ class JsonpCallbackContext { } /** * Processes an `HttpRequest` with the JSONP method, * by performing JSONP style requests. * @see `HttpHandler` * @see `HttpXhrBackend` * * @publicApi */ class JsonpClientBackend { constructor(callbackMap, document) { this.callbackMap = callbackMap; this.document = document; } /** * Get the name of the next callback method, by incrementing the global `nextRequestId`. */ nextCallback() { return `ng_jsonp_callback_${nextRequestId++}`; } /** * Processes a JSONP request and returns an event stream of the results. * @param req The request object. * @returns An observable of the response events. * */ handle(req) { // Firstly, check both the method and response type. If either doesn't match // then the request was improperly routed here and cannot be handled. if (req.method !== 'JSONP') { throw new Error(JSONP_ERR_WRONG_METHOD); } else if (req.responseType !== 'json') { throw new Error(JSONP_ERR_WRONG_RESPONSE_TYPE); } // Everything else happens inside the Observable boundary. return new rxjs__WEBPACK_IMPORTED_MODULE_1__["Observable"]((observer) => { // The first step to make a request is to generate the callback name, and replace the // callback placeholder in the URL with the name. Care has to be taken here to ensure // a trailing &, if matched, gets inserted back into the URL in the correct place. const callback = this.nextCallback(); const url = req.urlWithParams.replace(/=JSONP_CALLBACK(&|$)/, `=${callback}$1`); // Construct the
    {{headerText}} {{dataAccessor(data, name)}}